From 95741499fdf77636443f5e64f6b8abcfd9d05fa9 Mon Sep 17 00:00:00 2001 From: clerie Date: Wed, 4 Apr 2018 12:31:55 +0200 Subject: [PATCH] Added game info bar --- index.js | 22 +- node_modules/.bin/_mocha | 1 + node_modules/.bin/jade | 1 + node_modules/.bin/mkdirp | 1 + node_modules/.bin/mocha | 1 + node_modules/.bin/supports-color | 1 + node_modules/commander/Readme.md | 208 + node_modules/commander/index.js | 876 + node_modules/commander/package.json | 62 + node_modules/diff/README.md | 181 + node_modules/diff/diff.js | 619 + node_modules/diff/package.json | 74 + node_modules/escape-string-regexp/index.js | 11 + .../escape-string-regexp/package.json | 68 + node_modules/escape-string-regexp/readme.md | 27 + node_modules/glob/.npmignore | 2 + node_modules/glob/.travis.yml | 3 + node_modules/glob/LICENSE | 27 + node_modules/glob/README.md | 250 + node_modules/glob/examples/g.js | 9 + node_modules/glob/examples/usr-local.js | 9 + node_modules/glob/glob.js | 728 + node_modules/glob/package.json | 61 + node_modules/glob/test/00-setup.js | 176 + node_modules/glob/test/bash-comparison.js | 63 + node_modules/glob/test/bash-results.json | 351 + node_modules/glob/test/cwd-test.js | 55 + node_modules/glob/test/globstar-match.js | 19 + node_modules/glob/test/mark.js | 118 + .../glob/test/new-glob-optional-options.js | 10 + node_modules/glob/test/nocase-nomagic.js | 113 + node_modules/glob/test/pause-resume.js | 73 + node_modules/glob/test/readme-issue.js | 36 + node_modules/glob/test/root-nomount.js | 39 + node_modules/glob/test/root.js | 46 + node_modules/glob/test/stat.js | 32 + node_modules/glob/test/zz-cleanup.js | 11 + node_modules/growl/History.md | 63 + node_modules/growl/Readme.md | 108 + node_modules/growl/lib/growl.js | 290 + node_modules/growl/package.json | 50 + node_modules/growl/test.js | 31 + node_modules/jade/.npmignore | 15 + node_modules/jade/LICENSE | 22 + node_modules/jade/bin/jade | 147 + node_modules/jade/index.js | 4 + node_modules/jade/jade.js | 3586 +++++ node_modules/jade/jade.md | 510 + node_modules/jade/jade.min.js | 2 + node_modules/jade/lib/compiler.js | 642 + node_modules/jade/lib/doctypes.js | 18 + node_modules/jade/lib/filters.js | 97 + node_modules/jade/lib/inline-tags.js | 28 + node_modules/jade/lib/jade.js | 237 + node_modules/jade/lib/lexer.js | 771 + node_modules/jade/lib/nodes/attrs.js | 77 + node_modules/jade/lib/nodes/block-comment.js | 33 + node_modules/jade/lib/nodes/block.js | 121 + node_modules/jade/lib/nodes/case.js | 43 + node_modules/jade/lib/nodes/code.js | 35 + node_modules/jade/lib/nodes/comment.js | 32 + node_modules/jade/lib/nodes/doctype.js | 29 + node_modules/jade/lib/nodes/each.js | 35 + node_modules/jade/lib/nodes/filter.js | 35 + node_modules/jade/lib/nodes/index.js | 20 + node_modules/jade/lib/nodes/literal.js | 32 + node_modules/jade/lib/nodes/mixin.js | 36 + node_modules/jade/lib/nodes/node.js | 25 + node_modules/jade/lib/nodes/tag.js | 95 + node_modules/jade/lib/nodes/text.js | 36 + node_modules/jade/lib/parser.js | 710 + node_modules/jade/lib/runtime.js | 174 + node_modules/jade/lib/self-closing.js | 19 + node_modules/jade/lib/utils.js | 49 + .../jade/node_modules/commander/.npmignore | 4 + .../jade/node_modules/commander/.travis.yml | 4 + .../jade/node_modules/commander/History.md | 107 + .../jade/node_modules/commander/Makefile | 7 + .../jade/node_modules/commander/Readme.md | 262 + .../jade/node_modules/commander/index.js | 2 + .../node_modules/commander/lib/commander.js | 1026 ++ .../jade/node_modules/commander/package.json | 60 + .../jade/node_modules/mkdirp/.gitignore.orig | 2 + .../jade/node_modules/mkdirp/.gitignore.rej | 5 + .../jade/node_modules/mkdirp/.npmignore | 2 + node_modules/jade/node_modules/mkdirp/LICENSE | 21 + .../jade/node_modules/mkdirp/README.markdown | 54 + .../jade/node_modules/mkdirp/examples/pow.js | 6 + .../node_modules/mkdirp/examples/pow.js.orig | 6 + .../node_modules/mkdirp/examples/pow.js.rej | 19 + .../jade/node_modules/mkdirp/index.js | 79 + .../jade/node_modules/mkdirp/package.json | 58 + .../jade/node_modules/mkdirp/test/chmod.js | 38 + .../jade/node_modules/mkdirp/test/clobber.js | 37 + .../jade/node_modules/mkdirp/test/mkdirp.js | 28 + .../jade/node_modules/mkdirp/test/perm.js | 32 + .../node_modules/mkdirp/test/perm_sync.js | 39 + .../jade/node_modules/mkdirp/test/race.js | 41 + .../jade/node_modules/mkdirp/test/rel.js | 32 + .../jade/node_modules/mkdirp/test/sync.js | 27 + .../jade/node_modules/mkdirp/test/umask.js | 28 + .../node_modules/mkdirp/test/umask_sync.js | 27 + node_modules/jade/package.json | 70 + node_modules/jade/runtime.js | 179 + node_modules/jade/runtime.min.js | 1 + node_modules/jade/test.jade | 7 + node_modules/jade/testing/head.jade | 5 + node_modules/jade/testing/index.jade | 22 + node_modules/jade/testing/index.js | 11 + node_modules/jade/testing/layout.jade | 6 + node_modules/jade/testing/user.jade | 7 + node_modules/jade/testing/user.js | 27 + node_modules/lru-cache/.npmignore | 1 + node_modules/lru-cache/.travis.yml | 8 + node_modules/lru-cache/CONTRIBUTORS | 14 + node_modules/lru-cache/LICENSE | 15 + node_modules/lru-cache/README.md | 137 + node_modules/lru-cache/lib/lru-cache.js | 334 + node_modules/lru-cache/package.json | 56 + node_modules/lru-cache/test/basic.js | 396 + node_modules/lru-cache/test/foreach.js | 120 + node_modules/lru-cache/test/memory-leak.js | 51 + node_modules/lru-cache/test/serialize.js | 216 + node_modules/minimatch/.npmignore | 1 + node_modules/minimatch/LICENSE | 23 + node_modules/minimatch/README.md | 218 + node_modules/minimatch/minimatch.js | 1061 ++ node_modules/minimatch/package.json | 61 + node_modules/minimatch/test/basic.js | 399 + node_modules/minimatch/test/brace-expand.js | 33 + node_modules/minimatch/test/caching.js | 14 + node_modules/minimatch/test/defaults.js | 274 + .../test/extglob-ending-with-state-char.js | 8 + node_modules/minimist/.travis.yml | 4 + node_modules/minimist/LICENSE | 18 + node_modules/minimist/example/parse.js | 2 + node_modules/minimist/index.js | 187 + node_modules/minimist/package.json | 71 + node_modules/minimist/readme.markdown | 73 + node_modules/minimist/test/dash.js | 24 + node_modules/minimist/test/default_bool.js | 20 + node_modules/minimist/test/dotted.js | 16 + node_modules/minimist/test/long.js | 31 + node_modules/minimist/test/parse.js | 318 + node_modules/minimist/test/parse_modified.js | 9 + node_modules/minimist/test/short.js | 67 + node_modules/minimist/test/whitespace.js | 8 + node_modules/mkdirp/.travis.yml | 8 + node_modules/mkdirp/LICENSE | 21 + node_modules/mkdirp/bin/cmd.js | 33 + node_modules/mkdirp/bin/usage.txt | 12 + node_modules/mkdirp/examples/pow.js | 6 + node_modules/mkdirp/index.js | 98 + node_modules/mkdirp/package.json | 62 + node_modules/mkdirp/readme.markdown | 100 + node_modules/mkdirp/test/chmod.js | 41 + node_modules/mkdirp/test/clobber.js | 38 + node_modules/mkdirp/test/mkdirp.js | 28 + node_modules/mkdirp/test/opts_fs.js | 29 + node_modules/mkdirp/test/opts_fs_sync.js | 27 + node_modules/mkdirp/test/perm.js | 32 + node_modules/mkdirp/test/perm_sync.js | 36 + node_modules/mkdirp/test/race.js | 37 + node_modules/mkdirp/test/rel.js | 32 + node_modules/mkdirp/test/return.js | 25 + node_modules/mkdirp/test/return_sync.js | 24 + node_modules/mkdirp/test/root.js | 19 + node_modules/mkdirp/test/sync.js | 32 + node_modules/mkdirp/test/umask.js | 28 + node_modules/mkdirp/test/umask_sync.js | 32 + node_modules/mocha/CHANGELOG.md | 1262 ++ node_modules/mocha/LICENSE | 22 + node_modules/mocha/bin/.eslintrc | 3 + node_modules/mocha/bin/_mocha | 480 + node_modules/mocha/bin/mocha | 73 + node_modules/mocha/bin/options.js | 39 + node_modules/mocha/images/error.png | Bin 0 -> 412 bytes node_modules/mocha/images/ok.png | Bin 0 -> 388 bytes node_modules/mocha/index.js | 3 + node_modules/mocha/lib/browser/debug.js | 4 + node_modules/mocha/lib/browser/events.js | 193 + node_modules/mocha/lib/browser/progress.js | 117 + node_modules/mocha/lib/browser/tty.js | 11 + node_modules/mocha/lib/context.js | 104 + node_modules/mocha/lib/hook.js | 46 + node_modules/mocha/lib/interfaces/bdd.js | 117 + node_modules/mocha/lib/interfaces/common.js | 85 + node_modules/mocha/lib/interfaces/exports.js | 61 + node_modules/mocha/lib/interfaces/index.js | 4 + node_modules/mocha/lib/interfaces/qunit.js | 94 + node_modules/mocha/lib/interfaces/tdd.js | 106 + node_modules/mocha/lib/mocha.js | 503 + node_modules/mocha/lib/ms.js | 128 + node_modules/mocha/lib/pending.js | 15 + node_modules/mocha/lib/reporters/base.js | 487 + node_modules/mocha/lib/reporters/doc.js | 62 + node_modules/mocha/lib/reporters/dot.js | 66 + node_modules/mocha/lib/reporters/html-cov.js | 56 + node_modules/mocha/lib/reporters/html.js | 343 + node_modules/mocha/lib/reporters/index.js | 19 + node_modules/mocha/lib/reporters/json-cov.js | 151 + .../mocha/lib/reporters/json-stream.js | 60 + node_modules/mocha/lib/reporters/json.js | 90 + node_modules/mocha/lib/reporters/landing.js | 92 + node_modules/mocha/lib/reporters/list.js | 61 + node_modules/mocha/lib/reporters/markdown.js | 97 + node_modules/mocha/lib/reporters/min.js | 36 + node_modules/mocha/lib/reporters/nyan.js | 261 + node_modules/mocha/lib/reporters/progress.js | 89 + node_modules/mocha/lib/reporters/spec.js | 83 + node_modules/mocha/lib/reporters/tap.js | 68 + .../lib/reporters/templates/coverage.jade | 51 + .../mocha/lib/reporters/templates/menu.jade | 13 + .../mocha/lib/reporters/templates/script.html | 34 + .../mocha/lib/reporters/templates/style.html | 324 + node_modules/mocha/lib/reporters/xunit.js | 166 + node_modules/mocha/lib/runnable.js | 363 + node_modules/mocha/lib/runner.js | 894 ++ node_modules/mocha/lib/suite.js | 395 + node_modules/mocha/lib/template.html | 18 + node_modules/mocha/lib/test.js | 44 + node_modules/mocha/lib/utils.js | 750 + node_modules/mocha/mocha.css | 314 + node_modules/mocha/mocha.js | 13149 ++++++++++++++++ .../mocha/node_modules/debug/.jshintrc | 3 + .../mocha/node_modules/debug/.npmignore | 6 + .../mocha/node_modules/debug/History.md | 195 + .../mocha/node_modules/debug/Makefile | 36 + .../mocha/node_modules/debug/Readme.md | 188 + .../mocha/node_modules/debug/bower.json | 28 + .../mocha/node_modules/debug/browser.js | 168 + .../mocha/node_modules/debug/component.json | 19 + .../mocha/node_modules/debug/debug.js | 197 + node_modules/mocha/node_modules/debug/node.js | 209 + .../mocha/node_modules/debug/package.json | 70 + node_modules/mocha/node_modules/ms/.npmignore | 5 + node_modules/mocha/node_modules/ms/History.md | 66 + node_modules/mocha/node_modules/ms/LICENSE | 20 + node_modules/mocha/node_modules/ms/README.md | 35 + node_modules/mocha/node_modules/ms/index.js | 125 + .../mocha/node_modules/ms/package.json | 49 + node_modules/mocha/package.json | 1271 ++ node_modules/quick-local-ip/.npmignore | 10 + node_modules/quick-local-ip/LICENSE | 22 + node_modules/quick-local-ip/README.md | 28 + node_modules/quick-local-ip/index.js | 43 + node_modules/quick-local-ip/package.json | 65 + node_modules/quick-local-ip/test.js | 19 + node_modules/sigmund/LICENSE | 15 + node_modules/sigmund/README.md | 53 + node_modules/sigmund/bench.js | 283 + node_modules/sigmund/package.json | 63 + node_modules/sigmund/sigmund.js | 39 + node_modules/sigmund/test/basic.js | 24 + node_modules/supports-color/cli.js | 29 + node_modules/supports-color/index.js | 39 + node_modules/supports-color/package.json | 83 + node_modules/supports-color/readme.md | 44 + node_modules/to-iso-string/.npmignore | 3 + node_modules/to-iso-string/History.md | 9 + node_modules/to-iso-string/Makefile | 17 + node_modules/to-iso-string/Readme.md | 18 + node_modules/to-iso-string/component.json | 9 + node_modules/to-iso-string/index.js | 40 + node_modules/to-iso-string/package.json | 50 + node_modules/to-iso-string/test/index.js | 10 + package-lock.json | 132 + package.json | 1 + public/index.html | 1 + public/main.js | 15 + public/style.css | 11 + 271 files changed, 46086 insertions(+), 2 deletions(-) create mode 120000 node_modules/.bin/_mocha create mode 120000 node_modules/.bin/jade create mode 120000 node_modules/.bin/mkdirp create mode 120000 node_modules/.bin/mocha create mode 120000 node_modules/.bin/supports-color create mode 100644 node_modules/commander/Readme.md create mode 100644 node_modules/commander/index.js create mode 100644 node_modules/commander/package.json create mode 100644 node_modules/diff/README.md create mode 100644 node_modules/diff/diff.js create mode 100644 node_modules/diff/package.json create mode 100644 node_modules/escape-string-regexp/index.js create mode 100644 node_modules/escape-string-regexp/package.json create mode 100644 node_modules/escape-string-regexp/readme.md create mode 100644 node_modules/glob/.npmignore create mode 100644 node_modules/glob/.travis.yml create mode 100644 node_modules/glob/LICENSE create mode 100644 node_modules/glob/README.md create mode 100644 node_modules/glob/examples/g.js create mode 100644 node_modules/glob/examples/usr-local.js create mode 100644 node_modules/glob/glob.js create mode 100644 node_modules/glob/package.json create mode 100644 node_modules/glob/test/00-setup.js create mode 100644 node_modules/glob/test/bash-comparison.js create mode 100644 node_modules/glob/test/bash-results.json create mode 100644 node_modules/glob/test/cwd-test.js create mode 100644 node_modules/glob/test/globstar-match.js create mode 100644 node_modules/glob/test/mark.js create mode 100644 node_modules/glob/test/new-glob-optional-options.js create mode 100644 node_modules/glob/test/nocase-nomagic.js create mode 100644 node_modules/glob/test/pause-resume.js create mode 100644 node_modules/glob/test/readme-issue.js create mode 100644 node_modules/glob/test/root-nomount.js create mode 100644 node_modules/glob/test/root.js create mode 100644 node_modules/glob/test/stat.js create mode 100644 node_modules/glob/test/zz-cleanup.js create mode 100644 node_modules/growl/History.md create mode 100644 node_modules/growl/Readme.md create mode 100644 node_modules/growl/lib/growl.js create mode 100644 node_modules/growl/package.json create mode 100644 node_modules/growl/test.js create mode 100644 node_modules/jade/.npmignore create mode 100644 node_modules/jade/LICENSE create mode 100755 node_modules/jade/bin/jade create mode 100644 node_modules/jade/index.js create mode 100644 node_modules/jade/jade.js create mode 100644 node_modules/jade/jade.md create mode 100644 node_modules/jade/jade.min.js create mode 100644 node_modules/jade/lib/compiler.js create mode 100644 node_modules/jade/lib/doctypes.js create mode 100644 node_modules/jade/lib/filters.js create mode 100644 node_modules/jade/lib/inline-tags.js create mode 100644 node_modules/jade/lib/jade.js create mode 100644 node_modules/jade/lib/lexer.js create mode 100644 node_modules/jade/lib/nodes/attrs.js create mode 100644 node_modules/jade/lib/nodes/block-comment.js create mode 100644 node_modules/jade/lib/nodes/block.js create mode 100644 node_modules/jade/lib/nodes/case.js create mode 100644 node_modules/jade/lib/nodes/code.js create mode 100644 node_modules/jade/lib/nodes/comment.js create mode 100644 node_modules/jade/lib/nodes/doctype.js create mode 100644 node_modules/jade/lib/nodes/each.js create mode 100644 node_modules/jade/lib/nodes/filter.js create mode 100644 node_modules/jade/lib/nodes/index.js create mode 100644 node_modules/jade/lib/nodes/literal.js create mode 100644 node_modules/jade/lib/nodes/mixin.js create mode 100644 node_modules/jade/lib/nodes/node.js create mode 100644 node_modules/jade/lib/nodes/tag.js create mode 100644 node_modules/jade/lib/nodes/text.js create mode 100644 node_modules/jade/lib/parser.js create mode 100644 node_modules/jade/lib/runtime.js create mode 100644 node_modules/jade/lib/self-closing.js create mode 100644 node_modules/jade/lib/utils.js create mode 100644 node_modules/jade/node_modules/commander/.npmignore create mode 100644 node_modules/jade/node_modules/commander/.travis.yml create mode 100644 node_modules/jade/node_modules/commander/History.md create mode 100644 node_modules/jade/node_modules/commander/Makefile create mode 100644 node_modules/jade/node_modules/commander/Readme.md create mode 100644 node_modules/jade/node_modules/commander/index.js create mode 100644 node_modules/jade/node_modules/commander/lib/commander.js create mode 100644 node_modules/jade/node_modules/commander/package.json create mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.orig create mode 100644 node_modules/jade/node_modules/mkdirp/.gitignore.rej create mode 100644 node_modules/jade/node_modules/mkdirp/.npmignore create mode 100644 node_modules/jade/node_modules/mkdirp/LICENSE create mode 100644 node_modules/jade/node_modules/mkdirp/README.markdown create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.orig create mode 100644 node_modules/jade/node_modules/mkdirp/examples/pow.js.rej create mode 100644 node_modules/jade/node_modules/mkdirp/index.js create mode 100644 node_modules/jade/node_modules/mkdirp/package.json create mode 100644 node_modules/jade/node_modules/mkdirp/test/chmod.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/clobber.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/mkdirp.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/perm.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/perm_sync.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/race.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/rel.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/sync.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/umask.js create mode 100644 node_modules/jade/node_modules/mkdirp/test/umask_sync.js create mode 100644 node_modules/jade/package.json create mode 100644 node_modules/jade/runtime.js create mode 100644 node_modules/jade/runtime.min.js create mode 100644 node_modules/jade/test.jade create mode 100644 node_modules/jade/testing/head.jade create mode 100644 node_modules/jade/testing/index.jade create mode 100644 node_modules/jade/testing/index.js create mode 100644 node_modules/jade/testing/layout.jade create mode 100644 node_modules/jade/testing/user.jade create mode 100644 node_modules/jade/testing/user.js create mode 100644 node_modules/lru-cache/.npmignore create mode 100644 node_modules/lru-cache/.travis.yml create mode 100644 node_modules/lru-cache/CONTRIBUTORS create mode 100644 node_modules/lru-cache/LICENSE create mode 100644 node_modules/lru-cache/README.md create mode 100644 node_modules/lru-cache/lib/lru-cache.js create mode 100644 node_modules/lru-cache/package.json create mode 100644 node_modules/lru-cache/test/basic.js create mode 100644 node_modules/lru-cache/test/foreach.js create mode 100644 node_modules/lru-cache/test/memory-leak.js create mode 100644 node_modules/lru-cache/test/serialize.js create mode 100644 node_modules/minimatch/.npmignore create mode 100644 node_modules/minimatch/LICENSE create mode 100644 node_modules/minimatch/README.md create mode 100644 node_modules/minimatch/minimatch.js create mode 100644 node_modules/minimatch/package.json create mode 100644 node_modules/minimatch/test/basic.js create mode 100644 node_modules/minimatch/test/brace-expand.js create mode 100644 node_modules/minimatch/test/caching.js create mode 100644 node_modules/minimatch/test/defaults.js create mode 100644 node_modules/minimatch/test/extglob-ending-with-state-char.js create mode 100644 node_modules/minimist/.travis.yml create mode 100644 node_modules/minimist/LICENSE create mode 100644 node_modules/minimist/example/parse.js create mode 100644 node_modules/minimist/index.js create mode 100644 node_modules/minimist/package.json create mode 100644 node_modules/minimist/readme.markdown create mode 100644 node_modules/minimist/test/dash.js create mode 100644 node_modules/minimist/test/default_bool.js create mode 100644 node_modules/minimist/test/dotted.js create mode 100644 node_modules/minimist/test/long.js create mode 100644 node_modules/minimist/test/parse.js create mode 100644 node_modules/minimist/test/parse_modified.js create mode 100644 node_modules/minimist/test/short.js create mode 100644 node_modules/minimist/test/whitespace.js create mode 100644 node_modules/mkdirp/.travis.yml create mode 100644 node_modules/mkdirp/LICENSE create mode 100755 node_modules/mkdirp/bin/cmd.js create mode 100644 node_modules/mkdirp/bin/usage.txt create mode 100644 node_modules/mkdirp/examples/pow.js create mode 100644 node_modules/mkdirp/index.js create mode 100644 node_modules/mkdirp/package.json create mode 100644 node_modules/mkdirp/readme.markdown create mode 100644 node_modules/mkdirp/test/chmod.js create mode 100644 node_modules/mkdirp/test/clobber.js create mode 100644 node_modules/mkdirp/test/mkdirp.js create mode 100644 node_modules/mkdirp/test/opts_fs.js create mode 100644 node_modules/mkdirp/test/opts_fs_sync.js create mode 100644 node_modules/mkdirp/test/perm.js create mode 100644 node_modules/mkdirp/test/perm_sync.js create mode 100644 node_modules/mkdirp/test/race.js create mode 100644 node_modules/mkdirp/test/rel.js create mode 100644 node_modules/mkdirp/test/return.js create mode 100644 node_modules/mkdirp/test/return_sync.js create mode 100644 node_modules/mkdirp/test/root.js create mode 100644 node_modules/mkdirp/test/sync.js create mode 100644 node_modules/mkdirp/test/umask.js create mode 100644 node_modules/mkdirp/test/umask_sync.js create mode 100644 node_modules/mocha/CHANGELOG.md create mode 100644 node_modules/mocha/LICENSE create mode 100644 node_modules/mocha/bin/.eslintrc create mode 100755 node_modules/mocha/bin/_mocha create mode 100755 node_modules/mocha/bin/mocha create mode 100644 node_modules/mocha/bin/options.js create mode 100644 node_modules/mocha/images/error.png create mode 100644 node_modules/mocha/images/ok.png create mode 100644 node_modules/mocha/index.js create mode 100644 node_modules/mocha/lib/browser/debug.js create mode 100644 node_modules/mocha/lib/browser/events.js create mode 100644 node_modules/mocha/lib/browser/progress.js create mode 100644 node_modules/mocha/lib/browser/tty.js create mode 100644 node_modules/mocha/lib/context.js create mode 100644 node_modules/mocha/lib/hook.js create mode 100644 node_modules/mocha/lib/interfaces/bdd.js create mode 100644 node_modules/mocha/lib/interfaces/common.js create mode 100644 node_modules/mocha/lib/interfaces/exports.js create mode 100644 node_modules/mocha/lib/interfaces/index.js create mode 100644 node_modules/mocha/lib/interfaces/qunit.js create mode 100644 node_modules/mocha/lib/interfaces/tdd.js create mode 100644 node_modules/mocha/lib/mocha.js create mode 100644 node_modules/mocha/lib/ms.js create mode 100644 node_modules/mocha/lib/pending.js create mode 100644 node_modules/mocha/lib/reporters/base.js create mode 100644 node_modules/mocha/lib/reporters/doc.js create mode 100644 node_modules/mocha/lib/reporters/dot.js create mode 100644 node_modules/mocha/lib/reporters/html-cov.js create mode 100644 node_modules/mocha/lib/reporters/html.js create mode 100644 node_modules/mocha/lib/reporters/index.js create mode 100644 node_modules/mocha/lib/reporters/json-cov.js create mode 100644 node_modules/mocha/lib/reporters/json-stream.js create mode 100644 node_modules/mocha/lib/reporters/json.js create mode 100644 node_modules/mocha/lib/reporters/landing.js create mode 100644 node_modules/mocha/lib/reporters/list.js create mode 100644 node_modules/mocha/lib/reporters/markdown.js create mode 100644 node_modules/mocha/lib/reporters/min.js create mode 100644 node_modules/mocha/lib/reporters/nyan.js create mode 100644 node_modules/mocha/lib/reporters/progress.js create mode 100644 node_modules/mocha/lib/reporters/spec.js create mode 100644 node_modules/mocha/lib/reporters/tap.js create mode 100644 node_modules/mocha/lib/reporters/templates/coverage.jade create mode 100644 node_modules/mocha/lib/reporters/templates/menu.jade create mode 100644 node_modules/mocha/lib/reporters/templates/script.html create mode 100644 node_modules/mocha/lib/reporters/templates/style.html create mode 100644 node_modules/mocha/lib/reporters/xunit.js create mode 100644 node_modules/mocha/lib/runnable.js create mode 100644 node_modules/mocha/lib/runner.js create mode 100644 node_modules/mocha/lib/suite.js create mode 100644 node_modules/mocha/lib/template.html create mode 100644 node_modules/mocha/lib/test.js create mode 100644 node_modules/mocha/lib/utils.js create mode 100644 node_modules/mocha/mocha.css create mode 100644 node_modules/mocha/mocha.js create mode 100644 node_modules/mocha/node_modules/debug/.jshintrc create mode 100644 node_modules/mocha/node_modules/debug/.npmignore create mode 100644 node_modules/mocha/node_modules/debug/History.md create mode 100644 node_modules/mocha/node_modules/debug/Makefile create mode 100644 node_modules/mocha/node_modules/debug/Readme.md create mode 100644 node_modules/mocha/node_modules/debug/bower.json create mode 100644 node_modules/mocha/node_modules/debug/browser.js create mode 100644 node_modules/mocha/node_modules/debug/component.json create mode 100644 node_modules/mocha/node_modules/debug/debug.js create mode 100644 node_modules/mocha/node_modules/debug/node.js create mode 100644 node_modules/mocha/node_modules/debug/package.json create mode 100644 node_modules/mocha/node_modules/ms/.npmignore create mode 100644 node_modules/mocha/node_modules/ms/History.md create mode 100644 node_modules/mocha/node_modules/ms/LICENSE create mode 100644 node_modules/mocha/node_modules/ms/README.md create mode 100644 node_modules/mocha/node_modules/ms/index.js create mode 100644 node_modules/mocha/node_modules/ms/package.json create mode 100644 node_modules/mocha/package.json create mode 100644 node_modules/quick-local-ip/.npmignore create mode 100644 node_modules/quick-local-ip/LICENSE create mode 100644 node_modules/quick-local-ip/README.md create mode 100644 node_modules/quick-local-ip/index.js create mode 100644 node_modules/quick-local-ip/package.json create mode 100644 node_modules/quick-local-ip/test.js create mode 100644 node_modules/sigmund/LICENSE create mode 100644 node_modules/sigmund/README.md create mode 100644 node_modules/sigmund/bench.js create mode 100644 node_modules/sigmund/package.json create mode 100644 node_modules/sigmund/sigmund.js create mode 100644 node_modules/sigmund/test/basic.js create mode 100755 node_modules/supports-color/cli.js create mode 100644 node_modules/supports-color/index.js create mode 100644 node_modules/supports-color/package.json create mode 100644 node_modules/supports-color/readme.md create mode 100644 node_modules/to-iso-string/.npmignore create mode 100644 node_modules/to-iso-string/History.md create mode 100644 node_modules/to-iso-string/Makefile create mode 100644 node_modules/to-iso-string/Readme.md create mode 100644 node_modules/to-iso-string/component.json create mode 100644 node_modules/to-iso-string/index.js create mode 100644 node_modules/to-iso-string/package.json create mode 100644 node_modules/to-iso-string/test/index.js diff --git a/index.js b/index.js index 88e0077..e9646c0 100644 --- a/index.js +++ b/index.js @@ -6,6 +6,12 @@ const io = require('socket.io')(http); const http_port = process.env.PORT || 61813; const net = require('net'); const input_port = 1337; +const myip = require('quick-local-ip'); +const ip4 = myip.getLocalIP4(); +const ip6 = myip.getLocalIP6(); + +console.log(ip4); +console.log(ip6); // define canvas var canvas_size_x = 100; @@ -75,13 +81,26 @@ app.use(express.static(__dirname + '/public')); // output socket io.on('connection', function (socket){ console.log("[HTTP] new connection"); - socket.emit('setting', {canvas: {size: {x: canvas_size_x, y: canvas_size_y}}}); + socket.emit('setting', { + canvas: { + size: { + x: canvas_size_x, + y: canvas_size_y + } + }, + network: { + ip4: ip4, + ip6: ip6, + port: input_port + } + }); }); // input socket var server = net.createServer(); server.on('connection', function (server_socket) { + console.log(server_socket); conn_count++; server_socket.setEncoding('utf8'); console.log('[INPUT] new input'); @@ -117,7 +136,6 @@ server.on('connection', function (server_socket) { server_socket.write('STATS px:' + pixel_count_flat + ' conn:' + conn_count_flat + '\n'); } }); - server_socket.on('close', function() { conn_count--; }); diff --git a/node_modules/.bin/_mocha b/node_modules/.bin/_mocha new file mode 120000 index 0000000..f2a54ff --- /dev/null +++ b/node_modules/.bin/_mocha @@ -0,0 +1 @@ +../mocha/bin/_mocha \ No newline at end of file diff --git a/node_modules/.bin/jade b/node_modules/.bin/jade new file mode 120000 index 0000000..571fae7 --- /dev/null +++ b/node_modules/.bin/jade @@ -0,0 +1 @@ +../jade/bin/jade \ No newline at end of file diff --git a/node_modules/.bin/mkdirp b/node_modules/.bin/mkdirp new file mode 120000 index 0000000..017896c --- /dev/null +++ b/node_modules/.bin/mkdirp @@ -0,0 +1 @@ +../mkdirp/bin/cmd.js \ No newline at end of file diff --git a/node_modules/.bin/mocha b/node_modules/.bin/mocha new file mode 120000 index 0000000..43c668d --- /dev/null +++ b/node_modules/.bin/mocha @@ -0,0 +1 @@ +../mocha/bin/mocha \ No newline at end of file diff --git a/node_modules/.bin/supports-color b/node_modules/.bin/supports-color new file mode 120000 index 0000000..af0f05e --- /dev/null +++ b/node_modules/.bin/supports-color @@ -0,0 +1 @@ +../supports-color/cli.js \ No newline at end of file diff --git a/node_modules/commander/Readme.md b/node_modules/commander/Readme.md new file mode 100644 index 0000000..7bb60b2 --- /dev/null +++ b/node_modules/commander/Readme.md @@ -0,0 +1,208 @@ +# Commander.js + + The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander). + + [![Build Status](https://api.travis-ci.org/visionmedia/commander.js.svg)](http://travis-ci.org/visionmedia/commander.js) + +## Installation + + $ npm install commander + +## Option parsing + + Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.0.1') + .option('-p, --peppers', 'Add peppers') + .option('-P, --pineapple', 'Add pineapple') + .option('-b, --bbq', 'Add bbq sauce') + .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') + .parse(process.argv); + +console.log('you ordered a pizza with:'); +if (program.peppers) console.log(' - peppers'); +if (program.pineapple) console.log(' - pineapple'); +if (program.bbq) console.log(' - bbq'); +console.log(' - %s cheese', program.cheese); +``` + + Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. + +## Automated --help + + The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: + +``` + $ ./examples/pizza --help + + Usage: pizza [options] + + Options: + + -V, --version output the version number + -p, --peppers Add peppers + -P, --pineapple Add pineapple + -b, --bbq Add bbq sauce + -c, --cheese Add the specified type of cheese [marble] + -h, --help output usage information + +``` + +## Coercion + +```js +function range(val) { + return val.split('..').map(Number); +} + +function list(val) { + return val.split(','); +} + +function collect(val, memo) { + memo.push(val); + return memo; +} + +function increaseVerbosity(v, total) { + return total + 1; +} + +program + .version('0.0.1') + .usage('[options] ') + .option('-i, --integer ', 'An integer argument', parseInt) + .option('-f, --float ', 'A float argument', parseFloat) + .option('-r, --range ..', 'A range', range) + .option('-l, --list ', 'A list', list) + .option('-o, --optional [value]', 'An optional value') + .option('-c, --collect [value]', 'A repeatable value', collect, []) + .option('-v, --verbose', 'A value that can be increased', increaseVerbosity, 0) + .parse(process.argv); + +console.log(' int: %j', program.integer); +console.log(' float: %j', program.float); +console.log(' optional: %j', program.optional); +program.range = program.range || []; +console.log(' range: %j..%j', program.range[0], program.range[1]); +console.log(' list: %j', program.list); +console.log(' collect: %j', program.collect); +console.log(' verbosity: %j', program.verbose); +console.log(' args: %j', program.args); +``` + +## Custom help + + You can display arbitrary `-h, --help` information + by listening for "--help". Commander will automatically + exit once you are done so that the remainder of your program + does not execute causing undesired behaviours, for example + in the following executable "stuff" will not output when + `--help` is used. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('../'); + +function list(val) { + return val.split(',').map(Number); +} + +program + .version('0.0.1') + .option('-f, --foo', 'enable some foo') + .option('-b, --bar', 'enable some bar') + .option('-B, --baz', 'enable some baz'); + +// must be before .parse() since +// node's emit() is immediate + +program.on('--help', function(){ + console.log(' Examples:'); + console.log(''); + console.log(' $ custom-help --help'); + console.log(' $ custom-help -h'); + console.log(''); +}); + +program.parse(process.argv); + +console.log('stuff'); +``` + +yielding the following help output: + +``` + +Usage: custom-help [options] + +Options: + + -h, --help output usage information + -V, --version output the version number + -f, --foo enable some foo + -b, --bar enable some bar + -B, --baz enable some baz + +Examples: + + $ custom-help --help + $ custom-help -h + +``` + +## .outputHelp() + + Output help information without exiting. + +## .help() + + Output help information and exit immediately. + +## Links + + - [API documentation](http://visionmedia.github.com/commander.js/) + - [ascii tables](https://github.com/LearnBoost/cli-table) + - [progress bars](https://github.com/visionmedia/node-progress) + - [more progress bars](https://github.com/substack/node-multimeter) + - [examples](https://github.com/visionmedia/commander.js/tree/master/examples) + +## License + +(The MIT License) + +Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/commander/index.js b/node_modules/commander/index.js new file mode 100644 index 0000000..8378d19 --- /dev/null +++ b/node_modules/commander/index.js @@ -0,0 +1,876 @@ + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter; +var spawn = require('child_process').spawn; +var path = require('path'); +var dirname = path.dirname; +var basename = path.basename; + +/** + * Expose the root command. + */ + +exports = module.exports = new Command; + +/** + * Expose `Command`. + */ + +exports.Command = Command; + +/** + * Expose `Option`. + */ + +exports.Option = Option; + +/** + * Initialize a new `Option` with the given `flags` and `description`. + * + * @param {String} flags + * @param {String} description + * @api public + */ + +function Option(flags, description) { + this.flags = flags; + this.required = ~flags.indexOf('<'); + this.optional = ~flags.indexOf('['); + this.bool = !~flags.indexOf('-no-'); + flags = flags.split(/[ ,|]+/); + if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); + this.long = flags.shift(); + this.description = description || ''; +} + +/** + * Return option name. + * + * @return {String} + * @api private + */ + +Option.prototype.name = function(){ + return this.long + .replace('--', '') + .replace('no-', ''); +}; + +/** + * Check if `arg` matches the short or long flag. + * + * @param {String} arg + * @return {Boolean} + * @api private + */ + +Option.prototype.is = function(arg){ + return arg == this.short + || arg == this.long; +}; + +/** + * Initialize a new `Command`. + * + * @param {String} name + * @api public + */ + +function Command(name) { + this.commands = []; + this.options = []; + this._execs = []; + this._args = []; + this._name = name; +} + +/** + * Inherit from `EventEmitter.prototype`. + */ + +Command.prototype.__proto__ = EventEmitter.prototype; + +/** + * Add command `name`. + * + * The `.action()` callback is invoked when the + * command `name` is specified via __ARGV__, + * and the remaining arguments are applied to the + * function for access. + * + * When the `name` is "*" an un-matched command + * will be passed as the first arg, followed by + * the rest of __ARGV__ remaining. + * + * Examples: + * + * program + * .version('0.0.1') + * .option('-C, --chdir ', 'change the working directory') + * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + * .option('-T, --no-tests', 'ignore test hook') + * + * program + * .command('setup') + * .description('run remote setup commands') + * .action(function(){ + * console.log('setup'); + * }); + * + * program + * .command('exec ') + * .description('run the given remote command') + * .action(function(cmd){ + * console.log('exec "%s"', cmd); + * }); + * + * program + * .command('*') + * .description('deploy the given env') + * .action(function(env){ + * console.log('deploying "%s"', env); + * }); + * + * program.parse(process.argv); + * + * @param {String} name + * @param {String} [desc] + * @return {Command} the new command + * @api public + */ + +Command.prototype.command = function(name, desc) { + var args = name.split(/ +/); + var cmd = new Command(args.shift()); + if (desc) cmd.description(desc); + if (desc) this.executables = true; + if (desc) this._execs[cmd._name] = true; + this.commands.push(cmd); + cmd.parseExpectedArgs(args); + cmd.parent = this; + if (desc) return this; + return cmd; +}; + +/** + * Add an implicit `help [cmd]` subcommand + * which invokes `--help` for the given command. + * + * @api private + */ + +Command.prototype.addImplicitHelpCommand = function() { + this.command('help [cmd]', 'display help for [cmd]'); +}; + +/** + * Parse expected `args`. + * + * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. + * + * @param {Array} args + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parseExpectedArgs = function(args){ + if (!args.length) return; + var self = this; + args.forEach(function(arg){ + switch (arg[0]) { + case '<': + self._args.push({ required: true, name: arg.slice(1, -1) }); + break; + case '[': + self._args.push({ required: false, name: arg.slice(1, -1) }); + break; + } + }); + return this; +}; + +/** + * Register callback `fn` for the command. + * + * Examples: + * + * program + * .command('help') + * .description('display verbose help') + * .action(function(){ + * // output help here + * }); + * + * @param {Function} fn + * @return {Command} for chaining + * @api public + */ + +Command.prototype.action = function(fn){ + var self = this; + var listener = function(args, unknown){ + // Parse any so-far unknown options + args = args || []; + unknown = unknown || []; + + var parsed = self.parseOptions(unknown); + + // Output help if necessary + outputHelpIfNecessary(self, parsed.unknown); + + // If there are still any unknown options, then we simply + // die, unless someone asked for help, in which case we give it + // to them, and then we die. + if (parsed.unknown.length > 0) { + self.unknownOption(parsed.unknown[0]); + } + + // Leftover arguments need to be pushed back. Fixes issue #56 + if (parsed.args.length) args = parsed.args.concat(args); + + self._args.forEach(function(arg, i){ + if (arg.required && null == args[i]) { + self.missingArgument(arg.name); + } + }); + + // Always append ourselves to the end of the arguments, + // to make sure we match the number of arguments the user + // expects + if (self._args.length) { + args[self._args.length] = self; + } else { + args.push(self); + } + + fn.apply(this, args); + }; + this.parent.on(this._name, listener); + if (this._alias) this.parent.on(this._alias, listener); + return this; +}; + +/** + * Define option with `flags`, `description` and optional + * coercion `fn`. + * + * The `flags` string should contain both the short and long flags, + * separated by comma, a pipe or space. The following are all valid + * all will output this way when `--help` is used. + * + * "-p, --pepper" + * "-p|--pepper" + * "-p --pepper" + * + * Examples: + * + * // simple boolean defaulting to false + * program.option('-p, --pepper', 'add pepper'); + * + * --pepper + * program.pepper + * // => Boolean + * + * // simple boolean defaulting to true + * program.option('-C, --no-cheese', 'remove cheese'); + * + * program.cheese + * // => true + * + * --no-cheese + * program.cheese + * // => false + * + * // required argument + * program.option('-C, --chdir ', 'change the working directory'); + * + * --chdir /tmp + * program.chdir + * // => "/tmp" + * + * // optional argument + * program.option('-c, --cheese [type]', 'add cheese [marble]'); + * + * @param {String} flags + * @param {String} description + * @param {Function|Mixed} fn or default + * @param {Mixed} defaultValue + * @return {Command} for chaining + * @api public + */ + +Command.prototype.option = function(flags, description, fn, defaultValue){ + var self = this + , option = new Option(flags, description) + , oname = option.name() + , name = camelcase(oname); + + // default as 3rd arg + if ('function' != typeof fn) defaultValue = fn, fn = null; + + // preassign default value only for --no-*, [optional], or + if (false == option.bool || option.optional || option.required) { + // when --no-* we make sure default is true + if (false == option.bool) defaultValue = true; + // preassign only if we have a default + if (undefined !== defaultValue) self[name] = defaultValue; + } + + // register the option + this.options.push(option); + + // when it's passed assign the value + // and conditionally invoke the callback + this.on(oname, function(val){ + // coercion + if (null !== val && fn) val = fn(val, undefined === self[name] ? defaultValue : self[name]); + + // unassigned or bool + if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) { + // if no value, bool true, and we have a default, then use it! + if (null == val) { + self[name] = option.bool + ? defaultValue || true + : false; + } else { + self[name] = val; + } + } else if (null !== val) { + // reassign + self[name] = val; + } + }); + + return this; +}; + +/** + * Parse `argv`, settings options and invoking commands when defined. + * + * @param {Array} argv + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parse = function(argv){ + // implicit help + if (this.executables) this.addImplicitHelpCommand(); + + // store raw args + this.rawArgs = argv; + + // guess name + this._name = this._name || basename(argv[1], '.js'); + + // process argv + var parsed = this.parseOptions(this.normalize(argv.slice(2))); + var args = this.args = parsed.args; + + var result = this.parseArgs(this.args, parsed.unknown); + + // executable sub-commands + var name = result.args[0]; + if (this._execs[name]) return this.executeSubCommand(argv, args, parsed.unknown); + + return result; +}; + +/** + * Execute a sub-command executable. + * + * @param {Array} argv + * @param {Array} args + * @param {Array} unknown + * @api private + */ + +Command.prototype.executeSubCommand = function(argv, args, unknown) { + args = args.concat(unknown); + + if (!args.length) this.help(); + if ('help' == args[0] && 1 == args.length) this.help(); + + // --help + if ('help' == args[0]) { + args[0] = args[1]; + args[1] = '--help'; + } + + // executable + var dir = dirname(argv[1]); + var bin = basename(argv[1], '.js') + '-' + args[0]; + + // check for ./ first + var local = path.join(dir, bin); + + // run it + args = args.slice(1); + args.unshift(local); + var proc = spawn('node', args, { stdio: 'inherit', customFds: [0, 1, 2] }); + proc.on('error', function(err){ + if (err.code == "ENOENT") { + console.error('\n %s(1) does not exist, try --help\n', bin); + } else if (err.code == "EACCES") { + console.error('\n %s(1) not executable. try chmod or run with root\n', bin); + } + }); + + this.runningCommand = proc; +}; + +/** + * Normalize `args`, splitting joined short flags. For example + * the arg "-abc" is equivalent to "-a -b -c". + * This also normalizes equal sign and splits "--abc=def" into "--abc def". + * + * @param {Array} args + * @return {Array} + * @api private + */ + +Command.prototype.normalize = function(args){ + var ret = [] + , arg + , lastOpt + , index; + + for (var i = 0, len = args.length; i < len; ++i) { + arg = args[i]; + i > 0 && (lastOpt = this.optionFor(args[i-1])); + + if (lastOpt && lastOpt.required) { + ret.push(arg); + } else if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) { + arg.slice(1).split('').forEach(function(c){ + ret.push('-' + c); + }); + } else if (/^--/.test(arg) && ~(index = arg.indexOf('='))) { + ret.push(arg.slice(0, index), arg.slice(index + 1)); + } else { + ret.push(arg); + } + } + + return ret; +}; + +/** + * Parse command `args`. + * + * When listener(s) are available those + * callbacks are invoked, otherwise the "*" + * event is emitted and those actions are invoked. + * + * @param {Array} args + * @return {Command} for chaining + * @api private + */ + +Command.prototype.parseArgs = function(args, unknown){ + var cmds = this.commands + , len = cmds.length + , name; + + if (args.length) { + name = args[0]; + if (this.listeners(name).length) { + this.emit(args.shift(), args, unknown); + } else { + this.emit('*', args); + } + } else { + outputHelpIfNecessary(this, unknown); + + // If there were no args and we have unknown options, + // then they are extraneous and we need to error. + if (unknown.length > 0) { + this.unknownOption(unknown[0]); + } + } + + return this; +}; + +/** + * Return an option matching `arg` if any. + * + * @param {String} arg + * @return {Option} + * @api private + */ + +Command.prototype.optionFor = function(arg){ + for (var i = 0, len = this.options.length; i < len; ++i) { + if (this.options[i].is(arg)) { + return this.options[i]; + } + } +}; + +/** + * Parse options from `argv` returning `argv` + * void of these options. + * + * @param {Array} argv + * @return {Array} + * @api public + */ + +Command.prototype.parseOptions = function(argv){ + var args = [] + , len = argv.length + , literal + , option + , arg; + + var unknownOptions = []; + + // parse options + for (var i = 0; i < len; ++i) { + arg = argv[i]; + + // literal args after -- + if ('--' == arg) { + literal = true; + continue; + } + + if (literal) { + args.push(arg); + continue; + } + + // find matching Option + option = this.optionFor(arg); + + // option is defined + if (option) { + // requires arg + if (option.required) { + arg = argv[++i]; + if (null == arg) return this.optionMissingArgument(option); + this.emit(option.name(), arg); + // optional arg + } else if (option.optional) { + arg = argv[i+1]; + if (null == arg || ('-' == arg[0] && '-' != arg)) { + arg = null; + } else { + ++i; + } + this.emit(option.name(), arg); + // bool + } else { + this.emit(option.name()); + } + continue; + } + + // looks like an option + if (arg.length > 1 && '-' == arg[0]) { + unknownOptions.push(arg); + + // If the next argument looks like it might be + // an argument for this option, we pass it on. + // If it isn't, then it'll simply be ignored + if (argv[i+1] && '-' != argv[i+1][0]) { + unknownOptions.push(argv[++i]); + } + continue; + } + + // arg + args.push(arg); + } + + return { args: args, unknown: unknownOptions }; +}; + +/** + * Argument `name` is missing. + * + * @param {String} name + * @api private + */ + +Command.prototype.missingArgument = function(name){ + console.error(); + console.error(" error: missing required argument `%s'", name); + console.error(); + process.exit(1); +}; + +/** + * `Option` is missing an argument, but received `flag` or nothing. + * + * @param {String} option + * @param {String} flag + * @api private + */ + +Command.prototype.optionMissingArgument = function(option, flag){ + console.error(); + if (flag) { + console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); + } else { + console.error(" error: option `%s' argument missing", option.flags); + } + console.error(); + process.exit(1); +}; + +/** + * Unknown option `flag`. + * + * @param {String} flag + * @api private + */ + +Command.prototype.unknownOption = function(flag){ + console.error(); + console.error(" error: unknown option `%s'", flag); + console.error(); + process.exit(1); +}; + + +/** + * Set the program version to `str`. + * + * This method auto-registers the "-V, --version" flag + * which will print the version number when passed. + * + * @param {String} str + * @param {String} flags + * @return {Command} for chaining + * @api public + */ + +Command.prototype.version = function(str, flags){ + if (0 == arguments.length) return this._version; + this._version = str; + flags = flags || '-V, --version'; + this.option(flags, 'output the version number'); + this.on('version', function(){ + console.log(str); + process.exit(0); + }); + return this; +}; + +/** + * Set the description `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.description = function(str){ + if (0 == arguments.length) return this._description; + this._description = str; + return this; +}; + +/** + * Set an alias for the command + * + * @param {String} alias + * @return {String|Command} + * @api public + */ + +Command.prototype.alias = function(alias){ + if (0 == arguments.length) return this._alias; + this._alias = alias; + return this; +}; + +/** + * Set / get the command usage `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.usage = function(str){ + var args = this._args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }); + + var usage = '[options' + + (this.commands.length ? '] [command' : '') + + ']' + + (this._args.length ? ' ' + args : ''); + + if (0 == arguments.length) return this._usage || usage; + this._usage = str; + + return this; +}; + +/** + * Return the largest option length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestOptionLength = function(){ + return this.options.reduce(function(max, option){ + return Math.max(max, option.flags.length); + }, 0); +}; + +/** + * Return help for options. + * + * @return {String} + * @api private + */ + +Command.prototype.optionHelp = function(){ + var width = this.largestOptionLength(); + + // Prepend the help information + return [pad('-h, --help', width) + ' ' + 'output usage information'] + .concat(this.options.map(function(option){ + return pad(option.flags, width) + + ' ' + option.description; + })) + .join('\n'); +}; + +/** + * Return command help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.commandHelp = function(){ + if (!this.commands.length) return ''; + return [ + '' + , ' Commands:' + , '' + , this.commands.map(function(cmd){ + var args = cmd._args.map(function(arg){ + return arg.required + ? '<' + arg.name + '>' + : '[' + arg.name + ']'; + }).join(' '); + + return cmd._name + + (cmd._alias + ? '|' + cmd._alias + : '') + + (cmd.options.length + ? ' [options]' + : '') + ' ' + args + + (cmd.description() + ? '\n ' + cmd.description() + : '') + + '\n'; + }).join('\n').replace(/^/gm, ' ') + , '' + ].join('\n'); +}; + +/** + * Return program help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.helpInformation = function(){ + return [ + '' + , ' Usage: ' + this._name + + (this._alias + ? '|' + this._alias + : '') + + ' ' + this.usage() + , '' + this.commandHelp() + , ' Options:' + , '' + , '' + this.optionHelp().replace(/^/gm, ' ') + , '' + , '' + ].join('\n'); +}; + +/** + * Output help information for this command + * + * @api public + */ + +Command.prototype.outputHelp = function(){ + process.stdout.write(this.helpInformation()); + this.emit('--help'); +}; + +/** + * Output help information and exit. + * + * @api public + */ + +Command.prototype.help = function(){ + this.outputHelp(); + process.exit(); +}; + +/** + * Camel-case the given `flag` + * + * @param {String} flag + * @return {String} + * @api private + */ + +function camelcase(flag) { + return flag.split('-').reduce(function(str, word){ + return str + word[0].toUpperCase() + word.slice(1); + }); +} + +/** + * Pad `str` to `width`. + * + * @param {String} str + * @param {Number} width + * @return {String} + * @api private + */ + +function pad(str, width) { + var len = Math.max(0, width - str.length); + return str + Array(len + 1).join(' '); +} + +/** + * Output help information if necessary + * + * @param {Command} command to output help for + * @param {Array} array of options to search for -h or --help + * @api private + */ + +function outputHelpIfNecessary(cmd, options) { + options = options || []; + for (var i = 0; i < options.length; i++) { + if (options[i] == '--help' || options[i] == '-h') { + cmd.outputHelp(); + process.exit(0); + } + } +} diff --git a/node_modules/commander/package.json b/node_modules/commander/package.json new file mode 100644 index 0000000..01b9d68 --- /dev/null +++ b/node_modules/commander/package.json @@ -0,0 +1,62 @@ +{ + "_from": "commander@2.3.0", + "_id": "commander@2.3.0", + "_inBundle": false, + "_integrity": "sha1-/UMOiJgy7DU7ms0d4hfBHLPu+HM=", + "_location": "/commander", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "commander@2.3.0", + "name": "commander", + "escapedName": "commander", + "rawSpec": "2.3.0", + "saveSpec": null, + "fetchSpec": "2.3.0" + }, + "_requiredBy": [ + "/mocha" + ], + "_resolved": "https://registry.npmjs.org/commander/-/commander-2.3.0.tgz", + "_shasum": "fd430e889832ec353b9acd1de217c11cb3eef873", + "_spec": "commander@2.3.0", + "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/visionmedia/commander.js/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "the complete solution for node.js command-line programs", + "devDependencies": { + "should": ">= 0.0.1" + }, + "engines": { + "node": ">= 0.6.x" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/visionmedia/commander.js#readme", + "keywords": [ + "command", + "option", + "parser", + "prompt", + "stdin" + ], + "main": "index", + "name": "commander", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/commander.js.git" + }, + "scripts": { + "test": "make test" + }, + "version": "2.3.0" +} diff --git a/node_modules/diff/README.md b/node_modules/diff/README.md new file mode 100644 index 0000000..b867e19 --- /dev/null +++ b/node_modules/diff/README.md @@ -0,0 +1,181 @@ +# jsdiff + +[![Build Status](https://secure.travis-ci.org/kpdecker/jsdiff.png)](http://travis-ci.org/kpdecker/jsdiff) + +A javascript text differencing implementation. + +Based on the algorithm proposed in +["An O(ND) Difference Algorithm and its Variations" (Myers, 1986)](http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927). + +## Installation + + npm install diff + +or + + bower install jsdiff + +or + + git clone git://github.com/kpdecker/jsdiff.git + +## API + +* `JsDiff.diffChars(oldStr, newStr[, callback])` - diffs two blocks of text, comparing character by character. + + Returns a list of change objects (See below). + +* `JsDiff.diffWords(oldStr, newStr[, callback])` - diffs two blocks of text, comparing word by word, ignoring whitespace. + + Returns a list of change objects (See below). + +* `JsDiff.diffWordsWithSpace(oldStr, newStr[, callback])` - diffs two blocks of text, comparing word by word, treating whitespace as significant. + + Returns a list of change objects (See below). + +* `JsDiff.diffLines(oldStr, newStr[, callback])` - diffs two blocks of text, comparing line by line. + + Returns a list of change objects (See below). + +* `JsDiff.diffTrimmedLines(oldStr, newStr[, callback])` - diffs two blocks of text, comparing line by line, ignoring leading and trailing whitespace. + + Returns a list of change objects (See below). + +* `JsDiff.diffSentences(oldStr, newStr[, callback])` - diffs two blocks of text, comparing sentence by sentence. + + Returns a list of change objects (See below). + +* `JsDiff.diffCss(oldStr, newStr[, callback])` - diffs two blocks of text, comparing CSS tokens. + + Returns a list of change objects (See below). + +* `JsDiff.diffJson(oldObj, newObj[, callback])` - diffs two JSON objects, comparing the fields defined on each. The order of fields, etc does not matter in this comparison. + + Returns a list of change objects (See below). + +* `JsDiff.createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch. + + Parameters: + * `oldFileName` : String to be output in the filename section of the patch for the removals + * `newFileName` : String to be output in the filename section of the patch for the additions + * `oldStr` : Original string value + * `newStr` : New string value + * `oldHeader` : Additional information to include in the old file header + * `newHeader` : Additional information to include in thew new file header + +* `JsDiff.createPatch(fileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch. + + Just like JsDiff.createTwoFilesPatch, but with oldFileName being equal to newFileName. + +* `JsDiff.applyPatch(oldStr, diffStr)` - applies a unified diff patch. + + Return a string containing new version of provided data. + +* `convertChangesToXML(changes)` - converts a list of changes to a serialized XML format + + +All methods above which accept the optional callback method will run in sync mode when that parameter is omitted and in async mode when supplied. This allows for larger diffs without blocking the event loop. + +### Change Objects +Many of the methods above return change objects. These objects are consist of the following fields: + +* `value`: Text content +* `added`: True if the value was inserted into the new string +* `removed`: True of the value was removed from the old string + +Note that some cases may omit a particular flag field. Comparison on the flag fields should always be done in a truthy or falsy manner. + +## Examples + +Basic example in Node + +```js +require('colors') +var jsdiff = require('diff'); + +var one = 'beep boop'; +var other = 'beep boob blah'; + +var diff = jsdiff.diffChars(one, other); + +diff.forEach(function(part){ + // green for additions, red for deletions + // grey for common parts + var color = part.added ? 'green' : + part.removed ? 'red' : 'grey'; + process.stderr.write(part.value[color]); +}); + +console.log() +``` +Running the above program should yield + +Node Example + +Basic example in a web page + +```html +

+
+
+```
+
+Open the above .html file in a browser and you should see
+
+Node Example
+
+**[Full online demo](http://kpdecker.github.com/jsdiff)**
+
+## License
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2011, Kevin Decker kpdecker@gmail.com
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+[![Bitdeli Badge](https://d2weczhvl823v0.cloudfront.net/kpdecker/jsdiff/trend.png)](https://bitdeli.com/free "Bitdeli Badge")
diff --git a/node_modules/diff/diff.js b/node_modules/diff/diff.js
new file mode 100644
index 0000000..421854a
--- /dev/null
+++ b/node_modules/diff/diff.js
@@ -0,0 +1,619 @@
+/* See LICENSE file for terms of use */
+
+/*
+ * Text diff implementation.
+ *
+ * This library supports the following APIS:
+ * JsDiff.diffChars: Character by character diff
+ * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+ * JsDiff.diffLines: Line based diff
+ *
+ * JsDiff.diffCss: Diff targeted at CSS content
+ *
+ * These methods are based on the implementation proposed in
+ * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+ * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+ */
+(function(global, undefined) {
+  var objectPrototypeToString = Object.prototype.toString;
+
+  /*istanbul ignore next*/
+  function map(arr, mapper, that) {
+    if (Array.prototype.map) {
+      return Array.prototype.map.call(arr, mapper, that);
+    }
+
+    var other = new Array(arr.length);
+
+    for (var i = 0, n = arr.length; i < n; i++) {
+      other[i] = mapper.call(that, arr[i], i, arr);
+    }
+    return other;
+  }
+  function clonePath(path) {
+    return { newPos: path.newPos, components: path.components.slice(0) };
+  }
+  function removeEmpty(array) {
+    var ret = [];
+    for (var i = 0; i < array.length; i++) {
+      if (array[i]) {
+        ret.push(array[i]);
+      }
+    }
+    return ret;
+  }
+  function escapeHTML(s) {
+    var n = s;
+    n = n.replace(/&/g, '&');
+    n = n.replace(//g, '>');
+    n = n.replace(/"/g, '"');
+
+    return n;
+  }
+
+  // This function handles the presence of circular references by bailing out when encountering an
+  // object that is already on the "stack" of items being processed.
+  function canonicalize(obj, stack, replacementStack) {
+    stack = stack || [];
+    replacementStack = replacementStack || [];
+
+    var i;
+
+    for (i = 0; i < stack.length; i += 1) {
+      if (stack[i] === obj) {
+        return replacementStack[i];
+      }
+    }
+
+    var canonicalizedObj;
+
+    if ('[object Array]' === objectPrototypeToString.call(obj)) {
+      stack.push(obj);
+      canonicalizedObj = new Array(obj.length);
+      replacementStack.push(canonicalizedObj);
+      for (i = 0; i < obj.length; i += 1) {
+        canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack);
+      }
+      stack.pop();
+      replacementStack.pop();
+    } else if (typeof obj === 'object' && obj !== null) {
+      stack.push(obj);
+      canonicalizedObj = {};
+      replacementStack.push(canonicalizedObj);
+      var sortedKeys = [],
+          key;
+      for (key in obj) {
+        sortedKeys.push(key);
+      }
+      sortedKeys.sort();
+      for (i = 0; i < sortedKeys.length; i += 1) {
+        key = sortedKeys[i];
+        canonicalizedObj[key] = canonicalize(obj[key], stack, replacementStack);
+      }
+      stack.pop();
+      replacementStack.pop();
+    } else {
+      canonicalizedObj = obj;
+    }
+    return canonicalizedObj;
+  }
+
+  function buildValues(components, newString, oldString, useLongestToken) {
+    var componentPos = 0,
+        componentLen = components.length,
+        newPos = 0,
+        oldPos = 0;
+
+    for (; componentPos < componentLen; componentPos++) {
+      var component = components[componentPos];
+      if (!component.removed) {
+        if (!component.added && useLongestToken) {
+          var value = newString.slice(newPos, newPos + component.count);
+          value = map(value, function(value, i) {
+            var oldValue = oldString[oldPos + i];
+            return oldValue.length > value.length ? oldValue : value;
+          });
+
+          component.value = value.join('');
+        } else {
+          component.value = newString.slice(newPos, newPos + component.count).join('');
+        }
+        newPos += component.count;
+
+        // Common case
+        if (!component.added) {
+          oldPos += component.count;
+        }
+      } else {
+        component.value = oldString.slice(oldPos, oldPos + component.count).join('');
+        oldPos += component.count;
+
+        // Reverse add and remove so removes are output first to match common convention
+        // The diffing algorithm is tied to add then remove output and this is the simplest
+        // route to get the desired output with minimal overhead.
+        if (componentPos && components[componentPos - 1].added) {
+          var tmp = components[componentPos - 1];
+          components[componentPos - 1] = components[componentPos];
+          components[componentPos] = tmp;
+        }
+      }
+    }
+
+    return components;
+  }
+
+  function Diff(ignoreWhitespace) {
+    this.ignoreWhitespace = ignoreWhitespace;
+  }
+  Diff.prototype = {
+    diff: function(oldString, newString, callback) {
+      var self = this;
+
+      function done(value) {
+        if (callback) {
+          setTimeout(function() { callback(undefined, value); }, 0);
+          return true;
+        } else {
+          return value;
+        }
+      }
+
+      // Handle the identity case (this is due to unrolling editLength == 0
+      if (newString === oldString) {
+        return done([{ value: newString }]);
+      }
+      if (!newString) {
+        return done([{ value: oldString, removed: true }]);
+      }
+      if (!oldString) {
+        return done([{ value: newString, added: true }]);
+      }
+
+      newString = this.tokenize(newString);
+      oldString = this.tokenize(oldString);
+
+      var newLen = newString.length, oldLen = oldString.length;
+      var editLength = 1;
+      var maxEditLength = newLen + oldLen;
+      var bestPath = [{ newPos: -1, components: [] }];
+
+      // Seed editLength = 0, i.e. the content starts with the same values
+      var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+      if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+        // Identity per the equality and tokenizer
+        return done([{value: newString.join('')}]);
+      }
+
+      // Main worker method. checks all permutations of a given edit length for acceptance.
+      function execEditLength() {
+        for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+          var basePath;
+          var addPath = bestPath[diagonalPath - 1],
+              removePath = bestPath[diagonalPath + 1],
+              oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+          if (addPath) {
+            // No one else is going to attempt to use this value, clear it
+            bestPath[diagonalPath - 1] = undefined;
+          }
+
+          var canAdd = addPath && addPath.newPos + 1 < newLen,
+              canRemove = removePath && 0 <= oldPos && oldPos < oldLen;
+          if (!canAdd && !canRemove) {
+            // If this path is a terminal then prune
+            bestPath[diagonalPath] = undefined;
+            continue;
+          }
+
+          // Select the diagonal that we want to branch from. We select the prior
+          // path whose position in the new string is the farthest from the origin
+          // and does not pass the bounds of the diff graph
+          if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) {
+            basePath = clonePath(removePath);
+            self.pushComponent(basePath.components, undefined, true);
+          } else {
+            basePath = addPath;   // No need to clone, we've pulled it from the list
+            basePath.newPos++;
+            self.pushComponent(basePath.components, true, undefined);
+          }
+
+          oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+          // If we have hit the end of both strings, then we are done
+          if (basePath.newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+            return done(buildValues(basePath.components, newString, oldString, self.useLongestToken));
+          } else {
+            // Otherwise track this path as a potential candidate and continue.
+            bestPath[diagonalPath] = basePath;
+          }
+        }
+
+        editLength++;
+      }
+
+      // Performs the length of edit iteration. Is a bit fugly as this has to support the
+      // sync and async mode which is never fun. Loops over execEditLength until a value
+      // is produced.
+      if (callback) {
+        (function exec() {
+          setTimeout(function() {
+            // This should not happen, but we want to be safe.
+            /*istanbul ignore next */
+            if (editLength > maxEditLength) {
+              return callback();
+            }
+
+            if (!execEditLength()) {
+              exec();
+            }
+          }, 0);
+        }());
+      } else {
+        while (editLength <= maxEditLength) {
+          var ret = execEditLength();
+          if (ret) {
+            return ret;
+          }
+        }
+      }
+    },
+
+    pushComponent: function(components, added, removed) {
+      var last = components[components.length - 1];
+      if (last && last.added === added && last.removed === removed) {
+        // We need to clone here as the component clone operation is just
+        // as shallow array clone
+        components[components.length - 1] = {count: last.count + 1, added: added, removed: removed };
+      } else {
+        components.push({count: 1, added: added, removed: removed });
+      }
+    },
+    extractCommon: function(basePath, newString, oldString, diagonalPath) {
+      var newLen = newString.length,
+          oldLen = oldString.length,
+          newPos = basePath.newPos,
+          oldPos = newPos - diagonalPath,
+
+          commonCount = 0;
+      while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+        newPos++;
+        oldPos++;
+        commonCount++;
+      }
+
+      if (commonCount) {
+        basePath.components.push({count: commonCount});
+      }
+
+      basePath.newPos = newPos;
+      return oldPos;
+    },
+
+    equals: function(left, right) {
+      var reWhitespace = /\S/;
+      return left === right || (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right));
+    },
+    tokenize: function(value) {
+      return value.split('');
+    }
+  };
+
+  var CharDiff = new Diff();
+
+  var WordDiff = new Diff(true);
+  var WordWithSpaceDiff = new Diff();
+  WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/(\s+|\b)/));
+  };
+
+  var CssDiff = new Diff(true);
+  CssDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/([{}:;,]|\s+)/));
+  };
+
+  var LineDiff = new Diff();
+
+  var TrimmedLineDiff = new Diff();
+  TrimmedLineDiff.ignoreTrim = true;
+
+  LineDiff.tokenize = TrimmedLineDiff.tokenize = function(value) {
+    var retLines = [],
+        lines = value.split(/^/m);
+    for (var i = 0; i < lines.length; i++) {
+      var line = lines[i],
+          lastLine = lines[i - 1],
+          lastLineLastChar = lastLine && lastLine[lastLine.length - 1];
+
+      // Merge lines that may contain windows new lines
+      if (line === '\n' && lastLineLastChar === '\r') {
+          retLines[retLines.length - 1] = retLines[retLines.length - 1].slice(0, -1) + '\r\n';
+      } else {
+        if (this.ignoreTrim) {
+          line = line.trim();
+          // add a newline unless this is the last line.
+          if (i < lines.length - 1) {
+            line += '\n';
+          }
+        }
+        retLines.push(line);
+      }
+    }
+
+    return retLines;
+  };
+
+  var PatchDiff = new Diff();
+  PatchDiff.tokenize = function(value) {
+    var ret = [],
+        linesAndNewlines = value.split(/(\n|\r\n)/);
+
+    // Ignore the final empty token that occurs if the string ends with a new line
+    if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+      linesAndNewlines.pop();
+    }
+
+    // Merge the content and line separators into single tokens
+    for (var i = 0; i < linesAndNewlines.length; i++) {
+      var line = linesAndNewlines[i];
+
+      if (i % 2) {
+        ret[ret.length - 1] += line;
+      } else {
+        ret.push(line);
+      }
+    }
+    return ret;
+  };
+
+  var SentenceDiff = new Diff();
+  SentenceDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/(\S.+?[.!?])(?=\s+|$)/));
+  };
+
+  var JsonDiff = new Diff();
+  // Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+  // dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+  JsonDiff.useLongestToken = true;
+  JsonDiff.tokenize = LineDiff.tokenize;
+  JsonDiff.equals = function(left, right) {
+    return LineDiff.equals(left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'));
+  };
+
+  var JsDiff = {
+    Diff: Diff,
+
+    diffChars: function(oldStr, newStr, callback) { return CharDiff.diff(oldStr, newStr, callback); },
+    diffWords: function(oldStr, newStr, callback) { return WordDiff.diff(oldStr, newStr, callback); },
+    diffWordsWithSpace: function(oldStr, newStr, callback) { return WordWithSpaceDiff.diff(oldStr, newStr, callback); },
+    diffLines: function(oldStr, newStr, callback) { return LineDiff.diff(oldStr, newStr, callback); },
+    diffTrimmedLines: function(oldStr, newStr, callback) { return TrimmedLineDiff.diff(oldStr, newStr, callback); },
+
+    diffSentences: function(oldStr, newStr, callback) { return SentenceDiff.diff(oldStr, newStr, callback); },
+
+    diffCss: function(oldStr, newStr, callback) { return CssDiff.diff(oldStr, newStr, callback); },
+    diffJson: function(oldObj, newObj, callback) {
+      return JsonDiff.diff(
+        typeof oldObj === 'string' ? oldObj : JSON.stringify(canonicalize(oldObj), undefined, '  '),
+        typeof newObj === 'string' ? newObj : JSON.stringify(canonicalize(newObj), undefined, '  '),
+        callback
+      );
+    },
+
+    createTwoFilesPatch: function(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader) {
+      var ret = [];
+
+      if (oldFileName == newFileName) {
+        ret.push('Index: ' + oldFileName);
+      }
+      ret.push('===================================================================');
+      ret.push('--- ' + oldFileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader));
+      ret.push('+++ ' + newFileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader));
+
+      var diff = PatchDiff.diff(oldStr, newStr);
+      diff.push({value: '', lines: []});   // Append an empty value to make cleanup easier
+
+      // Formats a given set of lines for printing as context lines in a patch
+      function contextLines(lines) {
+        return map(lines, function(entry) { return ' ' + entry; });
+      }
+
+      // Outputs the no newline at end of file warning if needed
+      function eofNL(curRange, i, current) {
+        var last = diff[diff.length - 2],
+            isLast = i === diff.length - 2,
+            isLastOfType = i === diff.length - 3 && current.added !== last.added;
+
+        // Figure out if this is the last line for the given file and missing NL
+        if (!(/\n$/.test(current.value)) && (isLast || isLastOfType)) {
+          curRange.push('\\ No newline at end of file');
+        }
+      }
+
+      var oldRangeStart = 0, newRangeStart = 0, curRange = [],
+          oldLine = 1, newLine = 1;
+      for (var i = 0; i < diff.length; i++) {
+        var current = diff[i],
+            lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+        current.lines = lines;
+
+        if (current.added || current.removed) {
+          // If we have previous context, start with that
+          if (!oldRangeStart) {
+            var prev = diff[i - 1];
+            oldRangeStart = oldLine;
+            newRangeStart = newLine;
+
+            if (prev) {
+              curRange = contextLines(prev.lines.slice(-4));
+              oldRangeStart -= curRange.length;
+              newRangeStart -= curRange.length;
+            }
+          }
+
+          // Output our changes
+          curRange.push.apply(curRange, map(lines, function(entry) {
+            return (current.added ? '+' : '-') + entry;
+          }));
+          eofNL(curRange, i, current);
+
+          // Track the updated file position
+          if (current.added) {
+            newLine += lines.length;
+          } else {
+            oldLine += lines.length;
+          }
+        } else {
+          // Identical context lines. Track line changes
+          if (oldRangeStart) {
+            // Close out any changes that have been output (or join overlapping)
+            if (lines.length <= 8 && i < diff.length - 2) {
+              // Overlapping
+              curRange.push.apply(curRange, contextLines(lines));
+            } else {
+              // end the range and output
+              var contextSize = Math.min(lines.length, 4);
+              ret.push(
+                  '@@ -' + oldRangeStart + ',' + (oldLine - oldRangeStart + contextSize)
+                  + ' +' + newRangeStart + ',' + (newLine - newRangeStart + contextSize)
+                  + ' @@');
+              ret.push.apply(ret, curRange);
+              ret.push.apply(ret, contextLines(lines.slice(0, contextSize)));
+              if (lines.length <= 4) {
+                eofNL(ret, i, current);
+              }
+
+              oldRangeStart = 0;
+              newRangeStart = 0;
+              curRange = [];
+            }
+          }
+          oldLine += lines.length;
+          newLine += lines.length;
+        }
+      }
+
+      return ret.join('\n') + '\n';
+    },
+
+    createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) {
+      return JsDiff.createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader);
+    },
+
+    applyPatch: function(oldStr, uniDiff) {
+      var diffstr = uniDiff.split('\n'),
+          hunks = [],
+          i = 0,
+          remEOFNL = false,
+          addEOFNL = false;
+
+      // Skip to the first change hunk
+      while (i < diffstr.length && !(/^@@/.test(diffstr[i]))) {
+        i++;
+      }
+
+      // Parse the unified diff
+      for (; i < diffstr.length; i++) {
+        if (diffstr[i][0] === '@') {
+          var chnukHeader = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/);
+          hunks.unshift({
+            start: chnukHeader[3],
+            oldlength: +chnukHeader[2],
+            removed: [],
+            newlength: chnukHeader[4],
+            added: []
+          });
+        } else if (diffstr[i][0] === '+') {
+          hunks[0].added.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === '-') {
+          hunks[0].removed.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === ' ') {
+          hunks[0].added.push(diffstr[i].substr(1));
+          hunks[0].removed.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === '\\') {
+          if (diffstr[i - 1][0] === '+') {
+            remEOFNL = true;
+          } else if (diffstr[i - 1][0] === '-') {
+            addEOFNL = true;
+          }
+        }
+      }
+
+      // Apply the diff to the input
+      var lines = oldStr.split('\n');
+      for (i = hunks.length - 1; i >= 0; i--) {
+        var hunk = hunks[i];
+        // Sanity check the input string. Bail if we don't match.
+        for (var j = 0; j < hunk.oldlength; j++) {
+          if (lines[hunk.start - 1 + j] !== hunk.removed[j]) {
+            return false;
+          }
+        }
+        Array.prototype.splice.apply(lines, [hunk.start - 1, hunk.oldlength].concat(hunk.added));
+      }
+
+      // Handle EOFNL insertion/removal
+      if (remEOFNL) {
+        while (!lines[lines.length - 1]) {
+          lines.pop();
+        }
+      } else if (addEOFNL) {
+        lines.push('');
+      }
+      return lines.join('\n');
+    },
+
+    convertChangesToXML: function(changes) {
+      var ret = [];
+      for (var i = 0; i < changes.length; i++) {
+        var change = changes[i];
+        if (change.added) {
+          ret.push('');
+        } else if (change.removed) {
+          ret.push('');
+        }
+
+        ret.push(escapeHTML(change.value));
+
+        if (change.added) {
+          ret.push('');
+        } else if (change.removed) {
+          ret.push('');
+        }
+      }
+      return ret.join('');
+    },
+
+    // See: http://code.google.com/p/google-diff-match-patch/wiki/API
+    convertChangesToDMP: function(changes) {
+      var ret = [],
+          change,
+          operation;
+      for (var i = 0; i < changes.length; i++) {
+        change = changes[i];
+        if (change.added) {
+          operation = 1;
+        } else if (change.removed) {
+          operation = -1;
+        } else {
+          operation = 0;
+        }
+
+        ret.push([operation, change.value]);
+      }
+      return ret;
+    },
+
+    canonicalize: canonicalize
+  };
+
+  /*istanbul ignore next */
+  /*global module */
+  if (typeof module !== 'undefined' && module.exports) {
+    module.exports = JsDiff;
+  } else if (typeof define === 'function' && define.amd) {
+    /*global define */
+    define([], function() { return JsDiff; });
+  } else if (typeof global.JsDiff === 'undefined') {
+    global.JsDiff = JsDiff;
+  }
+}(this));
diff --git a/node_modules/diff/package.json b/node_modules/diff/package.json
new file mode 100644
index 0000000..0fc8bfa
--- /dev/null
+++ b/node_modules/diff/package.json
@@ -0,0 +1,74 @@
+{
+  "_from": "diff@1.4.0",
+  "_id": "diff@1.4.0",
+  "_inBundle": false,
+  "_integrity": "sha1-fyjS657nsVqX79ic5j3P2qPMur8=",
+  "_location": "/diff",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "diff@1.4.0",
+    "name": "diff",
+    "escapedName": "diff",
+    "rawSpec": "1.4.0",
+    "saveSpec": null,
+    "fetchSpec": "1.4.0"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/diff/-/diff-1.4.0.tgz",
+  "_shasum": "7f28d2eb9ee7b15a97efd89ce63dcfdaa3ccbabf",
+  "_spec": "diff@1.4.0",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "bugs": {
+    "url": "http://github.com/kpdecker/jsdiff/issues",
+    "email": "kpdecker@gmail.com"
+  },
+  "bundleDependencies": false,
+  "dependencies": {},
+  "deprecated": false,
+  "description": "A javascript text diff implementation.",
+  "devDependencies": {
+    "colors": "^1.1.0",
+    "istanbul": "^0.3.2",
+    "mocha": "^2.2.4",
+    "should": "^6.0.1"
+  },
+  "engines": {
+    "node": ">=0.3.1"
+  },
+  "files": [
+    "diff.js"
+  ],
+  "homepage": "https://github.com/kpdecker/jsdiff#readme",
+  "keywords": [
+    "diff",
+    "javascript"
+  ],
+  "licenses": [
+    {
+      "type": "BSD",
+      "url": "http://github.com/kpdecker/jsdiff/blob/master/LICENSE"
+    }
+  ],
+  "main": "./diff",
+  "maintainers": [
+    {
+      "name": "Kevin Decker",
+      "email": "kpdecker@gmail.com",
+      "url": "http://incaseofstairs.com"
+    }
+  ],
+  "name": "diff",
+  "optionalDependencies": {},
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/kpdecker/jsdiff.git"
+  },
+  "scripts": {
+    "test": "istanbul cover node_modules/.bin/_mocha test/*.js && istanbul check-coverage --statements 100 --functions 100 --branches 100 --lines 100 coverage/coverage.json"
+  },
+  "version": "1.4.0"
+}
diff --git a/node_modules/escape-string-regexp/index.js b/node_modules/escape-string-regexp/index.js
new file mode 100644
index 0000000..ac6572c
--- /dev/null
+++ b/node_modules/escape-string-regexp/index.js
@@ -0,0 +1,11 @@
+'use strict';
+
+var matchOperatorsRe = /[|\\{}()[\]^$+*?.]/g;
+
+module.exports = function (str) {
+	if (typeof str !== 'string') {
+		throw new TypeError('Expected a string');
+	}
+
+	return str.replace(matchOperatorsRe,  '\\$&');
+};
diff --git a/node_modules/escape-string-regexp/package.json b/node_modules/escape-string-regexp/package.json
new file mode 100644
index 0000000..873b06f
--- /dev/null
+++ b/node_modules/escape-string-regexp/package.json
@@ -0,0 +1,68 @@
+{
+  "_from": "escape-string-regexp@1.0.2",
+  "_id": "escape-string-regexp@1.0.2",
+  "_inBundle": false,
+  "_integrity": "sha1-Tbwv5nTnGUnK8/smlc5/LcHZqNE=",
+  "_location": "/escape-string-regexp",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "escape-string-regexp@1.0.2",
+    "name": "escape-string-regexp",
+    "escapedName": "escape-string-regexp",
+    "rawSpec": "1.0.2",
+    "saveSpec": null,
+    "fetchSpec": "1.0.2"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.2.tgz",
+  "_shasum": "4dbc2fe674e71949caf3fb2695ce7f2dc1d9a8d1",
+  "_spec": "escape-string-regexp@1.0.2",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "Sindre Sorhus",
+    "email": "sindresorhus@gmail.com",
+    "url": "http://sindresorhus.com"
+  },
+  "bugs": {
+    "url": "https://github.com/sindresorhus/escape-string-regexp/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "Escape RegExp special characters",
+  "devDependencies": {
+    "mocha": "*"
+  },
+  "engines": {
+    "node": ">=0.8.0"
+  },
+  "files": [
+    "index.js"
+  ],
+  "homepage": "https://github.com/sindresorhus/escape-string-regexp#readme",
+  "keywords": [
+    "regex",
+    "regexp",
+    "re",
+    "regular",
+    "expression",
+    "escape",
+    "string",
+    "str",
+    "special",
+    "characters"
+  ],
+  "license": "MIT",
+  "name": "escape-string-regexp",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/sindresorhus/escape-string-regexp.git"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "version": "1.0.2"
+}
diff --git a/node_modules/escape-string-regexp/readme.md b/node_modules/escape-string-regexp/readme.md
new file mode 100644
index 0000000..808a963
--- /dev/null
+++ b/node_modules/escape-string-regexp/readme.md
@@ -0,0 +1,27 @@
+# escape-string-regexp [![Build Status](https://travis-ci.org/sindresorhus/escape-string-regexp.svg?branch=master)](https://travis-ci.org/sindresorhus/escape-string-regexp)
+
+> Escape RegExp special characters
+
+
+## Install
+
+```sh
+$ npm install --save escape-string-regexp
+```
+
+
+## Usage
+
+```js
+var escapeStringRegexp = require('escape-string-regexp');
+
+var escapedString = escapeStringRegexp('how much $ for a unicorn?');
+//=> how much \$ for a unicorn\?
+
+new RegExp(escapedString);
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/node_modules/glob/.npmignore b/node_modules/glob/.npmignore
new file mode 100644
index 0000000..2af4b71
--- /dev/null
+++ b/node_modules/glob/.npmignore
@@ -0,0 +1,2 @@
+.*.swp
+test/a/
diff --git a/node_modules/glob/.travis.yml b/node_modules/glob/.travis.yml
new file mode 100644
index 0000000..baa0031
--- /dev/null
+++ b/node_modules/glob/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+  - 0.8
diff --git a/node_modules/glob/LICENSE b/node_modules/glob/LICENSE
new file mode 100644
index 0000000..0c44ae7
--- /dev/null
+++ b/node_modules/glob/LICENSE
@@ -0,0 +1,27 @@
+Copyright (c) Isaac Z. Schlueter ("Author")
+All rights reserved.
+
+The BSD License
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+
+1. Redistributions of source code must retain the above copyright
+   notice, this list of conditions and the following disclaimer.
+
+2. Redistributions in binary form must reproduce the above copyright
+   notice, this list of conditions and the following disclaimer in the
+   documentation and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE ARE DISCLAIMED.  IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS
+BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR
+BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE
+OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN
+IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/glob/README.md b/node_modules/glob/README.md
new file mode 100644
index 0000000..cc69164
--- /dev/null
+++ b/node_modules/glob/README.md
@@ -0,0 +1,250 @@
+# Glob
+
+Match files using the patterns the shell uses, like stars and stuff.
+
+This is a glob implementation in JavaScript.  It uses the `minimatch`
+library to do its matching.
+
+## Attention: node-glob users!
+
+The API has changed dramatically between 2.x and 3.x. This library is
+now 100% JavaScript, and the integer flags have been replaced with an
+options object.
+
+Also, there's an event emitter class, proper tests, and all the other
+things you've come to expect from node modules.
+
+And best of all, no compilation!
+
+## Usage
+
+```javascript
+var glob = require("glob")
+
+// options is optional
+glob("**/*.js", options, function (er, files) {
+  // files is an array of filenames.
+  // If the `nonull` option is set, and nothing
+  // was found, then files is ["**/*.js"]
+  // er is an error object or null.
+})
+```
+
+## Features
+
+Please see the [minimatch
+documentation](https://github.com/isaacs/minimatch) for more details.
+
+Supports these glob features:
+
+* Brace Expansion
+* Extended glob matching
+* "Globstar" `**` matching
+
+See:
+
+* `man sh`
+* `man bash`
+* `man 3 fnmatch`
+* `man 5 gitignore`
+* [minimatch documentation](https://github.com/isaacs/minimatch)
+
+## glob(pattern, [options], cb)
+
+* `pattern` {String} Pattern to be matched
+* `options` {Object}
+* `cb` {Function}
+  * `err` {Error | null}
+  * `matches` {Array} filenames found matching the pattern
+
+Perform an asynchronous glob search.
+
+## glob.sync(pattern, [options])
+
+* `pattern` {String} Pattern to be matched
+* `options` {Object}
+* return: {Array} filenames found matching the pattern
+
+Perform a synchronous glob search.
+
+## Class: glob.Glob
+
+Create a Glob object by instanting the `glob.Glob` class.
+
+```javascript
+var Glob = require("glob").Glob
+var mg = new Glob(pattern, options, cb)
+```
+
+It's an EventEmitter, and starts walking the filesystem to find matches
+immediately.
+
+### new glob.Glob(pattern, [options], [cb])
+
+* `pattern` {String} pattern to search for
+* `options` {Object}
+* `cb` {Function} Called when an error occurs, or matches are found
+  * `err` {Error | null}
+  * `matches` {Array} filenames found matching the pattern
+
+Note that if the `sync` flag is set in the options, then matches will
+be immediately available on the `g.found` member.
+
+### Properties
+
+* `minimatch` The minimatch object that the glob uses.
+* `options` The options object passed in.
+* `error` The error encountered.  When an error is encountered, the
+  glob object is in an undefined state, and should be discarded.
+* `aborted` Boolean which is set to true when calling `abort()`.  There
+  is no way at this time to continue a glob search after aborting, but
+  you can re-use the statCache to avoid having to duplicate syscalls.
+* `statCache` Collection of all the stat results the glob search
+  performed.
+* `cache` Convenience object.  Each field has the following possible
+  values:
+  * `false` - Path does not exist
+  * `true` - Path exists
+  * `1` - Path exists, and is not a directory
+  * `2` - Path exists, and is a directory
+  * `[file, entries, ...]` - Path exists, is a directory, and the
+    array value is the results of `fs.readdir`
+
+### Events
+
+* `end` When the matching is finished, this is emitted with all the
+  matches found.  If the `nonull` option is set, and no match was found,
+  then the `matches` list contains the original pattern.  The matches
+  are sorted, unless the `nosort` flag is set.
+* `match` Every time a match is found, this is emitted with the matched.
+* `error` Emitted when an unexpected error is encountered, or whenever
+  any fs error occurs if `options.strict` is set.
+* `abort` When `abort()` is called, this event is raised.
+
+### Methods
+
+* `abort` Stop the search.
+
+### Options
+
+All the options that can be passed to Minimatch can also be passed to
+Glob to change pattern matching behavior.  Also, some have been added,
+or have glob-specific ramifications.
+
+All options are false by default, unless otherwise noted.
+
+All options are added to the glob object, as well.
+
+* `cwd` The current working directory in which to search.  Defaults
+  to `process.cwd()`.
+* `root` The place where patterns starting with `/` will be mounted
+  onto.  Defaults to `path.resolve(options.cwd, "/")` (`/` on Unix
+  systems, and `C:\` or some such on Windows.)
+* `dot` Include `.dot` files in normal matches and `globstar` matches.
+  Note that an explicit dot in a portion of the pattern will always
+  match dot files.
+* `nomount` By default, a pattern starting with a forward-slash will be
+  "mounted" onto the root setting, so that a valid filesystem path is
+  returned.  Set this flag to disable that behavior.
+* `mark` Add a `/` character to directory matches.  Note that this
+  requires additional stat calls.
+* `nosort` Don't sort the results.
+* `stat` Set to true to stat *all* results.  This reduces performance
+  somewhat, and is completely unnecessary, unless `readdir` is presumed
+  to be an untrustworthy indicator of file existence.  It will cause
+  ELOOP to be triggered one level sooner in the case of cyclical
+  symbolic links.
+* `silent` When an unusual error is encountered
+  when attempting to read a directory, a warning will be printed to
+  stderr.  Set the `silent` option to true to suppress these warnings.
+* `strict` When an unusual error is encountered
+  when attempting to read a directory, the process will just continue on
+  in search of other matches.  Set the `strict` option to raise an error
+  in these cases.
+* `cache` See `cache` property above.  Pass in a previously generated
+  cache object to save some fs calls.
+* `statCache` A cache of results of filesystem information, to prevent
+  unnecessary stat calls.  While it should not normally be necessary to
+  set this, you may pass the statCache from one glob() call to the
+  options object of another, if you know that the filesystem will not
+  change between calls.  (See "Race Conditions" below.)
+* `sync` Perform a synchronous glob search.
+* `nounique` In some cases, brace-expanded patterns can result in the
+  same file showing up multiple times in the result set.  By default,
+  this implementation prevents duplicates in the result set.
+  Set this flag to disable that behavior.
+* `nonull` Set to never return an empty set, instead returning a set
+  containing the pattern itself.  This is the default in glob(3).
+* `nocase` Perform a case-insensitive match.  Note that case-insensitive
+  filesystems will sometimes result in glob returning results that are
+  case-insensitively matched anyway, since readdir and stat will not
+  raise an error.
+* `debug` Set to enable debug logging in minimatch and glob.
+* `globDebug` Set to enable debug logging in glob, but not minimatch.
+
+## Comparisons to other fnmatch/glob implementations
+
+While strict compliance with the existing standards is a worthwhile
+goal, some discrepancies exist between node-glob and other
+implementations, and are intentional.
+
+If the pattern starts with a `!` character, then it is negated.  Set the
+`nonegate` flag to suppress this behavior, and treat leading `!`
+characters normally.  This is perhaps relevant if you wish to start the
+pattern with a negative extglob pattern like `!(a|B)`.  Multiple `!`
+characters at the start of a pattern will negate the pattern multiple
+times.
+
+If a pattern starts with `#`, then it is treated as a comment, and
+will not match anything.  Use `\#` to match a literal `#` at the
+start of a line, or set the `nocomment` flag to suppress this behavior.
+
+The double-star character `**` is supported by default, unless the
+`noglobstar` flag is set.  This is supported in the manner of bsdglob
+and bash 4.1, where `**` only has special significance if it is the only
+thing in a path part.  That is, `a/**/b` will match `a/x/y/b`, but
+`a/**b` will not.
+
+If an escaped pattern has no matches, and the `nonull` flag is set,
+then glob returns the pattern as-provided, rather than
+interpreting the character escapes.  For example,
+`glob.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than
+`"*a?"`.  This is akin to setting the `nullglob` option in bash, except
+that it does not resolve escaped pattern characters.
+
+If brace expansion is not disabled, then it is performed before any
+other interpretation of the glob pattern.  Thus, a pattern like
+`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded
+**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are
+checked for validity.  Since those two are valid, matching proceeds.
+
+## Windows
+
+**Please only use forward-slashes in glob expressions.**
+
+Though windows uses either `/` or `\` as its path separator, only `/`
+characters are used by this glob implementation.  You must use
+forward-slashes **only** in glob expressions.  Back-slashes will always
+be interpreted as escape characters, not path separators.
+
+Results from absolute patterns such as `/foo/*` are mounted onto the
+root setting using `path.join`.  On windows, this will by default result
+in `/foo/*` matching `C:\foo\bar.txt`.
+
+## Race Conditions
+
+Glob searching, by its very nature, is susceptible to race conditions,
+since it relies on directory walking and such.
+
+As a result, it is possible that a file that exists when glob looks for
+it may have been deleted or modified by the time it returns the result.
+
+As part of its internal implementation, this program caches all stat
+and readdir calls that it makes, in order to cut down on system
+overhead.  However, this also makes it even more susceptible to races,
+especially if the cache or statCache objects are reused between glob
+calls.
+
+Users are thus advised not to use a glob result as a guarantee of
+filesystem state in the face of rapid changes.  For the vast majority
+of operations, this is never a problem.
diff --git a/node_modules/glob/examples/g.js b/node_modules/glob/examples/g.js
new file mode 100644
index 0000000..be122df
--- /dev/null
+++ b/node_modules/glob/examples/g.js
@@ -0,0 +1,9 @@
+var Glob = require("../").Glob
+
+var pattern = "test/a/**/[cg]/../[cg]"
+console.log(pattern)
+
+var mg = new Glob(pattern, {mark: true, sync:true}, function (er, matches) {
+  console.log("matches", matches)
+})
+console.log("after")
diff --git a/node_modules/glob/examples/usr-local.js b/node_modules/glob/examples/usr-local.js
new file mode 100644
index 0000000..327a425
--- /dev/null
+++ b/node_modules/glob/examples/usr-local.js
@@ -0,0 +1,9 @@
+var Glob = require("../").Glob
+
+var pattern = "{./*/*,/*,/usr/local/*}"
+console.log(pattern)
+
+var mg = new Glob(pattern, {mark: true}, function (er, matches) {
+  console.log("matches", matches)
+})
+console.log("after")
diff --git a/node_modules/glob/glob.js b/node_modules/glob/glob.js
new file mode 100644
index 0000000..f646c44
--- /dev/null
+++ b/node_modules/glob/glob.js
@@ -0,0 +1,728 @@
+// Approach:
+//
+// 1. Get the minimatch set
+// 2. For each pattern in the set, PROCESS(pattern)
+// 3. Store matches per-set, then uniq them
+//
+// PROCESS(pattern)
+// Get the first [n] items from pattern that are all strings
+// Join these together.  This is PREFIX.
+//   If there is no more remaining, then stat(PREFIX) and
+//   add to matches if it succeeds.  END.
+// readdir(PREFIX) as ENTRIES
+//   If fails, END
+//   If pattern[n] is GLOBSTAR
+//     // handle the case where the globstar match is empty
+//     // by pruning it out, and testing the resulting pattern
+//     PROCESS(pattern[0..n] + pattern[n+1 .. $])
+//     // handle other cases.
+//     for ENTRY in ENTRIES (not dotfiles)
+//       // attach globstar + tail onto the entry
+//       PROCESS(pattern[0..n] + ENTRY + pattern[n .. $])
+//
+//   else // not globstar
+//     for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot)
+//       Test ENTRY against pattern[n]
+//       If fails, continue
+//       If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $])
+//
+// Caveat:
+//   Cache all stats and readdirs results to minimize syscall.  Since all
+//   we ever care about is existence and directory-ness, we can just keep
+//   `true` for files, and [children,...] for directories, or `false` for
+//   things that don't exist.
+
+
+
+module.exports = glob
+
+var fs = require("fs")
+, minimatch = require("minimatch")
+, Minimatch = minimatch.Minimatch
+, inherits = require("inherits")
+, EE = require("events").EventEmitter
+, path = require("path")
+, isDir = {}
+, assert = require("assert").ok
+
+function glob (pattern, options, cb) {
+  if (typeof options === "function") cb = options, options = {}
+  if (!options) options = {}
+
+  if (typeof options === "number") {
+    deprecated()
+    return
+  }
+
+  var g = new Glob(pattern, options, cb)
+  return g.sync ? g.found : g
+}
+
+glob.fnmatch = deprecated
+
+function deprecated () {
+  throw new Error("glob's interface has changed. Please see the docs.")
+}
+
+glob.sync = globSync
+function globSync (pattern, options) {
+  if (typeof options === "number") {
+    deprecated()
+    return
+  }
+
+  options = options || {}
+  options.sync = true
+  return glob(pattern, options)
+}
+
+this._processingEmitQueue = false
+
+glob.Glob = Glob
+inherits(Glob, EE)
+function Glob (pattern, options, cb) {
+  if (!(this instanceof Glob)) {
+    return new Glob(pattern, options, cb)
+  }
+
+  if (typeof options === "function") {
+    cb = options
+    options = null
+  }
+
+  if (typeof cb === "function") {
+    this.on("error", cb)
+    this.on("end", function (matches) {
+      cb(null, matches)
+    })
+  }
+
+  options = options || {}
+
+  this._endEmitted = false
+  this.EOF = {}
+  this._emitQueue = []
+
+  this.paused = false
+  this._processingEmitQueue = false
+
+  this.maxDepth = options.maxDepth || 1000
+  this.maxLength = options.maxLength || Infinity
+  this.cache = options.cache || {}
+  this.statCache = options.statCache || {}
+
+  this.changedCwd = false
+  var cwd = process.cwd()
+  if (!options.hasOwnProperty("cwd")) this.cwd = cwd
+  else {
+    this.cwd = options.cwd
+    this.changedCwd = path.resolve(options.cwd) !== cwd
+  }
+
+  this.root = options.root || path.resolve(this.cwd, "/")
+  this.root = path.resolve(this.root)
+  if (process.platform === "win32")
+    this.root = this.root.replace(/\\/g, "/")
+
+  this.nomount = !!options.nomount
+
+  if (!pattern) {
+    throw new Error("must provide pattern")
+  }
+
+  // base-matching: just use globstar for that.
+  if (options.matchBase && -1 === pattern.indexOf("/")) {
+    if (options.noglobstar) {
+      throw new Error("base matching requires globstar")
+    }
+    pattern = "**/" + pattern
+  }
+
+  this.strict = options.strict !== false
+  this.dot = !!options.dot
+  this.mark = !!options.mark
+  this.sync = !!options.sync
+  this.nounique = !!options.nounique
+  this.nonull = !!options.nonull
+  this.nosort = !!options.nosort
+  this.nocase = !!options.nocase
+  this.stat = !!options.stat
+
+  this.debug = !!options.debug || !!options.globDebug
+  if (this.debug)
+    this.log = console.error
+
+  this.silent = !!options.silent
+
+  var mm = this.minimatch = new Minimatch(pattern, options)
+  this.options = mm.options
+  pattern = this.pattern = mm.pattern
+
+  this.error = null
+  this.aborted = false
+
+  // list of all the patterns that ** has resolved do, so
+  // we can avoid visiting multiple times.
+  this._globstars = {}
+
+  EE.call(this)
+
+  // process each pattern in the minimatch set
+  var n = this.minimatch.set.length
+
+  // The matches are stored as {: true,...} so that
+  // duplicates are automagically pruned.
+  // Later, we do an Object.keys() on these.
+  // Keep them as a list so we can fill in when nonull is set.
+  this.matches = new Array(n)
+
+  this.minimatch.set.forEach(iterator.bind(this))
+  function iterator (pattern, i, set) {
+    this._process(pattern, 0, i, function (er) {
+      if (er) this.emit("error", er)
+      if (-- n <= 0) this._finish()
+    })
+  }
+}
+
+Glob.prototype.log = function () {}
+
+Glob.prototype._finish = function () {
+  assert(this instanceof Glob)
+
+  var nou = this.nounique
+  , all = nou ? [] : {}
+
+  for (var i = 0, l = this.matches.length; i < l; i ++) {
+    var matches = this.matches[i]
+    this.log("matches[%d] =", i, matches)
+    // do like the shell, and spit out the literal glob
+    if (!matches) {
+      if (this.nonull) {
+        var literal = this.minimatch.globSet[i]
+        if (nou) all.push(literal)
+        else all[literal] = true
+      }
+    } else {
+      // had matches
+      var m = Object.keys(matches)
+      if (nou) all.push.apply(all, m)
+      else m.forEach(function (m) {
+        all[m] = true
+      })
+    }
+  }
+
+  if (!nou) all = Object.keys(all)
+
+  if (!this.nosort) {
+    all = all.sort(this.nocase ? alphasorti : alphasort)
+  }
+
+  if (this.mark) {
+    // at *some* point we statted all of these
+    all = all.map(this._mark, this)
+  }
+
+  this.log("emitting end", all)
+
+  this.EOF = this.found = all
+  this.emitMatch(this.EOF)
+}
+
+function alphasorti (a, b) {
+  a = a.toLowerCase()
+  b = b.toLowerCase()
+  return alphasort(a, b)
+}
+
+function alphasort (a, b) {
+  return a > b ? 1 : a < b ? -1 : 0
+}
+
+Glob.prototype._mark = function (p) {
+  var c = this.cache[p]
+  var m = p
+  if (c) {
+    var isDir = c === 2 || Array.isArray(c)
+    var slash = p.slice(-1) === '/'
+
+    if (isDir && !slash)
+      m += '/'
+    else if (!isDir && slash)
+      m = m.slice(0, -1)
+
+    if (m !== p) {
+      this.statCache[m] = this.statCache[p]
+      this.cache[m] = this.cache[p]
+    }
+  }
+
+  return m
+}
+
+Glob.prototype.abort = function () {
+  this.aborted = true
+  this.emit("abort")
+}
+
+Glob.prototype.pause = function () {
+  if (this.paused) return
+  if (this.sync)
+    this.emit("error", new Error("Can't pause/resume sync glob"))
+  this.paused = true
+  this.emit("pause")
+}
+
+Glob.prototype.resume = function () {
+  if (!this.paused) return
+  if (this.sync)
+    this.emit("error", new Error("Can't pause/resume sync glob"))
+  this.paused = false
+  this.emit("resume")
+  this._processEmitQueue()
+  //process.nextTick(this.emit.bind(this, "resume"))
+}
+
+Glob.prototype.emitMatch = function (m) {
+  this.log('emitMatch', m)
+  this._emitQueue.push(m)
+  this._processEmitQueue()
+}
+
+Glob.prototype._processEmitQueue = function (m) {
+  this.log("pEQ paused=%j processing=%j m=%j", this.paused,
+           this._processingEmitQueue, m)
+  var done = false
+  while (!this._processingEmitQueue &&
+         !this.paused) {
+    this._processingEmitQueue = true
+    var m = this._emitQueue.shift()
+    this.log(">processEmitQueue", m === this.EOF ? ":EOF:" : m)
+    if (!m) {
+      this.log(">processEmitQueue, falsey m")
+      this._processingEmitQueue = false
+      break
+    }
+
+    if (m === this.EOF || !(this.mark && !this.stat)) {
+      this.log("peq: unmarked, or eof")
+      next.call(this, 0, false)
+    } else if (this.statCache[m]) {
+      var sc = this.statCache[m]
+      var exists
+      if (sc)
+        exists = sc.isDirectory() ? 2 : 1
+      this.log("peq: stat cached")
+      next.call(this, exists, exists === 2)
+    } else {
+      this.log("peq: _stat, then next")
+      this._stat(m, next)
+    }
+
+    function next(exists, isDir) {
+      this.log("next", m, exists, isDir)
+      var ev = m === this.EOF ? "end" : "match"
+
+      // "end" can only happen once.
+      assert(!this._endEmitted)
+      if (ev === "end")
+        this._endEmitted = true
+
+      if (exists) {
+        // Doesn't mean it necessarily doesn't exist, it's possible
+        // we just didn't check because we don't care that much, or
+        // this is EOF anyway.
+        if (isDir && !m.match(/\/$/)) {
+          m = m + "/"
+        } else if (!isDir && m.match(/\/$/)) {
+          m = m.replace(/\/+$/, "")
+        }
+      }
+      this.log("emit", ev, m)
+      this.emit(ev, m)
+      this._processingEmitQueue = false
+      if (done && m !== this.EOF && !this.paused)
+        this._processEmitQueue()
+    }
+  }
+  done = true
+}
+
+Glob.prototype._process = function (pattern, depth, index, cb_) {
+  assert(this instanceof Glob)
+
+  var cb = function cb (er, res) {
+    assert(this instanceof Glob)
+    if (this.paused) {
+      if (!this._processQueue) {
+        this._processQueue = []
+        this.once("resume", function () {
+          var q = this._processQueue
+          this._processQueue = null
+          q.forEach(function (cb) { cb() })
+        })
+      }
+      this._processQueue.push(cb_.bind(this, er, res))
+    } else {
+      cb_.call(this, er, res)
+    }
+  }.bind(this)
+
+  if (this.aborted) return cb()
+
+  if (depth > this.maxDepth) return cb()
+
+  // Get the first [n] parts of pattern that are all strings.
+  var n = 0
+  while (typeof pattern[n] === "string") {
+    n ++
+  }
+  // now n is the index of the first one that is *not* a string.
+
+  // see if there's anything else
+  var prefix
+  switch (n) {
+    // if not, then this is rather simple
+    case pattern.length:
+      prefix = pattern.join("/")
+      this._stat(prefix, function (exists, isDir) {
+        // either it's there, or it isn't.
+        // nothing more to do, either way.
+        if (exists) {
+          if (prefix && isAbsolute(prefix) && !this.nomount) {
+            if (prefix.charAt(0) === "/") {
+              prefix = path.join(this.root, prefix)
+            } else {
+              prefix = path.resolve(this.root, prefix)
+            }
+          }
+
+          if (process.platform === "win32")
+            prefix = prefix.replace(/\\/g, "/")
+
+          this.matches[index] = this.matches[index] || {}
+          this.matches[index][prefix] = true
+          this.emitMatch(prefix)
+        }
+        return cb()
+      })
+      return
+
+    case 0:
+      // pattern *starts* with some non-trivial item.
+      // going to readdir(cwd), but not include the prefix in matches.
+      prefix = null
+      break
+
+    default:
+      // pattern has some string bits in the front.
+      // whatever it starts with, whether that's "absolute" like /foo/bar,
+      // or "relative" like "../baz"
+      prefix = pattern.slice(0, n)
+      prefix = prefix.join("/")
+      break
+  }
+
+  // get the list of entries.
+  var read
+  if (prefix === null) read = "."
+  else if (isAbsolute(prefix) || isAbsolute(pattern.join("/"))) {
+    if (!prefix || !isAbsolute(prefix)) {
+      prefix = path.join("/", prefix)
+    }
+    read = prefix = path.resolve(prefix)
+
+    // if (process.platform === "win32")
+    //   read = prefix = prefix.replace(/^[a-zA-Z]:|\\/g, "/")
+
+    this.log('absolute: ', prefix, this.root, pattern, read)
+  } else {
+    read = prefix
+  }
+
+  this.log('readdir(%j)', read, this.cwd, this.root)
+
+  return this._readdir(read, function (er, entries) {
+    if (er) {
+      // not a directory!
+      // this means that, whatever else comes after this, it can never match
+      return cb()
+    }
+
+    // globstar is special
+    if (pattern[n] === minimatch.GLOBSTAR) {
+      // test without the globstar, and with every child both below
+      // and replacing the globstar.
+      var s = [ pattern.slice(0, n).concat(pattern.slice(n + 1)) ]
+      entries.forEach(function (e) {
+        if (e.charAt(0) === "." && !this.dot) return
+        // instead of the globstar
+        s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1)))
+        // below the globstar
+        s.push(pattern.slice(0, n).concat(e).concat(pattern.slice(n)))
+      }, this)
+
+      s = s.filter(function (pattern) {
+        var key = gsKey(pattern)
+        var seen = !this._globstars[key]
+        this._globstars[key] = true
+        return seen
+      }, this)
+
+      if (!s.length)
+        return cb()
+
+      // now asyncForEach over this
+      var l = s.length
+      , errState = null
+      s.forEach(function (gsPattern) {
+        this._process(gsPattern, depth + 1, index, function (er) {
+          if (errState) return
+          if (er) return cb(errState = er)
+          if (--l <= 0) return cb()
+        })
+      }, this)
+
+      return
+    }
+
+    // not a globstar
+    // It will only match dot entries if it starts with a dot, or if
+    // dot is set.  Stuff like @(.foo|.bar) isn't allowed.
+    var pn = pattern[n]
+    var rawGlob = pattern[n]._glob
+    , dotOk = this.dot || rawGlob.charAt(0) === "."
+
+    entries = entries.filter(function (e) {
+      return (e.charAt(0) !== "." || dotOk) &&
+             e.match(pattern[n])
+    })
+
+    // If n === pattern.length - 1, then there's no need for the extra stat
+    // *unless* the user has specified "mark" or "stat" explicitly.
+    // We know that they exist, since the readdir returned them.
+    if (n === pattern.length - 1 &&
+        !this.mark &&
+        !this.stat) {
+      entries.forEach(function (e) {
+        if (prefix) {
+          if (prefix !== "/") e = prefix + "/" + e
+          else e = prefix + e
+        }
+        if (e.charAt(0) === "/" && !this.nomount) {
+          e = path.join(this.root, e)
+        }
+
+        if (process.platform === "win32")
+          e = e.replace(/\\/g, "/")
+
+        this.matches[index] = this.matches[index] || {}
+        this.matches[index][e] = true
+        this.emitMatch(e)
+      }, this)
+      return cb.call(this)
+    }
+
+
+    // now test all the remaining entries as stand-ins for that part
+    // of the pattern.
+    var l = entries.length
+    , errState = null
+    if (l === 0) return cb() // no matches possible
+    entries.forEach(function (e) {
+      var p = pattern.slice(0, n).concat(e).concat(pattern.slice(n + 1))
+      this._process(p, depth + 1, index, function (er) {
+        if (errState) return
+        if (er) return cb(errState = er)
+        if (--l === 0) return cb.call(this)
+      })
+    }, this)
+  })
+
+}
+
+function gsKey (pattern) {
+  return '**' + pattern.map(function (p) {
+    return (p === minimatch.GLOBSTAR) ? '**' : (''+p)
+  }).join('/')
+}
+
+Glob.prototype._stat = function (f, cb) {
+  assert(this instanceof Glob)
+  var abs = f
+  if (f.charAt(0) === "/") {
+    abs = path.join(this.root, f)
+  } else if (this.changedCwd) {
+    abs = path.resolve(this.cwd, f)
+  }
+
+  if (f.length > this.maxLength) {
+    var er = new Error("Path name too long")
+    er.code = "ENAMETOOLONG"
+    er.path = f
+    return this._afterStat(f, abs, cb, er)
+  }
+
+  this.log('stat', [this.cwd, f, '=', abs])
+
+  if (!this.stat && this.cache.hasOwnProperty(f)) {
+    var exists = this.cache[f]
+    , isDir = exists && (Array.isArray(exists) || exists === 2)
+    if (this.sync) return cb.call(this, !!exists, isDir)
+    return process.nextTick(cb.bind(this, !!exists, isDir))
+  }
+
+  var stat = this.statCache[abs]
+  if (this.sync || stat) {
+    var er
+    try {
+      stat = fs.statSync(abs)
+    } catch (e) {
+      er = e
+    }
+    this._afterStat(f, abs, cb, er, stat)
+  } else {
+    fs.stat(abs, this._afterStat.bind(this, f, abs, cb))
+  }
+}
+
+Glob.prototype._afterStat = function (f, abs, cb, er, stat) {
+  var exists
+  assert(this instanceof Glob)
+
+  if (abs.slice(-1) === "/" && stat && !stat.isDirectory()) {
+    this.log("should be ENOTDIR, fake it")
+
+    er = new Error("ENOTDIR, not a directory '" + abs + "'")
+    er.path = abs
+    er.code = "ENOTDIR"
+    stat = null
+  }
+
+  var emit = !this.statCache[abs]
+  this.statCache[abs] = stat
+
+  if (er || !stat) {
+    exists = false
+  } else {
+    exists = stat.isDirectory() ? 2 : 1
+    if (emit)
+      this.emit('stat', f, stat)
+  }
+  this.cache[f] = this.cache[f] || exists
+  cb.call(this, !!exists, exists === 2)
+}
+
+Glob.prototype._readdir = function (f, cb) {
+  assert(this instanceof Glob)
+  var abs = f
+  if (f.charAt(0) === "/") {
+    abs = path.join(this.root, f)
+  } else if (isAbsolute(f)) {
+    abs = f
+  } else if (this.changedCwd) {
+    abs = path.resolve(this.cwd, f)
+  }
+
+  if (f.length > this.maxLength) {
+    var er = new Error("Path name too long")
+    er.code = "ENAMETOOLONG"
+    er.path = f
+    return this._afterReaddir(f, abs, cb, er)
+  }
+
+  this.log('readdir', [this.cwd, f, abs])
+  if (this.cache.hasOwnProperty(f)) {
+    var c = this.cache[f]
+    if (Array.isArray(c)) {
+      if (this.sync) return cb.call(this, null, c)
+      return process.nextTick(cb.bind(this, null, c))
+    }
+
+    if (!c || c === 1) {
+      // either ENOENT or ENOTDIR
+      var code = c ? "ENOTDIR" : "ENOENT"
+      , er = new Error((c ? "Not a directory" : "Not found") + ": " + f)
+      er.path = f
+      er.code = code
+      this.log(f, er)
+      if (this.sync) return cb.call(this, er)
+      return process.nextTick(cb.bind(this, er))
+    }
+
+    // at this point, c === 2, meaning it's a dir, but we haven't
+    // had to read it yet, or c === true, meaning it's *something*
+    // but we don't have any idea what.  Need to read it, either way.
+  }
+
+  if (this.sync) {
+    var er, entries
+    try {
+      entries = fs.readdirSync(abs)
+    } catch (e) {
+      er = e
+    }
+    return this._afterReaddir(f, abs, cb, er, entries)
+  }
+
+  fs.readdir(abs, this._afterReaddir.bind(this, f, abs, cb))
+}
+
+Glob.prototype._afterReaddir = function (f, abs, cb, er, entries) {
+  assert(this instanceof Glob)
+  if (entries && !er) {
+    this.cache[f] = entries
+    // if we haven't asked to stat everything for suresies, then just
+    // assume that everything in there exists, so we can avoid
+    // having to stat it a second time.  This also gets us one step
+    // further into ELOOP territory.
+    if (!this.mark && !this.stat) {
+      entries.forEach(function (e) {
+        if (f === "/") e = f + e
+        else e = f + "/" + e
+        this.cache[e] = true
+      }, this)
+    }
+
+    return cb.call(this, er, entries)
+  }
+
+  // now handle errors, and cache the information
+  if (er) switch (er.code) {
+    case "ENOTDIR": // totally normal. means it *does* exist.
+      this.cache[f] = 1
+      return cb.call(this, er)
+    case "ENOENT": // not terribly unusual
+    case "ELOOP":
+    case "ENAMETOOLONG":
+    case "UNKNOWN":
+      this.cache[f] = false
+      return cb.call(this, er)
+    default: // some unusual error.  Treat as failure.
+      this.cache[f] = false
+      if (this.strict) this.emit("error", er)
+      if (!this.silent) console.error("glob error", er)
+      return cb.call(this, er)
+  }
+}
+
+var isAbsolute = process.platform === "win32" ? absWin : absUnix
+
+function absWin (p) {
+  if (absUnix(p)) return true
+  // pull off the device/UNC bit from a windows path.
+  // from node's lib/path.js
+  var splitDeviceRe =
+      /^([a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/]+[^\\\/]+)?([\\\/])?([\s\S]*?)$/
+    , result = splitDeviceRe.exec(p)
+    , device = result[1] || ''
+    , isUnc = device && device.charAt(1) !== ':'
+    , isAbsolute = !!result[2] || isUnc // UNC paths are always absolute
+
+  return isAbsolute
+}
+
+function absUnix (p) {
+  return p.charAt(0) === "/" || p === ""
+}
diff --git a/node_modules/glob/package.json b/node_modules/glob/package.json
new file mode 100644
index 0000000..cb33bca
--- /dev/null
+++ b/node_modules/glob/package.json
@@ -0,0 +1,61 @@
+{
+  "_from": "glob@3.2.11",
+  "_id": "glob@3.2.11",
+  "_inBundle": false,
+  "_integrity": "sha1-Spc/Y1uRkPcV0QmH1cAP0oFevj0=",
+  "_location": "/glob",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "glob@3.2.11",
+    "name": "glob",
+    "escapedName": "glob",
+    "rawSpec": "3.2.11",
+    "saveSpec": null,
+    "fetchSpec": "3.2.11"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/glob/-/glob-3.2.11.tgz",
+  "_shasum": "4a973f635b9190f715d10987d5c00fd2815ebe3d",
+  "_spec": "glob@3.2.11",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "Isaac Z. Schlueter",
+    "email": "i@izs.me",
+    "url": "http://blog.izs.me/"
+  },
+  "bugs": {
+    "url": "https://github.com/isaacs/node-glob/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {
+    "inherits": "2",
+    "minimatch": "0.3"
+  },
+  "deprecated": false,
+  "description": "a little globber",
+  "devDependencies": {
+    "mkdirp": "0",
+    "rimraf": "1",
+    "tap": "~0.4.0"
+  },
+  "engines": {
+    "node": "*"
+  },
+  "homepage": "https://github.com/isaacs/node-glob#readme",
+  "license": "BSD",
+  "main": "glob.js",
+  "name": "glob",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/isaacs/node-glob.git"
+  },
+  "scripts": {
+    "test": "tap test/*.js",
+    "test-regen": "TEST_REGEN=1 node test/00-setup.js"
+  },
+  "version": "3.2.11"
+}
diff --git a/node_modules/glob/test/00-setup.js b/node_modules/glob/test/00-setup.js
new file mode 100644
index 0000000..245afaf
--- /dev/null
+++ b/node_modules/glob/test/00-setup.js
@@ -0,0 +1,176 @@
+// just a little pre-run script to set up the fixtures.
+// zz-finish cleans it up
+
+var mkdirp = require("mkdirp")
+var path = require("path")
+var i = 0
+var tap = require("tap")
+var fs = require("fs")
+var rimraf = require("rimraf")
+
+var files =
+[ "a/.abcdef/x/y/z/a"
+, "a/abcdef/g/h"
+, "a/abcfed/g/h"
+, "a/b/c/d"
+, "a/bc/e/f"
+, "a/c/d/c/b"
+, "a/cb/e/f"
+]
+
+var symlinkTo = path.resolve(__dirname, "a/symlink/a/b/c")
+var symlinkFrom = "../.."
+
+files = files.map(function (f) {
+  return path.resolve(__dirname, f)
+})
+
+tap.test("remove fixtures", function (t) {
+  rimraf(path.resolve(__dirname, "a"), function (er) {
+    t.ifError(er, "remove fixtures")
+    t.end()
+  })
+})
+
+files.forEach(function (f) {
+  tap.test(f, function (t) {
+    var d = path.dirname(f)
+    mkdirp(d, 0755, function (er) {
+      if (er) {
+        t.fail(er)
+        return t.bailout()
+      }
+      fs.writeFile(f, "i like tests", function (er) {
+        t.ifError(er, "make file")
+        t.end()
+      })
+    })
+  })
+})
+
+if (process.platform !== "win32") {
+  tap.test("symlinky", function (t) {
+    var d = path.dirname(symlinkTo)
+    console.error("mkdirp", d)
+    mkdirp(d, 0755, function (er) {
+      t.ifError(er)
+      fs.symlink(symlinkFrom, symlinkTo, "dir", function (er) {
+        t.ifError(er, "make symlink")
+        t.end()
+      })
+    })
+  })
+}
+
+;["foo","bar","baz","asdf","quux","qwer","rewq"].forEach(function (w) {
+  w = "/tmp/glob-test/" + w
+  tap.test("create " + w, function (t) {
+    mkdirp(w, function (er) {
+      if (er)
+        throw er
+      t.pass(w)
+      t.end()
+    })
+  })
+})
+
+
+// generate the bash pattern test-fixtures if possible
+if (process.platform === "win32" || !process.env.TEST_REGEN) {
+  console.error("Windows, or TEST_REGEN unset.  Using cached fixtures.")
+  return
+}
+
+var spawn = require("child_process").spawn;
+var globs =
+  // put more patterns here.
+  // anything that would be directly in / should be in /tmp/glob-test
+  ["test/a/*/+(c|g)/./d"
+  ,"test/a/**/[cg]/../[cg]"
+  ,"test/a/{b,c,d,e,f}/**/g"
+  ,"test/a/b/**"
+  ,"test/**/g"
+  ,"test/a/abc{fed,def}/g/h"
+  ,"test/a/abc{fed/g,def}/**/"
+  ,"test/a/abc{fed/g,def}/**///**/"
+  ,"test/**/a/**/"
+  ,"test/+(a|b|c)/a{/,bc*}/**"
+  ,"test/*/*/*/f"
+  ,"test/**/f"
+  ,"test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**"
+  ,"{./*/*,/tmp/glob-test/*}"
+  ,"{/tmp/glob-test/*,*}" // evil owl face!  how you taunt me!
+  ,"test/a/!(symlink)/**"
+  ]
+var bashOutput = {}
+var fs = require("fs")
+
+globs.forEach(function (pattern) {
+  tap.test("generate fixture " + pattern, function (t) {
+    var cmd = "shopt -s globstar && " +
+              "shopt -s extglob && " +
+              "shopt -s nullglob && " +
+              // "shopt >&2; " +
+              "eval \'for i in " + pattern + "; do echo $i; done\'"
+    var cp = spawn("bash", ["-c", cmd], { cwd: path.dirname(__dirname) })
+    var out = []
+    cp.stdout.on("data", function (c) {
+      out.push(c)
+    })
+    cp.stderr.pipe(process.stderr)
+    cp.on("close", function (code) {
+      out = flatten(out)
+      if (!out)
+        out = []
+      else
+        out = cleanResults(out.split(/\r*\n/))
+
+      bashOutput[pattern] = out
+      t.notOk(code, "bash test should finish nicely")
+      t.end()
+    })
+  })
+})
+
+tap.test("save fixtures", function (t) {
+  var fname = path.resolve(__dirname, "bash-results.json")
+  var data = JSON.stringify(bashOutput, null, 2) + "\n"
+  fs.writeFile(fname, data, function (er) {
+    t.ifError(er)
+    t.end()
+  })
+})
+
+function cleanResults (m) {
+  // normalize discrepancies in ordering, duplication,
+  // and ending slashes.
+  return m.map(function (m) {
+    return m.replace(/\/+/g, "/").replace(/\/$/, "")
+  }).sort(alphasort).reduce(function (set, f) {
+    if (f !== set[set.length - 1]) set.push(f)
+    return set
+  }, []).sort(alphasort).map(function (f) {
+    // de-windows
+    return (process.platform !== 'win32') ? f
+           : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/')
+  })
+}
+
+function flatten (chunks) {
+  var s = 0
+  chunks.forEach(function (c) { s += c.length })
+  var out = new Buffer(s)
+  s = 0
+  chunks.forEach(function (c) {
+    c.copy(out, s)
+    s += c.length
+  })
+
+  return out.toString().trim()
+}
+
+function alphasort (a, b) {
+  a = a.toLowerCase()
+  b = b.toLowerCase()
+  return a > b ? 1 : a < b ? -1 : 0
+}
diff --git a/node_modules/glob/test/bash-comparison.js b/node_modules/glob/test/bash-comparison.js
new file mode 100644
index 0000000..239ed1a
--- /dev/null
+++ b/node_modules/glob/test/bash-comparison.js
@@ -0,0 +1,63 @@
+// basic test
+// show that it does the same thing by default as the shell.
+var tap = require("tap")
+, child_process = require("child_process")
+, bashResults = require("./bash-results.json")
+, globs = Object.keys(bashResults)
+, glob = require("../")
+, path = require("path")
+
+// run from the root of the project
+// this is usually where you're at anyway, but be sure.
+process.chdir(path.resolve(__dirname, ".."))
+
+function alphasort (a, b) {
+  a = a.toLowerCase()
+  b = b.toLowerCase()
+  return a > b ? 1 : a < b ? -1 : 0
+}
+
+globs.forEach(function (pattern) {
+  var expect = bashResults[pattern]
+  // anything regarding the symlink thing will fail on windows, so just skip it
+  if (process.platform === "win32" &&
+      expect.some(function (m) {
+        return /\/symlink\//.test(m)
+      }))
+    return
+
+  tap.test(pattern, function (t) {
+    glob(pattern, function (er, matches) {
+      if (er)
+        throw er
+
+      // sort and unmark, just to match the shell results
+      matches = cleanResults(matches)
+
+      t.deepEqual(matches, expect, pattern)
+      t.end()
+    })
+  })
+
+  tap.test(pattern + " sync", function (t) {
+    var matches = cleanResults(glob.sync(pattern))
+
+    t.deepEqual(matches, expect, "should match shell")
+    t.end()
+  })
+})
+
+function cleanResults (m) {
+  // normalize discrepancies in ordering, duplication,
+  // and ending slashes.
+  return m.map(function (m) {
+    return m.replace(/\/+/g, "/").replace(/\/$/, "")
+  }).sort(alphasort).reduce(function (set, f) {
+    if (f !== set[set.length - 1]) set.push(f)
+    return set
+  }, []).sort(alphasort).map(function (f) {
+    // de-windows
+    return (process.platform !== 'win32') ? f
+           : f.replace(/^[a-zA-Z]:[\/\\]+/, '/').replace(/[\\\/]+/g, '/')
+  })
+}
diff --git a/node_modules/glob/test/bash-results.json b/node_modules/glob/test/bash-results.json
new file mode 100644
index 0000000..8051c72
--- /dev/null
+++ b/node_modules/glob/test/bash-results.json
@@ -0,0 +1,351 @@
+{
+  "test/a/*/+(c|g)/./d": [
+    "test/a/b/c/./d"
+  ],
+  "test/a/**/[cg]/../[cg]": [
+    "test/a/abcdef/g/../g",
+    "test/a/abcfed/g/../g",
+    "test/a/b/c/../c",
+    "test/a/c/../c",
+    "test/a/c/d/c/../c",
+    "test/a/symlink/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/../c"
+  ],
+  "test/a/{b,c,d,e,f}/**/g": [],
+  "test/a/b/**": [
+    "test/a/b",
+    "test/a/b/c",
+    "test/a/b/c/d"
+  ],
+  "test/**/g": [
+    "test/a/abcdef/g",
+    "test/a/abcfed/g"
+  ],
+  "test/a/abc{fed,def}/g/h": [
+    "test/a/abcdef/g/h",
+    "test/a/abcfed/g/h"
+  ],
+  "test/a/abc{fed/g,def}/**/": [
+    "test/a/abcdef",
+    "test/a/abcdef/g",
+    "test/a/abcfed/g"
+  ],
+  "test/a/abc{fed/g,def}/**///**/": [
+    "test/a/abcdef",
+    "test/a/abcdef/g",
+    "test/a/abcfed/g"
+  ],
+  "test/**/a/**/": [
+    "test/a",
+    "test/a/abcdef",
+    "test/a/abcdef/g",
+    "test/a/abcfed",
+    "test/a/abcfed/g",
+    "test/a/b",
+    "test/a/b/c",
+    "test/a/bc",
+    "test/a/bc/e",
+    "test/a/c",
+    "test/a/c/d",
+    "test/a/c/d/c",
+    "test/a/cb",
+    "test/a/cb/e",
+    "test/a/symlink",
+    "test/a/symlink/a",
+    "test/a/symlink/a/b",
+    "test/a/symlink/a/b/c",
+    "test/a/symlink/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b"
+  ],
+  "test/+(a|b|c)/a{/,bc*}/**": [
+    "test/a/abcdef",
+    "test/a/abcdef/g",
+    "test/a/abcdef/g/h",
+    "test/a/abcfed",
+    "test/a/abcfed/g",
+    "test/a/abcfed/g/h"
+  ],
+  "test/*/*/*/f": [
+    "test/a/bc/e/f",
+    "test/a/cb/e/f"
+  ],
+  "test/**/f": [
+    "test/a/bc/e/f",
+    "test/a/cb/e/f"
+  ],
+  "test/a/symlink/a/b/c/a/b/c/a/b/c//a/b/c////a/b/c/**/b/c/**": [
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b",
+    "test/a/symlink/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c/a/b/c"
+  ],
+  "{./*/*,/tmp/glob-test/*}": [
+    "./examples/g.js",
+    "./examples/usr-local.js",
+    "./node_modules/inherits",
+    "./node_modules/minimatch",
+    "./node_modules/mkdirp",
+    "./node_modules/rimraf",
+    "./node_modules/tap",
+    "./test/00-setup.js",
+    "./test/a",
+    "./test/bash-comparison.js",
+    "./test/bash-results.json",
+    "./test/cwd-test.js",
+    "./test/globstar-match.js",
+    "./test/mark.js",
+    "./test/new-glob-optional-options.js",
+    "./test/nocase-nomagic.js",
+    "./test/pause-resume.js",
+    "./test/readme-issue.js",
+    "./test/root-nomount.js",
+    "./test/root.js",
+    "./test/stat.js",
+    "./test/zz-cleanup.js",
+    "/tmp/glob-test/asdf",
+    "/tmp/glob-test/bar",
+    "/tmp/glob-test/baz",
+    "/tmp/glob-test/foo",
+    "/tmp/glob-test/quux",
+    "/tmp/glob-test/qwer",
+    "/tmp/glob-test/rewq"
+  ],
+  "{/tmp/glob-test/*,*}": [
+    "/tmp/glob-test/asdf",
+    "/tmp/glob-test/bar",
+    "/tmp/glob-test/baz",
+    "/tmp/glob-test/foo",
+    "/tmp/glob-test/quux",
+    "/tmp/glob-test/qwer",
+    "/tmp/glob-test/rewq",
+    "examples",
+    "glob.js",
+    "LICENSE",
+    "node_modules",
+    "package.json",
+    "README.md",
+    "test"
+  ],
+  "test/a/!(symlink)/**": [
+    "test/a/abcdef",
+    "test/a/abcdef/g",
+    "test/a/abcdef/g/h",
+    "test/a/abcfed",
+    "test/a/abcfed/g",
+    "test/a/abcfed/g/h",
+    "test/a/b",
+    "test/a/b/c",
+    "test/a/b/c/d",
+    "test/a/bc",
+    "test/a/bc/e",
+    "test/a/bc/e/f",
+    "test/a/c",
+    "test/a/c/d",
+    "test/a/c/d/c",
+    "test/a/c/d/c/b",
+    "test/a/cb",
+    "test/a/cb/e",
+    "test/a/cb/e/f"
+  ]
+}
diff --git a/node_modules/glob/test/cwd-test.js b/node_modules/glob/test/cwd-test.js
new file mode 100644
index 0000000..352c27e
--- /dev/null
+++ b/node_modules/glob/test/cwd-test.js
@@ -0,0 +1,55 @@
+var tap = require("tap")
+
+var origCwd = process.cwd()
+process.chdir(__dirname)
+
+tap.test("changing cwd and searching for **/d", function (t) {
+  var glob = require('../')
+  var path = require('path')
+  t.test('.', function (t) {
+    glob('**/d', function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ 'a/b/c/d', 'a/c/d' ])
+      t.end()
+    })
+  })
+
+  t.test('a', function (t) {
+    glob('**/d', {cwd:path.resolve('a')}, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ 'b/c/d', 'c/d' ])
+      t.end()
+    })
+  })
+
+  t.test('a/b', function (t) {
+    glob('**/d', {cwd:path.resolve('a/b')}, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ 'c/d' ])
+      t.end()
+    })
+  })
+
+  t.test('a/b/', function (t) {
+    glob('**/d', {cwd:path.resolve('a/b/')}, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ 'c/d' ])
+      t.end()
+    })
+  })
+
+  t.test('.', function (t) {
+    glob('**/d', {cwd: process.cwd()}, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ 'a/b/c/d', 'a/c/d' ])
+      t.end()
+    })
+  })
+
+  t.test('cd -', function (t) {
+    process.chdir(origCwd)
+    t.end()
+  })
+
+  t.end()
+})
diff --git a/node_modules/glob/test/globstar-match.js b/node_modules/glob/test/globstar-match.js
new file mode 100644
index 0000000..9b234fa
--- /dev/null
+++ b/node_modules/glob/test/globstar-match.js
@@ -0,0 +1,19 @@
+var Glob = require("../glob.js").Glob
+var test = require('tap').test
+
+test('globstar should not have dupe matches', function(t) {
+  var pattern = 'a/**/[gh]'
+  var g = new Glob(pattern, { cwd: __dirname })
+  var matches = []
+  g.on('match', function(m) {
+    console.error('match %j', m)
+    matches.push(m)
+  })
+  g.on('end', function(set) {
+    console.error('set', set)
+    matches = matches.sort()
+    set = set.sort()
+    t.same(matches, set, 'should have same set of matches')
+    t.end()
+  })
+})
diff --git a/node_modules/glob/test/mark.js b/node_modules/glob/test/mark.js
new file mode 100644
index 0000000..bf411c0
--- /dev/null
+++ b/node_modules/glob/test/mark.js
@@ -0,0 +1,118 @@
+var test = require("tap").test
+var glob = require('../')
+process.chdir(__dirname)
+
+// expose timing issues
+var lag = 5
+glob.Glob.prototype._stat = function(o) { return function(f, cb) {
+  var args = arguments
+  setTimeout(function() {
+    o.call(this, f, cb)
+  }.bind(this), lag += 5)
+}}(glob.Glob.prototype._stat)
+
+
+test("mark, with **", function (t) {
+  glob("a/*b*/**", {mark: true}, function (er, results) {
+    if (er)
+      throw er
+    var expect =
+      [ 'a/abcdef/',
+        'a/abcdef/g/',
+        'a/abcdef/g/h',
+        'a/abcfed/',
+        'a/abcfed/g/',
+        'a/abcfed/g/h',
+        'a/b/',
+        'a/b/c/',
+        'a/b/c/d',
+        'a/bc/',
+        'a/bc/e/',
+        'a/bc/e/f',
+        'a/cb/',
+        'a/cb/e/',
+        'a/cb/e/f' ]
+
+    t.same(results, expect)
+    t.end()
+  })
+})
+
+test("mark, no / on pattern", function (t) {
+  glob("a/*", {mark: true}, function (er, results) {
+    if (er)
+      throw er
+    var expect = [ 'a/abcdef/',
+                   'a/abcfed/',
+                   'a/b/',
+                   'a/bc/',
+                   'a/c/',
+                   'a/cb/' ]
+
+    if (process.platform !== "win32")
+      expect.push('a/symlink/')
+
+    t.same(results, expect)
+    t.end()
+  }).on('match', function(m) {
+    t.similar(m, /\/$/)
+  })
+})
+
+test("mark=false, no / on pattern", function (t) {
+  glob("a/*", function (er, results) {
+    if (er)
+      throw er
+    var expect = [ 'a/abcdef',
+                   'a/abcfed',
+                   'a/b',
+                   'a/bc',
+                   'a/c',
+                   'a/cb' ]
+
+    if (process.platform !== "win32")
+      expect.push('a/symlink')
+    t.same(results, expect)
+    t.end()
+  }).on('match', function(m) {
+    t.similar(m, /[^\/]$/)
+  })
+})
+
+test("mark=true, / on pattern", function (t) {
+  glob("a/*/", {mark: true}, function (er, results) {
+    if (er)
+      throw er
+    var expect = [ 'a/abcdef/',
+                    'a/abcfed/',
+                    'a/b/',
+                    'a/bc/',
+                    'a/c/',
+                    'a/cb/' ]
+    if (process.platform !== "win32")
+      expect.push('a/symlink/')
+    t.same(results, expect)
+    t.end()
+  }).on('match', function(m) {
+    t.similar(m, /\/$/)
+  })
+})
+
+test("mark=false, / on pattern", function (t) {
+  glob("a/*/", function (er, results) {
+    if (er)
+      throw er
+    var expect = [ 'a/abcdef/',
+                   'a/abcfed/',
+                   'a/b/',
+                   'a/bc/',
+                   'a/c/',
+                   'a/cb/' ]
+    if (process.platform !== "win32")
+      expect.push('a/symlink/')
+    t.same(results, expect)
+    t.end()
+  }).on('match', function(m) {
+    t.similar(m, /\/$/)
+  })
+})
diff --git a/node_modules/glob/test/new-glob-optional-options.js b/node_modules/glob/test/new-glob-optional-options.js
new file mode 100644
index 0000000..3e7dc5a
--- /dev/null
+++ b/node_modules/glob/test/new-glob-optional-options.js
@@ -0,0 +1,10 @@
+var Glob = require('../glob.js').Glob;
+var test = require('tap').test;
+
+test('new glob, with cb, and no options', function (t) {
+  new Glob(__filename, function(er, results) {
+    if (er) throw er;
+    t.same(results, [__filename]);
+    t.end();
+  });
+});
diff --git a/node_modules/glob/test/nocase-nomagic.js b/node_modules/glob/test/nocase-nomagic.js
new file mode 100644
index 0000000..2503f23
--- /dev/null
+++ b/node_modules/glob/test/nocase-nomagic.js
@@ -0,0 +1,113 @@
+var fs = require('fs');
+var test = require('tap').test;
+var glob = require('../');
+
+test('mock fs', function(t) {
+  var stat = fs.stat
+  var statSync = fs.statSync
+  var readdir = fs.readdir
+  var readdirSync = fs.readdirSync
+
+  function fakeStat(path) {
+    var ret
+    switch (path.toLowerCase()) {
+      case '/tmp': case '/tmp/':
+        ret = { isDirectory: function() { return true } }
+        break
+      case '/tmp/a':
+        ret = { isDirectory: function() { return false } }
+        break
+    }
+    return ret
+  }
+
+  fs.stat = function(path, cb) {
+    var f = fakeStat(path);
+    if (f) {
+      process.nextTick(function() {
+        cb(null, f)
+      })
+    } else {
+      stat.call(fs, path, cb)
+    }
+  }
+
+  fs.statSync = function(path) {
+    return fakeStat(path) || statSync.call(fs, path)
+  }
+
+  function fakeReaddir(path) {
+    var ret
+    switch (path.toLowerCase()) {
+      case '/tmp': case '/tmp/':
+        ret = [ 'a', 'A' ]
+        break
+      case '/':
+        ret = ['tmp', 'tMp', 'tMP', 'TMP']
+    }
+    return ret
+  }
+
+  fs.readdir = function(path, cb) {
+    var f = fakeReaddir(path)
+    if (f)
+      process.nextTick(function() {
+        cb(null, f)
+      })
+    else
+      readdir.call(fs, path, cb)
+  }
+
+  fs.readdirSync = function(path) {
+    return fakeReaddir(path) || readdirSync.call(fs, path)
+  }
+
+  t.pass('mocked')
+  t.end()
+})
+
+test('nocase, nomagic', function(t) {
+  var n = 2
+  var want = [ '/TMP/A',
+               '/TMP/a',
+               '/tMP/A',
+               '/tMP/a',
+               '/tMp/A',
+               '/tMp/a',
+               '/tmp/A',
+               '/tmp/a' ]
+  glob('/tmp/a', { nocase: true }, function(er, res) {
+    if (er)
+      throw er
+    t.same(res.sort(), want)
+    if (--n === 0) t.end()
+  })
+  glob('/tmp/A', { nocase: true }, function(er, res) {
+    if (er)
+      throw er
+    t.same(res.sort(), want)
+    if (--n === 0) t.end()
+  })
+})
+
+test('nocase, with some magic', function(t) {
+  t.plan(2)
+  var want = [ '/TMP/A',
+               '/TMP/a',
+               '/tMP/A',
+               '/tMP/a',
+               '/tMp/A',
+               '/tMp/a',
+               '/tmp/A',
+               '/tmp/a' ]
+  glob('/tmp/*', { nocase: true }, function(er, res) {
+    if (er)
+      throw er
+    t.same(res.sort(), want)
+  })
+  glob('/tmp/*', { nocase: true }, function(er, res) {
+    if (er)
+      throw er
+    t.same(res.sort(), want)
+  })
+})
diff --git a/node_modules/glob/test/pause-resume.js b/node_modules/glob/test/pause-resume.js
new file mode 100644
index 0000000..e1ffbab
--- /dev/null
+++ b/node_modules/glob/test/pause-resume.js
@@ -0,0 +1,73 @@
+// show that no match events happen while paused.
+var tap = require("tap")
+, child_process = require("child_process")
+// just some gnarly pattern with lots of matches
+, pattern = "test/a/!(symlink)/**"
+, bashResults = require("./bash-results.json")
+, patterns = Object.keys(bashResults)
+, glob = require("../")
+, Glob = glob.Glob
+, path = require("path")
+
+// run from the root of the project
+// this is usually where you're at anyway, but be sure.
+process.chdir(path.resolve(__dirname, ".."))
+
+function alphasort (a, b) {
+  a = a.toLowerCase()
+  b = b.toLowerCase()
+  return a > b ? 1 : a < b ? -1 : 0
+}
+
+function cleanResults (m) {
+  // normalize discrepancies in ordering, duplication,
+  // and ending slashes.
+  return m.map(function (m) {
+    return m.replace(/\/+/g, "/").replace(/\/$/, "")
+  }).sort(alphasort).reduce(function (set, f) {
+    if (f !== set[set.length - 1]) set.push(f)
+    return set
+  }, []).sort(alphasort).map(function (f) {
+    // de-windows
+    return (process.platform !== 'win32') ? f
+           : f.replace(/^[a-zA-Z]:\\\\/, '/').replace(/\\/g, '/')
+  })
+}
+
+var globResults = []
+tap.test("use a Glob object, and pause/resume it", function (t) {
+  var g = new Glob(pattern)
+  , paused = false
+  , res = []
+  , expect = bashResults[pattern]
+
+  g.on("pause", function () {
+    console.error("pause")
+  })
+
+  g.on("resume", function () {
+    console.error("resume")
+  })
+
+  g.on("match", function (m) {
+    t.notOk(g.paused, "must not be paused")
+    globResults.push(m)
+    g.pause()
+    t.ok(g.paused, "must be paused")
+    setTimeout(g.resume.bind(g), 10)
+  })
+
+  g.on("end", function (matches) {
+    t.pass("reached glob end")
+    globResults = cleanResults(globResults)
+    matches = cleanResults(matches)
+    t.deepEqual(matches, globResults,
+      "end event matches should be the same as match events")
+
+    t.deepEqual(matches, expect,
+      "glob matches should be the same as bash results")
+
+    t.end()
+  })
+})
+
diff --git a/node_modules/glob/test/readme-issue.js b/node_modules/glob/test/readme-issue.js
new file mode 100644
index 0000000..0b4e0be
--- /dev/null
+++ b/node_modules/glob/test/readme-issue.js
@@ -0,0 +1,36 @@
+var test = require("tap").test
+var glob = require("../")
+
+var mkdirp = require("mkdirp")
+var fs = require("fs")
+var rimraf = require("rimraf")
+var dir = __dirname + "/package"
+
+test("setup", function (t) {
+  mkdirp.sync(dir)
+  fs.writeFileSync(dir + "/package.json", "{}", "ascii")
+  fs.writeFileSync(dir + "/README", "x", "ascii")
+  t.pass("setup done")
+  t.end()
+})
+
+test("glob", function (t) {
+  var opt = {
+    cwd: dir,
+    nocase: true,
+    mark: true
+  }
+
+  glob("README?(.*)", opt, function (er, files) {
+    if (er)
+      throw er
+    t.same(files, ["README"])
+    t.end()
+  })
+})
+
+test("cleanup", function (t) {
+  rimraf.sync(dir)
+  t.pass("clean")
+  t.end()
+})
diff --git a/node_modules/glob/test/root-nomount.js b/node_modules/glob/test/root-nomount.js
new file mode 100644
index 0000000..3ac5979
--- /dev/null
+++ b/node_modules/glob/test/root-nomount.js
@@ -0,0 +1,39 @@
+var tap = require("tap")
+
+var origCwd = process.cwd()
+process.chdir(__dirname)
+
+tap.test("changing root and searching for /b*/**", function (t) {
+  var glob = require('../')
+  var path = require('path')
+  t.test('.', function (t) {
+    glob('/b*/**', { globDebug: true, root: '.', nomount: true }, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [])
+      t.end()
+    })
+  })
+
+  t.test('a', function (t) {
+    glob('/b*/**', { globDebug: true, root: path.resolve('a'), nomount: true }, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ])
+      t.end()
+    })
+  })
+
+  t.test('root=a, cwd=a/b', function (t) {
+    glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b'), nomount: true }, function (er, matches) {
+      t.ifError(er)
+      t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ])
+      t.end()
+    })
+  })
+
+  t.test('cd -', function (t) {
+    process.chdir(origCwd)
+    t.end()
+  })
+
+  t.end()
+})
diff --git a/node_modules/glob/test/root.js b/node_modules/glob/test/root.js
new file mode 100644
index 0000000..95c23f9
--- /dev/null
+++ b/node_modules/glob/test/root.js
@@ -0,0 +1,46 @@
+var t = require("tap")
+
+var origCwd = process.cwd()
+process.chdir(__dirname)
+
+var glob = require('../')
+var path = require('path')
+
+t.test('.', function (t) {
+  glob('/b*/**', { globDebug: true, root: '.' }, function (er, matches) {
+    t.ifError(er)
+    t.like(matches, [])
+    t.end()
+  })
+})
+
+
+t.test('a', function (t) {
+  console.error("root=" + path.resolve('a'))
+  glob('/b*/**', { globDebug: true, root: path.resolve('a') }, function (er, matches) {
+    t.ifError(er)
+    var wanted = [
+        '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f'
+      ].map(function (m) {
+        return path.join(path.resolve('a'), m).replace(/\\/g, '/')
+      })
+
+    t.like(matches, wanted)
+    t.end()
+  })
+})
+
+t.test('root=a, cwd=a/b', function (t) {
+  glob('/b*/**', { globDebug: true, root: 'a', cwd: path.resolve('a/b') }, function (er, matches) {
+    t.ifError(er)
+    t.like(matches, [ '/b', '/b/c', '/b/c/d', '/bc', '/bc/e', '/bc/e/f' ].map(function (m) {
+      return path.join(path.resolve('a'), m).replace(/\\/g, '/')
+    }))
+    t.end()
+  })
+})
+
+t.test('cd -', function (t) {
+  process.chdir(origCwd)
+  t.end()
+})
diff --git a/node_modules/glob/test/stat.js b/node_modules/glob/test/stat.js
new file mode 100644
index 0000000..6291711
--- /dev/null
+++ b/node_modules/glob/test/stat.js
@@ -0,0 +1,32 @@
+var glob = require('../')
+var test = require('tap').test
+var path = require('path')
+
+test('stat all the things', function(t) {
+  var g = new glob.Glob('a/*abc*/**', { stat: true, cwd: __dirname })
+  var matches = []
+  g.on('match', function(m) {
+    matches.push(m)
+  })
+  var stats = []
+  g.on('stat', function(m) {
+    stats.push(m)
+  })
+  g.on('end', function(eof) {
+    stats = stats.sort()
+    matches = matches.sort()
+    eof = eof.sort()
+    t.same(stats, matches)
+    t.same(eof, matches)
+    var cache = Object.keys(this.statCache)
+    t.same(cache.map(function (f) {
+      return path.relative(__dirname, f)
+    }).sort(), matches)
+
+    cache.forEach(function(c) {
+      t.equal(typeof this.statCache[c], 'object')
+    }, this)
+
+    t.end()
+  })
+})
diff --git a/node_modules/glob/test/zz-cleanup.js b/node_modules/glob/test/zz-cleanup.js
new file mode 100644
index 0000000..e085f0f
--- /dev/null
+++ b/node_modules/glob/test/zz-cleanup.js
@@ -0,0 +1,11 @@
+// remove the fixtures
+var tap = require("tap")
+, rimraf = require("rimraf")
+, path = require("path")
+
+tap.test("cleanup fixtures", function (t) {
+  rimraf(path.resolve(__dirname, "a"), function (er) {
+    t.ifError(er, "removed")
+    t.end()
+  })
+})
diff --git a/node_modules/growl/History.md b/node_modules/growl/History.md
new file mode 100644
index 0000000..a4b7b49
--- /dev/null
+++ b/node_modules/growl/History.md
@@ -0,0 +1,63 @@
+
+1.7.0 / 2012-12-30 
+==================
+
+  * support transient notifications in Gnome
+
+1.6.1 / 2012-09-25 
+==================
+
+  * restore compatibility with node < 0.8 [fgnass]
+
+1.6.0 / 2012-09-06 
+==================
+
+  * add notification center support [drudge]
+
+1.5.1 / 2012-04-08 
+==================
+
+  * Merge pull request #16 from KyleAMathews/patch-1
+  * Fixes #15
+
+1.5.0 / 2012-02-08 
+==================
+
+  * Added windows support [perfusorius]
+
+1.4.1 / 2011-12-28 
+==================
+
+  * Fixed: dont exit(). Closes #9
+
+1.4.0 / 2011-12-17 
+==================
+
+  * Changed API: `growl.notify()` -> `growl()`
+
+1.3.0 / 2011-12-17 
+==================
+
+  * Added support for Ubuntu/Debian/Linux users [niftylettuce]
+  * Fixed: send notifications even if title not specified [alessioalex]
+
+1.2.0 / 2011-10-06 
+==================
+
+  * Add support for priority.
+
+1.1.0 / 2011-03-15 
+==================
+
+  * Added optional callbacks
+  * Added parsing of version
+
+1.0.1 / 2010-03-26
+==================
+
+  * Fixed; sys.exec -> child_process.exec to support latest node
+
+1.0.0 / 2010-03-19
+==================
+  
+  * Initial release
diff --git a/node_modules/growl/Readme.md b/node_modules/growl/Readme.md
new file mode 100644
index 0000000..785344e
--- /dev/null
+++ b/node_modules/growl/Readme.md
@@ -0,0 +1,108 @@
+# Growl for nodejs
+
+Growl support for Nodejs. This is essentially a port of my [Ruby Growl Library](http://github.com/visionmedia/growl). Ubuntu/Linux support added thanks to [@niftylettuce](http://github.com/niftylettuce).
+
+## Installation
+
+### Install
+
+### Mac OS X (Darwin):
+
+  Install [growlnotify(1)](http://growl.info/extras.php#growlnotify). On OS X 10.8, Notification Center is supported using [terminal-notifier](https://github.com/alloy/terminal-notifier). To install:
+
+    $ sudo gem install terminal-notifier
+
+  Install [npm](http://npmjs.org/) and run:
+
+    $ npm install growl
+
+### Ubuntu (Linux):
+
+  Install `notify-send` through the [libnotify-bin](http://packages.ubuntu.com/libnotify-bin) package:
+
+    $ sudo apt-get install libnotify-bin
+
+  Install [npm](http://npmjs.org/) and run:
+
+    $ npm install growl
+
+### Windows:
+
+  Download and install [Growl for Windows](http://www.growlforwindows.com/gfw/default.aspx)
+
+  Download [growlnotify](http://www.growlforwindows.com/gfw/help/growlnotify.aspx) - **IMPORTANT :** Unpack growlnotify to a folder that is present in your path!
+
+  Install [npm](http://npmjs.org/) and run:
+
+    $ npm install growl
+
+## Examples
+
+Callback functions are optional
+
+```javascript
+var growl = require('growl')
+growl('You have mail!')
+growl('5 new messages', { sticky: true })
+growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true })
+growl('Message with title', { title: 'Title'})
+growl('Set priority', { priority: 2 })
+growl('Show Safari icon', { image: 'Safari' })
+growl('Show icon', { image: 'path/to/icon.icns' })
+growl('Show image', { image: 'path/to/my.image.png' })
+growl('Show png filesystem icon', { image: 'png' })
+growl('Show pdf filesystem icon', { image: 'article.pdf' })
+growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(err){
+  // ... notified
+})
+```
+
+## Options
+
+  - title
+    - notification title
+  - name
+    - application name
+  - priority
+    - priority for the notification (default is 0)
+  - sticky
+    - weither or not the notification should remainin until closed
+  - image
+    - Auto-detects the context:
+      - path to an icon sets --iconpath
+      - path to an image sets --image
+      - capitalized word sets --appIcon
+      - filename uses extname as --icon
+      - otherwise treated as --icon
+  - exec
+    - manually specify a shell command instead
+      - appends message to end of shell command
+      - or, replaces `%s` with message
+      - optionally prepends title (example: `title: message`)
+      - examples: `{exec: 'tmux display-message'}`, `{exec: 'echo "%s" > messages.log}`
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2009 TJ Holowaychuk 
+Copyright (c) 2016 Joshua Boy Nicolai Appelman 
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/growl/lib/growl.js b/node_modules/growl/lib/growl.js
new file mode 100644
index 0000000..719b5af
--- /dev/null
+++ b/node_modules/growl/lib/growl.js
@@ -0,0 +1,290 @@
+// Growl - Copyright TJ Holowaychuk  (MIT Licensed)
+
+/**
+ * Module dependencies.
+ */
+
+var exec = require('child_process').exec
+  , fs = require('fs')
+  , path = require('path')
+  , exists = fs.existsSync || path.existsSync
+  , os = require('os')
+  , quote = JSON.stringify
+  , cmd;
+
+function which(name) {
+  var paths = process.env.PATH.split(':');
+  var loc;
+
+  for (var i = 0, len = paths.length; i < len; ++i) {
+    loc = path.join(paths[i], name);
+    if (exists(loc)) return loc;
+  }
+}
+
+switch(os.type()) {
+  case 'Darwin':
+    if (which('terminal-notifier')) {
+      cmd = {
+          type: "Darwin-NotificationCenter"
+        , pkg: "terminal-notifier"
+        , msg: '-message'
+        , title: '-title'
+        , subtitle: '-subtitle'
+        , icon: '-appIcon'
+        , sound:  '-sound'
+        , url: '-open'
+        , priority: {
+              cmd: '-execute'
+            , range: []
+          }
+      };
+    } else {
+      cmd = {
+          type: "Darwin-Growl"
+        , pkg: "growlnotify"
+        , msg: '-m'
+        , sticky: '--sticky'
+        , priority: {
+              cmd: '--priority'
+            , range: [
+                -2
+              , -1
+              , 0
+              , 1
+              , 2
+              , "Very Low"
+              , "Moderate"
+              , "Normal"
+              , "High"
+              , "Emergency"
+            ]
+          }
+      };
+    }
+    break;
+  case 'Linux':
+    if (which('growl')) {
+      cmd = {
+          type: "Linux-Growl"
+        , pkg: "growl"
+        , msg: '-m'
+        , title: '-title'
+        , subtitle: '-subtitle'
+        , host: {
+            cmd: '-H'
+          , hostname: '192.168.33.1'
+        }
+      };
+    } else {
+      cmd = {
+          type: "Linux"
+        , pkg: "notify-send"
+        , msg: ''
+        , sticky: '-t 0'
+        , icon: '-i'
+        , priority: {
+            cmd: '-u'
+          , range: [
+              "low"
+            , "normal"
+            , "critical"
+          ]
+        }
+      };
+    }
+    break;
+  case 'Windows_NT':
+    cmd = {
+        type: "Windows"
+      , pkg: "growlnotify"
+      , msg: ''
+      , sticky: '/s:true'
+      , title: '/t:'
+      , icon: '/i:'
+      , url: '/cu:'
+      , priority: {
+            cmd: '/p:'
+          , range: [
+              -2
+            , -1
+            , 0
+            , 1
+            , 2
+          ]
+        }
+    };
+    break;
+}
+
+/**
+ * Expose `growl`.
+ */
+
+exports = module.exports = growl;
+
+/**
+ * Node-growl version.
+ */
+
+exports.version = '1.4.1'
+
+/**
+ * Send growl notification _msg_ with _options_.
+ *
+ * Options:
+ *
+ *  - title   Notification title
+ *  - sticky  Make the notification stick (defaults to false)
+ *  - priority  Specify an int or named key (default is 0)
+ *  - name    Application name (defaults to growlnotify)
+ *  - sound   Sound efect ( in OSx defined in preferences -> sound -> effects) * works only in OSX > 10.8x
+ *  - image
+ *    - path to an icon sets --iconpath
+ *    - path to an image sets --image
+ *    - capitalized word sets --appIcon
+ *    - filename uses extname as --icon
+ *    - otherwise treated as --icon
+ *
+ * Examples:
+ *
+ *   growl('New email')
+ *   growl('5 new emails', { title: 'Thunderbird' })
+ *   growl('5 new emails', { title: 'Thunderbird', sound: 'Purr' })
+ *   growl('Email sent', function(){
+ *     // ... notification sent
+ *   })
+ *
+ * @param {string} msg
+ * @param {object} options
+ * @param {function} fn
+ * @api public
+ */
+
+function growl(msg, options, fn) {
+  var image
+    , args
+    , options = options || {}
+    , fn = fn || function(){};
+
+  if (options.exec) {
+    cmd = {
+        type: "Custom"
+      , pkg: options.exec
+      , range: []
+    };
+  }
+
+  // noop
+  if (!cmd) return fn(new Error('growl not supported on this platform'));
+  args = [cmd.pkg];
+
+  // image
+  if (image = options.image) {
+    switch(cmd.type) {
+      case 'Darwin-Growl':
+        var flag, ext = path.extname(image).substr(1)
+        flag = flag || ext == 'icns' && 'iconpath'
+        flag = flag || /^[A-Z]/.test(image) && 'appIcon'
+        flag = flag || /^png|gif|jpe?g$/.test(ext) && 'image'
+        flag = flag || ext && (image = ext) && 'icon'
+        flag = flag || 'icon'
+        args.push('--' + flag, quote(image))
+        break;
+      case 'Darwin-NotificationCenter':
+        args.push(cmd.icon, quote(image));
+        break;
+      case 'Linux':
+        args.push(cmd.icon, quote(image));
+        // libnotify defaults to sticky, set a hint for transient notifications
+        if (!options.sticky) args.push('--hint=int:transient:1');
+        break;
+      case 'Windows':
+        args.push(cmd.icon + quote(image));
+        break;
+    }
+  }
+
+  // sticky
+  if (options.sticky) args.push(cmd.sticky);
+
+  // priority
+  if (options.priority) {
+    var priority = options.priority + '';
+    var checkindexOf = cmd.priority.range.indexOf(priority);
+    if (~cmd.priority.range.indexOf(priority)) {
+      args.push(cmd.priority, options.priority);
+    }
+  }
+
+  //sound
+  if(options.sound && cmd.type === 'Darwin-NotificationCenter'){
+    args.push(cmd.sound, options.sound)
+  }
+
+  // name
+  if (options.name && cmd.type === "Darwin-Growl") {
+    args.push('--name', options.name);
+  }
+
+  switch(cmd.type) {
+    case 'Darwin-Growl':
+      args.push(cmd.msg);
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(quote(options.title));
+      break;
+    case 'Darwin-NotificationCenter':
+      args.push(cmd.msg);
+      var stringifiedMsg = quote(msg);
+      var escapedMsg = stringifiedMsg.replace(/\\n/g, '\n');
+      args.push(escapedMsg);
+      if (options.title) {
+        args.push(cmd.title);
+        args.push(quote(options.title));
+      }
+      if (options.subtitle) {
+        args.push(cmd.subtitle);
+        args.push(quote(options.subtitle));
+      }
+      if (options.url) {
+        args.push(cmd.url);
+        args.push(quote(options.url));
+      }
+      break;
+    case 'Linux-Growl':
+      args.push(cmd.msg);
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(quote(options.title));
+      if (cmd.host) {
+        args.push(cmd.host.cmd, cmd.host.hostname)
+      }
+      break;
+    case 'Linux':
+      if (options.title) {
+        args.push(quote(options.title));
+        args.push(cmd.msg);
+        args.push(quote(msg).replace(/\\n/g, '\n'));
+      } else {
+        args.push(quote(msg).replace(/\\n/g, '\n'));
+      }
+      break;
+    case 'Windows':
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(cmd.title + quote(options.title));
+      if (options.url) args.push(cmd.url + quote(options.url));
+      break;
+    case 'Custom':
+      args[0] = (function(origCommand) {
+        var message = options.title
+          ? options.title + ': ' + msg
+          : msg;
+        var command = origCommand.replace(/(^|[^%])%s/g, '$1' + quote(message));
+        if (command === origCommand) args.push(quote(message));
+        return command;
+      })(args[0]);
+      break;
+  }
+
+  // execute
+  exec(args.join(' '), fn);
+};
diff --git a/node_modules/growl/package.json b/node_modules/growl/package.json
new file mode 100644
index 0000000..adb2e55
--- /dev/null
+++ b/node_modules/growl/package.json
@@ -0,0 +1,50 @@
+{
+  "_from": "growl@1.9.2",
+  "_id": "growl@1.9.2",
+  "_inBundle": false,
+  "_integrity": "sha1-Dqd0NxXbjY3ixe3hd14bRayFwC8=",
+  "_location": "/growl",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "growl@1.9.2",
+    "name": "growl",
+    "escapedName": "growl",
+    "rawSpec": "1.9.2",
+    "saveSpec": null,
+    "fetchSpec": "1.9.2"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/growl/-/growl-1.9.2.tgz",
+  "_shasum": "0ea7743715db8d8de2c5ede1775e1b45ac85c02f",
+  "_spec": "growl@1.9.2",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "bugs": {
+    "url": "https://github.com/tj/node-growl/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "Growl unobtrusive notifications",
+  "homepage": "https://github.com/tj/node-growl#readme",
+  "license": "MIT",
+  "main": "./lib/growl.js",
+  "maintainers": [
+    {
+      "name": "Joshua Boy Nicolai Appelman",
+      "email": "joshua@jbnicolai.nl"
+    }
+  ],
+  "name": "growl",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/tj/node-growl.git"
+  },
+  "version": "1.9.2"
+}
diff --git a/node_modules/growl/test.js b/node_modules/growl/test.js
new file mode 100644
index 0000000..9bb09d9
--- /dev/null
+++ b/node_modules/growl/test.js
@@ -0,0 +1,31 @@
+
+var growl = require('./lib/growl')
+
+growl('Support sound notifications', {title: 'Make a sound', sound: 'purr'});
+growl('You have mail!')
+growl('5 new messages', { sticky: true })
+growl('5 new emails', { title: 'Email Client', image: 'Safari', sticky: true })
+growl('Message with title', { title: 'Title'})
+growl('Set priority', { priority: 2 })
+growl('Show Safari icon', { image: 'Safari' })
+growl('Show icon', { image: 'path/to/icon.icns' })
+growl('Show image', { image: 'path/to/my.image.png' })
+growl('Show png filesystem icon', { image: 'png' })
+growl('Show pdf filesystem icon', { image: 'article.pdf' })
+growl('Show pdf filesystem icon', { image: 'article.pdf' }, function(){
+  console.log('callback');
+})
+growl('Show pdf filesystem icon', { title: 'Use show()', image: 'article.pdf' })
+growl('here \' are \n some \\ characters that " need escaping', {}, function(error, stdout, stderr) {
+  if (error !== null) throw new Error('escaping failed:\n' + stdout + stderr);
+})
+growl('Allow custom notifiers', { exec: 'echo XXX %s' }, function(error, stdout, stderr) {
+  console.log(stdout);
+})
+growl('Allow custom notifiers', { title: 'test', exec: 'echo YYY' }, function(error, stdout, stderr) {
+  console.log(stdout);
+})
+growl('Allow custom notifiers', { title: 'test', exec: 'echo ZZZ %s' }, function(error, stdout, stderr) {
+  console.log(stdout);
+})
+growl('Open a URL', { url: 'https://npmjs.org/package/growl' });
diff --git a/node_modules/jade/.npmignore b/node_modules/jade/.npmignore
new file mode 100644
index 0000000..b9af3d4
--- /dev/null
+++ b/node_modules/jade/.npmignore
@@ -0,0 +1,15 @@
+test
+support
+benchmarks
+examples
+lib-cov
+coverage.html
+.gitmodules
+.travis.yml
+History.md
+Readme.md
+Makefile
+test/
+support/
+benchmarks/
+examples/
diff --git a/node_modules/jade/LICENSE b/node_modules/jade/LICENSE
new file mode 100644
index 0000000..8ad0e0d
--- /dev/null
+++ b/node_modules/jade/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2009-2010 TJ Holowaychuk 
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/node_modules/jade/bin/jade b/node_modules/jade/bin/jade
new file mode 100755
index 0000000..7e6002f
--- /dev/null
+++ b/node_modules/jade/bin/jade
@@ -0,0 +1,147 @@
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var fs = require('fs')
+  , program = require('commander')
+  , path = require('path')
+  , basename = path.basename
+  , dirname = path.dirname
+  , resolve = path.resolve
+  , join = path.join
+  , mkdirp = require('mkdirp')
+  , jade = require('../');
+
+// jade options
+
+var options = {};
+
+// options
+
+program
+  .version(jade.version)
+  .usage('[options] [dir|file ...]')
+  .option('-o, --obj ', 'javascript options object')
+  .option('-O, --out ', 'output the compiled html to ')
+  .option('-p, --path ', 'filename used to resolve includes')
+  .option('-P, --pretty', 'compile pretty html output')
+  .option('-c, --client', 'compile for client-side runtime.js')
+  .option('-D, --no-debug', 'compile without debugging (smaller functions)')
+
+program.on('--help', function(){
+  console.log('  Examples:');
+  console.log('');
+  console.log('    # translate jade the templates dir');
+  console.log('    $ jade templates');
+  console.log('');
+  console.log('    # create {foo,bar}.html');
+  console.log('    $ jade {foo,bar}.jade');
+  console.log('');
+  console.log('    # jade over stdio');
+  console.log('    $ jade < my.jade > my.html');
+  console.log('');
+  console.log('    # jade over stdio');
+  console.log('    $ echo "h1 Jade!" | jade');
+  console.log('');
+  console.log('    # foo, bar dirs rendering to /tmp');
+  console.log('    $ jade foo bar --out /tmp ');
+  console.log('');
+});
+
+program.parse(process.argv);
+
+// options given, parse them
+
+if (program.obj) options = eval('(' + program.obj + ')');
+
+// --filename
+
+if (program.path) options.filename = program.path;
+
+// --no-debug
+
+options.compileDebug = program.debug;
+
+// --client
+
+options.client = program.client;
+
+// --pretty
+
+options.pretty = program.pretty;
+
+// left-over args are file paths
+
+var files = program.args;
+
+// compile files
+
+if (files.length) {
+  console.log();
+  files.forEach(renderFile);
+  process.on('exit', console.log);
+// stdio
+} else {
+  stdin();
+}
+
+/**
+ * Compile from stdin.
+ */
+
+function stdin() {
+  var buf = '';
+  process.stdin.setEncoding('utf8');
+  process.stdin.on('data', function(chunk){ buf += chunk; });
+  process.stdin.on('end', function(){
+    var fn = jade.compile(buf, options);
+    var output = options.client
+        ? fn.toString()
+        : fn(options);
+    process.stdout.write(output);
+  }).resume();
+}
+
+/**
+ * Process the given path, compiling the jade files found.
+ * Always walk the subdirectories.
+ */
+
+function renderFile(path) {
+  var re = /\.jade$/;
+  fs.lstat(path, function(err, stat) {
+    if (err) throw err;
+    // Found jade file
+    if (stat.isFile() && re.test(path)) {
+      fs.readFile(path, 'utf8', function(err, str){
+        if (err) throw err;
+        options.filename = path;
+        var fn = jade.compile(str, options);
+        var extname = options.client ? '.js' : '.html';
+        path = path.replace(re, extname);
+        if (program.out) path = join(program.out, basename(path));
+        var dir = resolve(dirname(path));
+        mkdirp(dir, 0755, function(err){
+          if (err) throw err;
+          var output = options.client
+            ? fn.toString()
+            : fn(options);
+          fs.writeFile(path, output, function(err){
+            if (err) throw err;
+            console.log('  \033[90mrendered \033[36m%s\033[0m', path);
+          });
+        });
+      });
+    // Found directory
+    } else if (stat.isDirectory()) {
+      fs.readdir(path, function(err, files) {
+        if (err) throw err;
+        files.map(function(filename) {
+          return path + '/' + filename;
+        }).forEach(renderFile);
+      });
+    }
+  });
+}
diff --git a/node_modules/jade/index.js b/node_modules/jade/index.js
new file mode 100644
index 0000000..8ad059f
--- /dev/null
+++ b/node_modules/jade/index.js
@@ -0,0 +1,4 @@
+
+module.exports = process.env.JADE_COV
+  ? require('./lib-cov/jade')
+  : require('./lib/jade');
\ No newline at end of file
diff --git a/node_modules/jade/jade.js b/node_modules/jade/jade.js
new file mode 100644
index 0000000..1983a20
--- /dev/null
+++ b/node_modules/jade/jade.js
@@ -0,0 +1,3586 @@
+(function() {
+
+// CommonJS require()
+
+function require(p){
+    var path = require.resolve(p)
+      , mod = require.modules[path];
+    if (!mod) throw new Error('failed to require "' + p + '"');
+    if (!mod.exports) {
+      mod.exports = {};
+      mod.call(mod.exports, mod, mod.exports, require.relative(path));
+    }
+    return mod.exports;
+  }
+
+require.modules = {};
+
+require.resolve = function (path){
+    var orig = path
+      , reg = path + '.js'
+      , index = path + '/index.js';
+    return require.modules[reg] && reg
+      || require.modules[index] && index
+      || orig;
+  };
+
+require.register = function (path, fn){
+    require.modules[path] = fn;
+  };
+
+require.relative = function (parent) {
+    return function(p){
+      if ('.' != p.charAt(0)) return require(p);
+      
+      var path = parent.split('/')
+        , segs = p.split('/');
+      path.pop();
+      
+      for (var i = 0; i < segs.length; i++) {
+        var seg = segs[i];
+        if ('..' == seg) path.pop();
+        else if ('.' != seg) path.push(seg);
+      }
+
+      return require(path.join('/'));
+    };
+  };
+
+
+require.register("compiler.js", function(module, exports, require){
+
+/*!
+ * Jade - Compiler
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var nodes = require('./nodes')
+  , filters = require('./filters')
+  , doctypes = require('./doctypes')
+  , selfClosing = require('./self-closing')
+  , runtime = require('./runtime')
+  , utils = require('./utils');
+
+
+ if (!Object.keys) {
+   Object.keys = function(obj){
+     var arr = [];
+     for (var key in obj) {
+       if (obj.hasOwnProperty(key)) {
+         arr.push(key);
+       }
+     }
+     return arr;
+   }
+ }
+
+ if (!String.prototype.trimLeft) {
+   String.prototype.trimLeft = function(){
+     return this.replace(/^\s+/, '');
+   }
+ }
+
+
+
+/**
+ * Initialize `Compiler` with the given `node`.
+ *
+ * @param {Node} node
+ * @param {Object} options
+ * @api public
+ */
+
+var Compiler = module.exports = function Compiler(node, options) {
+  this.options = options = options || {};
+  this.node = node;
+  this.hasCompiledDoctype = false;
+  this.hasCompiledTag = false;
+  this.pp = options.pretty || false;
+  this.debug = false !== options.compileDebug;
+  this.indents = 0;
+  this.parentIndents = 0;
+  if (options.doctype) this.setDoctype(options.doctype);
+};
+
+/**
+ * Compiler prototype.
+ */
+
+Compiler.prototype = {
+
+  /**
+   * Compile parse tree to JavaScript.
+   *
+   * @api public
+   */
+
+  compile: function(){
+    this.buf = ['var interp;'];
+    if (this.pp) this.buf.push("var __indent = [];");
+    this.lastBufferedIdx = -1;
+    this.visit(this.node);
+    return this.buf.join('\n');
+  },
+
+  /**
+   * Sets the default doctype `name`. Sets terse mode to `true` when
+   * html 5 is used, causing self-closing tags to end with ">" vs "/>",
+   * and boolean attributes are not mirrored.
+   *
+   * @param {string} name
+   * @api public
+   */
+
+  setDoctype: function(name){
+    var doctype = doctypes[(name || 'default').toLowerCase()];
+    doctype = doctype || '';
+    this.doctype = doctype;
+    this.terse = '5' == name || 'html' == name;
+    this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText)
+      this.prettyIndent(1, true);
+    
+    for (var i = 0; i < len; ++i) {
+      // Pretty print text
+      if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText)
+        this.prettyIndent(1, false);
+      
+      this.visit(block.nodes[i]);
+      // Multiple text nodes are separated by newlines
+      if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText)
+        this.buffer('\\n');
+    }
+  },
+
+  /**
+   * Visit `doctype`. Sets terse mode to `true` when html 5
+   * is used, causing self-closing tags to end with ">" vs "/>",
+   * and boolean attributes are not mirrored.
+   *
+   * @param {Doctype} doctype
+   * @api public
+   */
+
+  visitDoctype: function(doctype){
+    if (doctype && (doctype.val || !this.doctype)) {
+      this.setDoctype(doctype.val || 'default');
+    }
+
+    if (this.doctype) this.buffer(this.doctype);
+    this.hasCompiledDoctype = true;
+  },
+
+  /**
+   * Visit `mixin`, generating a function that
+   * may be called within the template.
+   *
+   * @param {Mixin} mixin
+   * @api public
+   */
+
+  visitMixin: function(mixin){
+    var name = mixin.name.replace(/-/g, '_') + '_mixin'
+      , args = mixin.args || ''
+      , block = mixin.block
+      , attrs = mixin.attrs
+      , pp = this.pp;
+
+    if (mixin.call) {
+      if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join('  ') + "');")
+      if (block || attrs.length) {
+        
+        this.buf.push(name + '.call({');
+        
+        if (block) {
+          this.buf.push('block: function(){');
+          
+          // Render block with no indents, dynamically added when rendered
+          this.parentIndents++;
+          var _indents = this.indents;
+          this.indents = 0;
+          this.visit(mixin.block);
+          this.indents = _indents;
+          this.parentIndents--;
+          
+          if (attrs.length) {
+            this.buf.push('},');
+          } else {
+            this.buf.push('}');
+          }
+        }
+        
+        if (attrs.length) {
+          var val = this.attrs(attrs);
+          if (val.inherits) {
+            this.buf.push('attributes: merge({' + val.buf
+                + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)');
+          } else {
+            this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped);
+          }
+        }
+        
+        if (args) {
+          this.buf.push('}, ' + args + ');');
+        } else {
+          this.buf.push('});');
+        }
+        
+      } else {
+        this.buf.push(name + '(' + args + ');');
+      }
+      if (pp) this.buf.push("__indent.pop();")
+    } else {
+      this.buf.push('var ' + name + ' = function(' + args + '){');
+      this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};');
+      this.parentIndents++;
+      this.visit(block);
+      this.parentIndents--;
+      this.buf.push('};');
+    }
+  },
+
+  /**
+   * Visit `tag` buffering tag markup, generating
+   * attributes, visiting the `tag`'s code and block.
+   *
+   * @param {Tag} tag
+   * @api public
+   */
+
+  visitTag: function(tag){
+    this.indents++;
+    var name = tag.name
+      , pp = this.pp;
+
+    if (tag.buffer) name = "' + (" + name + ") + '";
+
+    if (!this.hasCompiledTag) {
+      if (!this.hasCompiledDoctype && 'html' == name) {
+        this.visitDoctype();
+      }
+      this.hasCompiledTag = true;
+    }
+
+    // pretty print
+    if (pp && !tag.isInline())
+      this.prettyIndent(0, true);
+
+    if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) {
+      this.buffer('<' + name);
+      this.visitAttributes(tag.attrs);
+      this.terse
+        ? this.buffer('>')
+        : this.buffer('/>');
+    } else {
+      // Optimize attributes buffering
+      if (tag.attrs.length) {
+        this.buffer('<' + name);
+        if (tag.attrs.length) this.visitAttributes(tag.attrs);
+        this.buffer('>');
+      } else {
+        this.buffer('<' + name + '>');
+      }
+      if (tag.code) this.visitCode(tag.code);
+      this.escape = 'pre' == tag.name;
+      this.visit(tag.block);
+
+      // pretty print
+      if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline())
+        this.prettyIndent(0, true);
+
+      this.buffer('');
+    }
+    this.indents--;
+  },
+
+  /**
+   * Visit `filter`, throwing when the filter does not exist.
+   *
+   * @param {Filter} filter
+   * @api public
+   */
+
+  visitFilter: function(filter){
+    var fn = filters[filter.name];
+
+    // unknown filter
+    if (!fn) {
+      if (filter.isASTFilter) {
+        throw new Error('unknown ast filter "' + filter.name + ':"');
+      } else {
+        throw new Error('unknown filter ":' + filter.name + '"');
+      }
+    }
+
+    if (filter.isASTFilter) {
+      this.buf.push(fn(filter.block, this, filter.attrs));
+    } else {
+      var text = filter.block.nodes.map(function(node){ return node.val }).join('\n');
+      filter.attrs = filter.attrs || {};
+      filter.attrs.filename = this.options.filename;
+      this.buffer(utils.text(fn(text, filter.attrs)));
+    }
+  },
+
+  /**
+   * Visit `text` node.
+   *
+   * @param {Text} text
+   * @api public
+   */
+
+  visitText: function(text){
+    text = utils.text(text.val.replace(/\\/g, '\\\\'));
+    if (this.escape) text = escape(text);
+    this.buffer(text);
+  },
+
+  /**
+   * Visit a `comment`, only buffering when the buffer flag is set.
+   *
+   * @param {Comment} comment
+   * @api public
+   */
+
+  visitComment: function(comment){
+    if (!comment.buffer) return;
+    if (this.pp) this.prettyIndent(1, true);
+    this.buffer('');
+  },
+
+  /**
+   * Visit a `BlockComment`.
+   *
+   * @param {Comment} comment
+   * @api public
+   */
+
+  visitBlockComment: function(comment){
+    if (!comment.buffer) return;
+    if (0 == comment.val.trim().indexOf('if')) {
+      this.buffer('');
+    } else {
+      this.buffer('');
+    }
+  },
+
+  /**
+   * Visit `code`, respecting buffer / escape flags.
+   * If the code is followed by a block, wrap it in
+   * a self-calling function.
+   *
+   * @param {Code} code
+   * @api public
+   */
+
+  visitCode: function(code){
+    // Wrap code blocks with {}.
+    // we only wrap unbuffered code blocks ATM
+    // since they are usually flow control
+
+    // Buffer code
+    if (code.buffer) {
+      var val = code.val.trimLeft();
+      this.buf.push('var __val__ = ' + val);
+      val = 'null == __val__ ? "" : __val__';
+      if (code.escape) val = 'escape(' + val + ')';
+      this.buf.push("buf.push(" + val + ");");
+    } else {
+      this.buf.push(code.val);
+    }
+
+    // Block support
+    if (code.block) {
+      if (!code.buffer) this.buf.push('{');
+      this.visit(code.block);
+      if (!code.buffer) this.buf.push('}');
+    }
+  },
+
+  /**
+   * Visit `each` block.
+   *
+   * @param {Each} each
+   * @api public
+   */
+
+  visitEach: function(each){
+    this.buf.push(''
+      + '// iterate ' + each.obj + '\n'
+      + ';(function(){\n'
+      + '  if (\'number\' == typeof ' + each.obj + '.length) {\n'
+      + '    for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n'
+      + '      var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n');
+
+    this.visit(each.block);
+
+    this.buf.push(''
+      + '    }\n'
+      + '  } else {\n'
+      + '    for (var ' + each.key + ' in ' + each.obj + ') {\n'
+       + '      if (' + each.obj + '.hasOwnProperty(' + each.key + ')){'
+      + '      var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n');
+
+    this.visit(each.block);
+
+     this.buf.push('      }\n');
+
+    this.buf.push('   }\n  }\n}).call(this);\n');
+  },
+
+  /**
+   * Visit `attrs`.
+   *
+   * @param {Array} attrs
+   * @api public
+   */
+
+  visitAttributes: function(attrs){
+    var val = this.attrs(attrs);
+    if (val.inherits) {
+      this.buf.push("buf.push(attrs(merge({ " + val.buf +
+          " }, attributes), merge(" + val.escaped + ", escaped, true)));");
+    } else if (val.constant) {
+      eval('var buf={' + val.buf + '};');
+      this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true);
+    } else {
+      this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));");
+    }
+  },
+
+  /**
+   * Compile attributes.
+   */
+
+  attrs: function(attrs){
+    var buf = []
+      , classes = []
+      , escaped = {}
+      , constant = attrs.every(function(attr){ return isConstant(attr.val) })
+      , inherits = false;
+
+    if (this.terse) buf.push('terse: true');
+
+    attrs.forEach(function(attr){
+      if (attr.name == 'attributes') return inherits = true;
+      escaped[attr.name] = attr.escaped;
+      if (attr.name == 'class') {
+        classes.push('(' + attr.val + ')');
+      } else {
+        var pair = "'" + attr.name + "':(" + attr.val + ')';
+        buf.push(pair);
+      }
+    });
+
+    if (classes.length) {
+      classes = classes.join(" + ' ' + ");
+      buf.push("class: " + classes);
+    }
+
+    return {
+      buf: buf.join(', ').replace('class:', '"class":'),
+      escaped: JSON.stringify(escaped),
+      inherits: inherits,
+      constant: constant
+    };
+  }
+};
+
+/**
+ * Check if expression can be evaluated to a constant
+ *
+ * @param {String} expression
+ * @return {Boolean}
+ * @api private
+ */
+
+function isConstant(val){
+  // Check strings/literals
+  if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val))
+    return true;
+  
+  // Check numbers
+  if (!isNaN(Number(val)))
+    return true;
+  
+  // Check arrays
+  var matches;
+  if (matches = /^ *\[(.*)\] *$/.exec(val))
+    return matches[1].split(',').every(isConstant);
+  
+  return false;
+}
+
+/**
+ * Escape the given string of `html`.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+function escape(html){
+  return String(html)
+    .replace(/&(?!\w+;)/g, '&')
+    .replace(//g, '>')
+    .replace(/"/g, '"');
+}
+}); // module: compiler.js
+
+require.register("doctypes.js", function(module, exports, require){
+
+/*!
+ * Jade - doctypes
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = {
+    '5': ''
+  , 'default': ''
+  , 'xml': ''
+  , 'transitional': ''
+  , 'strict': ''
+  , 'frameset': ''
+  , '1.1': ''
+  , 'basic': ''
+  , 'mobile': ''
+};
+}); // module: doctypes.js
+
+require.register("filters.js", function(module, exports, require){
+
+/*!
+ * Jade - filters
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = {
+  
+  /**
+   * Wrap text with CDATA block.
+   */
+  
+  cdata: function(str){
+    return '';
+  },
+  
+  /**
+   * Transform sass to css, wrapped in style tags.
+   */
+  
+  sass: function(str){
+    str = str.replace(/\\n/g, '\n');
+    var sass = require('sass').render(str).replace(/\n/g, '\\n');
+    return ''; 
+  },
+  
+  /**
+   * Transform stylus to css, wrapped in style tags.
+   */
+  
+  stylus: function(str, options){
+    var ret;
+    str = str.replace(/\\n/g, '\n');
+    var stylus = require('stylus');
+    stylus(str, options).render(function(err, css){
+      if (err) throw err;
+      ret = css.replace(/\n/g, '\\n');
+    });
+    return ''; 
+  },
+  
+  /**
+   * Transform less to css, wrapped in style tags.
+   */
+  
+  less: function(str){
+    var ret;
+    str = str.replace(/\\n/g, '\n');
+    require('less').render(str, function(err, css){
+      if (err) throw err;
+      ret = '';  
+    });
+    return ret;
+  },
+  
+  /**
+   * Transform markdown to html.
+   */
+  
+  markdown: function(str){
+    var md;
+
+    // support markdown / discount
+    try {
+      md = require('markdown');
+    } catch (err){
+      try {
+        md = require('discount');
+      } catch (err) {
+        try {
+          md = require('markdown-js');
+        } catch (err) {
+          try {
+            md = require('marked');
+          } catch (err) {
+            throw new
+              Error('Cannot find markdown library, install markdown, discount, or marked.');
+          }
+        }
+      }
+    }
+
+    str = str.replace(/\\n/g, '\n');
+    return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,''');
+  },
+  
+  /**
+   * Transform coffeescript to javascript.
+   */
+
+  coffeescript: function(str){
+    str = str.replace(/\\n/g, '\n');
+    var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n');
+    return '';
+  }
+};
+
+}); // module: filters.js
+
+require.register("inline-tags.js", function(module, exports, require){
+
+/*!
+ * Jade - inline tags
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = [
+    'a'
+  , 'abbr'
+  , 'acronym'
+  , 'b'
+  , 'br'
+  , 'code'
+  , 'em'
+  , 'font'
+  , 'i'
+  , 'img'
+  , 'ins'
+  , 'kbd'
+  , 'map'
+  , 'samp'
+  , 'small'
+  , 'span'
+  , 'strong'
+  , 'sub'
+  , 'sup'
+];
+}); // module: inline-tags.js
+
+require.register("jade.js", function(module, exports, require){
+/*!
+ * Jade
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Parser = require('./parser')
+  , Lexer = require('./lexer')
+  , Compiler = require('./compiler')
+  , runtime = require('./runtime')
+
+/**
+ * Library version.
+ */
+
+exports.version = '0.26.1';
+
+/**
+ * Expose self closing tags.
+ */
+
+exports.selfClosing = require('./self-closing');
+
+/**
+ * Default supported doctypes.
+ */
+
+exports.doctypes = require('./doctypes');
+
+/**
+ * Text filters.
+ */
+
+exports.filters = require('./filters');
+
+/**
+ * Utilities.
+ */
+
+exports.utils = require('./utils');
+
+/**
+ * Expose `Compiler`.
+ */
+
+exports.Compiler = Compiler;
+
+/**
+ * Expose `Parser`.
+ */
+
+exports.Parser = Parser;
+
+/**
+ * Expose `Lexer`.
+ */
+
+exports.Lexer = Lexer;
+
+/**
+ * Nodes.
+ */
+
+exports.nodes = require('./nodes');
+
+/**
+ * Jade runtime helpers.
+ */
+
+exports.runtime = runtime;
+
+/**
+ * Template function cache.
+ */
+
+exports.cache = {};
+
+/**
+ * Parse the given `str` of jade and return a function body.
+ *
+ * @param {String} str
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function parse(str, options){
+  try {
+    // Parse
+    var parser = new Parser(str, options.filename, options);
+
+    // Compile
+    var compiler = new (options.compiler || Compiler)(parser.parse(), options)
+      , js = compiler.compile();
+
+    // Debug compiler
+    if (options.debug) {
+      console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, '  '));
+    }
+
+    return ''
+      + 'var buf = [];\n'
+      + (options.self
+        ? 'var self = locals || {};\n' + js
+        : 'with (locals || {}) {\n' + js + '\n}\n')
+      + 'return buf.join("");';
+  } catch (err) {
+    parser = parser.context();
+    runtime.rethrow(err, parser.filename, parser.lexer.lineno);
+  }
+}
+
+/**
+ * Compile a `Function` representation of the given jade `str`.
+ *
+ * Options:
+ *
+ *   - `compileDebug` when `false` debugging code is stripped from the compiled template
+ *   - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()`
+ *      for use with the Jade client-side runtime.js
+ *
+ * @param {String} str
+ * @param {Options} options
+ * @return {Function}
+ * @api public
+ */
+
+exports.compile = function(str, options){
+  var options = options || {}
+    , client = options.client
+    , filename = options.filename
+      ? JSON.stringify(options.filename)
+      : 'undefined'
+    , fn;
+
+  if (options.compileDebug !== false) {
+    fn = [
+        'var __jade = [{ lineno: 1, filename: ' + filename + ' }];'
+      , 'try {'
+      , parse(String(str), options)
+      , '} catch (err) {'
+      , '  rethrow(err, __jade[0].filename, __jade[0].lineno);'
+      , '}'
+    ].join('\n');
+  } else {
+    fn = parse(String(str), options);
+  }
+
+  if (client) {
+    fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn;
+  }
+
+  fn = new Function('locals, attrs, escape, rethrow, merge', fn);
+
+  if (client) return fn;
+
+  return function(locals){
+    return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge);
+  };
+};
+
+/**
+ * Render the given `str` of jade and invoke
+ * the callback `fn(err, str)`.
+ *
+ * Options:
+ *
+ *   - `cache` enable template caching
+ *   - `filename` filename required for `include` / `extends` and caching
+ *
+ * @param {String} str
+ * @param {Object|Function} options or fn
+ * @param {Function} fn
+ * @api public
+ */
+
+exports.render = function(str, options, fn){
+  // swap args
+  if ('function' == typeof options) {
+    fn = options, options = {};
+  }
+
+  // cache requires .filename
+  if (options.cache && !options.filename) {
+    return fn(new Error('the "filename" option is required for caching'));
+  }
+
+  try {
+    var path = options.filename;
+    var tmpl = options.cache
+      ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options))
+      : exports.compile(str, options);
+    fn(null, tmpl(options));
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Render a Jade file at the given `path` and callback `fn(err, str)`.
+ *
+ * @param {String} path
+ * @param {Object|Function} options or callback
+ * @param {Function} fn
+ * @api public
+ */
+
+exports.renderFile = function(path, options, fn){
+  var key = path + ':string';
+
+  if ('function' == typeof options) {
+    fn = options, options = {};
+  }
+
+  try {
+    options.filename = path;
+    var str = options.cache
+      ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8'))
+      : fs.readFileSync(path, 'utf8');
+    exports.render(str, options, fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Express support.
+ */
+
+exports.__express = exports.renderFile;
+
+}); // module: jade.js
+
+require.register("lexer.js", function(module, exports, require){
+
+/*!
+ * Jade - Lexer
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Initialize `Lexer` with the given `str`.
+ *
+ * Options:
+ *
+ *   - `colons` allow colons for attr delimiters
+ *
+ * @param {String} str
+ * @param {Object} options
+ * @api private
+ */
+
+var Lexer = module.exports = function Lexer(str, options) {
+  options = options || {};
+  this.input = str.replace(/\r\n|\r/g, '\n');
+  this.colons = options.colons;
+  this.deferredTokens = [];
+  this.lastIndents = 0;
+  this.lineno = 1;
+  this.stash = [];
+  this.indentStack = [];
+  this.indentRe = null;
+  this.pipeless = false;
+};
+
+/**
+ * Lexer prototype.
+ */
+
+Lexer.prototype = {
+  
+  /**
+   * Construct a token with the given `type` and `val`.
+   *
+   * @param {String} type
+   * @param {String} val
+   * @return {Object}
+   * @api private
+   */
+  
+  tok: function(type, val){
+    return {
+        type: type
+      , line: this.lineno
+      , val: val
+    }
+  },
+  
+  /**
+   * Consume the given `len` of input.
+   *
+   * @param {Number} len
+   * @api private
+   */
+  
+  consume: function(len){
+    this.input = this.input.substr(len);
+  },
+  
+  /**
+   * Scan for `type` with the given `regexp`.
+   *
+   * @param {String} type
+   * @param {RegExp} regexp
+   * @return {Object}
+   * @api private
+   */
+  
+  scan: function(regexp, type){
+    var captures;
+    if (captures = regexp.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok(type, captures[1]);
+    }
+  },
+  
+  /**
+   * Defer the given `tok`.
+   *
+   * @param {Object} tok
+   * @api private
+   */
+  
+  defer: function(tok){
+    this.deferredTokens.push(tok);
+  },
+  
+  /**
+   * Lookahead `n` tokens.
+   *
+   * @param {Number} n
+   * @return {Object}
+   * @api private
+   */
+  
+  lookahead: function(n){
+    var fetch = n - this.stash.length;
+    while (fetch-- > 0) this.stash.push(this.next());
+    return this.stash[--n];
+  },
+  
+  /**
+   * Return the indexOf `start` / `end` delimiters.
+   *
+   * @param {String} start
+   * @param {String} end
+   * @return {Number}
+   * @api private
+   */
+  
+  indexOfDelimiters: function(start, end){
+    var str = this.input
+      , nstart = 0
+      , nend = 0
+      , pos = 0;
+    for (var i = 0, len = str.length; i < len; ++i) {
+      if (start == str.charAt(i)) {
+        ++nstart;
+      } else if (end == str.charAt(i)) {
+        if (++nend == nstart) {
+          pos = i;
+          break;
+        }
+      }
+    }
+    return pos;
+  },
+  
+  /**
+   * Stashed token.
+   */
+  
+  stashed: function() {
+    return this.stash.length
+      && this.stash.shift();
+  },
+  
+  /**
+   * Deferred token.
+   */
+  
+  deferred: function() {
+    return this.deferredTokens.length 
+      && this.deferredTokens.shift();
+  },
+  
+  /**
+   * end-of-source.
+   */
+  
+  eos: function() {
+    if (this.input.length) return;
+    if (this.indentStack.length) {
+      this.indentStack.shift();
+      return this.tok('outdent');
+    } else {
+      return this.tok('eos');
+    }
+  },
+
+  /**
+   * Blank line.
+   */
+  
+  blank: function() {
+    var captures;
+    if (captures = /^\n *\n/.exec(this.input)) {
+      this.consume(captures[0].length - 1);
+      if (this.pipeless) return this.tok('text', '');
+      return this.next();
+    }
+  },
+
+  /**
+   * Comment.
+   */
+  
+  comment: function() {
+    var captures;
+    if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('comment', captures[2]);
+      tok.buffer = '-' != captures[1];
+      return tok;
+    }
+  },
+
+  /**
+   * Interpolated tag.
+   */
+
+  interpolation: function() {
+    var captures;
+    if (captures = /^#\{(.*?)\}/.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok('interpolation', captures[1]);
+    }
+  },
+
+  /**
+   * Tag.
+   */
+  
+  tag: function() {
+    var captures;
+    if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok, name = captures[1];
+      if (':' == name[name.length - 1]) {
+        name = name.slice(0, -1);
+        tok = this.tok('tag', name);
+        this.defer(this.tok(':'));
+        while (' ' == this.input[0]) this.input = this.input.substr(1);
+      } else {
+        tok = this.tok('tag', name);
+      }
+      tok.selfClosing = !! captures[2];
+      return tok;
+    }
+  },
+  
+  /**
+   * Filter.
+   */
+  
+  filter: function() {
+    return this.scan(/^:(\w+)/, 'filter');
+  },
+  
+  /**
+   * Doctype.
+   */
+  
+  doctype: function() {
+    return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype');
+  },
+
+  /**
+   * Id.
+   */
+  
+  id: function() {
+    return this.scan(/^#([\w-]+)/, 'id');
+  },
+  
+  /**
+   * Class.
+   */
+  
+  className: function() {
+    return this.scan(/^\.([\w-]+)/, 'class');
+  },
+  
+  /**
+   * Text.
+   */
+  
+  text: function() {
+    return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text');
+  },
+
+  /**
+   * Extends.
+   */
+  
+  "extends": function() {
+    return this.scan(/^extends? +([^\n]+)/, 'extends');
+  },
+
+  /**
+   * Block prepend.
+   */
+  
+  prepend: function() {
+    var captures;
+    if (captures = /^prepend +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = 'prepend'
+        , name = captures[1]
+        , tok = this.tok('block', name);
+      tok.mode = mode;
+      return tok;
+    }
+  },
+  
+  /**
+   * Block append.
+   */
+  
+  append: function() {
+    var captures;
+    if (captures = /^append +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = 'append'
+        , name = captures[1]
+        , tok = this.tok('block', name);
+      tok.mode = mode;
+      return tok;
+    }
+  },
+
+  /**
+   * Block.
+   */
+  
+  block: function() {
+    var captures;
+    if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = captures[1] || 'replace'
+        , name = captures[2]
+        , tok = this.tok('block', name);
+
+      tok.mode = mode;
+      return tok;
+    }
+  },
+
+  /**
+   * Yield.
+   */
+  
+  yield: function() {
+    return this.scan(/^yield */, 'yield');
+  },
+
+  /**
+   * Include.
+   */
+  
+  include: function() {
+    return this.scan(/^include +([^\n]+)/, 'include');
+  },
+
+  /**
+   * Case.
+   */
+  
+  "case": function() {
+    return this.scan(/^case +([^\n]+)/, 'case');
+  },
+
+  /**
+   * When.
+   */
+  
+  when: function() {
+    return this.scan(/^when +([^:\n]+)/, 'when');
+  },
+
+  /**
+   * Default.
+   */
+  
+  "default": function() {
+    return this.scan(/^default */, 'default');
+  },
+
+  /**
+   * Assignment.
+   */
+  
+  assignment: function() {
+    var captures;
+    if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var name = captures[1]
+        , val = captures[2];
+      return this.tok('code', 'var ' + name + ' = (' + val + ');');
+    }
+  },
+
+  /**
+   * Call mixin.
+   */
+  
+  call: function(){
+    var captures;
+    if (captures = /^\+([-\w]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('call', captures[1]);
+      
+      // Check for args (not attributes)
+      if (captures = /^ *\((.*?)\)/.exec(this.input)) {
+        if (!/^ *[-\w]+ *=/.test(captures[1])) {
+          this.consume(captures[0].length);
+          tok.args = captures[1];
+        }
+      }
+      
+      return tok;
+    }
+  },
+
+  /**
+   * Mixin.
+   */
+
+  mixin: function(){
+    var captures;
+    if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('mixin', captures[1]);
+      tok.args = captures[2];
+      return tok;
+    }
+  },
+
+  /**
+   * Conditional.
+   */
+  
+  conditional: function() {
+    var captures;
+    if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var type = captures[1]
+        , js = captures[2];
+
+      switch (type) {
+        case 'if': js = 'if (' + js + ')'; break;
+        case 'unless': js = 'if (!(' + js + '))'; break;
+        case 'else if': js = 'else if (' + js + ')'; break;
+        case 'else': js = 'else'; break;
+      }
+
+      return this.tok('code', js);
+    }
+  },
+
+  /**
+   * While.
+   */
+  
+  "while": function() {
+    var captures;
+    if (captures = /^while +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok('code', 'while (' + captures[1] + ')');
+    }
+  },
+
+  /**
+   * Each.
+   */
+  
+  each: function() {
+    var captures;
+    if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('each', captures[1]);
+      tok.key = captures[2] || '$index';
+      tok.code = captures[3];
+      return tok;
+    }
+  },
+  
+  /**
+   * Code.
+   */
+  
+  code: function() {
+    var captures;
+    if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var flags = captures[1];
+      captures[1] = captures[2];
+      var tok = this.tok('code', captures[1]);
+      tok.escape = flags[0] === '=';
+      tok.buffer = flags[0] === '=' || flags[1] === '=';
+      return tok;
+    }
+  },
+  
+  /**
+   * Attributes.
+   */
+  
+  attrs: function() {
+    if ('(' == this.input.charAt(0)) {
+      var index = this.indexOfDelimiters('(', ')')
+        , str = this.input.substr(1, index-1)
+        , tok = this.tok('attrs')
+        , len = str.length
+        , colons = this.colons
+        , states = ['key']
+        , escapedAttr
+        , key = ''
+        , val = ''
+        , quote
+        , c
+        , p;
+
+      function state(){
+        return states[states.length - 1];
+      }
+
+      function interpolate(attr) {
+        return attr.replace(/#\{([^}]+)\}/g, function(_, expr){
+          return quote + " + (" + expr + ") + " + quote;
+        });
+      }
+
+      this.consume(index + 1);
+      tok.attrs = {};
+      tok.escaped = {};
+
+      function parse(c) {
+        var real = c;
+        // TODO: remove when people fix ":"
+        if (colons && ':' == c) c = '=';
+        switch (c) {
+          case ',':
+          case '\n':
+            switch (state()) {
+              case 'expr':
+              case 'array':
+              case 'string':
+              case 'object':
+                val += c;
+                break;
+              default:
+                states.push('key');
+                val = val.trim();
+                key = key.trim();
+                if ('' == key) return;
+                key = key.replace(/^['"]|['"]$/g, '').replace('!', '');
+                tok.escaped[key] = escapedAttr;
+                tok.attrs[key] = '' == val
+                  ? true
+                  : interpolate(val);
+                key = val = '';
+            }
+            break;
+          case '=':
+            switch (state()) {
+              case 'key char':
+                key += real;
+                break;
+              case 'val':
+              case 'expr':
+              case 'array':
+              case 'string':
+              case 'object':
+                val += real;
+                break;
+              default:
+                escapedAttr = '!' != p;
+                states.push('val');
+            }
+            break;
+          case '(':
+            if ('val' == state()
+              || 'expr' == state()) states.push('expr');
+            val += c;
+            break;
+          case ')':
+            if ('expr' == state()
+              || 'val' == state()) states.pop();
+            val += c;
+            break;
+          case '{':
+            if ('val' == state()) states.push('object');
+            val += c;
+            break;
+          case '}':
+            if ('object' == state()) states.pop();
+            val += c;
+            break;
+          case '[':
+            if ('val' == state()) states.push('array');
+            val += c;
+            break;
+          case ']':
+            if ('array' == state()) states.pop();
+            val += c;
+            break;
+          case '"':
+          case "'":
+            switch (state()) {
+              case 'key':
+                states.push('key char');
+                break;
+              case 'key char':
+                states.pop();
+                break;
+              case 'string':
+                if (c == quote) states.pop();
+                val += c;
+                break;
+              default:
+                states.push('string');
+                val += c;
+                quote = c;
+            }
+            break;
+          case '':
+            break;
+          default:
+            switch (state()) {
+              case 'key':
+              case 'key char':
+                key += c;
+                break;
+              default:
+                val += c;
+            }
+        }
+        p = c;
+      }
+
+      for (var i = 0; i < len; ++i) {
+        parse(str.charAt(i));
+      }
+
+      parse(',');
+
+      if ('/' == this.input.charAt(0)) {
+        this.consume(1);
+        tok.selfClosing = true;
+      }
+
+      return tok;
+    }
+  },
+  
+  /**
+   * Indent | Outdent | Newline.
+   */
+  
+  indent: function() {
+    var captures, re;
+
+    // established regexp
+    if (this.indentRe) {
+      captures = this.indentRe.exec(this.input);
+    // determine regexp
+    } else {
+      // tabs
+      re = /^\n(\t*) */;
+      captures = re.exec(this.input);
+
+      // spaces
+      if (captures && !captures[1].length) {
+        re = /^\n( *)/;
+        captures = re.exec(this.input);
+      }
+
+      // established
+      if (captures && captures[1].length) this.indentRe = re;
+    }
+
+    if (captures) {
+      var tok
+        , indents = captures[1].length;
+
+      ++this.lineno;
+      this.consume(indents + 1);
+
+      if (' ' == this.input[0] || '\t' == this.input[0]) {
+        throw new Error('Invalid indentation, you can use tabs or spaces but not both');
+      }
+
+      // blank line
+      if ('\n' == this.input[0]) return this.tok('newline');
+
+      // outdent
+      if (this.indentStack.length && indents < this.indentStack[0]) {
+        while (this.indentStack.length && this.indentStack[0] > indents) {
+          this.stash.push(this.tok('outdent'));
+          this.indentStack.shift();
+        }
+        tok = this.stash.pop();
+      // indent
+      } else if (indents && indents != this.indentStack[0]) {
+        this.indentStack.unshift(indents);
+        tok = this.tok('indent', indents);
+      // newline
+      } else {
+        tok = this.tok('newline');
+      }
+
+      return tok;
+    }
+  },
+
+  /**
+   * Pipe-less text consumed only when 
+   * pipeless is true;
+   */
+
+  pipelessText: function() {
+    if (this.pipeless) {
+      if ('\n' == this.input[0]) return;
+      var i = this.input.indexOf('\n');
+      if (-1 == i) i = this.input.length;
+      var str = this.input.substr(0, i);
+      this.consume(str.length);
+      return this.tok('text', str);
+    }
+  },
+
+  /**
+   * ':'
+   */
+
+  colon: function() {
+    return this.scan(/^: */, ':');
+  },
+
+  /**
+   * Return the next token object, or those
+   * previously stashed by lookahead.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  advance: function(){
+    return this.stashed()
+      || this.next();
+  },
+  
+  /**
+   * Return the next token object.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  next: function() {
+    return this.deferred()
+      || this.blank()
+      || this.eos()
+      || this.pipelessText()
+      || this.yield()
+      || this.doctype()
+      || this.interpolation()
+      || this["case"]()
+      || this.when()
+      || this["default"]()
+      || this["extends"]()
+      || this.append()
+      || this.prepend()
+      || this.block()
+      || this.include()
+      || this.mixin()
+      || this.call()
+      || this.conditional()
+      || this.each()
+      || this["while"]()
+      || this.assignment()
+      || this.tag()
+      || this.filter()
+      || this.code()
+      || this.id()
+      || this.className()
+      || this.attrs()
+      || this.indent()
+      || this.comment()
+      || this.colon()
+      || this.text();
+  }
+};
+
+}); // module: lexer.js
+
+require.register("nodes/attrs.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Attrs
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node'),
+    Block = require('./block');
+
+/**
+ * Initialize a `Attrs` node.
+ *
+ * @api public
+ */
+
+var Attrs = module.exports = function Attrs() {
+  this.attrs = [];
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Attrs.prototype = new Node;
+Attrs.prototype.constructor = Attrs;
+
+
+/**
+ * Set attribute `name` to `val`, keep in mind these become
+ * part of a raw js object literal, so to quote a value you must
+ * '"quote me"', otherwise or example 'user.name' is literal JavaScript.
+ *
+ * @param {String} name
+ * @param {String} val
+ * @param {Boolean} escaped
+ * @return {Tag} for chaining
+ * @api public
+ */
+
+Attrs.prototype.setAttribute = function(name, val, escaped){
+  this.attrs.push({ name: name, val: val, escaped: escaped });
+  return this;
+};
+
+/**
+ * Remove attribute `name` when present.
+ *
+ * @param {String} name
+ * @api public
+ */
+
+Attrs.prototype.removeAttribute = function(name){
+  for (var i = 0, len = this.attrs.length; i < len; ++i) {
+    if (this.attrs[i] && this.attrs[i].name == name) {
+      delete this.attrs[i];
+    }
+  }
+};
+
+/**
+ * Get attribute value by `name`.
+ *
+ * @param {String} name
+ * @return {String}
+ * @api public
+ */
+
+Attrs.prototype.getAttribute = function(name){
+  for (var i = 0, len = this.attrs.length; i < len; ++i) {
+    if (this.attrs[i] && this.attrs[i].name == name) {
+      return this.attrs[i].val;
+    }
+  }
+};
+
+}); // module: nodes/attrs.js
+
+require.register("nodes/block-comment.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - BlockComment
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `BlockComment` with the given `block`.
+ *
+ * @param {String} val
+ * @param {Block} block
+ * @param {Boolean} buffer
+ * @api public
+ */
+
+var BlockComment = module.exports = function BlockComment(val, block, buffer) {
+  this.block = block;
+  this.val = val;
+  this.buffer = buffer;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+BlockComment.prototype = new Node;
+BlockComment.prototype.constructor = BlockComment;
+
+}); // module: nodes/block-comment.js
+
+require.register("nodes/block.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Block
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a new `Block` with an optional `node`.
+ *
+ * @param {Node} node
+ * @api public
+ */
+
+var Block = module.exports = function Block(node){
+  this.nodes = [];
+  if (node) this.push(node);
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Block.prototype = new Node;
+Block.prototype.constructor = Block;
+
+
+/**
+ * Block flag.
+ */
+
+Block.prototype.isBlock = true;
+
+/**
+ * Replace the nodes in `other` with the nodes
+ * in `this` block.
+ *
+ * @param {Block} other
+ * @api private
+ */
+
+Block.prototype.replace = function(other){
+  other.nodes = this.nodes;
+};
+
+/**
+ * Pust the given `node`.
+ *
+ * @param {Node} node
+ * @return {Number}
+ * @api public
+ */
+
+Block.prototype.push = function(node){
+  return this.nodes.push(node);
+};
+
+/**
+ * Check if this block is empty.
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+Block.prototype.isEmpty = function(){
+  return 0 == this.nodes.length;
+};
+
+/**
+ * Unshift the given `node`.
+ *
+ * @param {Node} node
+ * @return {Number}
+ * @api public
+ */
+
+Block.prototype.unshift = function(node){
+  return this.nodes.unshift(node);
+};
+
+/**
+ * Return the "last" block, or the first `yield` node.
+ *
+ * @return {Block}
+ * @api private
+ */
+
+Block.prototype.includeBlock = function(){
+  var ret = this
+    , node;
+
+  for (var i = 0, len = this.nodes.length; i < len; ++i) {
+    node = this.nodes[i];
+    if (node.yield) return node;
+    else if (node.textOnly) continue;
+    else if (node.includeBlock) ret = node.includeBlock();
+    else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock();
+  }
+
+  return ret;
+};
+
+/**
+ * Return a clone of this block.
+ *
+ * @return {Block}
+ * @api private
+ */
+
+Block.prototype.clone = function(){
+  var clone = new Block;
+  for (var i = 0, len = this.nodes.length; i < len; ++i) {
+    clone.push(this.nodes[i].clone());
+  }
+  return clone;
+};
+
+
+}); // module: nodes/block.js
+
+require.register("nodes/case.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Case
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a new `Case` with `expr`.
+ *
+ * @param {String} expr
+ * @api public
+ */
+
+var Case = exports = module.exports = function Case(expr, block){
+  this.expr = expr;
+  this.block = block;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Case.prototype = new Node;
+Case.prototype.constructor = Case;
+
+
+var When = exports.When = function When(expr, block){
+  this.expr = expr;
+  this.block = block;
+  this.debug = false;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+When.prototype = new Node;
+When.prototype.constructor = When;
+
+
+
+}); // module: nodes/case.js
+
+require.register("nodes/code.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Code
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Code` node with the given code `val`.
+ * Code may also be optionally buffered and escaped.
+ *
+ * @param {String} val
+ * @param {Boolean} buffer
+ * @param {Boolean} escape
+ * @api public
+ */
+
+var Code = module.exports = function Code(val, buffer, escape) {
+  this.val = val;
+  this.buffer = buffer;
+  this.escape = escape;
+  if (val.match(/^ *else/)) this.debug = false;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Code.prototype = new Node;
+Code.prototype.constructor = Code;
+
+}); // module: nodes/code.js
+
+require.register("nodes/comment.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Comment
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Comment` with the given `val`, optionally `buffer`,
+ * otherwise the comment may render in the output.
+ *
+ * @param {String} val
+ * @param {Boolean} buffer
+ * @api public
+ */
+
+var Comment = module.exports = function Comment(val, buffer) {
+  this.val = val;
+  this.buffer = buffer;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Comment.prototype = new Node;
+Comment.prototype.constructor = Comment;
+
+}); // module: nodes/comment.js
+
+require.register("nodes/doctype.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Doctype
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Doctype` with the given `val`. 
+ *
+ * @param {String} val
+ * @api public
+ */
+
+var Doctype = module.exports = function Doctype(val) {
+  this.val = val;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Doctype.prototype = new Node;
+Doctype.prototype.constructor = Doctype;
+
+}); // module: nodes/doctype.js
+
+require.register("nodes/each.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Each
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize an `Each` node, representing iteration
+ *
+ * @param {String} obj
+ * @param {String} val
+ * @param {String} key
+ * @param {Block} block
+ * @api public
+ */
+
+var Each = module.exports = function Each(obj, val, key, block) {
+  this.obj = obj;
+  this.val = val;
+  this.key = key;
+  this.block = block;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Each.prototype = new Node;
+Each.prototype.constructor = Each;
+
+}); // module: nodes/each.js
+
+require.register("nodes/filter.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Filter
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node')
+  , Block = require('./block');
+
+/**
+ * Initialize a `Filter` node with the given 
+ * filter `name` and `block`.
+ *
+ * @param {String} name
+ * @param {Block|Node} block
+ * @api public
+ */
+
+var Filter = module.exports = function Filter(name, block, attrs) {
+  this.name = name;
+  this.block = block;
+  this.attrs = attrs;
+  this.isASTFilter = !block.nodes.every(function(node){ return node.isText });
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Filter.prototype = new Node;
+Filter.prototype.constructor = Filter;
+
+}); // module: nodes/filter.js
+
+require.register("nodes/index.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+exports.Node = require('./node');
+exports.Tag = require('./tag');
+exports.Code = require('./code');
+exports.Each = require('./each');
+exports.Case = require('./case');
+exports.Text = require('./text');
+exports.Block = require('./block');
+exports.Mixin = require('./mixin');
+exports.Filter = require('./filter');
+exports.Comment = require('./comment');
+exports.Literal = require('./literal');
+exports.BlockComment = require('./block-comment');
+exports.Doctype = require('./doctype');
+
+}); // module: nodes/index.js
+
+require.register("nodes/literal.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Literal
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Literal` node with the given `str.
+ *
+ * @param {String} str
+ * @api public
+ */
+
+var Literal = module.exports = function Literal(str) {
+  this.str = str
+    .replace(/\\/g, "\\\\")
+    .replace(/\n|\r\n/g, "\\n")
+    .replace(/'/g, "\\'");
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Literal.prototype = new Node;
+Literal.prototype.constructor = Literal;
+
+
+}); // module: nodes/literal.js
+
+require.register("nodes/mixin.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Mixin
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Attrs = require('./attrs');
+
+/**
+ * Initialize a new `Mixin` with `name` and `block`.
+ *
+ * @param {String} name
+ * @param {String} args
+ * @param {Block} block
+ * @api public
+ */
+
+var Mixin = module.exports = function Mixin(name, args, block, call){
+  this.name = name;
+  this.args = args;
+  this.block = block;
+  this.attrs = [];
+  this.call = call;
+};
+
+/**
+ * Inherit from `Attrs`.
+ */
+
+Mixin.prototype = new Attrs;
+Mixin.prototype.constructor = Mixin;
+
+
+
+}); // module: nodes/mixin.js
+
+require.register("nodes/node.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Node
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Initialize a `Node`.
+ *
+ * @api public
+ */
+
+var Node = module.exports = function Node(){};
+
+/**
+ * Clone this node (return itself)
+ *
+ * @return {Node}
+ * @api private
+ */
+
+Node.prototype.clone = function(){
+  return this;
+};
+
+}); // module: nodes/node.js
+
+require.register("nodes/tag.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Tag
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Attrs = require('./attrs'),
+    Block = require('./block'),
+    inlineTags = require('../inline-tags');
+
+/**
+ * Initialize a `Tag` node with the given tag `name` and optional `block`.
+ *
+ * @param {String} name
+ * @param {Block} block
+ * @api public
+ */
+
+var Tag = module.exports = function Tag(name, block) {
+  this.name = name;
+  this.attrs = [];
+  this.block = block || new Block;
+};
+
+/**
+ * Inherit from `Attrs`.
+ */
+
+Tag.prototype = new Attrs;
+Tag.prototype.constructor = Tag;
+
+
+/**
+ * Clone this tag.
+ *
+ * @return {Tag}
+ * @api private
+ */
+
+Tag.prototype.clone = function(){
+  var clone = new Tag(this.name, this.block.clone());
+  clone.line = this.line;
+  clone.attrs = this.attrs;
+  clone.textOnly = this.textOnly;
+  return clone;
+};
+
+/**
+ * Check if this tag is an inline tag.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+Tag.prototype.isInline = function(){
+  return ~inlineTags.indexOf(this.name);
+};
+
+/**
+ * Check if this tag's contents can be inlined.  Used for pretty printing.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+Tag.prototype.canInline = function(){
+  var nodes = this.block.nodes;
+
+  function isInline(node){
+    // Recurse if the node is a block
+    if (node.isBlock) return node.nodes.every(isInline);
+    return node.isText || (node.isInline && node.isInline());
+  }
+  
+  // Empty tag
+  if (!nodes.length) return true;
+  
+  // Text-only or inline-only tag
+  if (1 == nodes.length) return isInline(nodes[0]);
+  
+  // Multi-line inline-only tag
+  if (this.block.nodes.every(isInline)) {
+    for (var i = 1, len = nodes.length; i < len; ++i) {
+      if (nodes[i-1].isText && nodes[i].isText)
+        return false;
+    }
+    return true;
+  }
+  
+  // Mixed tag
+  return false;
+};
+}); // module: nodes/tag.js
+
+require.register("nodes/text.js", function(module, exports, require){
+
+/*!
+ * Jade - nodes - Text
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Text` node with optional `line`.
+ *
+ * @param {String} line
+ * @api public
+ */
+
+var Text = module.exports = function Text(line) {
+  this.val = '';
+  if ('string' == typeof line) this.val = line;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Text.prototype = new Node;
+Text.prototype.constructor = Text;
+
+
+/**
+ * Flag as text.
+ */
+
+Text.prototype.isText = true;
+}); // module: nodes/text.js
+
+require.register("parser.js", function(module, exports, require){
+
+/*!
+ * Jade - Parser
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Lexer = require('./lexer')
+  , nodes = require('./nodes');
+
+/**
+ * Initialize `Parser` with the given input `str` and `filename`.
+ *
+ * @param {String} str
+ * @param {String} filename
+ * @param {Object} options
+ * @api public
+ */
+
+var Parser = exports = module.exports = function Parser(str, filename, options){
+  this.input = str;
+  this.lexer = new Lexer(str, options);
+  this.filename = filename;
+  this.blocks = {};
+  this.mixins = {};
+  this.options = options;
+  this.contexts = [this];
+};
+
+/**
+ * Tags that may not contain tags.
+ */
+
+var textOnly = exports.textOnly = ['script', 'style'];
+
+/**
+ * Parser prototype.
+ */
+
+Parser.prototype = {
+
+  /**
+   * Push `parser` onto the context stack,
+   * or pop and return a `Parser`.
+   */
+
+  context: function(parser){
+    if (parser) {
+      this.contexts.push(parser);
+    } else {
+      return this.contexts.pop();
+    }
+  },
+
+  /**
+   * Return the next token object.
+   *
+   * @return {Object}
+   * @api private
+   */
+
+  advance: function(){
+    return this.lexer.advance();
+  },
+
+  /**
+   * Skip `n` tokens.
+   *
+   * @param {Number} n
+   * @api private
+   */
+
+  skip: function(n){
+    while (n--) this.advance();
+  },
+  
+  /**
+   * Single token lookahead.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  peek: function() {
+    return this.lookahead(1);
+  },
+  
+  /**
+   * Return lexer lineno.
+   *
+   * @return {Number}
+   * @api private
+   */
+  
+  line: function() {
+    return this.lexer.lineno;
+  },
+  
+  /**
+   * `n` token lookahead.
+   *
+   * @param {Number} n
+   * @return {Object}
+   * @api private
+   */
+  
+  lookahead: function(n){
+    return this.lexer.lookahead(n);
+  },
+  
+  /**
+   * Parse input returning a string of js for evaluation.
+   *
+   * @return {String}
+   * @api public
+   */
+  
+  parse: function(){
+    var block = new nodes.Block, parser;
+    block.line = this.line();
+
+    while ('eos' != this.peek().type) {
+      if ('newline' == this.peek().type) {
+        this.advance();
+      } else {
+        block.push(this.parseExpr());
+      }
+    }
+
+    if (parser = this.extending) {
+      this.context(parser);
+      var ast = parser.parse();
+      this.context();
+      // hoist mixins
+      for (var name in this.mixins)
+        ast.unshift(this.mixins[name]);
+      return ast;
+    }
+
+    return block;
+  },
+  
+  /**
+   * Expect the given type, or throw an exception.
+   *
+   * @param {String} type
+   * @api private
+   */
+  
+  expect: function(type){
+    if (this.peek().type === type) {
+      return this.advance();
+    } else {
+      throw new Error('expected "' + type + '", but got "' + this.peek().type + '"');
+    }
+  },
+  
+  /**
+   * Accept the given `type`.
+   *
+   * @param {String} type
+   * @api private
+   */
+  
+  accept: function(type){
+    if (this.peek().type === type) {
+      return this.advance();
+    }
+  },
+  
+  /**
+   *   tag
+   * | doctype
+   * | mixin
+   * | include
+   * | filter
+   * | comment
+   * | text
+   * | each
+   * | code
+   * | yield
+   * | id
+   * | class
+   * | interpolation
+   */
+  
+  parseExpr: function(){
+    switch (this.peek().type) {
+      case 'tag':
+        return this.parseTag();
+      case 'mixin':
+        return this.parseMixin();
+      case 'block':
+        return this.parseBlock();
+      case 'case':
+        return this.parseCase();
+      case 'when':
+        return this.parseWhen();
+      case 'default':
+        return this.parseDefault();
+      case 'extends':
+        return this.parseExtends();
+      case 'include':
+        return this.parseInclude();
+      case 'doctype':
+        return this.parseDoctype();
+      case 'filter':
+        return this.parseFilter();
+      case 'comment':
+        return this.parseComment();
+      case 'text':
+        return this.parseText();
+      case 'each':
+        return this.parseEach();
+      case 'code':
+        return this.parseCode();
+      case 'call':
+        return this.parseCall();
+      case 'interpolation':
+        return this.parseInterpolation();
+      case 'yield':
+        this.advance();
+        var block = new nodes.Block;
+        block.yield = true;
+        return block;
+      case 'id':
+      case 'class':
+        var tok = this.advance();
+        this.lexer.defer(this.lexer.tok('tag', 'div'));
+        this.lexer.defer(tok);
+        return this.parseExpr();
+      default:
+        throw new Error('unexpected token "' + this.peek().type + '"');
+    }
+  },
+  
+  /**
+   * Text
+   */
+  
+  parseText: function(){
+    var tok = this.expect('text')
+      , node = new nodes.Text(tok.val);
+    node.line = this.line();
+    return node;
+  },
+
+  /**
+   *   ':' expr
+   * | block
+   */
+
+  parseBlockExpansion: function(){
+    if (':' == this.peek().type) {
+      this.advance();
+      return new nodes.Block(this.parseExpr());
+    } else {
+      return this.block();
+    }
+  },
+
+  /**
+   * case
+   */
+
+  parseCase: function(){
+    var val = this.expect('case').val
+      , node = new nodes.Case(val);
+    node.line = this.line();
+    node.block = this.block();
+    return node;
+  },
+
+  /**
+   * when
+   */
+
+  parseWhen: function(){
+    var val = this.expect('when').val
+    return new nodes.Case.When(val, this.parseBlockExpansion());
+  },
+  
+  /**
+   * default
+   */
+
+  parseDefault: function(){
+    this.expect('default');
+    return new nodes.Case.When('default', this.parseBlockExpansion());
+  },
+
+  /**
+   * code
+   */
+  
+  parseCode: function(){
+    var tok = this.expect('code')
+      , node = new nodes.Code(tok.val, tok.buffer, tok.escape)
+      , block
+      , i = 1;
+    node.line = this.line();
+    while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i;
+    block = 'indent' == this.lookahead(i).type;
+    if (block) {
+      this.skip(i-1);
+      node.block = this.block();
+    }
+    return node;
+  },
+  
+  /**
+   * comment
+   */
+  
+  parseComment: function(){
+    var tok = this.expect('comment')
+      , node;
+
+    if ('indent' == this.peek().type) {
+      node = new nodes.BlockComment(tok.val, this.block(), tok.buffer);
+    } else {
+      node = new nodes.Comment(tok.val, tok.buffer);
+    }
+
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * doctype
+   */
+  
+  parseDoctype: function(){
+    var tok = this.expect('doctype')
+      , node = new nodes.Doctype(tok.val);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * filter attrs? text-block
+   */
+  
+  parseFilter: function(){
+    var block
+      , tok = this.expect('filter')
+      , attrs = this.accept('attrs');
+
+    this.lexer.pipeless = true;
+    block = this.parseTextBlock();
+    this.lexer.pipeless = false;
+
+    var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * tag ':' attrs? block
+   */
+  
+  parseASTFilter: function(){
+    var block
+      , tok = this.expect('tag')
+      , attrs = this.accept('attrs');
+
+    this.expect(':');
+    block = this.block();
+
+    var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * each block
+   */
+  
+  parseEach: function(){
+    var tok = this.expect('each')
+      , node = new nodes.Each(tok.code, tok.val, tok.key);
+    node.line = this.line();
+    node.block = this.block();
+    return node;
+  },
+
+  /**
+   * 'extends' name
+   */
+
+  parseExtends: function(){
+    var path = require('path')
+      , fs = require('fs')
+      , dirname = path.dirname
+      , basename = path.basename
+      , join = path.join;
+
+    if (!this.filename)
+      throw new Error('the "filename" option is required to extend templates');
+
+    var path = this.expect('extends').val.trim()
+      , dir = dirname(this.filename);
+
+    var path = join(dir, path + '.jade')
+      , str = fs.readFileSync(path, 'utf8')
+      , parser = new Parser(str, path, this.options);
+
+    parser.blocks = this.blocks;
+    parser.contexts = this.contexts;
+    this.extending = parser;
+
+    // TODO: null node
+    return new nodes.Literal('');
+  },
+
+  /**
+   * 'block' name block
+   */
+
+  parseBlock: function(){
+    var block = this.expect('block')
+      , mode = block.mode
+      , name = block.val.trim();
+
+    block = 'indent' == this.peek().type
+      ? this.block()
+      : new nodes.Block(new nodes.Literal(''));
+
+    var prev = this.blocks[name];
+
+    if (prev) {
+      switch (prev.mode) {
+        case 'append':
+          block.nodes = block.nodes.concat(prev.nodes);
+          prev = block;
+          break;
+        case 'prepend':
+          block.nodes = prev.nodes.concat(block.nodes);
+          prev = block;
+          break;
+      }
+    }
+
+    block.mode = mode;
+    return this.blocks[name] = prev || block;
+  },
+
+  /**
+   * include block?
+   */
+
+  parseInclude: function(){
+    var path = require('path')
+      , fs = require('fs')
+      , dirname = path.dirname
+      , basename = path.basename
+      , join = path.join;
+
+    var path = this.expect('include').val.trim()
+      , dir = dirname(this.filename);
+
+    if (!this.filename)
+      throw new Error('the "filename" option is required to use includes');
+
+    // no extension
+    if (!~basename(path).indexOf('.')) {
+      path += '.jade';
+    }
+
+    // non-jade
+    if ('.jade' != path.substr(-5)) {
+      var path = join(dir, path)
+        , str = fs.readFileSync(path, 'utf8');
+      return new nodes.Literal(str);
+    }
+
+    var path = join(dir, path)
+      , str = fs.readFileSync(path, 'utf8')
+     , parser = new Parser(str, path, this.options);
+    parser.blocks = this.blocks;
+    parser.mixins = this.mixins;
+
+    this.context(parser);
+    var ast = parser.parse();
+    this.context();
+    ast.filename = path;
+
+    if ('indent' == this.peek().type) {
+      ast.includeBlock().push(this.block());
+    }
+
+    return ast;
+  },
+
+  /**
+   * call ident block
+   */
+
+  parseCall: function(){
+    var tok = this.expect('call')
+      , name = tok.val
+      , args = tok.args
+      , mixin = new nodes.Mixin(name, args, new nodes.Block, true);
+
+    this.tag(mixin);
+    if (mixin.block.isEmpty()) mixin.block = null;
+    return mixin;
+  },
+
+  /**
+   * mixin block
+   */
+
+  parseMixin: function(){
+    var tok = this.expect('mixin')
+      , name = tok.val
+      , args = tok.args
+      , mixin;
+
+    // definition
+    if ('indent' == this.peek().type) {
+      mixin = new nodes.Mixin(name, args, this.block(), false);
+      this.mixins[name] = mixin;
+      return mixin;
+    // call
+    } else {
+      return new nodes.Mixin(name, args, null, true);
+    }
+  },
+
+  /**
+   * indent (text | newline)* outdent
+   */
+
+  parseTextBlock: function(){
+    var block = new nodes.Block;
+    block.line = this.line();
+    var spaces = this.expect('indent').val;
+    if (null == this._spaces) this._spaces = spaces;
+    var indent = Array(spaces - this._spaces + 1).join(' ');
+    while ('outdent' != this.peek().type) {
+      switch (this.peek().type) {
+        case 'newline':
+          this.advance();
+          break;
+        case 'indent':
+          this.parseTextBlock().nodes.forEach(function(node){
+            block.push(node);
+          });
+          break;
+        default:
+          var text = new nodes.Text(indent + this.advance().val);
+          text.line = this.line();
+          block.push(text);
+      }
+    }
+
+    if (spaces == this._spaces) this._spaces = null;
+    this.expect('outdent');
+    return block;
+  },
+
+  /**
+   * indent expr* outdent
+   */
+  
+  block: function(){
+    var block = new nodes.Block;
+    block.line = this.line();
+    this.expect('indent');
+    while ('outdent' != this.peek().type) {
+      if ('newline' == this.peek().type) {
+        this.advance();
+      } else {
+        block.push(this.parseExpr());
+      }
+    }
+    this.expect('outdent');
+    return block;
+  },
+
+  /**
+   * interpolation (attrs | class | id)* (text | code | ':')? newline* block?
+   */
+  
+  parseInterpolation: function(){
+    var tok = this.advance();
+    var tag = new nodes.Tag(tok.val);
+    tag.buffer = true;
+    return this.tag(tag);
+  },
+
+  /**
+   * tag (attrs | class | id)* (text | code | ':')? newline* block?
+   */
+  
+  parseTag: function(){
+    // ast-filter look-ahead
+    var i = 2;
+    if ('attrs' == this.lookahead(i).type) ++i;
+    if (':' == this.lookahead(i).type) {
+      if ('indent' == this.lookahead(++i).type) {
+        return this.parseASTFilter();
+      }
+    }
+
+    var tok = this.advance()
+      , tag = new nodes.Tag(tok.val);
+
+    tag.selfClosing = tok.selfClosing;
+
+    return this.tag(tag);
+  },
+
+  /**
+   * Parse tag.
+   */
+
+  tag: function(tag){
+    var dot;
+
+    tag.line = this.line();
+
+    // (attrs | class | id)*
+    out:
+      while (true) {
+        switch (this.peek().type) {
+          case 'id':
+          case 'class':
+            var tok = this.advance();
+            tag.setAttribute(tok.type, "'" + tok.val + "'");
+            continue;
+          case 'attrs':
+            var tok = this.advance()
+              , obj = tok.attrs
+              , escaped = tok.escaped
+              , names = Object.keys(obj);
+
+            if (tok.selfClosing) tag.selfClosing = true;
+
+            for (var i = 0, len = names.length; i < len; ++i) {
+              var name = names[i]
+                , val = obj[name];
+              tag.setAttribute(name, val, escaped[name]);
+            }
+            continue;
+          default:
+            break out;
+        }
+      }
+
+    // check immediate '.'
+    if ('.' == this.peek().val) {
+      dot = tag.textOnly = true;
+      this.advance();
+    }
+
+    // (text | code | ':')?
+    switch (this.peek().type) {
+      case 'text':
+        tag.block.push(this.parseText());
+        break;
+      case 'code':
+        tag.code = this.parseCode();
+        break;
+      case ':':
+        this.advance();
+        tag.block = new nodes.Block;
+        tag.block.push(this.parseExpr());
+        break;
+    }
+
+    // newline*
+    while ('newline' == this.peek().type) this.advance();
+
+    tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name);
+
+    // script special-case
+    if ('script' == tag.name) {
+      var type = tag.getAttribute('type');
+      if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) {
+        tag.textOnly = false;
+      }
+    }
+
+    // block?
+    if ('indent' == this.peek().type) {
+      if (tag.textOnly) {
+        this.lexer.pipeless = true;
+        tag.block = this.parseTextBlock();
+        this.lexer.pipeless = false;
+      } else {
+        var block = this.block();
+        if (tag.block) {
+          for (var i = 0, len = block.nodes.length; i < len; ++i) {
+            tag.block.push(block.nodes[i]);
+          }
+        } else {
+          tag.block = block;
+        }
+      }
+    }
+    
+    return tag;
+  }
+};
+
+}); // module: parser.js
+
+require.register("runtime.js", function(module, exports, require){
+
+/*!
+ * Jade - runtime
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Lame Array.isArray() polyfill for now.
+ */
+
+if (!Array.isArray) {
+  Array.isArray = function(arr){
+    return '[object Array]' == Object.prototype.toString.call(arr);
+  };
+}
+
+/**
+ * Lame Object.keys() polyfill for now.
+ */
+
+if (!Object.keys) {
+  Object.keys = function(obj){
+    var arr = [];
+    for (var key in obj) {
+      if (obj.hasOwnProperty(key)) {
+        arr.push(key);
+      }
+    }
+    return arr;
+  }
+}
+
+/**
+ * Merge two attribute objects giving precedence
+ * to values in object `b`. Classes are special-cased
+ * allowing for arrays and merging/joining appropriately
+ * resulting in a string.
+ *
+ * @param {Object} a
+ * @param {Object} b
+ * @return {Object} a
+ * @api private
+ */
+
+exports.merge = function merge(a, b) {
+  var ac = a['class'];
+  var bc = b['class'];
+
+  if (ac || bc) {
+    ac = ac || [];
+    bc = bc || [];
+    if (!Array.isArray(ac)) ac = [ac];
+    if (!Array.isArray(bc)) bc = [bc];
+    ac = ac.filter(nulls);
+    bc = bc.filter(nulls);
+    a['class'] = ac.concat(bc).join(' ');
+  }
+
+  for (var key in b) {
+    if (key != 'class') {
+      a[key] = b[key];
+    }
+  }
+
+  return a;
+};
+
+/**
+ * Filter null `val`s.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function nulls(val) {
+  return val != null;
+}
+
+/**
+ * Render the given attributes object.
+ *
+ * @param {Object} obj
+ * @param {Object} escaped
+ * @return {String}
+ * @api private
+ */
+
+exports.attrs = function attrs(obj, escaped){
+  var buf = []
+    , terse = obj.terse;
+
+  delete obj.terse;
+  var keys = Object.keys(obj)
+    , len = keys.length;
+
+  if (len) {
+    buf.push('');
+    for (var i = 0; i < len; ++i) {
+      var key = keys[i]
+        , val = obj[key];
+
+      if ('boolean' == typeof val || null == val) {
+        if (val) {
+          terse
+            ? buf.push(key)
+            : buf.push(key + '="' + key + '"');
+        }
+      } else if (0 == key.indexOf('data') && 'string' != typeof val) {
+        buf.push(key + "='" + JSON.stringify(val) + "'");
+      } else if ('class' == key && Array.isArray(val)) {
+        buf.push(key + '="' + exports.escape(val.join(' ')) + '"');
+      } else if (escaped && escaped[key]) {
+        buf.push(key + '="' + exports.escape(val) + '"');
+      } else {
+        buf.push(key + '="' + val + '"');
+      }
+    }
+  }
+
+  return buf.join(' ');
+};
+
+/**
+ * Escape the given string of `html`.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+exports.escape = function escape(html){
+  return String(html)
+    .replace(/&(?!(\w+|\#\d+);)/g, '&')
+    .replace(//g, '>')
+    .replace(/"/g, '"');
+};
+
+/**
+ * Re-throw the given `err` in context to the
+ * the jade in `filename` at the given `lineno`.
+ *
+ * @param {Error} err
+ * @param {String} filename
+ * @param {String} lineno
+ * @api private
+ */
+
+exports.rethrow = function rethrow(err, filename, lineno){
+  if (!filename) throw err;
+
+  var context = 3
+    , str = require('fs').readFileSync(filename, 'utf8')
+    , lines = str.split('\n')
+    , start = Math.max(lineno - context, 0)
+    , end = Math.min(lines.length, lineno + context);
+
+  // Error context
+  var context = lines.slice(start, end).map(function(line, i){
+    var curr = i + start + 1;
+    return (curr == lineno ? '  > ' : '    ')
+      + curr
+      + '| '
+      + line;
+  }).join('\n');
+
+  // Alter exception message
+  err.path = filename;
+  err.message = (filename || 'Jade') + ':' + lineno
+    + '\n' + context + '\n\n' + err.message;
+  throw err;
+};
+
+}); // module: runtime.js
+
+require.register("self-closing.js", function(module, exports, require){
+
+/*!
+ * Jade - self closing tags
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = [
+    'meta'
+  , 'img'
+  , 'link'
+  , 'input'
+  , 'source'
+  , 'area'
+  , 'base'
+  , 'col'
+  , 'br'
+  , 'hr'
+];
+}); // module: self-closing.js
+
+require.register("utils.js", function(module, exports, require){
+
+/*!
+ * Jade - utils
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Convert interpolation in the given string to JavaScript.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+var interpolate = exports.interpolate = function(str){
+  return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){
+    return escape
+      ? str
+      : "' + "
+        + ('!' == flag ? '' : 'escape')
+        + "((interp = " + code.replace(/\\'/g, "'")
+        + ") == null ? '' : interp) + '";
+  });
+};
+
+/**
+ * Escape single quotes in `str`.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+var escape = exports.escape = function(str) {
+  return str.replace(/'/g, "\\'");
+};
+
+/**
+ * Interpolate, and escape the given `str`.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+exports.text = function(str){
+  return interpolate(escape(str));
+};
+}); // module: utils.js
+
+window.jade = require("jade");
+})();
diff --git a/node_modules/jade/jade.md b/node_modules/jade/jade.md
new file mode 100644
index 0000000..051dc03
--- /dev/null
+++ b/node_modules/jade/jade.md
@@ -0,0 +1,510 @@
+
+# Jade
+
+  The jade template engine for node.js
+
+## Synopsis
+
+    jade [-h|--help] [-v|--version] [-o|--obj STR]
+         [-O|--out DIR] [-p|--path PATH] [-P|--pretty]
+         [-c|--client] [-D|--no-debug]
+
+## Examples
+
+  translate jade the templates dir
+
+    $ jade templates
+
+  create {foo,bar}.html
+
+    $ jade {foo,bar}.jade
+
+  jade over stdio
+
+    $ jade < my.jade > my.html
+
+  jade over s
+
+    $ echo "h1 Jade!" | jade
+
+  foo, bar dirs rendering to /tmp
+
+    $ jade foo bar --out /tmp
+
+  compile client-side templates without debugging
+  instrumentation, making the output javascript
+  very light-weight. This requires runtime.js
+  in your projects.
+
+     $ jade --client --no-debug < my.jade
+
+## Tags
+
+  Tags are simply nested via whitespace, closing
+  tags defined for you. These indents are called "blocks".
+  
+    ul
+      li
+        a Foo
+      li
+        a Bar
+
+  You may have several tags in one "block":
+  
+    ul
+      li
+        a Foo
+        a Bar
+        a Baz
+
+## Self-closing Tags
+
+  Some tags are flagged as self-closing by default, such
+  as `meta`, `link`, and so on. To explicitly self-close
+  a tag simply append the `/` character:
+
+     foo/
+     foo(bar='baz')/
+
+  Would yield:
+  
+     
+     
+
+## Attributes
+
+  Tag attributes look similar to HTML, however
+  the values are regular JavaScript, here are
+  some examples:
+  
+    a(href='google.com') Google
+    a(class='button', href='google.com') Google
+
+  As mentioned the attribute values are just JavaScript,
+  this means ternary operations and other JavaScript expressions
+  work just fine:
+  
+    body(class=user.authenticated ? 'authenticated' : 'anonymous')
+    a(href=user.website || 'http://google.com')
+
+  Multiple lines work too:
+
+    input(type='checkbox',
+      name='agreement',
+      checked)
+
+  Multiple lines without the comma work fine:
+
+    input(type='checkbox'
+      name='agreement'
+      checked)
+
+  Funky whitespace? fine:
+
+    input(
+      type='checkbox'
+      name='agreement'
+      checked)
+
+## Boolean attributes
+
+  Boolean attributes are mirrored by Jade, and accept
+  bools, aka _true_ or _false_. When no value is specified
+  _true_ is assumed. For example:
+  
+    input(type="checkbox", checked)
+    // => ""
+
+  For example if the checkbox was for an agreement, perhaps `user.agreed`
+  was _true_ the following would also output 'checked="checked"':
+  
+     input(type="checkbox", checked=user.agreed)
+
+## Class attributes
+
+  The _class_ attribute accepts an array of classes,
+  this can be handy when generated from a javascript
+  function etc:
+  
+    classes = ['foo', 'bar', 'baz']
+    a(class=classes)
+    // => ""
+
+## Class literal
+
+  Classes may be defined using a ".CLASSNAME" syntax:
+  
+     .button
+     // => "
"
+  
+  Or chained:
+  
+     .large.button
+     // => "
"
+
+  The previous defaulted to divs, however you
+  may also specify the tag type:
+  
+      h1.title My Title
+      // => "
My Title
"
+
+## Id literal
+
+  Much like the class literal there's an id literal:
+  
+    #user-1
+    // => "
"
+
+  Again we may specify the tag as well:
+  
+    ul#menu
+      li: a(href='/home') Home
+      li: a(href='/store') Store
+      li: a(href='/contact') Contact
+
+  Finally all of these may be used in any combination,
+  the following are all valid tags:
+  
+    a.button#contact(style: 'color: red') Contact
+    a.button(style: 'color: red')#contact Contact
+    a(style: 'color: red').button#contact Contact
+
+## Block expansion
+
+  Jade supports the concept of "block expansion", in which
+  using a trailing ":" after a tag will inject a block:
+  
+    ul
+      li: a Foo
+      li: a Bar
+      li: a Baz
+
+## Text
+
+   Arbitrary text may follow tags:
+   
+     p Welcome to my site
+  
+  yields:
+  
+     
Welcome to my site

+
+## Pipe text
+
+  Another form of text is "pipe" text. Pipes act
+  as the text margin for large bodies of text.
+
+    p
+      | This is a large
+      | body of text for
+      | this tag.
+      | 
+      | Nothing too
+      | exciting.
+
+  yields:
+  
+    
This is a large
+    body of text for
+    this tag.
+
+    Nothing too
+    exciting.
+    

+
+  Using pipes we can also specify regular Jade tags
+  within the text:
+  
+    p
+      | Click to visit
+      a(href='http://google.com') Google
+      | if you want.
+
+## Text only tags
+
+  As an alternative to pipe text you may add
+  a trailing "." to indicate that the block
+  contains nothing but plain-text, no tags:
+
+    p.
+      This is a large
+      body of text for
+      this tag.
+
+      Nothing too
+      exciting.
+
+  Some tags are text-only by default, for example
+  _script_, _textarea_, and _style_ tags do not
+  contain nested HTML so Jade implies the trailing ".":
+  
+    script
+      if (foo) {
+        bar();
+      }
+
+    style
+      body {
+        padding: 50px;
+        font: 14px Helvetica;
+      }
+
+## Template script tags
+
+  Sometimes it's useful to define HTML in script
+  tags using Jade, typically for client-side templates.
+  
+  To do this simply give the _script_ tag an arbitrary
+  _type_ attribute such as _text/x-template_:
+  
+    script(type='text/template')
+      h1 Look!
+      p Jade still works in here!
+
+## Interpolation
+
+  Both plain-text and piped-text support interpolation,
+  which comes in two forms, escapes and non-escaped. The
+  following will output the _user.name_ in the paragraph
+  but HTML within it will be escaped to prevent XSS attacks:
+  
+    p Welcome #{user.name}
+
+  The following syntax is identical however it will _not_ escape
+  HTML, and should only be used with strings that you trust:
+  
+    p Welcome !{user.name}
+  
+## Inline HTML
+
+  Sometimes constructing small inline snippets of HTML
+  in Jade can be annoying, luckily we can add plain
+  HTML as well:
+  
+    p Welcome #{user.name}
+
+## Code
+
+  To buffer output with Jade simply use _=_ at the beginning
+  of a line or after a tag. This method escapes any HTML
+  present in the string.
+  
+    p= user.description
+    
+  To buffer output unescaped use the _!=_ variant, but again
+  be careful of XSS.
+  
+    p!= user.description
+  
+  The final way to mess with JavaScript code in Jade is the unbuffered
+  _-_, which can be used for conditionals, defining variables etc:
+  
+    - var user = { description: 'foo bar baz' }
+    #user
+      - if (user.description) {
+        h2 Description
+        p.description= user.description
+      - }
+
+   When compiled blocks are wrapped in anonymous functions, so the
+   following is also valid, without braces:
+   
+     - var user = { description: 'foo bar baz' }
+     #user
+       - if (user.description)
+         h2 Description
+         p.description= user.description
+
+   If you really want you could even use `.forEach()` and others:
+   
+    - users.forEach(function(user){
+      .user
+        h2= user.name
+        p User #{user.name} is #{user.age} years old
+    - })
+
+   Taking this further Jade provides some syntax for conditionals,
+   iteration, switch statements etc. Let's look at those next!
+
+## Assignment
+
+  Jade's first-class assignment is simple, simply use the _=_
+  operator and Jade will _var_ it for you. The following are equivalent:
+  
+    - var user = { name: 'tobi' }
+    user = { name: 'tobi' }
+
+## Conditionals
+
+  Jade's first-class conditional syntax allows for optional
+  parenthesis, and you may now omit the leading _-_ otherwise
+  it's identical, still just regular javascript:
+  
+    user = { description: 'foo bar baz' }
+    #user
+      if user.description
+        h2 Description
+        p.description= user.description
+
+  Jade provides the negated version, _unless_ as well, the following
+  are equivalent:
+  
+    - if (!(user.isAnonymous))
+      p You're logged in as #{user.name}
+
+    unless user.isAnonymous
+      p You're logged in as #{user.name}
+
+## Iteration
+
+  JavaScript's _for_ loops don't look very declarative, so Jade
+  also provides its own _for_ loop construct, aliased as _each_:
+
+    for user in users
+      .user
+        h2= user.name
+        p user #{user.name} is #{user.age} year old
+
+   As mentioned _each_ is identical:
+   
+     each user in users
+       .user
+         h2= user.name
+
+   If necessary the index is available as well:
+   
+      for user, i in users
+        .user(class='user-#{i}')
+          h2= user.name
+
+   Remember, it's just JavaScript:
+   
+      ul#letters
+        for letter in ['a', 'b', 'c']
+          li= letter
+
+## Mixins
+
+  Mixins provide a way to define jade "functions" which "mix in"
+  their contents when called. This is useful for abstracting
+  out large fragments of Jade.
+
+  The simplest possible mixin which accepts no arguments might
+  look like this:
+  
+      mixin hello
+        p Hello
+
+   You use a mixin by placing `+` before the name:
+
+      +hello
+
+   For something a little more dynamic, mixins can take
+   arguments, the mixin itself is converted to a javascript
+   function internally:
+   
+       mixin hello(user)
+         p Hello #{user}
+
+       +hello('Tobi')
+  
+   Yields:
+
+       
Hello Tobi

+
+  Mixins may optionally take blocks, when a block is passed
+  its contents becomes the implicit `block` argument. For
+  example here is a mixin passed a block, and also invoked
+  without passing a block:
+
+      mixin article(title)
+        .article
+          .article-wrapper
+            h1= title
+            if block
+              block
+            else
+              p No content provided
+      
+      +article('Hello world')
+      
+      +article('Hello world')
+        p This is my
+        p Amazing article
+
+   yields:
+   
+       

+         

+           
Hello world

+           
No content provided

+         

+       

+
+       

+         

+           
Hello world

+           
This is my

+           
Amazing article

+         

+       

+
+  Mixins can even take attributes, just like a tag. When
+  attributes are passed they become the implicit `attributes`
+  argument. Individual attributes can be accessed just like
+  normal object properties:
+  
+      mixin centered
+        .centered(class=attributes.class)
+          block
+      
+      +centered.bold Hello world
+      
+      +centered.red
+        p This is my
+        p Amazing article
+  
+   yields:
+   
+       
Hello world

+       

+         
This is my

+         
Amazing article

+       

+  
+   If you use `attributes` directly, *all* passed attributes
+   get used:
+   
+      mixin link
+        a.menu(attributes)
+          block
+      
+      +link.highlight(href='#top') Top
+      +link#sec1.plain(href='#section1') Section 1
+      +link#sec2.plain(href='#section2') Section 2
+  
+   yields:
+   
+       Top
+       Section 1
+       Section 2
+   
+   If you pass arguments, they must directly follow the mixin:
+   
+      mixin list(arr)
+        if block
+          .title
+            block
+        ul(attributes)
+          each item in arr
+            li= item
+      
+      +list(['foo', 'bar', 'baz'])(id='myList', class='bold')
+  
+   yields:
+   
+       
    
+         
  • foo
    • 
+         
  • bar
    • 
+         
  • baz
    • 
+       

diff --git a/node_modules/jade/jade.min.js b/node_modules/jade/jade.min.js
new file mode 100644
index 0000000..72e4535
--- /dev/null
+++ b/node_modules/jade/jade.min.js
@@ -0,0 +1,2 @@
+(function(){function require(p){var path=require.resolve(p),mod=require.modules[path];if(!mod)throw new Error('failed to require "'+p+'"');return mod.exports||(mod.exports={},mod.call(mod.exports,mod,mod.exports,require.relative(path))),mod.exports}require.modules={},require.resolve=function(path){var orig=path,reg=path+".js",index=path+"/index.js";return require.modules[reg]&®||require.modules[index]&&index||orig},require.register=function(path,fn){require.modules[path]=fn},require.relative=function(parent){return function(p){if("."!=p.charAt(0))return require(p);var path=parent.split("/"),segs=p.split("/");path.pop();for(var i=0;i",this.doctype=doctype,this.terse="5"==name||"html"==name,this.xml=0==this.doctype.indexOf("1&&!escape&&block.nodes[0].isText&&block.nodes[1].isText&&this.prettyIndent(1,!0);for(var i=0;i0&&!escape&&block.nodes[i].isText&&block.nodes[i-1].isText&&this.prettyIndent(1,!1),this.visit(block.nodes[i]),block.nodes[i+1]&&block.nodes[i].isText&&block.nodes[i+1].isText&&this.buffer("\\n")},visitDoctype:function(doctype){doctype&&(doctype.val||!this.doctype)&&this.setDoctype(doctype.val||"default"),this.doctype&&this.buffer(this.doctype),this.hasCompiledDoctype=!0},visitMixin:function(mixin){var name=mixin.name.replace(/-/g,"_")+"_mixin",args=mixin.args||"",block=mixin.block,attrs=mixin.attrs,pp=this.pp;if(mixin.call){pp&&this.buf.push("__indent.push('"+Array(this.indents+1).join("  ")+"');");if(block||attrs.length){this.buf.push(name+".call({");if(block){this.buf.push("block: function(){"),this.parentIndents++;var _indents=this.indents;this.indents=0,this.visit(mixin.block),this.indents=_indents,this.parentIndents--,attrs.length?this.buf.push("},"):this.buf.push("}")}if(attrs.length){var val=this.attrs(attrs);val.inherits?this.buf.push("attributes: merge({"+val.buf+"}, attributes), escaped: merge("+val.escaped+", escaped, true)"):this.buf.push("attributes: {"+val.buf+"}, escaped: "+val.escaped)}args?this.buf.push("}, "+args+");"):this.buf.push("});")}else this.buf.push(name+"("+args+");");pp&&this.buf.push("__indent.pop();")}else this.buf.push("var "+name+" = function("+args+"){"),this.buf.push("var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};"),this.parentIndents++,this.visit(block),this.parentIndents--,this.buf.push("};")},visitTag:function(tag){this.indents++;var name=tag.name,pp=this.pp;tag.buffer&&(name="' + ("+name+") + '"),this.hasCompiledTag||(!this.hasCompiledDoctype&&"html"==name&&this.visitDoctype(),this.hasCompiledTag=!0),pp&&!tag.isInline()&&this.prettyIndent(0,!0),(~selfClosing.indexOf(name)||tag.selfClosing)&&!this.xml?(this.buffer("<"+name),this.visitAttributes(tag.attrs),this.terse?this.buffer(">"):this.buffer("/>")):(tag.attrs.length?(this.buffer("<"+name),tag.attrs.length&&this.visitAttributes(tag.attrs),this.buffer(">")):this.buffer("<"+name+">"),tag.code&&this.visitCode(tag.code),this.escape="pre"==tag.name,this.visit(tag.block),pp&&!tag.isInline()&&"pre"!=tag.name&&!tag.canInline()&&this.prettyIndent(0,!0),this.buffer("")),this.indents--},visitFilter:function(filter){var fn=filters[filter.name];if(!fn)throw filter.isASTFilter?new Error('unknown ast filter "'+filter.name+':"'):new Error('unknown filter ":'+filter.name+'"');if(filter.isASTFilter)this.buf.push(fn(filter.block,this,filter.attrs));else{var text=filter.block.nodes.map(function(node){return node.val}).join("\n");filter.attrs=filter.attrs||{},filter.attrs.filename=this.options.filename,this.buffer(utils.text(fn(text,filter.attrs)))}},visitText:function(text){text=utils.text(text.val.replace(/\\/g,"\\\\")),this.escape&&(text=escape(text)),this.buffer(text)},visitComment:function(comment){if(!comment.buffer)return;this.pp&&this.prettyIndent(1,!0),this.buffer("")},visitBlockComment:function(comment){if(!comment.buffer)return;0==comment.val.trim().indexOf("if")?(this.buffer("")):(this.buffer(""))},visitCode:function(code){if(code.buffer){var val=code.val.trimLeft();this.buf.push("var __val__ = "+val),val='null == __val__ ? "" : __val__',code.escape&&(val="escape("+val+")"),this.buf.push("buf.push("+val+");")}else this.buf.push(code.val);code.block&&(code.buffer||this.buf.push("{"),this.visit(code.block),code.buffer||this.buf.push("}"))},visitEach:function(each){this.buf.push("// iterate "+each.obj+"\n"+";(function(){\n"+"  if ('number' == typeof "+each.obj+".length) {\n"+"    for (var "+each.key+" = 0, $$l = "+each.obj+".length; "+each.key+" < $$l; "+each.key+"++) {\n"+"      var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push("    }\n  } else {\n    for (var "+each.key+" in "+each.obj+") {\n"+"      if ("+each.obj+".hasOwnProperty("+each.key+")){"+"      var "+each.val+" = "+each.obj+"["+each.key+"];\n"),this.visit(each.block),this.buf.push("      }\n"),this.buf.push("   }\n  }\n}).call(this);\n")},visitAttributes:function(attrs){var val=this.attrs(attrs);val.inherits?this.buf.push("buf.push(attrs(merge({ "+val.buf+" }, attributes), merge("+val.escaped+", escaped, true)));"):val.constant?(eval("var buf={"+val.buf+"};"),this.buffer(runtime.attrs(buf,JSON.parse(val.escaped)),!0)):this.buf.push("buf.push(attrs({ "+val.buf+" }, "+val.escaped+"));")},attrs:function(attrs){var buf=[],classes=[],escaped={},constant=attrs.every(function(attr){return isConstant(attr.val)}),inherits=!1;return this.terse&&buf.push("terse: true"),attrs.forEach(function(attr){if(attr.name=="attributes")return inherits=!0;escaped[attr.name]=attr.escaped;if(attr.name=="class")classes.push("("+attr.val+")");else{var pair="'"+attr.name+"':("+attr.val+")";buf.push(pair)}}),classes.length&&(classes=classes.join(" + ' ' + "),buf.push("class: "+classes)),{buf:buf.join(", ").replace("class:",'"class":'),escaped:JSON.stringify(escaped),inherits:inherits,constant:constant}}};function isConstant(val){if(/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val))return!0;if(!isNaN(Number(val)))return!0;var matches;return(matches=/^ *\[(.*)\] *$/.exec(val))?matches[1].split(",").every(isConstant):!1}function escape(html){return String(html).replace(/&(?!\w+;)/g,"&").replace(//g,">").replace(/"/g,""")}}),require.register("doctypes.js",function(module,exports,require){module.exports={5:"","default":"",xml:'',transitional:'',strict:'',frameset:'',1.1:'',basic:'',mobile:''}}),require.register("filters.js",function(module,exports,require){module.exports={cdata:function(str){return""},sass:function(str){str=str.replace(/\\n/g,"\n");var sass=require("sass").render(str).replace(/\n/g,"\\n");return'"},stylus:function(str,options){var ret;str=str.replace(/\\n/g,"\n");var stylus=require("stylus");return stylus(str,options).render(function(err,css){if(err)throw err;ret=css.replace(/\n/g,"\\n")}),'"},less:function(str){var ret;return str=str.replace(/\\n/g,"\n"),require("less").render(str,function(err,css){if(err)throw err;ret='"}),ret},markdown:function(str){var md;try{md=require("markdown")}catch(err){try{md=require("discount")}catch(err){try{md=require("markdown-js")}catch(err){try{md=require("marked")}catch(err){throw new Error("Cannot find markdown library, install markdown, discount, or marked.")}}}}return str=str.replace(/\\n/g,"\n"),md.parse(str).replace(/\n/g,"\\n").replace(/'/g,"'")},coffeescript:function(str){str=str.replace(/\\n/g,"\n");var js=require("coffee-script").compile(str).replace(/\\/g,"\\\\").replace(/\n/g,"\\n");return'"}}}),require.register("inline-tags.js",function(module,exports,require){module.exports=["a","abbr","acronym","b","br","code","em","font","i","img","ins","kbd","map","samp","small","span","strong","sub","sup"]}),require.register("jade.js",function(module,exports,require){var Parser=require("./parser"),Lexer=require("./lexer"),Compiler=require("./compiler"),runtime=require("./runtime");exports.version="0.26.1",exports.selfClosing=require("./self-closing"),exports.doctypes=require("./doctypes"),exports.filters=require("./filters"),exports.utils=require("./utils"),exports.Compiler=Compiler,exports.Parser=Parser,exports.Lexer=Lexer,exports.nodes=require("./nodes"),exports.runtime=runtime,exports.cache={};function parse(str,options){try{var parser=new Parser(str,options.filename,options),compiler=new(options.compiler||Compiler)(parser.parse(),options),js=compiler.compile();return options.debug&&console.error("\nCompiled Function:\n\n%s",js.replace(/^/gm,"  ")),"var buf = [];\n"+(options.self?"var self = locals || {};\n"+js:"with (locals || {}) {\n"+js+"\n}\n")+'return buf.join("");'}catch(err){parser=parser.context(),runtime.rethrow(err,parser.filename,parser.lexer.lineno)}}exports.compile=function(str,options){var options=options||{},client=options.client,filename=options.filename?JSON.stringify(options.filename):"undefined",fn;return options.compileDebug!==!1?fn=["var __jade = [{ lineno: 1, filename: "+filename+" }];","try {",parse(String(str),options),"} catch (err) {","  rethrow(err, __jade[0].filename, __jade[0].lineno);","}"].join("\n"):fn=parse(String(str),options),client&&(fn="attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n"+fn),fn=new Function("locals, attrs, escape, rethrow, merge",fn),client?fn:function(locals){return fn(locals,runtime.attrs,runtime.escape,runtime.rethrow,runtime.merge)}},exports.render=function(str,options,fn){"function"==typeof options&&(fn=options,options={});if(options.cache&&!options.filename)return fn(new Error('the "filename" option is required for caching'));try{var path=options.filename,tmpl=options.cache?exports.cache[path]||(exports.cache[path]=exports.compile(str,options)):exports.compile(str,options);fn(null,tmpl(options))}catch(err){fn(err)}},exports.renderFile=function(path,options,fn){var key=path+":string";"function"==typeof options&&(fn=options,options={});try{options.filename=path;var str=options.cache?exports.cache[key]||(exports.cache[key]=fs.readFileSync(path,"utf8")):fs.readFileSync(path,"utf8");exports.render(str,options,fn)}catch(err){fn(err)}},exports.__express=exports.renderFile}),require.register("lexer.js",function(module,exports,require){var Lexer=module.exports=function Lexer(str,options){options=options||{},this.input=str.replace(/\r\n|\r/g,"\n"),this.colons=options.colons,this.deferredTokens=[],this.lastIndents=0,this.lineno=1,this.stash=[],this.indentStack=[],this.indentRe=null,this.pipeless=!1};Lexer.prototype={tok:function(type,val){return{type:type,line:this.lineno,val:val}},consume:function(len){this.input=this.input.substr(len)},scan:function(regexp,type){var captures;if(captures=regexp.exec(this.input))return this.consume(captures[0].length),this.tok(type,captures[1])},defer:function(tok){this.deferredTokens.push(tok)},lookahead:function(n){var fetch=n-this.stash.length;while(fetch-->0)this.stash.push(this.next());return this.stash[--n]},indexOfDelimiters:function(start,end){var str=this.input,nstart=0,nend=0,pos=0;for(var i=0,len=str.length;iindents)this.stash.push(this.tok("outdent")),this.indentStack.shift();tok=this.stash.pop()}else indents&&indents!=this.indentStack[0]?(this.indentStack.unshift(indents),tok=this.tok("indent",indents)):tok=this.tok("newline");return tok}},pipelessText:function(){if(this.pipeless){if("\n"==this.input[0])return;var i=this.input.indexOf("\n");-1==i&&(i=this.input.length);var str=this.input.substr(0,i);return this.consume(str.length),this.tok("text",str)}},colon:function(){return this.scan(/^: */,":")},advance:function(){return this.stashed()||this.next()},next:function(){return this.deferred()||this.blank()||this.eos()||this.pipelessText()||this.yield()||this.doctype()||this.interpolation()||this["case"]()||this.when()||this["default"]()||this["extends"]()||this.append()||this.prepend()||this.block()||this.include()||this.mixin()||this.call()||this.conditional()||this.each()||this["while"]()||this.assignment()||this.tag()||this.filter()||this.code()||this.id()||this.className()||this.attrs()||this.indent()||this.comment()||this.colon()||this.text()}}}),require.register("nodes/attrs.js",function(module,exports,require){var Node=require("./node"),Block=require("./block"),Attrs=module.exports=function Attrs(){this.attrs=[]};Attrs.prototype=new Node,Attrs.prototype.constructor=Attrs,Attrs.prototype.setAttribute=function(name,val,escaped){return this.attrs.push({name:name,val:val,escaped:escaped}),this},Attrs.prototype.removeAttribute=function(name){for(var i=0,len=this.attrs.length;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?"  > ":"    ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err}}),require.register("self-closing.js",function(module,exports,require){module.exports=["meta","img","link","input","source","area","base","col","br","hr"]}),require.register("utils.js",function(module,exports,require){var interpolate=exports.interpolate=function(str){return str.replace(/(\\)?([#!]){(.*?)}/g,function(str,escape,flag,code){return escape?str:"' + "+("!"==flag?"":"escape")+"((interp = "+code.replace(/\\'/g,"'")+") == null ? '' : interp) + '"})},escape=exports.escape=function(str){return str.replace(/'/g,"\\'")};exports.text=function(str){return interpolate(escape(str))}}),window.jade=require("jade")})();
\ No newline at end of file
diff --git a/node_modules/jade/lib/compiler.js b/node_modules/jade/lib/compiler.js
new file mode 100644
index 0000000..516ac83
--- /dev/null
+++ b/node_modules/jade/lib/compiler.js
@@ -0,0 +1,642 @@
+
+/*!
+ * Jade - Compiler
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var nodes = require('./nodes')
+  , filters = require('./filters')
+  , doctypes = require('./doctypes')
+  , selfClosing = require('./self-closing')
+  , runtime = require('./runtime')
+  , utils = require('./utils');
+
+// if browser
+//
+// if (!Object.keys) {
+//   Object.keys = function(obj){
+//     var arr = [];
+//     for (var key in obj) {
+//       if (obj.hasOwnProperty(key)) {
+//         arr.push(key);
+//       }
+//     }
+//     return arr;
+//   }
+// }
+//
+// if (!String.prototype.trimLeft) {
+//   String.prototype.trimLeft = function(){
+//     return this.replace(/^\s+/, '');
+//   }
+// }
+//
+// end
+
+
+/**
+ * Initialize `Compiler` with the given `node`.
+ *
+ * @param {Node} node
+ * @param {Object} options
+ * @api public
+ */
+
+var Compiler = module.exports = function Compiler(node, options) {
+  this.options = options = options || {};
+  this.node = node;
+  this.hasCompiledDoctype = false;
+  this.hasCompiledTag = false;
+  this.pp = options.pretty || false;
+  this.debug = false !== options.compileDebug;
+  this.indents = 0;
+  this.parentIndents = 0;
+  if (options.doctype) this.setDoctype(options.doctype);
+};
+
+/**
+ * Compiler prototype.
+ */
+
+Compiler.prototype = {
+
+  /**
+   * Compile parse tree to JavaScript.
+   *
+   * @api public
+   */
+
+  compile: function(){
+    this.buf = ['var interp;'];
+    if (this.pp) this.buf.push("var __indent = [];");
+    this.lastBufferedIdx = -1;
+    this.visit(this.node);
+    return this.buf.join('\n');
+  },
+
+  /**
+   * Sets the default doctype `name`. Sets terse mode to `true` when
+   * html 5 is used, causing self-closing tags to end with ">" vs "/>",
+   * and boolean attributes are not mirrored.
+   *
+   * @param {string} name
+   * @api public
+   */
+
+  setDoctype: function(name){
+    var doctype = doctypes[(name || 'default').toLowerCase()];
+    doctype = doctype || '';
+    this.doctype = doctype;
+    this.terse = '5' == name || 'html' == name;
+    this.xml = 0 == this.doctype.indexOf(' 1 && !escape && block.nodes[0].isText && block.nodes[1].isText)
+      this.prettyIndent(1, true);
+    
+    for (var i = 0; i < len; ++i) {
+      // Pretty print text
+      if (pp && i > 0 && !escape && block.nodes[i].isText && block.nodes[i-1].isText)
+        this.prettyIndent(1, false);
+      
+      this.visit(block.nodes[i]);
+      // Multiple text nodes are separated by newlines
+      if (block.nodes[i+1] && block.nodes[i].isText && block.nodes[i+1].isText)
+        this.buffer('\\n');
+    }
+  },
+
+  /**
+   * Visit `doctype`. Sets terse mode to `true` when html 5
+   * is used, causing self-closing tags to end with ">" vs "/>",
+   * and boolean attributes are not mirrored.
+   *
+   * @param {Doctype} doctype
+   * @api public
+   */
+
+  visitDoctype: function(doctype){
+    if (doctype && (doctype.val || !this.doctype)) {
+      this.setDoctype(doctype.val || 'default');
+    }
+
+    if (this.doctype) this.buffer(this.doctype);
+    this.hasCompiledDoctype = true;
+  },
+
+  /**
+   * Visit `mixin`, generating a function that
+   * may be called within the template.
+   *
+   * @param {Mixin} mixin
+   * @api public
+   */
+
+  visitMixin: function(mixin){
+    var name = mixin.name.replace(/-/g, '_') + '_mixin'
+      , args = mixin.args || ''
+      , block = mixin.block
+      , attrs = mixin.attrs
+      , pp = this.pp;
+
+    if (mixin.call) {
+      if (pp) this.buf.push("__indent.push('" + Array(this.indents + 1).join('  ') + "');")
+      if (block || attrs.length) {
+        
+        this.buf.push(name + '.call({');
+        
+        if (block) {
+          this.buf.push('block: function(){');
+          
+          // Render block with no indents, dynamically added when rendered
+          this.parentIndents++;
+          var _indents = this.indents;
+          this.indents = 0;
+          this.visit(mixin.block);
+          this.indents = _indents;
+          this.parentIndents--;
+          
+          if (attrs.length) {
+            this.buf.push('},');
+          } else {
+            this.buf.push('}');
+          }
+        }
+        
+        if (attrs.length) {
+          var val = this.attrs(attrs);
+          if (val.inherits) {
+            this.buf.push('attributes: merge({' + val.buf
+                + '}, attributes), escaped: merge(' + val.escaped + ', escaped, true)');
+          } else {
+            this.buf.push('attributes: {' + val.buf + '}, escaped: ' + val.escaped);
+          }
+        }
+        
+        if (args) {
+          this.buf.push('}, ' + args + ');');
+        } else {
+          this.buf.push('});');
+        }
+        
+      } else {
+        this.buf.push(name + '(' + args + ');');
+      }
+      if (pp) this.buf.push("__indent.pop();")
+    } else {
+      this.buf.push('var ' + name + ' = function(' + args + '){');
+      this.buf.push('var block = this.block, attributes = this.attributes || {}, escaped = this.escaped || {};');
+      this.parentIndents++;
+      this.visit(block);
+      this.parentIndents--;
+      this.buf.push('};');
+    }
+  },
+
+  /**
+   * Visit `tag` buffering tag markup, generating
+   * attributes, visiting the `tag`'s code and block.
+   *
+   * @param {Tag} tag
+   * @api public
+   */
+
+  visitTag: function(tag){
+    this.indents++;
+    var name = tag.name
+      , pp = this.pp;
+
+    if (tag.buffer) name = "' + (" + name + ") + '";
+
+    if (!this.hasCompiledTag) {
+      if (!this.hasCompiledDoctype && 'html' == name) {
+        this.visitDoctype();
+      }
+      this.hasCompiledTag = true;
+    }
+
+    // pretty print
+    if (pp && !tag.isInline())
+      this.prettyIndent(0, true);
+
+    if ((~selfClosing.indexOf(name) || tag.selfClosing) && !this.xml) {
+      this.buffer('<' + name);
+      this.visitAttributes(tag.attrs);
+      this.terse
+        ? this.buffer('>')
+        : this.buffer('/>');
+    } else {
+      // Optimize attributes buffering
+      if (tag.attrs.length) {
+        this.buffer('<' + name);
+        if (tag.attrs.length) this.visitAttributes(tag.attrs);
+        this.buffer('>');
+      } else {
+        this.buffer('<' + name + '>');
+      }
+      if (tag.code) this.visitCode(tag.code);
+      this.escape = 'pre' == tag.name;
+      this.visit(tag.block);
+
+      // pretty print
+      if (pp && !tag.isInline() && 'pre' != tag.name && !tag.canInline())
+        this.prettyIndent(0, true);
+
+      this.buffer('');
+    }
+    this.indents--;
+  },
+
+  /**
+   * Visit `filter`, throwing when the filter does not exist.
+   *
+   * @param {Filter} filter
+   * @api public
+   */
+
+  visitFilter: function(filter){
+    var fn = filters[filter.name];
+
+    // unknown filter
+    if (!fn) {
+      if (filter.isASTFilter) {
+        throw new Error('unknown ast filter "' + filter.name + ':"');
+      } else {
+        throw new Error('unknown filter ":' + filter.name + '"');
+      }
+    }
+
+    if (filter.isASTFilter) {
+      this.buf.push(fn(filter.block, this, filter.attrs));
+    } else {
+      var text = filter.block.nodes.map(function(node){ return node.val }).join('\n');
+      filter.attrs = filter.attrs || {};
+      filter.attrs.filename = this.options.filename;
+      this.buffer(utils.text(fn(text, filter.attrs)));
+    }
+  },
+
+  /**
+   * Visit `text` node.
+   *
+   * @param {Text} text
+   * @api public
+   */
+
+  visitText: function(text){
+    text = utils.text(text.val.replace(/\\/g, '\\\\'));
+    if (this.escape) text = escape(text);
+    this.buffer(text);
+  },
+
+  /**
+   * Visit a `comment`, only buffering when the buffer flag is set.
+   *
+   * @param {Comment} comment
+   * @api public
+   */
+
+  visitComment: function(comment){
+    if (!comment.buffer) return;
+    if (this.pp) this.prettyIndent(1, true);
+    this.buffer('');
+  },
+
+  /**
+   * Visit a `BlockComment`.
+   *
+   * @param {Comment} comment
+   * @api public
+   */
+
+  visitBlockComment: function(comment){
+    if (!comment.buffer) return;
+    if (0 == comment.val.trim().indexOf('if')) {
+      this.buffer('');
+    } else {
+      this.buffer('');
+    }
+  },
+
+  /**
+   * Visit `code`, respecting buffer / escape flags.
+   * If the code is followed by a block, wrap it in
+   * a self-calling function.
+   *
+   * @param {Code} code
+   * @api public
+   */
+
+  visitCode: function(code){
+    // Wrap code blocks with {}.
+    // we only wrap unbuffered code blocks ATM
+    // since they are usually flow control
+
+    // Buffer code
+    if (code.buffer) {
+      var val = code.val.trimLeft();
+      this.buf.push('var __val__ = ' + val);
+      val = 'null == __val__ ? "" : __val__';
+      if (code.escape) val = 'escape(' + val + ')';
+      this.buf.push("buf.push(" + val + ");");
+    } else {
+      this.buf.push(code.val);
+    }
+
+    // Block support
+    if (code.block) {
+      if (!code.buffer) this.buf.push('{');
+      this.visit(code.block);
+      if (!code.buffer) this.buf.push('}');
+    }
+  },
+
+  /**
+   * Visit `each` block.
+   *
+   * @param {Each} each
+   * @api public
+   */
+
+  visitEach: function(each){
+    this.buf.push(''
+      + '// iterate ' + each.obj + '\n'
+      + ';(function(){\n'
+      + '  if (\'number\' == typeof ' + each.obj + '.length) {\n'
+      + '    for (var ' + each.key + ' = 0, $$l = ' + each.obj + '.length; ' + each.key + ' < $$l; ' + each.key + '++) {\n'
+      + '      var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n');
+
+    this.visit(each.block);
+
+    this.buf.push(''
+      + '    }\n'
+      + '  } else {\n'
+      + '    for (var ' + each.key + ' in ' + each.obj + ') {\n'
+      // if browser
+      // + '      if (' + each.obj + '.hasOwnProperty(' + each.key + ')){'
+      // end
+      + '      var ' + each.val + ' = ' + each.obj + '[' + each.key + '];\n');
+
+    this.visit(each.block);
+
+    // if browser
+    // this.buf.push('      }\n');
+    // end
+
+    this.buf.push('   }\n  }\n}).call(this);\n');
+  },
+
+  /**
+   * Visit `attrs`.
+   *
+   * @param {Array} attrs
+   * @api public
+   */
+
+  visitAttributes: function(attrs){
+    var val = this.attrs(attrs);
+    if (val.inherits) {
+      this.buf.push("buf.push(attrs(merge({ " + val.buf +
+          " }, attributes), merge(" + val.escaped + ", escaped, true)));");
+    } else if (val.constant) {
+      eval('var buf={' + val.buf + '};');
+      this.buffer(runtime.attrs(buf, JSON.parse(val.escaped)), true);
+    } else {
+      this.buf.push("buf.push(attrs({ " + val.buf + " }, " + val.escaped + "));");
+    }
+  },
+
+  /**
+   * Compile attributes.
+   */
+
+  attrs: function(attrs){
+    var buf = []
+      , classes = []
+      , escaped = {}
+      , constant = attrs.every(function(attr){ return isConstant(attr.val) })
+      , inherits = false;
+
+    if (this.terse) buf.push('terse: true');
+
+    attrs.forEach(function(attr){
+      if (attr.name == 'attributes') return inherits = true;
+      escaped[attr.name] = attr.escaped;
+      if (attr.name == 'class') {
+        classes.push('(' + attr.val + ')');
+      } else {
+        var pair = "'" + attr.name + "':(" + attr.val + ')';
+        buf.push(pair);
+      }
+    });
+
+    if (classes.length) {
+      classes = classes.join(" + ' ' + ");
+      buf.push("class: " + classes);
+    }
+
+    return {
+      buf: buf.join(', ').replace('class:', '"class":'),
+      escaped: JSON.stringify(escaped),
+      inherits: inherits,
+      constant: constant
+    };
+  }
+};
+
+/**
+ * Check if expression can be evaluated to a constant
+ *
+ * @param {String} expression
+ * @return {Boolean}
+ * @api private
+ */
+
+function isConstant(val){
+  // Check strings/literals
+  if (/^ *("([^"\\]*(\\.[^"\\]*)*)"|'([^'\\]*(\\.[^'\\]*)*)'|true|false|null|undefined) *$/i.test(val))
+    return true;
+  
+  // Check numbers
+  if (!isNaN(Number(val)))
+    return true;
+  
+  // Check arrays
+  var matches;
+  if (matches = /^ *\[(.*)\] *$/.exec(val))
+    return matches[1].split(',').every(isConstant);
+  
+  return false;
+}
+
+/**
+ * Escape the given string of `html`.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+function escape(html){
+  return String(html)
+    .replace(/&(?!\w+;)/g, '&')
+    .replace(//g, '>')
+    .replace(/"/g, '"');
+}
\ No newline at end of file
diff --git a/node_modules/jade/lib/doctypes.js b/node_modules/jade/lib/doctypes.js
new file mode 100644
index 0000000..e87ca1e
--- /dev/null
+++ b/node_modules/jade/lib/doctypes.js
@@ -0,0 +1,18 @@
+
+/*!
+ * Jade - doctypes
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = {
+    '5': ''
+  , 'default': ''
+  , 'xml': ''
+  , 'transitional': ''
+  , 'strict': ''
+  , 'frameset': ''
+  , '1.1': ''
+  , 'basic': ''
+  , 'mobile': ''
+};
\ No newline at end of file
diff --git a/node_modules/jade/lib/filters.js b/node_modules/jade/lib/filters.js
new file mode 100644
index 0000000..fdb634c
--- /dev/null
+++ b/node_modules/jade/lib/filters.js
@@ -0,0 +1,97 @@
+
+/*!
+ * Jade - filters
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = {
+  
+  /**
+   * Wrap text with CDATA block.
+   */
+  
+  cdata: function(str){
+    return '';
+  },
+  
+  /**
+   * Transform sass to css, wrapped in style tags.
+   */
+  
+  sass: function(str){
+    str = str.replace(/\\n/g, '\n');
+    var sass = require('sass').render(str).replace(/\n/g, '\\n');
+    return ''; 
+  },
+  
+  /**
+   * Transform stylus to css, wrapped in style tags.
+   */
+  
+  stylus: function(str, options){
+    var ret;
+    str = str.replace(/\\n/g, '\n');
+    var stylus = require('stylus');
+    stylus(str, options).render(function(err, css){
+      if (err) throw err;
+      ret = css.replace(/\n/g, '\\n');
+    });
+    return ''; 
+  },
+  
+  /**
+   * Transform less to css, wrapped in style tags.
+   */
+  
+  less: function(str){
+    var ret;
+    str = str.replace(/\\n/g, '\n');
+    require('less').render(str, function(err, css){
+      if (err) throw err;
+      ret = '';  
+    });
+    return ret;
+  },
+  
+  /**
+   * Transform markdown to html.
+   */
+  
+  markdown: function(str){
+    var md;
+
+    // support markdown / discount
+    try {
+      md = require('markdown');
+    } catch (err){
+      try {
+        md = require('discount');
+      } catch (err) {
+        try {
+          md = require('markdown-js');
+        } catch (err) {
+          try {
+            md = require('marked');
+          } catch (err) {
+            throw new
+              Error('Cannot find markdown library, install markdown, discount, or marked.');
+          }
+        }
+      }
+    }
+
+    str = str.replace(/\\n/g, '\n');
+    return md.parse(str).replace(/\n/g, '\\n').replace(/'/g,''');
+  },
+  
+  /**
+   * Transform coffeescript to javascript.
+   */
+
+  coffeescript: function(str){
+    str = str.replace(/\\n/g, '\n');
+    var js = require('coffee-script').compile(str).replace(/\\/g, '\\\\').replace(/\n/g, '\\n');
+    return '';
+  }
+};
diff --git a/node_modules/jade/lib/inline-tags.js b/node_modules/jade/lib/inline-tags.js
new file mode 100644
index 0000000..491de0b
--- /dev/null
+++ b/node_modules/jade/lib/inline-tags.js
@@ -0,0 +1,28 @@
+
+/*!
+ * Jade - inline tags
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = [
+    'a'
+  , 'abbr'
+  , 'acronym'
+  , 'b'
+  , 'br'
+  , 'code'
+  , 'em'
+  , 'font'
+  , 'i'
+  , 'img'
+  , 'ins'
+  , 'kbd'
+  , 'map'
+  , 'samp'
+  , 'small'
+  , 'span'
+  , 'strong'
+  , 'sub'
+  , 'sup'
+];
\ No newline at end of file
diff --git a/node_modules/jade/lib/jade.js b/node_modules/jade/lib/jade.js
new file mode 100644
index 0000000..00f0abb
--- /dev/null
+++ b/node_modules/jade/lib/jade.js
@@ -0,0 +1,237 @@
+/*!
+ * Jade
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Parser = require('./parser')
+  , Lexer = require('./lexer')
+  , Compiler = require('./compiler')
+  , runtime = require('./runtime')
+// if node
+  , fs = require('fs');
+// end
+
+/**
+ * Library version.
+ */
+
+exports.version = '0.26.3';
+
+/**
+ * Expose self closing tags.
+ */
+
+exports.selfClosing = require('./self-closing');
+
+/**
+ * Default supported doctypes.
+ */
+
+exports.doctypes = require('./doctypes');
+
+/**
+ * Text filters.
+ */
+
+exports.filters = require('./filters');
+
+/**
+ * Utilities.
+ */
+
+exports.utils = require('./utils');
+
+/**
+ * Expose `Compiler`.
+ */
+
+exports.Compiler = Compiler;
+
+/**
+ * Expose `Parser`.
+ */
+
+exports.Parser = Parser;
+
+/**
+ * Expose `Lexer`.
+ */
+
+exports.Lexer = Lexer;
+
+/**
+ * Nodes.
+ */
+
+exports.nodes = require('./nodes');
+
+/**
+ * Jade runtime helpers.
+ */
+
+exports.runtime = runtime;
+
+/**
+ * Template function cache.
+ */
+
+exports.cache = {};
+
+/**
+ * Parse the given `str` of jade and return a function body.
+ *
+ * @param {String} str
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function parse(str, options){
+  try {
+    // Parse
+    var parser = new Parser(str, options.filename, options);
+
+    // Compile
+    var compiler = new (options.compiler || Compiler)(parser.parse(), options)
+      , js = compiler.compile();
+
+    // Debug compiler
+    if (options.debug) {
+      console.error('\nCompiled Function:\n\n\033[90m%s\033[0m', js.replace(/^/gm, '  '));
+    }
+
+    return ''
+      + 'var buf = [];\n'
+      + (options.self
+        ? 'var self = locals || {};\n' + js
+        : 'with (locals || {}) {\n' + js + '\n}\n')
+      + 'return buf.join("");';
+  } catch (err) {
+    parser = parser.context();
+    runtime.rethrow(err, parser.filename, parser.lexer.lineno);
+  }
+}
+
+/**
+ * Compile a `Function` representation of the given jade `str`.
+ *
+ * Options:
+ *
+ *   - `compileDebug` when `false` debugging code is stripped from the compiled template
+ *   - `client` when `true` the helper functions `escape()` etc will reference `jade.escape()`
+ *      for use with the Jade client-side runtime.js
+ *
+ * @param {String} str
+ * @param {Options} options
+ * @return {Function}
+ * @api public
+ */
+
+exports.compile = function(str, options){
+  var options = options || {}
+    , client = options.client
+    , filename = options.filename
+      ? JSON.stringify(options.filename)
+      : 'undefined'
+    , fn;
+
+  if (options.compileDebug !== false) {
+    fn = [
+        'var __jade = [{ lineno: 1, filename: ' + filename + ' }];'
+      , 'try {'
+      , parse(String(str), options)
+      , '} catch (err) {'
+      , '  rethrow(err, __jade[0].filename, __jade[0].lineno);'
+      , '}'
+    ].join('\n');
+  } else {
+    fn = parse(String(str), options);
+  }
+
+  if (client) {
+    fn = 'attrs = attrs || jade.attrs; escape = escape || jade.escape; rethrow = rethrow || jade.rethrow; merge = merge || jade.merge;\n' + fn;
+  }
+
+  fn = new Function('locals, attrs, escape, rethrow, merge', fn);
+
+  if (client) return fn;
+
+  return function(locals){
+    return fn(locals, runtime.attrs, runtime.escape, runtime.rethrow, runtime.merge);
+  };
+};
+
+/**
+ * Render the given `str` of jade and invoke
+ * the callback `fn(err, str)`.
+ *
+ * Options:
+ *
+ *   - `cache` enable template caching
+ *   - `filename` filename required for `include` / `extends` and caching
+ *
+ * @param {String} str
+ * @param {Object|Function} options or fn
+ * @param {Function} fn
+ * @api public
+ */
+
+exports.render = function(str, options, fn){
+  // swap args
+  if ('function' == typeof options) {
+    fn = options, options = {};
+  }
+
+  // cache requires .filename
+  if (options.cache && !options.filename) {
+    return fn(new Error('the "filename" option is required for caching'));
+  }
+
+  try {
+    var path = options.filename;
+    var tmpl = options.cache
+      ? exports.cache[path] || (exports.cache[path] = exports.compile(str, options))
+      : exports.compile(str, options);
+    fn(null, tmpl(options));
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Render a Jade file at the given `path` and callback `fn(err, str)`.
+ *
+ * @param {String} path
+ * @param {Object|Function} options or callback
+ * @param {Function} fn
+ * @api public
+ */
+
+exports.renderFile = function(path, options, fn){
+  var key = path + ':string';
+
+  if ('function' == typeof options) {
+    fn = options, options = {};
+  }
+
+  try {
+    options.filename = path;
+    var str = options.cache
+      ? exports.cache[key] || (exports.cache[key] = fs.readFileSync(path, 'utf8'))
+      : fs.readFileSync(path, 'utf8');
+    exports.render(str, options, fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Express support.
+ */
+
+exports.__express = exports.renderFile;
diff --git a/node_modules/jade/lib/lexer.js b/node_modules/jade/lib/lexer.js
new file mode 100644
index 0000000..bca314a
--- /dev/null
+++ b/node_modules/jade/lib/lexer.js
@@ -0,0 +1,771 @@
+
+/*!
+ * Jade - Lexer
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Initialize `Lexer` with the given `str`.
+ *
+ * Options:
+ *
+ *   - `colons` allow colons for attr delimiters
+ *
+ * @param {String} str
+ * @param {Object} options
+ * @api private
+ */
+
+var Lexer = module.exports = function Lexer(str, options) {
+  options = options || {};
+  this.input = str.replace(/\r\n|\r/g, '\n');
+  this.colons = options.colons;
+  this.deferredTokens = [];
+  this.lastIndents = 0;
+  this.lineno = 1;
+  this.stash = [];
+  this.indentStack = [];
+  this.indentRe = null;
+  this.pipeless = false;
+};
+
+/**
+ * Lexer prototype.
+ */
+
+Lexer.prototype = {
+  
+  /**
+   * Construct a token with the given `type` and `val`.
+   *
+   * @param {String} type
+   * @param {String} val
+   * @return {Object}
+   * @api private
+   */
+  
+  tok: function(type, val){
+    return {
+        type: type
+      , line: this.lineno
+      , val: val
+    }
+  },
+  
+  /**
+   * Consume the given `len` of input.
+   *
+   * @param {Number} len
+   * @api private
+   */
+  
+  consume: function(len){
+    this.input = this.input.substr(len);
+  },
+  
+  /**
+   * Scan for `type` with the given `regexp`.
+   *
+   * @param {String} type
+   * @param {RegExp} regexp
+   * @return {Object}
+   * @api private
+   */
+  
+  scan: function(regexp, type){
+    var captures;
+    if (captures = regexp.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok(type, captures[1]);
+    }
+  },
+  
+  /**
+   * Defer the given `tok`.
+   *
+   * @param {Object} tok
+   * @api private
+   */
+  
+  defer: function(tok){
+    this.deferredTokens.push(tok);
+  },
+  
+  /**
+   * Lookahead `n` tokens.
+   *
+   * @param {Number} n
+   * @return {Object}
+   * @api private
+   */
+  
+  lookahead: function(n){
+    var fetch = n - this.stash.length;
+    while (fetch-- > 0) this.stash.push(this.next());
+    return this.stash[--n];
+  },
+  
+  /**
+   * Return the indexOf `start` / `end` delimiters.
+   *
+   * @param {String} start
+   * @param {String} end
+   * @return {Number}
+   * @api private
+   */
+  
+  indexOfDelimiters: function(start, end){
+    var str = this.input
+      , nstart = 0
+      , nend = 0
+      , pos = 0;
+    for (var i = 0, len = str.length; i < len; ++i) {
+      if (start == str.charAt(i)) {
+        ++nstart;
+      } else if (end == str.charAt(i)) {
+        if (++nend == nstart) {
+          pos = i;
+          break;
+        }
+      }
+    }
+    return pos;
+  },
+  
+  /**
+   * Stashed token.
+   */
+  
+  stashed: function() {
+    return this.stash.length
+      && this.stash.shift();
+  },
+  
+  /**
+   * Deferred token.
+   */
+  
+  deferred: function() {
+    return this.deferredTokens.length 
+      && this.deferredTokens.shift();
+  },
+  
+  /**
+   * end-of-source.
+   */
+  
+  eos: function() {
+    if (this.input.length) return;
+    if (this.indentStack.length) {
+      this.indentStack.shift();
+      return this.tok('outdent');
+    } else {
+      return this.tok('eos');
+    }
+  },
+
+  /**
+   * Blank line.
+   */
+  
+  blank: function() {
+    var captures;
+    if (captures = /^\n *\n/.exec(this.input)) {
+      this.consume(captures[0].length - 1);
+      if (this.pipeless) return this.tok('text', '');
+      return this.next();
+    }
+  },
+
+  /**
+   * Comment.
+   */
+  
+  comment: function() {
+    var captures;
+    if (captures = /^ *\/\/(-)?([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('comment', captures[2]);
+      tok.buffer = '-' != captures[1];
+      return tok;
+    }
+  },
+
+  /**
+   * Interpolated tag.
+   */
+
+  interpolation: function() {
+    var captures;
+    if (captures = /^#\{(.*?)\}/.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok('interpolation', captures[1]);
+    }
+  },
+
+  /**
+   * Tag.
+   */
+  
+  tag: function() {
+    var captures;
+    if (captures = /^(\w[-:\w]*)(\/?)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok, name = captures[1];
+      if (':' == name[name.length - 1]) {
+        name = name.slice(0, -1);
+        tok = this.tok('tag', name);
+        this.defer(this.tok(':'));
+        while (' ' == this.input[0]) this.input = this.input.substr(1);
+      } else {
+        tok = this.tok('tag', name);
+      }
+      tok.selfClosing = !! captures[2];
+      return tok;
+    }
+  },
+  
+  /**
+   * Filter.
+   */
+  
+  filter: function() {
+    return this.scan(/^:(\w+)/, 'filter');
+  },
+  
+  /**
+   * Doctype.
+   */
+  
+  doctype: function() {
+    return this.scan(/^(?:!!!|doctype) *([^\n]+)?/, 'doctype');
+  },
+
+  /**
+   * Id.
+   */
+  
+  id: function() {
+    return this.scan(/^#([\w-]+)/, 'id');
+  },
+  
+  /**
+   * Class.
+   */
+  
+  className: function() {
+    return this.scan(/^\.([\w-]+)/, 'class');
+  },
+  
+  /**
+   * Text.
+   */
+  
+  text: function() {
+    return this.scan(/^(?:\| ?| ?)?([^\n]+)/, 'text');
+  },
+
+  /**
+   * Extends.
+   */
+  
+  "extends": function() {
+    return this.scan(/^extends? +([^\n]+)/, 'extends');
+  },
+
+  /**
+   * Block prepend.
+   */
+  
+  prepend: function() {
+    var captures;
+    if (captures = /^prepend +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = 'prepend'
+        , name = captures[1]
+        , tok = this.tok('block', name);
+      tok.mode = mode;
+      return tok;
+    }
+  },
+  
+  /**
+   * Block append.
+   */
+  
+  append: function() {
+    var captures;
+    if (captures = /^append +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = 'append'
+        , name = captures[1]
+        , tok = this.tok('block', name);
+      tok.mode = mode;
+      return tok;
+    }
+  },
+
+  /**
+   * Block.
+   */
+  
+  block: function() {
+    var captures;
+    if (captures = /^block\b *(?:(prepend|append) +)?([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var mode = captures[1] || 'replace'
+        , name = captures[2]
+        , tok = this.tok('block', name);
+
+      tok.mode = mode;
+      return tok;
+    }
+  },
+
+  /**
+   * Yield.
+   */
+  
+  yield: function() {
+    return this.scan(/^yield */, 'yield');
+  },
+
+  /**
+   * Include.
+   */
+  
+  include: function() {
+    return this.scan(/^include +([^\n]+)/, 'include');
+  },
+
+  /**
+   * Case.
+   */
+  
+  "case": function() {
+    return this.scan(/^case +([^\n]+)/, 'case');
+  },
+
+  /**
+   * When.
+   */
+  
+  when: function() {
+    return this.scan(/^when +([^:\n]+)/, 'when');
+  },
+
+  /**
+   * Default.
+   */
+  
+  "default": function() {
+    return this.scan(/^default */, 'default');
+  },
+
+  /**
+   * Assignment.
+   */
+  
+  assignment: function() {
+    var captures;
+    if (captures = /^(\w+) += *([^;\n]+)( *;? *)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var name = captures[1]
+        , val = captures[2];
+      return this.tok('code', 'var ' + name + ' = (' + val + ');');
+    }
+  },
+
+  /**
+   * Call mixin.
+   */
+  
+  call: function(){
+    var captures;
+    if (captures = /^\+([-\w]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('call', captures[1]);
+      
+      // Check for args (not attributes)
+      if (captures = /^ *\((.*?)\)/.exec(this.input)) {
+        if (!/^ *[-\w]+ *=/.test(captures[1])) {
+          this.consume(captures[0].length);
+          tok.args = captures[1];
+        }
+      }
+      
+      return tok;
+    }
+  },
+
+  /**
+   * Mixin.
+   */
+
+  mixin: function(){
+    var captures;
+    if (captures = /^mixin +([-\w]+)(?: *\((.*)\))?/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('mixin', captures[1]);
+      tok.args = captures[2];
+      return tok;
+    }
+  },
+
+  /**
+   * Conditional.
+   */
+  
+  conditional: function() {
+    var captures;
+    if (captures = /^(if|unless|else if|else)\b([^\n]*)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var type = captures[1]
+        , js = captures[2];
+
+      switch (type) {
+        case 'if': js = 'if (' + js + ')'; break;
+        case 'unless': js = 'if (!(' + js + '))'; break;
+        case 'else if': js = 'else if (' + js + ')'; break;
+        case 'else': js = 'else'; break;
+      }
+
+      return this.tok('code', js);
+    }
+  },
+
+  /**
+   * While.
+   */
+  
+  "while": function() {
+    var captures;
+    if (captures = /^while +([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      return this.tok('code', 'while (' + captures[1] + ')');
+    }
+  },
+
+  /**
+   * Each.
+   */
+  
+  each: function() {
+    var captures;
+    if (captures = /^(?:- *)?(?:each|for) +(\w+)(?: *, *(\w+))? * in *([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var tok = this.tok('each', captures[1]);
+      tok.key = captures[2] || '$index';
+      tok.code = captures[3];
+      return tok;
+    }
+  },
+  
+  /**
+   * Code.
+   */
+  
+  code: function() {
+    var captures;
+    if (captures = /^(!?=|-)([^\n]+)/.exec(this.input)) {
+      this.consume(captures[0].length);
+      var flags = captures[1];
+      captures[1] = captures[2];
+      var tok = this.tok('code', captures[1]);
+      tok.escape = flags[0] === '=';
+      tok.buffer = flags[0] === '=' || flags[1] === '=';
+      return tok;
+    }
+  },
+  
+  /**
+   * Attributes.
+   */
+  
+  attrs: function() {
+    if ('(' == this.input.charAt(0)) {
+      var index = this.indexOfDelimiters('(', ')')
+        , str = this.input.substr(1, index-1)
+        , tok = this.tok('attrs')
+        , len = str.length
+        , colons = this.colons
+        , states = ['key']
+        , escapedAttr
+        , key = ''
+        , val = ''
+        , quote
+        , c
+        , p;
+
+      function state(){
+        return states[states.length - 1];
+      }
+
+      function interpolate(attr) {
+        return attr.replace(/#\{([^}]+)\}/g, function(_, expr){
+          return quote + " + (" + expr + ") + " + quote;
+        });
+      }
+
+      this.consume(index + 1);
+      tok.attrs = {};
+      tok.escaped = {};
+
+      function parse(c) {
+        var real = c;
+        // TODO: remove when people fix ":"
+        if (colons && ':' == c) c = '=';
+        switch (c) {
+          case ',':
+          case '\n':
+            switch (state()) {
+              case 'expr':
+              case 'array':
+              case 'string':
+              case 'object':
+                val += c;
+                break;
+              default:
+                states.push('key');
+                val = val.trim();
+                key = key.trim();
+                if ('' == key) return;
+                key = key.replace(/^['"]|['"]$/g, '').replace('!', '');
+                tok.escaped[key] = escapedAttr;
+                tok.attrs[key] = '' == val
+                  ? true
+                  : interpolate(val);
+                key = val = '';
+            }
+            break;
+          case '=':
+            switch (state()) {
+              case 'key char':
+                key += real;
+                break;
+              case 'val':
+              case 'expr':
+              case 'array':
+              case 'string':
+              case 'object':
+                val += real;
+                break;
+              default:
+                escapedAttr = '!' != p;
+                states.push('val');
+            }
+            break;
+          case '(':
+            if ('val' == state()
+              || 'expr' == state()) states.push('expr');
+            val += c;
+            break;
+          case ')':
+            if ('expr' == state()
+              || 'val' == state()) states.pop();
+            val += c;
+            break;
+          case '{':
+            if ('val' == state()) states.push('object');
+            val += c;
+            break;
+          case '}':
+            if ('object' == state()) states.pop();
+            val += c;
+            break;
+          case '[':
+            if ('val' == state()) states.push('array');
+            val += c;
+            break;
+          case ']':
+            if ('array' == state()) states.pop();
+            val += c;
+            break;
+          case '"':
+          case "'":
+            switch (state()) {
+              case 'key':
+                states.push('key char');
+                break;
+              case 'key char':
+                states.pop();
+                break;
+              case 'string':
+                if (c == quote) states.pop();
+                val += c;
+                break;
+              default:
+                states.push('string');
+                val += c;
+                quote = c;
+            }
+            break;
+          case '':
+            break;
+          default:
+            switch (state()) {
+              case 'key':
+              case 'key char':
+                key += c;
+                break;
+              default:
+                val += c;
+            }
+        }
+        p = c;
+      }
+
+      for (var i = 0; i < len; ++i) {
+        parse(str.charAt(i));
+      }
+
+      parse(',');
+
+      if ('/' == this.input.charAt(0)) {
+        this.consume(1);
+        tok.selfClosing = true;
+      }
+
+      return tok;
+    }
+  },
+  
+  /**
+   * Indent | Outdent | Newline.
+   */
+  
+  indent: function() {
+    var captures, re;
+
+    // established regexp
+    if (this.indentRe) {
+      captures = this.indentRe.exec(this.input);
+    // determine regexp
+    } else {
+      // tabs
+      re = /^\n(\t*) */;
+      captures = re.exec(this.input);
+
+      // spaces
+      if (captures && !captures[1].length) {
+        re = /^\n( *)/;
+        captures = re.exec(this.input);
+      }
+
+      // established
+      if (captures && captures[1].length) this.indentRe = re;
+    }
+
+    if (captures) {
+      var tok
+        , indents = captures[1].length;
+
+      ++this.lineno;
+      this.consume(indents + 1);
+
+      if (' ' == this.input[0] || '\t' == this.input[0]) {
+        throw new Error('Invalid indentation, you can use tabs or spaces but not both');
+      }
+
+      // blank line
+      if ('\n' == this.input[0]) return this.tok('newline');
+
+      // outdent
+      if (this.indentStack.length && indents < this.indentStack[0]) {
+        while (this.indentStack.length && this.indentStack[0] > indents) {
+          this.stash.push(this.tok('outdent'));
+          this.indentStack.shift();
+        }
+        tok = this.stash.pop();
+      // indent
+      } else if (indents && indents != this.indentStack[0]) {
+        this.indentStack.unshift(indents);
+        tok = this.tok('indent', indents);
+      // newline
+      } else {
+        tok = this.tok('newline');
+      }
+
+      return tok;
+    }
+  },
+
+  /**
+   * Pipe-less text consumed only when 
+   * pipeless is true;
+   */
+
+  pipelessText: function() {
+    if (this.pipeless) {
+      if ('\n' == this.input[0]) return;
+      var i = this.input.indexOf('\n');
+      if (-1 == i) i = this.input.length;
+      var str = this.input.substr(0, i);
+      this.consume(str.length);
+      return this.tok('text', str);
+    }
+  },
+
+  /**
+   * ':'
+   */
+
+  colon: function() {
+    return this.scan(/^: */, ':');
+  },
+
+  /**
+   * Return the next token object, or those
+   * previously stashed by lookahead.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  advance: function(){
+    return this.stashed()
+      || this.next();
+  },
+  
+  /**
+   * Return the next token object.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  next: function() {
+    return this.deferred()
+      || this.blank()
+      || this.eos()
+      || this.pipelessText()
+      || this.yield()
+      || this.doctype()
+      || this.interpolation()
+      || this["case"]()
+      || this.when()
+      || this["default"]()
+      || this["extends"]()
+      || this.append()
+      || this.prepend()
+      || this.block()
+      || this.include()
+      || this.mixin()
+      || this.call()
+      || this.conditional()
+      || this.each()
+      || this["while"]()
+      || this.assignment()
+      || this.tag()
+      || this.filter()
+      || this.code()
+      || this.id()
+      || this.className()
+      || this.attrs()
+      || this.indent()
+      || this.comment()
+      || this.colon()
+      || this.text();
+  }
+};
diff --git a/node_modules/jade/lib/nodes/attrs.js b/node_modules/jade/lib/nodes/attrs.js
new file mode 100644
index 0000000..5de9b59
--- /dev/null
+++ b/node_modules/jade/lib/nodes/attrs.js
@@ -0,0 +1,77 @@
+
+/*!
+ * Jade - nodes - Attrs
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node'),
+    Block = require('./block');
+
+/**
+ * Initialize a `Attrs` node.
+ *
+ * @api public
+ */
+
+var Attrs = module.exports = function Attrs() {
+  this.attrs = [];
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Attrs.prototype.__proto__ = Node.prototype;
+
+/**
+ * Set attribute `name` to `val`, keep in mind these become
+ * part of a raw js object literal, so to quote a value you must
+ * '"quote me"', otherwise or example 'user.name' is literal JavaScript.
+ *
+ * @param {String} name
+ * @param {String} val
+ * @param {Boolean} escaped
+ * @return {Tag} for chaining
+ * @api public
+ */
+
+Attrs.prototype.setAttribute = function(name, val, escaped){
+  this.attrs.push({ name: name, val: val, escaped: escaped });
+  return this;
+};
+
+/**
+ * Remove attribute `name` when present.
+ *
+ * @param {String} name
+ * @api public
+ */
+
+Attrs.prototype.removeAttribute = function(name){
+  for (var i = 0, len = this.attrs.length; i < len; ++i) {
+    if (this.attrs[i] && this.attrs[i].name == name) {
+      delete this.attrs[i];
+    }
+  }
+};
+
+/**
+ * Get attribute value by `name`.
+ *
+ * @param {String} name
+ * @return {String}
+ * @api public
+ */
+
+Attrs.prototype.getAttribute = function(name){
+  for (var i = 0, len = this.attrs.length; i < len; ++i) {
+    if (this.attrs[i] && this.attrs[i].name == name) {
+      return this.attrs[i].val;
+    }
+  }
+};
diff --git a/node_modules/jade/lib/nodes/block-comment.js b/node_modules/jade/lib/nodes/block-comment.js
new file mode 100644
index 0000000..4f41e4a
--- /dev/null
+++ b/node_modules/jade/lib/nodes/block-comment.js
@@ -0,0 +1,33 @@
+
+/*!
+ * Jade - nodes - BlockComment
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `BlockComment` with the given `block`.
+ *
+ * @param {String} val
+ * @param {Block} block
+ * @param {Boolean} buffer
+ * @api public
+ */
+
+var BlockComment = module.exports = function BlockComment(val, block, buffer) {
+  this.block = block;
+  this.val = val;
+  this.buffer = buffer;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+BlockComment.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/block.js b/node_modules/jade/lib/nodes/block.js
new file mode 100644
index 0000000..bb00a1d
--- /dev/null
+++ b/node_modules/jade/lib/nodes/block.js
@@ -0,0 +1,121 @@
+
+/*!
+ * Jade - nodes - Block
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a new `Block` with an optional `node`.
+ *
+ * @param {Node} node
+ * @api public
+ */
+
+var Block = module.exports = function Block(node){
+  this.nodes = [];
+  if (node) this.push(node);
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Block.prototype.__proto__ = Node.prototype;
+
+/**
+ * Block flag.
+ */
+
+Block.prototype.isBlock = true;
+
+/**
+ * Replace the nodes in `other` with the nodes
+ * in `this` block.
+ *
+ * @param {Block} other
+ * @api private
+ */
+
+Block.prototype.replace = function(other){
+  other.nodes = this.nodes;
+};
+
+/**
+ * Pust the given `node`.
+ *
+ * @param {Node} node
+ * @return {Number}
+ * @api public
+ */
+
+Block.prototype.push = function(node){
+  return this.nodes.push(node);
+};
+
+/**
+ * Check if this block is empty.
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+Block.prototype.isEmpty = function(){
+  return 0 == this.nodes.length;
+};
+
+/**
+ * Unshift the given `node`.
+ *
+ * @param {Node} node
+ * @return {Number}
+ * @api public
+ */
+
+Block.prototype.unshift = function(node){
+  return this.nodes.unshift(node);
+};
+
+/**
+ * Return the "last" block, or the first `yield` node.
+ *
+ * @return {Block}
+ * @api private
+ */
+
+Block.prototype.includeBlock = function(){
+  var ret = this
+    , node;
+
+  for (var i = 0, len = this.nodes.length; i < len; ++i) {
+    node = this.nodes[i];
+    if (node.yield) return node;
+    else if (node.textOnly) continue;
+    else if (node.includeBlock) ret = node.includeBlock();
+    else if (node.block && !node.block.isEmpty()) ret = node.block.includeBlock();
+  }
+
+  return ret;
+};
+
+/**
+ * Return a clone of this block.
+ *
+ * @return {Block}
+ * @api private
+ */
+
+Block.prototype.clone = function(){
+  var clone = new Block;
+  for (var i = 0, len = this.nodes.length; i < len; ++i) {
+    clone.push(this.nodes[i].clone());
+  }
+  return clone;
+};
+
diff --git a/node_modules/jade/lib/nodes/case.js b/node_modules/jade/lib/nodes/case.js
new file mode 100644
index 0000000..08ff033
--- /dev/null
+++ b/node_modules/jade/lib/nodes/case.js
@@ -0,0 +1,43 @@
+
+/*!
+ * Jade - nodes - Case
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a new `Case` with `expr`.
+ *
+ * @param {String} expr
+ * @api public
+ */
+
+var Case = exports = module.exports = function Case(expr, block){
+  this.expr = expr;
+  this.block = block;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Case.prototype.__proto__ = Node.prototype;
+
+var When = exports.When = function When(expr, block){
+  this.expr = expr;
+  this.block = block;
+  this.debug = false;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+When.prototype.__proto__ = Node.prototype;
+
diff --git a/node_modules/jade/lib/nodes/code.js b/node_modules/jade/lib/nodes/code.js
new file mode 100644
index 0000000..babc675
--- /dev/null
+++ b/node_modules/jade/lib/nodes/code.js
@@ -0,0 +1,35 @@
+
+/*!
+ * Jade - nodes - Code
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Code` node with the given code `val`.
+ * Code may also be optionally buffered and escaped.
+ *
+ * @param {String} val
+ * @param {Boolean} buffer
+ * @param {Boolean} escape
+ * @api public
+ */
+
+var Code = module.exports = function Code(val, buffer, escape) {
+  this.val = val;
+  this.buffer = buffer;
+  this.escape = escape;
+  if (val.match(/^ *else/)) this.debug = false;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Code.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/comment.js b/node_modules/jade/lib/nodes/comment.js
new file mode 100644
index 0000000..2e1469e
--- /dev/null
+++ b/node_modules/jade/lib/nodes/comment.js
@@ -0,0 +1,32 @@
+
+/*!
+ * Jade - nodes - Comment
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Comment` with the given `val`, optionally `buffer`,
+ * otherwise the comment may render in the output.
+ *
+ * @param {String} val
+ * @param {Boolean} buffer
+ * @api public
+ */
+
+var Comment = module.exports = function Comment(val, buffer) {
+  this.val = val;
+  this.buffer = buffer;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Comment.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/doctype.js b/node_modules/jade/lib/nodes/doctype.js
new file mode 100644
index 0000000..b8f33e5
--- /dev/null
+++ b/node_modules/jade/lib/nodes/doctype.js
@@ -0,0 +1,29 @@
+
+/*!
+ * Jade - nodes - Doctype
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Doctype` with the given `val`. 
+ *
+ * @param {String} val
+ * @api public
+ */
+
+var Doctype = module.exports = function Doctype(val) {
+  this.val = val;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Doctype.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/each.js b/node_modules/jade/lib/nodes/each.js
new file mode 100644
index 0000000..f54101f
--- /dev/null
+++ b/node_modules/jade/lib/nodes/each.js
@@ -0,0 +1,35 @@
+
+/*!
+ * Jade - nodes - Each
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize an `Each` node, representing iteration
+ *
+ * @param {String} obj
+ * @param {String} val
+ * @param {String} key
+ * @param {Block} block
+ * @api public
+ */
+
+var Each = module.exports = function Each(obj, val, key, block) {
+  this.obj = obj;
+  this.val = val;
+  this.key = key;
+  this.block = block;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Each.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/filter.js b/node_modules/jade/lib/nodes/filter.js
new file mode 100644
index 0000000..851a004
--- /dev/null
+++ b/node_modules/jade/lib/nodes/filter.js
@@ -0,0 +1,35 @@
+
+/*!
+ * Jade - nodes - Filter
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node')
+  , Block = require('./block');
+
+/**
+ * Initialize a `Filter` node with the given 
+ * filter `name` and `block`.
+ *
+ * @param {String} name
+ * @param {Block|Node} block
+ * @api public
+ */
+
+var Filter = module.exports = function Filter(name, block, attrs) {
+  this.name = name;
+  this.block = block;
+  this.attrs = attrs;
+  this.isASTFilter = !block.nodes.every(function(node){ return node.isText });
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Filter.prototype.__proto__ = Node.prototype;
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/index.js b/node_modules/jade/lib/nodes/index.js
new file mode 100644
index 0000000..386ad2f
--- /dev/null
+++ b/node_modules/jade/lib/nodes/index.js
@@ -0,0 +1,20 @@
+
+/*!
+ * Jade - nodes
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+exports.Node = require('./node');
+exports.Tag = require('./tag');
+exports.Code = require('./code');
+exports.Each = require('./each');
+exports.Case = require('./case');
+exports.Text = require('./text');
+exports.Block = require('./block');
+exports.Mixin = require('./mixin');
+exports.Filter = require('./filter');
+exports.Comment = require('./comment');
+exports.Literal = require('./literal');
+exports.BlockComment = require('./block-comment');
+exports.Doctype = require('./doctype');
diff --git a/node_modules/jade/lib/nodes/literal.js b/node_modules/jade/lib/nodes/literal.js
new file mode 100644
index 0000000..fde586b
--- /dev/null
+++ b/node_modules/jade/lib/nodes/literal.js
@@ -0,0 +1,32 @@
+
+/*!
+ * Jade - nodes - Literal
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Literal` node with the given `str.
+ *
+ * @param {String} str
+ * @api public
+ */
+
+var Literal = module.exports = function Literal(str) {
+  this.str = str
+    .replace(/\\/g, "\\\\")
+    .replace(/\n|\r\n/g, "\\n")
+    .replace(/'/g, "\\'");
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Literal.prototype.__proto__ = Node.prototype;
diff --git a/node_modules/jade/lib/nodes/mixin.js b/node_modules/jade/lib/nodes/mixin.js
new file mode 100644
index 0000000..8407bc7
--- /dev/null
+++ b/node_modules/jade/lib/nodes/mixin.js
@@ -0,0 +1,36 @@
+
+/*!
+ * Jade - nodes - Mixin
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Attrs = require('./attrs');
+
+/**
+ * Initialize a new `Mixin` with `name` and `block`.
+ *
+ * @param {String} name
+ * @param {String} args
+ * @param {Block} block
+ * @api public
+ */
+
+var Mixin = module.exports = function Mixin(name, args, block, call){
+  this.name = name;
+  this.args = args;
+  this.block = block;
+  this.attrs = [];
+  this.call = call;
+};
+
+/**
+ * Inherit from `Attrs`.
+ */
+
+Mixin.prototype.__proto__ = Attrs.prototype;
+
diff --git a/node_modules/jade/lib/nodes/node.js b/node_modules/jade/lib/nodes/node.js
new file mode 100644
index 0000000..e98f042
--- /dev/null
+++ b/node_modules/jade/lib/nodes/node.js
@@ -0,0 +1,25 @@
+
+/*!
+ * Jade - nodes - Node
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Initialize a `Node`.
+ *
+ * @api public
+ */
+
+var Node = module.exports = function Node(){};
+
+/**
+ * Clone this node (return itself)
+ *
+ * @return {Node}
+ * @api private
+ */
+
+Node.prototype.clone = function(){
+  return this;
+};
diff --git a/node_modules/jade/lib/nodes/tag.js b/node_modules/jade/lib/nodes/tag.js
new file mode 100644
index 0000000..4b6728a
--- /dev/null
+++ b/node_modules/jade/lib/nodes/tag.js
@@ -0,0 +1,95 @@
+
+/*!
+ * Jade - nodes - Tag
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Attrs = require('./attrs'),
+    Block = require('./block'),
+    inlineTags = require('../inline-tags');
+
+/**
+ * Initialize a `Tag` node with the given tag `name` and optional `block`.
+ *
+ * @param {String} name
+ * @param {Block} block
+ * @api public
+ */
+
+var Tag = module.exports = function Tag(name, block) {
+  this.name = name;
+  this.attrs = [];
+  this.block = block || new Block;
+};
+
+/**
+ * Inherit from `Attrs`.
+ */
+
+Tag.prototype.__proto__ = Attrs.prototype;
+
+/**
+ * Clone this tag.
+ *
+ * @return {Tag}
+ * @api private
+ */
+
+Tag.prototype.clone = function(){
+  var clone = new Tag(this.name, this.block.clone());
+  clone.line = this.line;
+  clone.attrs = this.attrs;
+  clone.textOnly = this.textOnly;
+  return clone;
+};
+
+/**
+ * Check if this tag is an inline tag.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+Tag.prototype.isInline = function(){
+  return ~inlineTags.indexOf(this.name);
+};
+
+/**
+ * Check if this tag's contents can be inlined.  Used for pretty printing.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+Tag.prototype.canInline = function(){
+  var nodes = this.block.nodes;
+
+  function isInline(node){
+    // Recurse if the node is a block
+    if (node.isBlock) return node.nodes.every(isInline);
+    return node.isText || (node.isInline && node.isInline());
+  }
+  
+  // Empty tag
+  if (!nodes.length) return true;
+  
+  // Text-only or inline-only tag
+  if (1 == nodes.length) return isInline(nodes[0]);
+  
+  // Multi-line inline-only tag
+  if (this.block.nodes.every(isInline)) {
+    for (var i = 1, len = nodes.length; i < len; ++i) {
+      if (nodes[i-1].isText && nodes[i].isText)
+        return false;
+    }
+    return true;
+  }
+  
+  // Mixed tag
+  return false;
+};
\ No newline at end of file
diff --git a/node_modules/jade/lib/nodes/text.js b/node_modules/jade/lib/nodes/text.js
new file mode 100644
index 0000000..3b5dd55
--- /dev/null
+++ b/node_modules/jade/lib/nodes/text.js
@@ -0,0 +1,36 @@
+
+/*!
+ * Jade - nodes - Text
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Node = require('./node');
+
+/**
+ * Initialize a `Text` node with optional `line`.
+ *
+ * @param {String} line
+ * @api public
+ */
+
+var Text = module.exports = function Text(line) {
+  this.val = '';
+  if ('string' == typeof line) this.val = line;
+};
+
+/**
+ * Inherit from `Node`.
+ */
+
+Text.prototype.__proto__ = Node.prototype;
+
+/**
+ * Flag as text.
+ */
+
+Text.prototype.isText = true;
\ No newline at end of file
diff --git a/node_modules/jade/lib/parser.js b/node_modules/jade/lib/parser.js
new file mode 100644
index 0000000..92f2af0
--- /dev/null
+++ b/node_modules/jade/lib/parser.js
@@ -0,0 +1,710 @@
+
+/*!
+ * Jade - Parser
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var Lexer = require('./lexer')
+  , nodes = require('./nodes');
+
+/**
+ * Initialize `Parser` with the given input `str` and `filename`.
+ *
+ * @param {String} str
+ * @param {String} filename
+ * @param {Object} options
+ * @api public
+ */
+
+var Parser = exports = module.exports = function Parser(str, filename, options){
+  this.input = str;
+  this.lexer = new Lexer(str, options);
+  this.filename = filename;
+  this.blocks = {};
+  this.mixins = {};
+  this.options = options;
+  this.contexts = [this];
+};
+
+/**
+ * Tags that may not contain tags.
+ */
+
+var textOnly = exports.textOnly = ['script', 'style'];
+
+/**
+ * Parser prototype.
+ */
+
+Parser.prototype = {
+
+  /**
+   * Push `parser` onto the context stack,
+   * or pop and return a `Parser`.
+   */
+
+  context: function(parser){
+    if (parser) {
+      this.contexts.push(parser);
+    } else {
+      return this.contexts.pop();
+    }
+  },
+
+  /**
+   * Return the next token object.
+   *
+   * @return {Object}
+   * @api private
+   */
+
+  advance: function(){
+    return this.lexer.advance();
+  },
+
+  /**
+   * Skip `n` tokens.
+   *
+   * @param {Number} n
+   * @api private
+   */
+
+  skip: function(n){
+    while (n--) this.advance();
+  },
+  
+  /**
+   * Single token lookahead.
+   *
+   * @return {Object}
+   * @api private
+   */
+  
+  peek: function() {
+    return this.lookahead(1);
+  },
+  
+  /**
+   * Return lexer lineno.
+   *
+   * @return {Number}
+   * @api private
+   */
+  
+  line: function() {
+    return this.lexer.lineno;
+  },
+  
+  /**
+   * `n` token lookahead.
+   *
+   * @param {Number} n
+   * @return {Object}
+   * @api private
+   */
+  
+  lookahead: function(n){
+    return this.lexer.lookahead(n);
+  },
+  
+  /**
+   * Parse input returning a string of js for evaluation.
+   *
+   * @return {String}
+   * @api public
+   */
+  
+  parse: function(){
+    var block = new nodes.Block, parser;
+    block.line = this.line();
+
+    while ('eos' != this.peek().type) {
+      if ('newline' == this.peek().type) {
+        this.advance();
+      } else {
+        block.push(this.parseExpr());
+      }
+    }
+
+    if (parser = this.extending) {
+      this.context(parser);
+      var ast = parser.parse();
+      this.context();
+      // hoist mixins
+      for (var name in this.mixins)
+        ast.unshift(this.mixins[name]);
+      return ast;
+    }
+
+    return block;
+  },
+  
+  /**
+   * Expect the given type, or throw an exception.
+   *
+   * @param {String} type
+   * @api private
+   */
+  
+  expect: function(type){
+    if (this.peek().type === type) {
+      return this.advance();
+    } else {
+      throw new Error('expected "' + type + '", but got "' + this.peek().type + '"');
+    }
+  },
+  
+  /**
+   * Accept the given `type`.
+   *
+   * @param {String} type
+   * @api private
+   */
+  
+  accept: function(type){
+    if (this.peek().type === type) {
+      return this.advance();
+    }
+  },
+  
+  /**
+   *   tag
+   * | doctype
+   * | mixin
+   * | include
+   * | filter
+   * | comment
+   * | text
+   * | each
+   * | code
+   * | yield
+   * | id
+   * | class
+   * | interpolation
+   */
+  
+  parseExpr: function(){
+    switch (this.peek().type) {
+      case 'tag':
+        return this.parseTag();
+      case 'mixin':
+        return this.parseMixin();
+      case 'block':
+        return this.parseBlock();
+      case 'case':
+        return this.parseCase();
+      case 'when':
+        return this.parseWhen();
+      case 'default':
+        return this.parseDefault();
+      case 'extends':
+        return this.parseExtends();
+      case 'include':
+        return this.parseInclude();
+      case 'doctype':
+        return this.parseDoctype();
+      case 'filter':
+        return this.parseFilter();
+      case 'comment':
+        return this.parseComment();
+      case 'text':
+        return this.parseText();
+      case 'each':
+        return this.parseEach();
+      case 'code':
+        return this.parseCode();
+      case 'call':
+        return this.parseCall();
+      case 'interpolation':
+        return this.parseInterpolation();
+      case 'yield':
+        this.advance();
+        var block = new nodes.Block;
+        block.yield = true;
+        return block;
+      case 'id':
+      case 'class':
+        var tok = this.advance();
+        this.lexer.defer(this.lexer.tok('tag', 'div'));
+        this.lexer.defer(tok);
+        return this.parseExpr();
+      default:
+        throw new Error('unexpected token "' + this.peek().type + '"');
+    }
+  },
+  
+  /**
+   * Text
+   */
+  
+  parseText: function(){
+    var tok = this.expect('text')
+      , node = new nodes.Text(tok.val);
+    node.line = this.line();
+    return node;
+  },
+
+  /**
+   *   ':' expr
+   * | block
+   */
+
+  parseBlockExpansion: function(){
+    if (':' == this.peek().type) {
+      this.advance();
+      return new nodes.Block(this.parseExpr());
+    } else {
+      return this.block();
+    }
+  },
+
+  /**
+   * case
+   */
+
+  parseCase: function(){
+    var val = this.expect('case').val
+      , node = new nodes.Case(val);
+    node.line = this.line();
+    node.block = this.block();
+    return node;
+  },
+
+  /**
+   * when
+   */
+
+  parseWhen: function(){
+    var val = this.expect('when').val
+    return new nodes.Case.When(val, this.parseBlockExpansion());
+  },
+  
+  /**
+   * default
+   */
+
+  parseDefault: function(){
+    this.expect('default');
+    return new nodes.Case.When('default', this.parseBlockExpansion());
+  },
+
+  /**
+   * code
+   */
+  
+  parseCode: function(){
+    var tok = this.expect('code')
+      , node = new nodes.Code(tok.val, tok.buffer, tok.escape)
+      , block
+      , i = 1;
+    node.line = this.line();
+    while (this.lookahead(i) && 'newline' == this.lookahead(i).type) ++i;
+    block = 'indent' == this.lookahead(i).type;
+    if (block) {
+      this.skip(i-1);
+      node.block = this.block();
+    }
+    return node;
+  },
+  
+  /**
+   * comment
+   */
+  
+  parseComment: function(){
+    var tok = this.expect('comment')
+      , node;
+
+    if ('indent' == this.peek().type) {
+      node = new nodes.BlockComment(tok.val, this.block(), tok.buffer);
+    } else {
+      node = new nodes.Comment(tok.val, tok.buffer);
+    }
+
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * doctype
+   */
+  
+  parseDoctype: function(){
+    var tok = this.expect('doctype')
+      , node = new nodes.Doctype(tok.val);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * filter attrs? text-block
+   */
+  
+  parseFilter: function(){
+    var block
+      , tok = this.expect('filter')
+      , attrs = this.accept('attrs');
+
+    this.lexer.pipeless = true;
+    block = this.parseTextBlock();
+    this.lexer.pipeless = false;
+
+    var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * tag ':' attrs? block
+   */
+  
+  parseASTFilter: function(){
+    var block
+      , tok = this.expect('tag')
+      , attrs = this.accept('attrs');
+
+    this.expect(':');
+    block = this.block();
+
+    var node = new nodes.Filter(tok.val, block, attrs && attrs.attrs);
+    node.line = this.line();
+    return node;
+  },
+  
+  /**
+   * each block
+   */
+  
+  parseEach: function(){
+    var tok = this.expect('each')
+      , node = new nodes.Each(tok.code, tok.val, tok.key);
+    node.line = this.line();
+    node.block = this.block();
+    return node;
+  },
+
+  /**
+   * 'extends' name
+   */
+
+  parseExtends: function(){
+    var path = require('path')
+      , fs = require('fs')
+      , dirname = path.dirname
+      , basename = path.basename
+      , join = path.join;
+
+    if (!this.filename)
+      throw new Error('the "filename" option is required to extend templates');
+
+    var path = this.expect('extends').val.trim()
+      , dir = dirname(this.filename);
+
+    var path = join(dir, path + '.jade')
+      , str = fs.readFileSync(path, 'utf8')
+      , parser = new Parser(str, path, this.options);
+
+    parser.blocks = this.blocks;
+    parser.contexts = this.contexts;
+    this.extending = parser;
+
+    // TODO: null node
+    return new nodes.Literal('');
+  },
+
+  /**
+   * 'block' name block
+   */
+
+  parseBlock: function(){
+    var block = this.expect('block')
+      , mode = block.mode
+      , name = block.val.trim();
+
+    block = 'indent' == this.peek().type
+      ? this.block()
+      : new nodes.Block(new nodes.Literal(''));
+
+    var prev = this.blocks[name];
+
+    if (prev) {
+      switch (prev.mode) {
+        case 'append':
+          block.nodes = block.nodes.concat(prev.nodes);
+          prev = block;
+          break;
+        case 'prepend':
+          block.nodes = prev.nodes.concat(block.nodes);
+          prev = block;
+          break;
+      }
+    }
+
+    block.mode = mode;
+    return this.blocks[name] = prev || block;
+  },
+
+  /**
+   * include block?
+   */
+
+  parseInclude: function(){
+    var path = require('path')
+      , fs = require('fs')
+      , dirname = path.dirname
+      , basename = path.basename
+      , join = path.join;
+
+    var path = this.expect('include').val.trim()
+      , dir = dirname(this.filename);
+
+    if (!this.filename)
+      throw new Error('the "filename" option is required to use includes');
+
+    // no extension
+    if (!~basename(path).indexOf('.')) {
+      path += '.jade';
+    }
+
+    // non-jade
+    if ('.jade' != path.substr(-5)) {
+      var path = join(dir, path)
+        , str = fs.readFileSync(path, 'utf8');
+      return new nodes.Literal(str);
+    }
+
+    var path = join(dir, path)
+      , str = fs.readFileSync(path, 'utf8')
+     , parser = new Parser(str, path, this.options);
+    parser.blocks = this.blocks;
+    parser.mixins = this.mixins;
+
+    this.context(parser);
+    var ast = parser.parse();
+    this.context();
+    ast.filename = path;
+
+    if ('indent' == this.peek().type) {
+      ast.includeBlock().push(this.block());
+    }
+
+    return ast;
+  },
+
+  /**
+   * call ident block
+   */
+
+  parseCall: function(){
+    var tok = this.expect('call')
+      , name = tok.val
+      , args = tok.args
+      , mixin = new nodes.Mixin(name, args, new nodes.Block, true);
+
+    this.tag(mixin);
+    if (mixin.block.isEmpty()) mixin.block = null;
+    return mixin;
+  },
+
+  /**
+   * mixin block
+   */
+
+  parseMixin: function(){
+    var tok = this.expect('mixin')
+      , name = tok.val
+      , args = tok.args
+      , mixin;
+
+    // definition
+    if ('indent' == this.peek().type) {
+      mixin = new nodes.Mixin(name, args, this.block(), false);
+      this.mixins[name] = mixin;
+      return mixin;
+    // call
+    } else {
+      return new nodes.Mixin(name, args, null, true);
+    }
+  },
+
+  /**
+   * indent (text | newline)* outdent
+   */
+
+  parseTextBlock: function(){
+    var block = new nodes.Block;
+    block.line = this.line();
+    var spaces = this.expect('indent').val;
+    if (null == this._spaces) this._spaces = spaces;
+    var indent = Array(spaces - this._spaces + 1).join(' ');
+    while ('outdent' != this.peek().type) {
+      switch (this.peek().type) {
+        case 'newline':
+          this.advance();
+          break;
+        case 'indent':
+          this.parseTextBlock().nodes.forEach(function(node){
+            block.push(node);
+          });
+          break;
+        default:
+          var text = new nodes.Text(indent + this.advance().val);
+          text.line = this.line();
+          block.push(text);
+      }
+    }
+
+    if (spaces == this._spaces) this._spaces = null;
+    this.expect('outdent');
+    return block;
+  },
+
+  /**
+   * indent expr* outdent
+   */
+  
+  block: function(){
+    var block = new nodes.Block;
+    block.line = this.line();
+    this.expect('indent');
+    while ('outdent' != this.peek().type) {
+      if ('newline' == this.peek().type) {
+        this.advance();
+      } else {
+        block.push(this.parseExpr());
+      }
+    }
+    this.expect('outdent');
+    return block;
+  },
+
+  /**
+   * interpolation (attrs | class | id)* (text | code | ':')? newline* block?
+   */
+  
+  parseInterpolation: function(){
+    var tok = this.advance();
+    var tag = new nodes.Tag(tok.val);
+    tag.buffer = true;
+    return this.tag(tag);
+  },
+
+  /**
+   * tag (attrs | class | id)* (text | code | ':')? newline* block?
+   */
+  
+  parseTag: function(){
+    // ast-filter look-ahead
+    var i = 2;
+    if ('attrs' == this.lookahead(i).type) ++i;
+    if (':' == this.lookahead(i).type) {
+      if ('indent' == this.lookahead(++i).type) {
+        return this.parseASTFilter();
+      }
+    }
+
+    var tok = this.advance()
+      , tag = new nodes.Tag(tok.val);
+
+    tag.selfClosing = tok.selfClosing;
+
+    return this.tag(tag);
+  },
+
+  /**
+   * Parse tag.
+   */
+
+  tag: function(tag){
+    var dot;
+
+    tag.line = this.line();
+
+    // (attrs | class | id)*
+    out:
+      while (true) {
+        switch (this.peek().type) {
+          case 'id':
+          case 'class':
+            var tok = this.advance();
+            tag.setAttribute(tok.type, "'" + tok.val + "'");
+            continue;
+          case 'attrs':
+            var tok = this.advance()
+              , obj = tok.attrs
+              , escaped = tok.escaped
+              , names = Object.keys(obj);
+
+            if (tok.selfClosing) tag.selfClosing = true;
+
+            for (var i = 0, len = names.length; i < len; ++i) {
+              var name = names[i]
+                , val = obj[name];
+              tag.setAttribute(name, val, escaped[name]);
+            }
+            continue;
+          default:
+            break out;
+        }
+      }
+
+    // check immediate '.'
+    if ('.' == this.peek().val) {
+      dot = tag.textOnly = true;
+      this.advance();
+    }
+
+    // (text | code | ':')?
+    switch (this.peek().type) {
+      case 'text':
+        tag.block.push(this.parseText());
+        break;
+      case 'code':
+        tag.code = this.parseCode();
+        break;
+      case ':':
+        this.advance();
+        tag.block = new nodes.Block;
+        tag.block.push(this.parseExpr());
+        break;
+    }
+
+    // newline*
+    while ('newline' == this.peek().type) this.advance();
+
+    tag.textOnly = tag.textOnly || ~textOnly.indexOf(tag.name);
+
+    // script special-case
+    if ('script' == tag.name) {
+      var type = tag.getAttribute('type');
+      if (!dot && type && 'text/javascript' != type.replace(/^['"]|['"]$/g, '')) {
+        tag.textOnly = false;
+      }
+    }
+
+    // block?
+    if ('indent' == this.peek().type) {
+      if (tag.textOnly) {
+        this.lexer.pipeless = true;
+        tag.block = this.parseTextBlock();
+        this.lexer.pipeless = false;
+      } else {
+        var block = this.block();
+        if (tag.block) {
+          for (var i = 0, len = block.nodes.length; i < len; ++i) {
+            tag.block.push(block.nodes[i]);
+          }
+        } else {
+          tag.block = block;
+        }
+      }
+    }
+    
+    return tag;
+  }
+};
diff --git a/node_modules/jade/lib/runtime.js b/node_modules/jade/lib/runtime.js
new file mode 100644
index 0000000..fb711f5
--- /dev/null
+++ b/node_modules/jade/lib/runtime.js
@@ -0,0 +1,174 @@
+
+/*!
+ * Jade - runtime
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Lame Array.isArray() polyfill for now.
+ */
+
+if (!Array.isArray) {
+  Array.isArray = function(arr){
+    return '[object Array]' == Object.prototype.toString.call(arr);
+  };
+}
+
+/**
+ * Lame Object.keys() polyfill for now.
+ */
+
+if (!Object.keys) {
+  Object.keys = function(obj){
+    var arr = [];
+    for (var key in obj) {
+      if (obj.hasOwnProperty(key)) {
+        arr.push(key);
+      }
+    }
+    return arr;
+  }
+}
+
+/**
+ * Merge two attribute objects giving precedence
+ * to values in object `b`. Classes are special-cased
+ * allowing for arrays and merging/joining appropriately
+ * resulting in a string.
+ *
+ * @param {Object} a
+ * @param {Object} b
+ * @return {Object} a
+ * @api private
+ */
+
+exports.merge = function merge(a, b) {
+  var ac = a['class'];
+  var bc = b['class'];
+
+  if (ac || bc) {
+    ac = ac || [];
+    bc = bc || [];
+    if (!Array.isArray(ac)) ac = [ac];
+    if (!Array.isArray(bc)) bc = [bc];
+    ac = ac.filter(nulls);
+    bc = bc.filter(nulls);
+    a['class'] = ac.concat(bc).join(' ');
+  }
+
+  for (var key in b) {
+    if (key != 'class') {
+      a[key] = b[key];
+    }
+  }
+
+  return a;
+};
+
+/**
+ * Filter null `val`s.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function nulls(val) {
+  return val != null;
+}
+
+/**
+ * Render the given attributes object.
+ *
+ * @param {Object} obj
+ * @param {Object} escaped
+ * @return {String}
+ * @api private
+ */
+
+exports.attrs = function attrs(obj, escaped){
+  var buf = []
+    , terse = obj.terse;
+
+  delete obj.terse;
+  var keys = Object.keys(obj)
+    , len = keys.length;
+
+  if (len) {
+    buf.push('');
+    for (var i = 0; i < len; ++i) {
+      var key = keys[i]
+        , val = obj[key];
+
+      if ('boolean' == typeof val || null == val) {
+        if (val) {
+          terse
+            ? buf.push(key)
+            : buf.push(key + '="' + key + '"');
+        }
+      } else if (0 == key.indexOf('data') && 'string' != typeof val) {
+        buf.push(key + "='" + JSON.stringify(val) + "'");
+      } else if ('class' == key && Array.isArray(val)) {
+        buf.push(key + '="' + exports.escape(val.join(' ')) + '"');
+      } else if (escaped && escaped[key]) {
+        buf.push(key + '="' + exports.escape(val) + '"');
+      } else {
+        buf.push(key + '="' + val + '"');
+      }
+    }
+  }
+
+  return buf.join(' ');
+};
+
+/**
+ * Escape the given string of `html`.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+exports.escape = function escape(html){
+  return String(html)
+    .replace(/&(?!(\w+|\#\d+);)/g, '&')
+    .replace(//g, '>')
+    .replace(/"/g, '"');
+};
+
+/**
+ * Re-throw the given `err` in context to the
+ * the jade in `filename` at the given `lineno`.
+ *
+ * @param {Error} err
+ * @param {String} filename
+ * @param {String} lineno
+ * @api private
+ */
+
+exports.rethrow = function rethrow(err, filename, lineno){
+  if (!filename) throw err;
+
+  var context = 3
+    , str = require('fs').readFileSync(filename, 'utf8')
+    , lines = str.split('\n')
+    , start = Math.max(lineno - context, 0)
+    , end = Math.min(lines.length, lineno + context);
+
+  // Error context
+  var context = lines.slice(start, end).map(function(line, i){
+    var curr = i + start + 1;
+    return (curr == lineno ? '  > ' : '    ')
+      + curr
+      + '| '
+      + line;
+  }).join('\n');
+
+  // Alter exception message
+  err.path = filename;
+  err.message = (filename || 'Jade') + ':' + lineno
+    + '\n' + context + '\n\n' + err.message;
+  throw err;
+};
diff --git a/node_modules/jade/lib/self-closing.js b/node_modules/jade/lib/self-closing.js
new file mode 100644
index 0000000..0548771
--- /dev/null
+++ b/node_modules/jade/lib/self-closing.js
@@ -0,0 +1,19 @@
+
+/*!
+ * Jade - self closing tags
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+module.exports = [
+    'meta'
+  , 'img'
+  , 'link'
+  , 'input'
+  , 'source'
+  , 'area'
+  , 'base'
+  , 'col'
+  , 'br'
+  , 'hr'
+];
\ No newline at end of file
diff --git a/node_modules/jade/lib/utils.js b/node_modules/jade/lib/utils.js
new file mode 100644
index 0000000..ff46d02
--- /dev/null
+++ b/node_modules/jade/lib/utils.js
@@ -0,0 +1,49 @@
+
+/*!
+ * Jade - utils
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Convert interpolation in the given string to JavaScript.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+var interpolate = exports.interpolate = function(str){
+  return str.replace(/(\\)?([#!]){(.*?)}/g, function(str, escape, flag, code){
+    return escape
+      ? str
+      : "' + "
+        + ('!' == flag ? '' : 'escape')
+        + "((interp = " + code.replace(/\\'/g, "'")
+        + ") == null ? '' : interp) + '";
+  });
+};
+
+/**
+ * Escape single quotes in `str`.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+var escape = exports.escape = function(str) {
+  return str.replace(/'/g, "\\'");
+};
+
+/**
+ * Interpolate, and escape the given `str`.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+exports.text = function(str){
+  return interpolate(escape(str));
+};
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/commander/.npmignore b/node_modules/jade/node_modules/commander/.npmignore
new file mode 100644
index 0000000..f1250e5
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/node_modules/jade/node_modules/commander/.travis.yml b/node_modules/jade/node_modules/commander/.travis.yml
new file mode 100644
index 0000000..f1d0f13
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+  - 0.4
+  - 0.6
diff --git a/node_modules/jade/node_modules/commander/History.md b/node_modules/jade/node_modules/commander/History.md
new file mode 100644
index 0000000..4961d2e
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/History.md
@@ -0,0 +1,107 @@
+
+0.6.1 / 2012-06-01 
+==================
+
+  * Added: append (yes or no) on confirmation
+  * Added: allow node.js v0.7.x
+
+0.6.0 / 2012-04-10 
+==================
+
+  * Added `.prompt(obj, callback)` support. Closes #49
+  * Added default support to .choose(). Closes #41
+  * Fixed the choice example
+
+0.5.1 / 2011-12-20 
+==================
+
+  * Fixed `password()` for recent nodes. Closes #36
+
+0.5.0 / 2011-12-04 
+==================
+
+  * Added sub-command option support [itay]
+
+0.4.3 / 2011-12-04 
+==================
+
+  * Fixed custom help ordering. Closes #32
+
+0.4.2 / 2011-11-24 
+==================
+
+  * Added travis support
+  * Fixed: line-buffered input automatically trimmed. Closes #31
+
+0.4.1 / 2011-11-18 
+==================
+
+  * Removed listening for "close" on --help
+
+0.4.0 / 2011-11-15 
+==================
+
+  * Added support for `--`. Closes #24
+
+0.3.3 / 2011-11-14 
+==================
+
+  * Fixed: wait for close event when writing help info [Jerry Hamlet]
+
+0.3.2 / 2011-11-01 
+==================
+
+  * Fixed long flag definitions with values [felixge]
+
+0.3.1 / 2011-10-31 
+==================
+
+  * Changed `--version` short flag to `-V` from `-v`
+  * Changed `.version()` so it's configurable [felixge]
+
+0.3.0 / 2011-10-31 
+==================
+
+  * Added support for long flags only. Closes #18
+
+0.2.1 / 2011-10-24 
+==================
+
+  * "node": ">= 0.4.x < 0.7.0". Closes #20
+
+0.2.0 / 2011-09-26 
+==================
+
+  * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs]
+
+0.1.0 / 2011-08-24 
+==================
+
+  * Added support for custom `--help` output
+
+0.0.5 / 2011-08-18 
+==================
+
+  * Changed: when the user enters nothing prompt for password again
+  * Fixed issue with passwords beginning with numbers [NuckChorris]
+
+0.0.4 / 2011-08-15 
+==================
+
+  * Fixed `Commander#args`
+
+0.0.3 / 2011-08-15 
+==================
+
+  * Added default option value support
+
+0.0.2 / 2011-08-15 
+==================
+
+  * Added mask support to `Command#password(str[, mask], fn)`
+  * Added `Command#password(str, fn)`
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
diff --git a/node_modules/jade/node_modules/commander/Makefile b/node_modules/jade/node_modules/commander/Makefile
new file mode 100644
index 0000000..0074625
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/Makefile
@@ -0,0 +1,7 @@
+
+TESTS = $(shell find test/test.*.js)
+
+test:
+	@./test/run $(TESTS)
+
+.PHONY: test
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/commander/Readme.md b/node_modules/jade/node_modules/commander/Readme.md
new file mode 100644
index 0000000..b8328c3
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/Readme.md
@@ -0,0 +1,262 @@
+# Commander.js
+
+  The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/visionmedia/commander).
+
+ [![Build Status](https://secure.travis-ci.org/visionmedia/commander.js.png)](http://travis-ci.org/visionmedia/commander.js)
+
+## Installation
+
+    $ npm install commander
+
+## Option parsing
+
+ Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options.
+
+```js
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('commander');
+
+program
+  .version('0.0.1')
+  .option('-p, --peppers', 'Add peppers')
+  .option('-P, --pineapple', 'Add pineapple')
+  .option('-b, --bbq', 'Add bbq sauce')
+  .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble')
+  .parse(process.argv);
+
+console.log('you ordered a pizza with:');
+if (program.peppers) console.log('  - peppers');
+if (program.pineapple) console.log('  - pineappe');
+if (program.bbq) console.log('  - bbq');
+console.log('  - %s cheese', program.cheese);
+```
+
+ Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc.
+
+## Automated --help
+
+ The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free:
+
+```  
+ $ ./examples/pizza --help
+
+   Usage: pizza [options]
+
+   Options:
+
+     -V, --version        output the version number
+     -p, --peppers        Add peppers
+     -P, --pineapple      Add pineappe
+     -b, --bbq            Add bbq sauce
+     -c, --cheese   Add the specified type of cheese [marble]
+     -h, --help           output usage information
+
+```
+
+## Coercion
+
+```js
+function range(val) {
+  return val.split('..').map(Number);
+}
+
+function list(val) {
+  return val.split(',');
+}
+
+program
+  .version('0.0.1')
+  .usage('[options] ')
+  .option('-i, --integer ', 'An integer argument', parseInt)
+  .option('-f, --float ', 'A float argument', parseFloat)
+  .option('-r, --range ..', 'A range', range)
+  .option('-l, --list ', 'A list', list)
+  .option('-o, --optional [value]', 'An optional value')
+  .parse(process.argv);
+
+console.log(' int: %j', program.integer);
+console.log(' float: %j', program.float);
+console.log(' optional: %j', program.optional);
+program.range = program.range || [];
+console.log(' range: %j..%j', program.range[0], program.range[1]);
+console.log(' list: %j', program.list);
+console.log(' args: %j', program.args);
+```
+
+## Custom help
+
+ You can display arbitrary `-h, --help` information
+ by listening for "--help". Commander will automatically
+ exit once you are done so that the remainder of your program
+ does not execute causing undesired behaviours, for example
+ in the following executable "stuff" will not output when
+ `--help` is used.
+
+```js
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('../');
+
+function list(val) {
+  return val.split(',').map(Number);
+}
+
+program
+  .version('0.0.1')
+  .option('-f, --foo', 'enable some foo')
+  .option('-b, --bar', 'enable some bar')
+  .option('-B, --baz', 'enable some baz');
+
+// must be before .parse() since
+// node's emit() is immediate
+
+program.on('--help', function(){
+  console.log('  Examples:');
+  console.log('');
+  console.log('    $ custom-help --help');
+  console.log('    $ custom-help -h');
+  console.log('');
+});
+
+program.parse(process.argv);
+
+console.log('stuff');
+```
+
+yielding the following help output:
+
+```
+
+Usage: custom-help [options]
+
+Options:
+
+  -h, --help     output usage information
+  -V, --version  output the version number
+  -f, --foo      enable some foo
+  -b, --bar      enable some bar
+  -B, --baz      enable some baz
+
+Examples:
+
+  $ custom-help --help
+  $ custom-help -h
+
+```
+
+## .prompt(msg, fn)
+
+ Single-line prompt:
+
+```js
+program.prompt('name: ', function(name){
+  console.log('hi %s', name);
+});
+```
+
+ Multi-line prompt:
+
+```js
+program.prompt('description:', function(name){
+  console.log('hi %s', name);
+});
+```
+
+ Coercion:
+
+```js
+program.prompt('Age: ', Number, function(age){
+  console.log('age: %j', age);
+});
+```
+
+```js
+program.prompt('Birthdate: ', Date, function(date){
+  console.log('date: %s', date);
+});
+```
+
+## .password(msg[, mask], fn)
+
+Prompt for password without echoing:
+
+```js
+program.password('Password: ', function(pass){
+  console.log('got "%s"', pass);
+  process.stdin.destroy();
+});
+```
+
+Prompt for password with mask char "*":
+
+```js
+program.password('Password: ', '*', function(pass){
+  console.log('got "%s"', pass);
+  process.stdin.destroy();
+});
+```
+
+## .confirm(msg, fn)
+
+ Confirm with the given `msg`:
+
+```js
+program.confirm('continue? ', function(ok){
+  console.log(' got %j', ok);
+});
+```
+
+## .choose(list, fn)
+
+ Let the user choose from a `list`:
+
+```js
+var list = ['tobi', 'loki', 'jane', 'manny', 'luna'];
+
+console.log('Choose the coolest pet:');
+program.choose(list, function(i){
+  console.log('you chose %d "%s"', i, list[i]);
+});
+```
+
+## Links
+
+ - [API documentation](http://visionmedia.github.com/commander.js/)
+ - [ascii tables](https://github.com/LearnBoost/cli-table)
+ - [progress bars](https://github.com/visionmedia/node-progress)
+ - [more progress bars](https://github.com/substack/node-multimeter)
+ - [examples](https://github.com/visionmedia/commander.js/tree/master/examples)
+
+## License 
+
+(The MIT License)
+
+Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/commander/index.js b/node_modules/jade/node_modules/commander/index.js
new file mode 100644
index 0000000..06ec1e4
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/index.js
@@ -0,0 +1,2 @@
+
+module.exports = require('./lib/commander');
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/commander/lib/commander.js b/node_modules/jade/node_modules/commander/lib/commander.js
new file mode 100644
index 0000000..5ba87eb
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/lib/commander.js
@@ -0,0 +1,1026 @@
+
+/*!
+ * commander
+ * Copyright(c) 2011 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter
+  , path = require('path')
+  , tty = require('tty')
+  , basename = path.basename;
+
+/**
+ * Expose the root command.
+ */
+
+exports = module.exports = new Command;
+
+/**
+ * Expose `Command`.
+ */
+
+exports.Command = Command;
+
+/**
+ * Expose `Option`.
+ */
+
+exports.Option = Option;
+
+/**
+ * Initialize a new `Option` with the given `flags` and `description`.
+ *
+ * @param {String} flags
+ * @param {String} description
+ * @api public
+ */
+
+function Option(flags, description) {
+  this.flags = flags;
+  this.required = ~flags.indexOf('<');
+  this.optional = ~flags.indexOf('[');
+  this.bool = !~flags.indexOf('-no-');
+  flags = flags.split(/[ ,|]+/);
+  if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift();
+  this.long = flags.shift();
+  this.description = description;
+}
+
+/**
+ * Return option name.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Option.prototype.name = function(){
+  return this.long
+    .replace('--', '')
+    .replace('no-', '');
+};
+
+/**
+ * Check if `arg` matches the short or long flag.
+ *
+ * @param {String} arg
+ * @return {Boolean}
+ * @api private
+ */
+
+Option.prototype.is = function(arg){
+  return arg == this.short
+    || arg == this.long;
+};
+
+/**
+ * Initialize a new `Command`.
+ *
+ * @param {String} name
+ * @api public
+ */
+
+function Command(name) {
+  this.commands = [];
+  this.options = [];
+  this.args = [];
+  this.name = name;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+
+Command.prototype.__proto__ = EventEmitter.prototype;
+
+/**
+ * Add command `name`.
+ *
+ * The `.action()` callback is invoked when the
+ * command `name` is specified via __ARGV__,
+ * and the remaining arguments are applied to the
+ * function for access.
+ *
+ * When the `name` is "*" an un-matched command
+ * will be passed as the first arg, followed by
+ * the rest of __ARGV__ remaining.
+ *
+ * Examples:
+ *
+ *      program
+ *        .version('0.0.1')
+ *        .option('-C, --chdir ', 'change the working directory')
+ *        .option('-c, --config ', 'set config path. defaults to ./deploy.conf')
+ *        .option('-T, --no-tests', 'ignore test hook')
+ *     
+ *      program
+ *        .command('setup')
+ *        .description('run remote setup commands')
+ *        .action(function(){
+ *          console.log('setup');
+ *        });
+ *     
+ *      program
+ *        .command('exec ')
+ *        .description('run the given remote command')
+ *        .action(function(cmd){
+ *          console.log('exec "%s"', cmd);
+ *        });
+ *     
+ *      program
+ *        .command('*')
+ *        .description('deploy the given env')
+ *        .action(function(env){
+ *          console.log('deploying "%s"', env);
+ *        });
+ *     
+ *      program.parse(process.argv);
+  *
+ * @param {String} name
+ * @return {Command} the new command
+ * @api public
+ */
+
+Command.prototype.command = function(name){
+  var args = name.split(/ +/);
+  var cmd = new Command(args.shift());
+  this.commands.push(cmd);
+  cmd.parseExpectedArgs(args);
+  cmd.parent = this;
+  return cmd;
+};
+
+/**
+ * Parse expected `args`.
+ *
+ * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`.
+ *
+ * @param {Array} args
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.parseExpectedArgs = function(args){
+  if (!args.length) return;
+  var self = this;
+  args.forEach(function(arg){
+    switch (arg[0]) {
+      case '<':
+        self.args.push({ required: true, name: arg.slice(1, -1) });
+        break;
+      case '[':
+        self.args.push({ required: false, name: arg.slice(1, -1) });
+        break;
+    }
+  });
+  return this;
+};
+
+/**
+ * Register callback `fn` for the command.
+ *
+ * Examples:
+ *
+ *      program
+ *        .command('help')
+ *        .description('display verbose help')
+ *        .action(function(){
+ *           // output help here
+ *        });
+ *
+ * @param {Function} fn
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.action = function(fn){
+  var self = this;
+  this.parent.on(this.name, function(args, unknown){    
+    // Parse any so-far unknown options
+    unknown = unknown || [];
+    var parsed = self.parseOptions(unknown);
+    
+    // Output help if necessary
+    outputHelpIfNecessary(self, parsed.unknown);
+    
+    // If there are still any unknown options, then we simply 
+    // die, unless someone asked for help, in which case we give it
+    // to them, and then we die.
+    if (parsed.unknown.length > 0) {      
+      self.unknownOption(parsed.unknown[0]);
+    }
+    
+    self.args.forEach(function(arg, i){
+      if (arg.required && null == args[i]) {
+        self.missingArgument(arg.name);
+      }
+    });
+    
+    // Always append ourselves to the end of the arguments,
+    // to make sure we match the number of arguments the user
+    // expects
+    if (self.args.length) {
+      args[self.args.length] = self;
+    } else {
+      args.push(self);
+    }
+    
+    fn.apply(this, args);
+  });
+  return this;
+};
+
+/**
+ * Define option with `flags`, `description` and optional
+ * coercion `fn`. 
+ *
+ * The `flags` string should contain both the short and long flags,
+ * separated by comma, a pipe or space. The following are all valid
+ * all will output this way when `--help` is used.
+ *
+ *    "-p, --pepper"
+ *    "-p|--pepper"
+ *    "-p --pepper"
+ *
+ * Examples:
+ *
+ *     // simple boolean defaulting to false
+ *     program.option('-p, --pepper', 'add pepper');
+ *
+ *     --pepper
+ *     program.pepper
+ *     // => Boolean
+ *
+ *     // simple boolean defaulting to false
+ *     program.option('-C, --no-cheese', 'remove cheese');
+ *
+ *     program.cheese
+ *     // => true
+ *
+ *     --no-cheese
+ *     program.cheese
+ *     // => true
+ *
+ *     // required argument
+ *     program.option('-C, --chdir ', 'change the working directory');
+ *
+ *     --chdir /tmp
+ *     program.chdir
+ *     // => "/tmp"
+ *
+ *     // optional argument
+ *     program.option('-c, --cheese [type]', 'add cheese [marble]');
+ *
+ * @param {String} flags
+ * @param {String} description
+ * @param {Function|Mixed} fn or default
+ * @param {Mixed} defaultValue
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.option = function(flags, description, fn, defaultValue){
+  var self = this
+    , option = new Option(flags, description)
+    , oname = option.name()
+    , name = camelcase(oname);
+
+  // default as 3rd arg
+  if ('function' != typeof fn) defaultValue = fn, fn = null;
+
+  // preassign default value only for --no-*, [optional], or 
+  if (false == option.bool || option.optional || option.required) {
+    // when --no-* we make sure default is true
+    if (false == option.bool) defaultValue = true;
+    // preassign only if we have a default
+    if (undefined !== defaultValue) self[name] = defaultValue;
+  }
+
+  // register the option
+  this.options.push(option);
+
+  // when it's passed assign the value
+  // and conditionally invoke the callback
+  this.on(oname, function(val){
+    // coercion
+    if (null != val && fn) val = fn(val);
+
+    // unassigned or bool
+    if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) {
+      // if no value, bool true, and we have a default, then use it!
+      if (null == val) {
+        self[name] = option.bool
+          ? defaultValue || true
+          : false;
+      } else {
+        self[name] = val;
+      }
+    } else if (null !== val) {
+      // reassign
+      self[name] = val;
+    }
+  });
+
+  return this;
+};
+
+/**
+ * Parse `argv`, settings options and invoking commands when defined.
+ *
+ * @param {Array} argv
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.parse = function(argv){
+  // store raw args
+  this.rawArgs = argv;
+
+  // guess name
+  if (!this.name) this.name = basename(argv[1]);
+
+  // process argv
+  var parsed = this.parseOptions(this.normalize(argv.slice(2)));
+  this.args = parsed.args;
+  return this.parseArgs(this.args, parsed.unknown);
+};
+
+/**
+ * Normalize `args`, splitting joined short flags. For example
+ * the arg "-abc" is equivalent to "-a -b -c".
+ *
+ * @param {Array} args
+ * @return {Array}
+ * @api private
+ */
+
+Command.prototype.normalize = function(args){
+  var ret = []
+    , arg;
+
+  for (var i = 0, len = args.length; i < len; ++i) {
+    arg = args[i];
+    if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) {
+      arg.slice(1).split('').forEach(function(c){
+        ret.push('-' + c);
+      });
+    } else {
+      ret.push(arg);
+    }
+  }
+
+  return ret;
+};
+
+/**
+ * Parse command `args`.
+ *
+ * When listener(s) are available those
+ * callbacks are invoked, otherwise the "*"
+ * event is emitted and those actions are invoked.
+ *
+ * @param {Array} args
+ * @return {Command} for chaining
+ * @api private
+ */
+
+Command.prototype.parseArgs = function(args, unknown){
+  var cmds = this.commands
+    , len = cmds.length
+    , name;
+
+  if (args.length) {
+    name = args[0];
+    if (this.listeners(name).length) {
+      this.emit(args.shift(), args, unknown);
+    } else {
+      this.emit('*', args);
+    }
+  } else {
+    outputHelpIfNecessary(this, unknown);
+    
+    // If there were no args and we have unknown options,
+    // then they are extraneous and we need to error.
+    if (unknown.length > 0) {      
+      this.unknownOption(unknown[0]);
+    }
+  }
+
+  return this;
+};
+
+/**
+ * Return an option matching `arg` if any.
+ *
+ * @param {String} arg
+ * @return {Option}
+ * @api private
+ */
+
+Command.prototype.optionFor = function(arg){
+  for (var i = 0, len = this.options.length; i < len; ++i) {
+    if (this.options[i].is(arg)) {
+      return this.options[i];
+    }
+  }
+};
+
+/**
+ * Parse options from `argv` returning `argv`
+ * void of these options.
+ *
+ * @param {Array} argv
+ * @return {Array}
+ * @api public
+ */
+
+Command.prototype.parseOptions = function(argv){
+  var args = []
+    , len = argv.length
+    , literal
+    , option
+    , arg;
+
+  var unknownOptions = [];
+
+  // parse options
+  for (var i = 0; i < len; ++i) {
+    arg = argv[i];
+
+    // literal args after --
+    if ('--' == arg) {
+      literal = true;
+      continue;
+    }
+
+    if (literal) {
+      args.push(arg);
+      continue;
+    }
+
+    // find matching Option
+    option = this.optionFor(arg);
+
+    // option is defined
+    if (option) {
+      // requires arg
+      if (option.required) {
+        arg = argv[++i];
+        if (null == arg) return this.optionMissingArgument(option);
+        if ('-' == arg[0]) return this.optionMissingArgument(option, arg);
+        this.emit(option.name(), arg);
+      // optional arg
+      } else if (option.optional) {
+        arg = argv[i+1];
+        if (null == arg || '-' == arg[0]) {
+          arg = null;
+        } else {
+          ++i;
+        }
+        this.emit(option.name(), arg);
+      // bool
+      } else {
+        this.emit(option.name());
+      }
+      continue;
+    }
+    
+    // looks like an option
+    if (arg.length > 1 && '-' == arg[0]) {
+      unknownOptions.push(arg);
+      
+      // If the next argument looks like it might be
+      // an argument for this option, we pass it on.
+      // If it isn't, then it'll simply be ignored
+      if (argv[i+1] && '-' != argv[i+1][0]) {
+        unknownOptions.push(argv[++i]);
+      }
+      continue;
+    }
+    
+    // arg
+    args.push(arg);
+  }
+  
+  return { args: args, unknown: unknownOptions };
+};
+
+/**
+ * Argument `name` is missing.
+ *
+ * @param {String} name
+ * @api private
+ */
+
+Command.prototype.missingArgument = function(name){
+  console.error();
+  console.error("  error: missing required argument `%s'", name);
+  console.error();
+  process.exit(1);
+};
+
+/**
+ * `Option` is missing an argument, but received `flag` or nothing.
+ *
+ * @param {String} option
+ * @param {String} flag
+ * @api private
+ */
+
+Command.prototype.optionMissingArgument = function(option, flag){
+  console.error();
+  if (flag) {
+    console.error("  error: option `%s' argument missing, got `%s'", option.flags, flag);
+  } else {
+    console.error("  error: option `%s' argument missing", option.flags);
+  }
+  console.error();
+  process.exit(1);
+};
+
+/**
+ * Unknown option `flag`.
+ *
+ * @param {String} flag
+ * @api private
+ */
+
+Command.prototype.unknownOption = function(flag){
+  console.error();
+  console.error("  error: unknown option `%s'", flag);
+  console.error();
+  process.exit(1);
+};
+
+/**
+ * Set the program version to `str`.
+ *
+ * This method auto-registers the "-V, --version" flag
+ * which will print the version number when passed.
+ *
+ * @param {String} str
+ * @param {String} flags
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.version = function(str, flags){
+  if (0 == arguments.length) return this._version;
+  this._version = str;
+  flags = flags || '-V, --version';
+  this.option(flags, 'output the version number');
+  this.on('version', function(){
+    console.log(str);
+    process.exit(0);
+  });
+  return this;
+};
+
+/**
+ * Set the description `str`.
+ *
+ * @param {String} str
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.description = function(str){
+  if (0 == arguments.length) return this._description;
+  this._description = str;
+  return this;
+};
+
+/**
+ * Set / get the command usage `str`.
+ *
+ * @param {String} str
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.usage = function(str){
+  var args = this.args.map(function(arg){
+    return arg.required
+      ? '<' + arg.name + '>'
+      : '[' + arg.name + ']';
+  });
+
+  var usage = '[options'
+    + (this.commands.length ? '] [command' : '')
+    + ']'
+    + (this.args.length ? ' ' + args : '');
+  if (0 == arguments.length) return this._usage || usage;
+  this._usage = str;
+
+  return this;
+};
+
+/**
+ * Return the largest option length.
+ *
+ * @return {Number}
+ * @api private
+ */
+
+Command.prototype.largestOptionLength = function(){
+  return this.options.reduce(function(max, option){
+    return Math.max(max, option.flags.length);
+  }, 0);
+};
+
+/**
+ * Return help for options.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.optionHelp = function(){
+  var width = this.largestOptionLength();
+  
+  // Prepend the help information
+  return [pad('-h, --help', width) + '  ' + 'output usage information']
+    .concat(this.options.map(function(option){
+      return pad(option.flags, width)
+        + '  ' + option.description;
+      }))
+    .join('\n');
+};
+
+/**
+ * Return command help documentation.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.commandHelp = function(){
+  if (!this.commands.length) return '';
+  return [
+      ''
+    , '  Commands:'
+    , ''
+    , this.commands.map(function(cmd){
+      var args = cmd.args.map(function(arg){
+        return arg.required
+          ? '<' + arg.name + '>'
+          : '[' + arg.name + ']';
+      }).join(' ');
+
+      return cmd.name 
+        + (cmd.options.length 
+          ? ' [options]'
+          : '') + ' ' + args
+        + (cmd.description()
+          ? '\n' + cmd.description()
+          : '');
+    }).join('\n\n').replace(/^/gm, '    ')
+    , ''
+  ].join('\n');
+};
+
+/**
+ * Return program help documentation.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.helpInformation = function(){
+  return [
+      ''
+    , '  Usage: ' + this.name + ' ' + this.usage()
+    , '' + this.commandHelp()
+    , '  Options:'
+    , ''
+    , '' + this.optionHelp().replace(/^/gm, '    ')
+    , ''
+    , ''
+  ].join('\n');
+};
+
+/**
+ * Prompt for a `Number`.
+ *
+ * @param {String} str
+ * @param {Function} fn
+ * @api private
+ */
+
+Command.prototype.promptForNumber = function(str, fn){
+  var self = this;
+  this.promptSingleLine(str, function parseNumber(val){
+    val = Number(val);
+    if (isNaN(val)) return self.promptSingleLine(str + '(must be a number) ', parseNumber);
+    fn(val);
+  });
+};
+
+/**
+ * Prompt for a `Date`.
+ *
+ * @param {String} str
+ * @param {Function} fn
+ * @api private
+ */
+
+Command.prototype.promptForDate = function(str, fn){
+  var self = this;
+  this.promptSingleLine(str, function parseDate(val){
+    val = new Date(val);
+    if (isNaN(val.getTime())) return self.promptSingleLine(str + '(must be a date) ', parseDate);
+    fn(val);
+  });
+};
+
+/**
+ * Single-line prompt.
+ *
+ * @param {String} str
+ * @param {Function} fn
+ * @api private
+ */
+
+Command.prototype.promptSingleLine = function(str, fn){
+  if ('function' == typeof arguments[2]) {
+    return this['promptFor' + (fn.name || fn)](str, arguments[2]);
+  }
+
+  process.stdout.write(str);
+  process.stdin.setEncoding('utf8');
+  process.stdin.once('data', function(val){
+    fn(val.trim());
+  }).resume();
+};
+
+/**
+ * Multi-line prompt.
+ *
+ * @param {String} str
+ * @param {Function} fn
+ * @api private
+ */
+
+Command.prototype.promptMultiLine = function(str, fn){
+  var buf = [];
+  console.log(str);
+  process.stdin.setEncoding('utf8');
+  process.stdin.on('data', function(val){
+    if ('\n' == val || '\r\n' == val) {
+      process.stdin.removeAllListeners('data');
+      fn(buf.join('\n'));
+    } else {
+      buf.push(val.trimRight());
+    }
+  }).resume();
+};
+
+/**
+ * Prompt `str` and callback `fn(val)`
+ *
+ * Commander supports single-line and multi-line prompts.
+ * To issue a single-line prompt simply add white-space
+ * to the end of `str`, something like "name: ", whereas
+ * for a multi-line prompt omit this "description:".
+ *
+ *
+ * Examples:
+ *
+ *     program.prompt('Username: ', function(name){
+ *       console.log('hi %s', name);
+ *     });
+ *     
+ *     program.prompt('Description:', function(desc){
+ *       console.log('description was "%s"', desc.trim());
+ *     });
+ *
+ * @param {String|Object} str
+ * @param {Function} fn
+ * @api public
+ */
+
+Command.prototype.prompt = function(str, fn){
+  var self = this;
+
+  if ('string' == typeof str) {
+    if (/ $/.test(str)) return this.promptSingleLine.apply(this, arguments);
+    this.promptMultiLine(str, fn);
+  } else {
+    var keys = Object.keys(str)
+      , obj = {};
+
+    function next() {
+      var key = keys.shift()
+        , label = str[key];
+
+      if (!key) return fn(obj);
+      self.prompt(label, function(val){
+        obj[key] = val;
+        next();
+      });
+    }
+
+    next();
+  }
+};
+
+/**
+ * Prompt for password with `str`, `mask` char and callback `fn(val)`.
+ *
+ * The mask string defaults to '', aka no output is
+ * written while typing, you may want to use "*" etc.
+ *
+ * Examples:
+ *
+ *     program.password('Password: ', function(pass){
+ *       console.log('got "%s"', pass);
+ *       process.stdin.destroy();
+ *     });
+ *
+ *     program.password('Password: ', '*', function(pass){
+ *       console.log('got "%s"', pass);
+ *       process.stdin.destroy();
+ *     });
+ *
+ * @param {String} str
+ * @param {String} mask
+ * @param {Function} fn
+ * @api public
+ */
+
+Command.prototype.password = function(str, mask, fn){
+  var self = this
+    , buf = '';
+
+  // default mask
+  if ('function' == typeof mask) {
+    fn = mask;
+    mask = '';
+  }
+
+  process.stdin.resume();
+  tty.setRawMode(true);
+  process.stdout.write(str);
+
+  // keypress
+  process.stdin.on('keypress', function(c, key){
+    if (key && 'enter' == key.name) {
+      console.log();
+      process.stdin.removeAllListeners('keypress');
+      tty.setRawMode(false);
+      if (!buf.trim().length) return self.password(str, mask, fn);
+      fn(buf);
+      return;
+    }
+
+    if (key && key.ctrl && 'c' == key.name) {
+      console.log('%s', buf);
+      process.exit();
+    }
+
+    process.stdout.write(mask);
+    buf += c;
+  }).resume();
+};
+
+/**
+ * Confirmation prompt with `str` and callback `fn(bool)`
+ *
+ * Examples:
+ *
+ *      program.confirm('continue? ', function(ok){
+ *        console.log(' got %j', ok);
+ *        process.stdin.destroy();
+ *      });
+ *
+ * @param {String} str
+ * @param {Function} fn
+ * @api public
+ */
+
+
+Command.prototype.confirm = function(str, fn, verbose){
+  var self = this;
+  this.prompt(str, function(ok){
+    if (!ok.trim()) {
+      if (!verbose) str += '(yes or no) ';
+      return self.confirm(str, fn, true);
+    }
+    fn(parseBool(ok));
+  });
+};
+
+/**
+ * Choice prompt with `list` of items and callback `fn(index, item)`
+ *
+ * Examples:
+ *
+ *      var list = ['tobi', 'loki', 'jane', 'manny', 'luna'];
+ *      
+ *      console.log('Choose the coolest pet:');
+ *      program.choose(list, function(i){
+ *        console.log('you chose %d "%s"', i, list[i]);
+ *        process.stdin.destroy();
+ *      });
+ *
+ * @param {Array} list
+ * @param {Number|Function} index or fn
+ * @param {Function} fn
+ * @api public
+ */
+
+Command.prototype.choose = function(list, index, fn){
+  var self = this
+    , hasDefault = 'number' == typeof index;
+
+  if (!hasDefault) {
+    fn = index;
+    index = null;
+  }
+
+  list.forEach(function(item, i){
+    if (hasDefault && i == index) {
+      console.log('* %d) %s', i + 1, item);
+    } else {
+      console.log('  %d) %s', i + 1, item);
+    }
+  });
+
+  function again() {
+    self.prompt('  : ', function(val){
+      val = parseInt(val, 10) - 1;
+      if (hasDefault && isNaN(val)) val = index;
+
+      if (null == list[val]) {
+        again();
+      } else {
+        fn(val, list[val]);
+      }
+    });
+  }
+
+  again();
+};
+
+/**
+ * Camel-case the given `flag`
+ *
+ * @param {String} flag
+ * @return {String}
+ * @api private
+ */
+
+function camelcase(flag) {
+  return flag.split('-').reduce(function(str, word){
+    return str + word[0].toUpperCase() + word.slice(1);
+  });
+}
+
+/**
+ * Parse a boolean `str`.
+ *
+ * @param {String} str
+ * @return {Boolean}
+ * @api private
+ */
+
+function parseBool(str) {
+  return /^y|yes|ok|true$/i.test(str);
+}
+
+/**
+ * Pad `str` to `width`.
+ *
+ * @param {String} str
+ * @param {Number} width
+ * @return {String}
+ * @api private
+ */
+
+function pad(str, width) {
+  var len = Math.max(0, width - str.length);
+  return str + Array(len + 1).join(' ');
+}
+
+/**
+ * Output help information if necessary
+ *
+ * @param {Command} command to output help for
+ * @param {Array} array of options to search for -h or --help
+ * @api private
+ */
+
+function outputHelpIfNecessary(cmd, options) {
+  options = options || [];
+  for (var i = 0; i < options.length; i++) {
+    if (options[i] == '--help' || options[i] == '-h') {
+      process.stdout.write(cmd.helpInformation());
+      cmd.emit('--help');
+      process.exit(0);
+    }
+  }
+}
diff --git a/node_modules/jade/node_modules/commander/package.json b/node_modules/jade/node_modules/commander/package.json
new file mode 100644
index 0000000..649fc33
--- /dev/null
+++ b/node_modules/jade/node_modules/commander/package.json
@@ -0,0 +1,60 @@
+{
+  "_from": "commander@0.6.1",
+  "_id": "commander@0.6.1",
+  "_inBundle": false,
+  "_integrity": "sha1-+mihT2qUXVTbvlDYzbMyDp47GgY=",
+  "_location": "/jade/commander",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "commander@0.6.1",
+    "name": "commander",
+    "escapedName": "commander",
+    "rawSpec": "0.6.1",
+    "saveSpec": null,
+    "fetchSpec": "0.6.1"
+  },
+  "_requiredBy": [
+    "/jade"
+  ],
+  "_resolved": "https://registry.npmjs.org/commander/-/commander-0.6.1.tgz",
+  "_shasum": "fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06",
+  "_spec": "commander@0.6.1",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/jade",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "bugs": {
+    "url": "https://github.com/visionmedia/commander.js/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {},
+  "deprecated": false,
+  "description": "the complete solution for node.js command-line programs",
+  "devDependencies": {
+    "should": ">= 0.0.1"
+  },
+  "engines": {
+    "node": ">= 0.4.x"
+  },
+  "homepage": "https://github.com/visionmedia/commander.js#readme",
+  "keywords": [
+    "command",
+    "option",
+    "parser",
+    "prompt",
+    "stdin"
+  ],
+  "main": "index",
+  "name": "commander",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/visionmedia/commander.js.git"
+  },
+  "scripts": {
+    "test": "make test"
+  },
+  "version": "0.6.1"
+}
diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.orig b/node_modules/jade/node_modules/mkdirp/.gitignore.orig
new file mode 100644
index 0000000..9303c34
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/.gitignore.orig
@@ -0,0 +1,2 @@
+node_modules/
+npm-debug.log
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/mkdirp/.gitignore.rej b/node_modules/jade/node_modules/mkdirp/.gitignore.rej
new file mode 100644
index 0000000..69244ff
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/.gitignore.rej
@@ -0,0 +1,5 @@
+--- /dev/null
++++ .gitignore
+@@ -0,0 +1,2 @@
++node_modules/
++npm-debug.log
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/mkdirp/.npmignore b/node_modules/jade/node_modules/mkdirp/.npmignore
new file mode 100644
index 0000000..9303c34
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/.npmignore
@@ -0,0 +1,2 @@
+node_modules/
+npm-debug.log
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/mkdirp/LICENSE b/node_modules/jade/node_modules/mkdirp/LICENSE
new file mode 100644
index 0000000..432d1ae
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/LICENSE
@@ -0,0 +1,21 @@
+Copyright 2010 James Halliday (mail@substack.net)
+
+This project is free software released under the MIT/X11 license:
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/jade/node_modules/mkdirp/README.markdown b/node_modules/jade/node_modules/mkdirp/README.markdown
new file mode 100644
index 0000000..b4dd75f
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/README.markdown
@@ -0,0 +1,54 @@
+mkdirp
+======
+
+Like `mkdir -p`, but in node.js!
+
+example
+=======
+
+pow.js
+------
+    var mkdirp = require('mkdirp');
+    
+    mkdirp('/tmp/foo/bar/baz', function (err) {
+        if (err) console.error(err)
+        else console.log('pow!')
+    });
+
+Output
+    pow!
+
+And now /tmp/foo/bar/baz exists, huzzah!
+
+methods
+=======
+
+var mkdirp = require('mkdirp');
+
+mkdirp(dir, mode, cb)
+---------------------
+
+Create a new directory and any necessary subdirectories at `dir` with octal
+permission string `mode`.
+
+If `mode` isn't specified, it defaults to `0777 & (~process.umask())`.
+
+mkdirp.sync(dir, mode)
+----------------------
+
+Synchronously create a new directory and any necessary subdirectories at `dir`
+with octal permission string `mode`.
+
+If `mode` isn't specified, it defaults to `0777 & (~process.umask())`.
+
+install
+=======
+
+With [npm](http://npmjs.org) do:
+
+    npm install mkdirp
+
+license
+=======
+
+MIT/X11
diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js b/node_modules/jade/node_modules/mkdirp/examples/pow.js
new file mode 100644
index 0000000..e692421
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js
@@ -0,0 +1,6 @@
+var mkdirp = require('mkdirp');
+
+mkdirp('/tmp/foo/bar/baz', function (err) {
+    if (err) console.error(err)
+    else console.log('pow!')
+});
diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig b/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig
new file mode 100644
index 0000000..7741462
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js.orig
@@ -0,0 +1,6 @@
+var mkdirp = require('mkdirp');
+
+mkdirp('/tmp/foo/bar/baz', 0755, function (err) {
+    if (err) console.error(err)
+    else console.log('pow!')
+});
diff --git a/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej b/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej
new file mode 100644
index 0000000..81e7f43
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/examples/pow.js.rej
@@ -0,0 +1,19 @@
+--- examples/pow.js
++++ examples/pow.js
+@@ -1,6 +1,15 @@
+-var mkdirp = require('mkdirp').mkdirp;
++var mkdirp = require('../').mkdirp,
++    mkdirpSync = require('../').mkdirpSync;
+ 
+ mkdirp('/tmp/foo/bar/baz', 0755, function (err) {
+     if (err) console.error(err)
+     else console.log('pow!')
+ });
++
++try {
++  mkdirpSync('/tmp/bar/foo/baz', 0755);
++  console.log('double pow!');
++}
++catch (ex) {
++  console.log(ex);
++}
\ No newline at end of file
diff --git a/node_modules/jade/node_modules/mkdirp/index.js b/node_modules/jade/node_modules/mkdirp/index.js
new file mode 100644
index 0000000..25f43ad
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/index.js
@@ -0,0 +1,79 @@
+var path = require('path');
+var fs = require('fs');
+
+module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP;
+
+function mkdirP (p, mode, f) {
+    if (typeof mode === 'function' || mode === undefined) {
+        f = mode;
+        mode = 0777 & (~process.umask());
+    }
+    
+    var cb = f || function () {};
+    if (typeof mode === 'string') mode = parseInt(mode, 8);
+    p = path.resolve(p);
+
+    fs.mkdir(p, mode, function (er) {
+        if (!er) return cb();
+        switch (er.code) {
+            case 'ENOENT':
+                mkdirP(path.dirname(p), mode, function (er) {
+                    if (er) cb(er);
+                    else mkdirP(p, mode, cb);
+                });
+                break;
+
+            case 'EEXIST':
+                fs.stat(p, function (er2, stat) {
+                    // if the stat fails, then that's super weird.
+                    // let the original EEXIST be the failure reason.
+                    if (er2 || !stat.isDirectory()) cb(er)
+                    else cb();
+                });
+                break;
+
+            default:
+                cb(er);
+                break;
+        }
+    });
+}
+
+mkdirP.sync = function sync (p, mode) {
+    if (mode === undefined) {
+        mode = 0777 & (~process.umask());
+    }
+    
+    if (typeof mode === 'string') mode = parseInt(mode, 8);
+    p = path.resolve(p);
+    
+    try {
+        fs.mkdirSync(p, mode)
+    }
+    catch (err0) {
+        switch (err0.code) {
+            case 'ENOENT' :
+                var err1 = sync(path.dirname(p), mode)
+                if (err1) throw err1;
+                else return sync(p, mode);
+                break;
+            
+            case 'EEXIST' :
+                var stat;
+                try {
+                    stat = fs.statSync(p);
+                }
+                catch (err1) {
+                    throw err0
+                }
+                if (!stat.isDirectory()) throw err0;
+                else return null;
+                break;
+            default :
+                throw err0
+                break;
+        }
+    }
+    
+    return null;
+};
diff --git a/node_modules/jade/node_modules/mkdirp/package.json b/node_modules/jade/node_modules/mkdirp/package.json
new file mode 100644
index 0000000..f73e515
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/package.json
@@ -0,0 +1,58 @@
+{
+  "_from": "mkdirp@0.3.0",
+  "_id": "mkdirp@0.3.0",
+  "_inBundle": false,
+  "_integrity": "sha1-G79asbqCevI1dRQ0kEJkVfSB/h4=",
+  "_location": "/jade/mkdirp",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "mkdirp@0.3.0",
+    "name": "mkdirp",
+    "escapedName": "mkdirp",
+    "rawSpec": "0.3.0",
+    "saveSpec": null,
+    "fetchSpec": "0.3.0"
+  },
+  "_requiredBy": [
+    "/jade"
+  ],
+  "_resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.3.0.tgz",
+  "_shasum": "1bbf5ab1ba827af23575143490426455f481fe1e",
+  "_spec": "mkdirp@0.3.0",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/jade",
+  "author": {
+    "name": "James Halliday",
+    "email": "mail@substack.net",
+    "url": "http://substack.net"
+  },
+  "bugs": {
+    "url": "https://github.com/substack/node-mkdirp/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "Recursively mkdir, like `mkdir -p`",
+  "devDependencies": {
+    "tap": "0.0.x"
+  },
+  "engines": {
+    "node": "*"
+  },
+  "homepage": "https://github.com/substack/node-mkdirp#readme",
+  "keywords": [
+    "mkdir",
+    "directory"
+  ],
+  "license": "MIT/X11",
+  "main": "./index",
+  "name": "mkdirp",
+  "repository": {
+    "type": "git",
+    "url": "git+ssh://git@github.com/substack/node-mkdirp.git"
+  },
+  "scripts": {
+    "test": "tap test/*.js"
+  },
+  "version": "0.3.0"
+}
diff --git a/node_modules/jade/node_modules/mkdirp/test/chmod.js b/node_modules/jade/node_modules/mkdirp/test/chmod.js
new file mode 100644
index 0000000..520dcb8
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/chmod.js
@@ -0,0 +1,38 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+var ps = [ '', 'tmp' ];
+
+for (var i = 0; i < 25; i++) {
+    var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    ps.push(dir);
+}
+
+var file = ps.join('/');
+
+test('chmod-pre', function (t) {
+    var mode = 0744
+    mkdirp(file, mode, function (er) {
+        t.ifError(er, 'should not error');
+        fs.stat(file, function (er, stat) {
+            t.ifError(er, 'should exist');
+            t.ok(stat && stat.isDirectory(), 'should be directory');
+            t.equal(stat && stat.mode & 0777, mode, 'should be 0744');
+            t.end();
+        });
+    });
+});
+
+test('chmod', function (t) {
+    var mode = 0755
+    mkdirp(file, mode, function (er) {
+        t.ifError(er, 'should not error');
+        fs.stat(file, function (er, stat) {
+            t.ifError(er, 'should exist');
+            t.ok(stat && stat.isDirectory(), 'should be directory');
+            t.end();
+        });
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/clobber.js b/node_modules/jade/node_modules/mkdirp/test/clobber.js
new file mode 100644
index 0000000..0eb7099
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/clobber.js
@@ -0,0 +1,37 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+var ps = [ '', 'tmp' ];
+
+for (var i = 0; i < 25; i++) {
+    var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    ps.push(dir);
+}
+
+var file = ps.join('/');
+
+// a file in the way
+var itw = ps.slice(0, 3).join('/');
+
+
+test('clobber-pre', function (t) {
+    console.error("about to write to "+itw)
+    fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.');
+
+    fs.stat(itw, function (er, stat) {
+        t.ifError(er)
+        t.ok(stat && stat.isFile(), 'should be file')
+        t.end()
+    })
+})
+
+test('clobber', function (t) {
+    t.plan(2);
+    mkdirp(file, 0755, function (err) {
+        t.ok(err);
+        t.equal(err.code, 'ENOTDIR');
+        t.end();
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/mkdirp.js b/node_modules/jade/node_modules/mkdirp/test/mkdirp.js
new file mode 100644
index 0000000..b07cd70
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/mkdirp.js
@@ -0,0 +1,28 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('woo', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    mkdirp(file, 0755, function (err) {
+        if (err) t.fail(err);
+        else path.exists(file, function (ex) {
+            if (!ex) t.fail('file not created')
+            else fs.stat(file, function (err, stat) {
+                if (err) t.fail(err)
+                else {
+                    t.equal(stat.mode & 0777, 0755);
+                    t.ok(stat.isDirectory(), 'target not a directory');
+                    t.end();
+                }
+            })
+        })
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/perm.js b/node_modules/jade/node_modules/mkdirp/test/perm.js
new file mode 100644
index 0000000..23a7abb
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/perm.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('async perm', function (t) {
+    t.plan(2);
+    var file = '/tmp/' + (Math.random() * (1<<30)).toString(16);
+    
+    mkdirp(file, 0755, function (err) {
+        if (err) t.fail(err);
+        else path.exists(file, function (ex) {
+            if (!ex) t.fail('file not created')
+            else fs.stat(file, function (err, stat) {
+                if (err) t.fail(err)
+                else {
+                    t.equal(stat.mode & 0777, 0755);
+                    t.ok(stat.isDirectory(), 'target not a directory');
+                    t.end();
+                }
+            })
+        })
+    });
+});
+
+test('async root perm', function (t) {
+    mkdirp('/tmp', 0755, function (err) {
+        if (err) t.fail(err);
+        t.end();
+    });
+    t.end();
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/perm_sync.js b/node_modules/jade/node_modules/mkdirp/test/perm_sync.js
new file mode 100644
index 0000000..f685f60
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/perm_sync.js
@@ -0,0 +1,39 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('sync perm', function (t) {
+    t.plan(2);
+    var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json';
+    
+    mkdirp.sync(file, 0755);
+    path.exists(file, function (ex) {
+        if (!ex) t.fail('file not created')
+        else fs.stat(file, function (err, stat) {
+            if (err) t.fail(err)
+            else {
+                t.equal(stat.mode & 0777, 0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+                t.end();
+            }
+        })
+    });
+});
+
+test('sync root perm', function (t) {
+    t.plan(1);
+    
+    var file = '/tmp';
+    mkdirp.sync(file, 0755);
+    path.exists(file, function (ex) {
+        if (!ex) t.fail('file not created')
+        else fs.stat(file, function (err, stat) {
+            if (err) t.fail(err)
+            else {
+                t.ok(stat.isDirectory(), 'target not a directory');
+                t.end();
+            }
+        })
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/race.js b/node_modules/jade/node_modules/mkdirp/test/race.js
new file mode 100644
index 0000000..96a0447
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/race.js
@@ -0,0 +1,41 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('race', function (t) {
+    t.plan(4);
+    var ps = [ '', 'tmp' ];
+    
+    for (var i = 0; i < 25; i++) {
+        var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+        ps.push(dir);
+    }
+    var file = ps.join('/');
+    
+    var res = 2;
+    mk(file, function () {
+        if (--res === 0) t.end();
+    });
+    
+    mk(file, function () {
+        if (--res === 0) t.end();
+    });
+    
+    function mk (file, cb) {
+        mkdirp(file, 0755, function (err) {
+            if (err) t.fail(err);
+            else path.exists(file, function (ex) {
+                if (!ex) t.fail('file not created')
+                else fs.stat(file, function (err, stat) {
+                    if (err) t.fail(err)
+                    else {
+                        t.equal(stat.mode & 0777, 0755);
+                        t.ok(stat.isDirectory(), 'target not a directory');
+                        if (cb) cb();
+                    }
+                })
+            })
+        });
+    }
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/rel.js b/node_modules/jade/node_modules/mkdirp/test/rel.js
new file mode 100644
index 0000000..7985824
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/rel.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('rel', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var cwd = process.cwd();
+    process.chdir('/tmp');
+    
+    var file = [x,y,z].join('/');
+    
+    mkdirp(file, 0755, function (err) {
+        if (err) t.fail(err);
+        else path.exists(file, function (ex) {
+            if (!ex) t.fail('file not created')
+            else fs.stat(file, function (err, stat) {
+                if (err) t.fail(err)
+                else {
+                    process.chdir(cwd);
+                    t.equal(stat.mode & 0777, 0755);
+                    t.ok(stat.isDirectory(), 'target not a directory');
+                    t.end();
+                }
+            })
+        })
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/sync.js b/node_modules/jade/node_modules/mkdirp/test/sync.js
new file mode 100644
index 0000000..e0e389d
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/sync.js
@@ -0,0 +1,27 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('sync', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    var err = mkdirp.sync(file, 0755);
+    if (err) t.fail(err);
+    else path.exists(file, function (ex) {
+        if (!ex) t.fail('file not created')
+        else fs.stat(file, function (err, stat) {
+            if (err) t.fail(err)
+            else {
+                t.equal(stat.mode & 0777, 0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+                t.end();
+            }
+        })
+    })
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/umask.js b/node_modules/jade/node_modules/mkdirp/test/umask.js
new file mode 100644
index 0000000..64ccafe
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/umask.js
@@ -0,0 +1,28 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('implicit mode from umask', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    mkdirp(file, function (err) {
+        if (err) t.fail(err);
+        else path.exists(file, function (ex) {
+            if (!ex) t.fail('file not created')
+            else fs.stat(file, function (err, stat) {
+                if (err) t.fail(err)
+                else {
+                    t.equal(stat.mode & 0777, 0777 & (~process.umask()));
+                    t.ok(stat.isDirectory(), 'target not a directory');
+                    t.end();
+                }
+            })
+        })
+    });
+});
diff --git a/node_modules/jade/node_modules/mkdirp/test/umask_sync.js b/node_modules/jade/node_modules/mkdirp/test/umask_sync.js
new file mode 100644
index 0000000..83cba56
--- /dev/null
+++ b/node_modules/jade/node_modules/mkdirp/test/umask_sync.js
@@ -0,0 +1,27 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('umask sync modes', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    var err = mkdirp.sync(file);
+    if (err) t.fail(err);
+    else path.exists(file, function (ex) {
+        if (!ex) t.fail('file not created')
+        else fs.stat(file, function (err, stat) {
+            if (err) t.fail(err)
+            else {
+                t.equal(stat.mode & 0777, (0777 & (~process.umask())));
+                t.ok(stat.isDirectory(), 'target not a directory');
+                t.end();
+            }
+        })
+    })
+});
diff --git a/node_modules/jade/package.json b/node_modules/jade/package.json
new file mode 100644
index 0000000..bef0914
--- /dev/null
+++ b/node_modules/jade/package.json
@@ -0,0 +1,70 @@
+{
+  "_from": "jade@0.26.3",
+  "_id": "jade@0.26.3",
+  "_inBundle": false,
+  "_integrity": "sha1-jxDXl32NefL2/4YqgbBRPMslaGw=",
+  "_location": "/jade",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "jade@0.26.3",
+    "name": "jade",
+    "escapedName": "jade",
+    "rawSpec": "0.26.3",
+    "saveSpec": null,
+    "fetchSpec": "0.26.3"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/jade/-/jade-0.26.3.tgz",
+  "_shasum": "8f10d7977d8d79f2f6ff862a81b0513ccb25686c",
+  "_spec": "jade@0.26.3",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "bin": {
+    "jade": "./bin/jade"
+  },
+  "bugs": {
+    "url": "https://github.com/visionmedia/jade/issues"
+  },
+  "bundleDependencies": false,
+  "component": {
+    "scripts": {
+      "jade": "runtime.js"
+    }
+  },
+  "dependencies": {
+    "commander": "0.6.1",
+    "mkdirp": "0.3.0"
+  },
+  "deprecated": "Jade has been renamed to pug, please install the latest version of pug instead of jade",
+  "description": "Jade template engine",
+  "devDependencies": {
+    "less": "*",
+    "markdown": "*",
+    "mocha": "*",
+    "should": "*",
+    "stylus": "*",
+    "uglify-js": "*",
+    "uubench": "*"
+  },
+  "homepage": "https://github.com/visionmedia/jade#readme",
+  "main": "./index.js",
+  "man": [
+    "./jade.1"
+  ],
+  "name": "jade",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/jade.git"
+  },
+  "scripts": {
+    "prepublish": "npm prune"
+  },
+  "version": "0.26.3"
+}
diff --git a/node_modules/jade/runtime.js b/node_modules/jade/runtime.js
new file mode 100644
index 0000000..0f54907
--- /dev/null
+++ b/node_modules/jade/runtime.js
@@ -0,0 +1,179 @@
+
+jade = (function(exports){
+/*!
+ * Jade - runtime
+ * Copyright(c) 2010 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Lame Array.isArray() polyfill for now.
+ */
+
+if (!Array.isArray) {
+  Array.isArray = function(arr){
+    return '[object Array]' == Object.prototype.toString.call(arr);
+  };
+}
+
+/**
+ * Lame Object.keys() polyfill for now.
+ */
+
+if (!Object.keys) {
+  Object.keys = function(obj){
+    var arr = [];
+    for (var key in obj) {
+      if (obj.hasOwnProperty(key)) {
+        arr.push(key);
+      }
+    }
+    return arr;
+  }
+}
+
+/**
+ * Merge two attribute objects giving precedence
+ * to values in object `b`. Classes are special-cased
+ * allowing for arrays and merging/joining appropriately
+ * resulting in a string.
+ *
+ * @param {Object} a
+ * @param {Object} b
+ * @return {Object} a
+ * @api private
+ */
+
+exports.merge = function merge(a, b) {
+  var ac = a['class'];
+  var bc = b['class'];
+
+  if (ac || bc) {
+    ac = ac || [];
+    bc = bc || [];
+    if (!Array.isArray(ac)) ac = [ac];
+    if (!Array.isArray(bc)) bc = [bc];
+    ac = ac.filter(nulls);
+    bc = bc.filter(nulls);
+    a['class'] = ac.concat(bc).join(' ');
+  }
+
+  for (var key in b) {
+    if (key != 'class') {
+      a[key] = b[key];
+    }
+  }
+
+  return a;
+};
+
+/**
+ * Filter null `val`s.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function nulls(val) {
+  return val != null;
+}
+
+/**
+ * Render the given attributes object.
+ *
+ * @param {Object} obj
+ * @param {Object} escaped
+ * @return {String}
+ * @api private
+ */
+
+exports.attrs = function attrs(obj, escaped){
+  var buf = []
+    , terse = obj.terse;
+
+  delete obj.terse;
+  var keys = Object.keys(obj)
+    , len = keys.length;
+
+  if (len) {
+    buf.push('');
+    for (var i = 0; i < len; ++i) {
+      var key = keys[i]
+        , val = obj[key];
+
+      if ('boolean' == typeof val || null == val) {
+        if (val) {
+          terse
+            ? buf.push(key)
+            : buf.push(key + '="' + key + '"');
+        }
+      } else if (0 == key.indexOf('data') && 'string' != typeof val) {
+        buf.push(key + "='" + JSON.stringify(val) + "'");
+      } else if ('class' == key && Array.isArray(val)) {
+        buf.push(key + '="' + exports.escape(val.join(' ')) + '"');
+      } else if (escaped && escaped[key]) {
+        buf.push(key + '="' + exports.escape(val) + '"');
+      } else {
+        buf.push(key + '="' + val + '"');
+      }
+    }
+  }
+
+  return buf.join(' ');
+};
+
+/**
+ * Escape the given string of `html`.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+exports.escape = function escape(html){
+  return String(html)
+    .replace(/&(?!(\w+|\#\d+);)/g, '&')
+    .replace(//g, '>')
+    .replace(/"/g, '"');
+};
+
+/**
+ * Re-throw the given `err` in context to the
+ * the jade in `filename` at the given `lineno`.
+ *
+ * @param {Error} err
+ * @param {String} filename
+ * @param {String} lineno
+ * @api private
+ */
+
+exports.rethrow = function rethrow(err, filename, lineno){
+  if (!filename) throw err;
+
+  var context = 3
+    , str = require('fs').readFileSync(filename, 'utf8')
+    , lines = str.split('\n')
+    , start = Math.max(lineno - context, 0)
+    , end = Math.min(lines.length, lineno + context);
+
+  // Error context
+  var context = lines.slice(start, end).map(function(line, i){
+    var curr = i + start + 1;
+    return (curr == lineno ? '  > ' : '    ')
+      + curr
+      + '| '
+      + line;
+  }).join('\n');
+
+  // Alter exception message
+  err.path = filename;
+  err.message = (filename || 'Jade') + ':' + lineno
+    + '\n' + context + '\n\n' + err.message;
+  throw err;
+};
+
+  return exports;
+
+})({});
diff --git a/node_modules/jade/runtime.min.js b/node_modules/jade/runtime.min.js
new file mode 100644
index 0000000..1714efb
--- /dev/null
+++ b/node_modules/jade/runtime.min.js
@@ -0,0 +1 @@
+jade=function(exports){Array.isArray||(Array.isArray=function(arr){return"[object Array]"==Object.prototype.toString.call(arr)}),Object.keys||(Object.keys=function(obj){var arr=[];for(var key in obj)obj.hasOwnProperty(key)&&arr.push(key);return arr}),exports.merge=function merge(a,b){var ac=a["class"],bc=b["class"];if(ac||bc)ac=ac||[],bc=bc||[],Array.isArray(ac)||(ac=[ac]),Array.isArray(bc)||(bc=[bc]),ac=ac.filter(nulls),bc=bc.filter(nulls),a["class"]=ac.concat(bc).join(" ");for(var key in b)key!="class"&&(a[key]=b[key]);return a};function nulls(val){return val!=null}return exports.attrs=function attrs(obj,escaped){var buf=[],terse=obj.terse;delete obj.terse;var keys=Object.keys(obj),len=keys.length;if(len){buf.push("");for(var i=0;i/g,">").replace(/"/g,""")},exports.rethrow=function rethrow(err,filename,lineno){if(!filename)throw err;var context=3,str=require("fs").readFileSync(filename,"utf8"),lines=str.split("\n"),start=Math.max(lineno-context,0),end=Math.min(lines.length,lineno+context),context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?"  > ":"    ")+curr+"| "+line}).join("\n");throw err.path=filename,err.message=(filename||"Jade")+":"+lineno+"\n"+context+"\n\n"+err.message,err},exports}({});
\ No newline at end of file
diff --git a/node_modules/jade/test.jade b/node_modules/jade/test.jade
new file mode 100644
index 0000000..b3a8988
--- /dev/null
+++ b/node_modules/jade/test.jade
@@ -0,0 +1,7 @@
+p.
+  This is a large
+  body of text for
+  this tag.
+  
+  Nothing too
+  exciting.
\ No newline at end of file
diff --git a/node_modules/jade/testing/head.jade b/node_modules/jade/testing/head.jade
new file mode 100644
index 0000000..8515406
--- /dev/null
+++ b/node_modules/jade/testing/head.jade
@@ -0,0 +1,5 @@
+head
+  script(src='/jquery.js')
+  yield
+  if false
+    script(src='/jquery.ui.js')
diff --git a/node_modules/jade/testing/index.jade b/node_modules/jade/testing/index.jade
new file mode 100644
index 0000000..1032c5f
--- /dev/null
+++ b/node_modules/jade/testing/index.jade
@@ -0,0 +1,22 @@
+
+tag = 'p'
+foo = 'bar'
+
+#{tag} value
+#{tag}(foo='bar') value
+#{foo ? 'a' : 'li'}(something) here
+
+mixin item(icon)
+  li
+    if attributes.href
+      a(attributes)
+        img.icon(src=icon)
+        block
+    else
+      span(attributes)
+        img.icon(src=icon)
+        block
+
+ul
+  +item('contact') Contact
+  +item(href='/contact') Contact
diff --git a/node_modules/jade/testing/index.js b/node_modules/jade/testing/index.js
new file mode 100644
index 0000000..226e8c0
--- /dev/null
+++ b/node_modules/jade/testing/index.js
@@ -0,0 +1,11 @@
+
+/**
+ * Module dependencies.
+ */
+
+var jade = require('../');
+
+jade.renderFile('testing/index.jade', { pretty: true, debug: true, compileDebug: false }, function(err, str){
+  if (err) throw err;
+  console.log(str);
+});
\ No newline at end of file
diff --git a/node_modules/jade/testing/layout.jade b/node_modules/jade/testing/layout.jade
new file mode 100644
index 0000000..6923cf1
--- /dev/null
+++ b/node_modules/jade/testing/layout.jade
@@ -0,0 +1,6 @@
+html
+  include head
+    script(src='/caustic.js')
+    script(src='/app.js')
+  body
+    block content
\ No newline at end of file
diff --git a/node_modules/jade/testing/user.jade b/node_modules/jade/testing/user.jade
new file mode 100644
index 0000000..3c636b7
--- /dev/null
+++ b/node_modules/jade/testing/user.jade
@@ -0,0 +1,7 @@
+h1 Tobi
+p Is a ferret
+
+ul
+  li: a foo
+  li: a bar
+  li: a baz
\ No newline at end of file
diff --git a/node_modules/jade/testing/user.js b/node_modules/jade/testing/user.js
new file mode 100644
index 0000000..2ecc45e
--- /dev/null
+++ b/node_modules/jade/testing/user.js
@@ -0,0 +1,27 @@
+function anonymous(locals, attrs, escape, rethrow) {
+var attrs = jade.attrs, escape = jade.escape, rethrow = jade.rethrow;
+var __jade = [{ lineno: 1, filename: "testing/user.jade" }];
+try {
+var buf = [];
+with (locals || {}) {
+var interp;
+__jade.unshift({ lineno: 1, filename: __jade[0].filename });
+__jade.unshift({ lineno: 1, filename: __jade[0].filename });
+buf.push('
Tobi');
+__jade.unshift({ lineno: undefined, filename: __jade[0].filename });
+__jade.shift();
+buf.push('
');
+__jade.shift();
+__jade.unshift({ lineno: 2, filename: __jade[0].filename });
+buf.push('
Is a ferret');
+__jade.unshift({ lineno: undefined, filename: __jade[0].filename });
+__jade.shift();
+buf.push('
');
+__jade.shift();
+__jade.shift();
+}
+return buf.join("");
+} catch (err) {
+  rethrow(err, __jade[0].filename, __jade[0].lineno);
+}
+}
\ No newline at end of file
diff --git a/node_modules/lru-cache/.npmignore b/node_modules/lru-cache/.npmignore
new file mode 100644
index 0000000..07e6e47
--- /dev/null
+++ b/node_modules/lru-cache/.npmignore
@@ -0,0 +1 @@
+/node_modules
diff --git a/node_modules/lru-cache/.travis.yml b/node_modules/lru-cache/.travis.yml
new file mode 100644
index 0000000..4af02b3
--- /dev/null
+++ b/node_modules/lru-cache/.travis.yml
@@ -0,0 +1,8 @@
+language: node_js
+node_js:
+  - '0.8'
+  - '0.10'
+  - '0.12'
+  - 'iojs'
+before_install:
+  - npm install -g npm@latest
diff --git a/node_modules/lru-cache/CONTRIBUTORS b/node_modules/lru-cache/CONTRIBUTORS
new file mode 100644
index 0000000..4a0bc50
--- /dev/null
+++ b/node_modules/lru-cache/CONTRIBUTORS
@@ -0,0 +1,14 @@
+# Authors, sorted by whether or not they are me
+Isaac Z. Schlueter 
+Brian Cottingham 
+Carlos Brito Lage 
+Jesse Dailey 
+Kevin O'Hara 
+Marco Rogers 
+Mark Cavage 
+Marko Mikulicic 
+Nathan Rajlich 
+Satheesh Natesan 
+Trent Mick 
+ashleybrener 
+n4kz 
diff --git a/node_modules/lru-cache/LICENSE b/node_modules/lru-cache/LICENSE
new file mode 100644
index 0000000..19129e3
--- /dev/null
+++ b/node_modules/lru-cache/LICENSE
@@ -0,0 +1,15 @@
+The ISC License
+
+Copyright (c) Isaac Z. Schlueter and Contributors
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
+IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/node_modules/lru-cache/README.md b/node_modules/lru-cache/README.md
new file mode 100644
index 0000000..c06814e
--- /dev/null
+++ b/node_modules/lru-cache/README.md
@@ -0,0 +1,137 @@
+# lru cache
+
+A cache object that deletes the least-recently-used items.
+
+## Usage:
+
+```javascript
+var LRU = require("lru-cache")
+  , options = { max: 500
+              , length: function (n) { return n * 2 }
+              , dispose: function (key, n) { n.close() }
+              , maxAge: 1000 * 60 * 60 }
+  , cache = LRU(options)
+  , otherCache = LRU(50) // sets just the max size
+
+cache.set("key", "value")
+cache.get("key") // "value"
+
+cache.reset()    // empty the cache
+```
+
+If you put more stuff in it, then items will fall out.
+
+If you try to put an oversized thing in it, then it'll fall out right
+away.
+
+## Keys should always be Strings or Numbers
+
+Note: this module will print warnings to `console.error` if you use a
+key that is not a String or Number.  Because items are stored in an
+object, which coerces keys to a string, it won't go well for you if
+you try to use a key that is not a unique string, it'll cause surprise
+collisions.  For example:
+
+```JavaScript
+// Bad Example!  Dont' do this!
+var cache = LRU()
+var a = {}
+var b = {}
+cache.set(a, 'this is a')
+cache.set(b, 'this is b')
+console.log(cache.get(a)) // prints: 'this is b'
+```
+
+## Options
+
+* `max` The maximum size of the cache, checked by applying the length
+  function to all values in the cache.  Not setting this is kind of
+  silly, since that's the whole purpose of this lib, but it defaults
+  to `Infinity`.
+* `maxAge` Maximum age in ms.  Items are not pro-actively pruned out
+  as they age, but if you try to get an item that is too old, it'll
+  drop it and return undefined instead of giving it to you.
+* `length` Function that is used to calculate the length of stored
+  items.  If you're storing strings or buffers, then you probably want
+  to do something like `function(n){return n.length}`.  The default is
+  `function(n){return 1}`, which is fine if you want to store `max`
+  like-sized things.
+* `dispose` Function that is called on items when they are dropped
+  from the cache.  This can be handy if you want to close file
+  descriptors or do other cleanup tasks when items are no longer
+  accessible.  Called with `key, value`.  It's called *before*
+  actually removing the item from the internal cache, so if you want
+  to immediately put it back in, you'll have to do that in a
+  `nextTick` or `setTimeout` callback or it won't do anything.
+* `stale` By default, if you set a `maxAge`, it'll only actually pull
+  stale items out of the cache when you `get(key)`.  (That is, it's
+  not pre-emptively doing a `setTimeout` or anything.)  If you set
+  `stale:true`, it'll return the stale value before deleting it.  If
+  you don't set this, then it'll return `undefined` when you try to
+  get a stale entry, as if it had already been deleted.
+
+## API
+
+* `set(key, value, maxAge)`
+* `get(key) => value`
+
+    Both of these will update the "recently used"-ness of the key.
+    They do what you think. `max` is optional and overrides the
+    cache `max` option if provided.
+
+* `peek(key)`
+
+    Returns the key value (or `undefined` if not found) without
+    updating the "recently used"-ness of the key.
+
+    (If you find yourself using this a lot, you *might* be using the
+    wrong sort of data structure, but there are some use cases where
+    it's handy.)
+
+* `del(key)`
+
+    Deletes a key out of the cache.
+
+* `reset()`
+
+    Clear the cache entirely, throwing away all values.
+
+* `has(key)`
+
+    Check if a key is in the cache, without updating the recent-ness
+    or deleting it for being stale.
+
+* `forEach(function(value,key,cache), [thisp])`
+
+    Just like `Array.prototype.forEach`.  Iterates over all the keys
+    in the cache, in order of recent-ness.  (Ie, more recently used
+    items are iterated over first.)
+
+* `keys()`
+
+    Return an array of the keys in the cache.
+
+* `values()`
+
+    Return an array of the values in the cache.
+
+* `length()`
+
+    Return total length of objects in cache taking into account
+    `length` options function.
+
+* `itemCount`
+
+    Return total quantity of objects currently in cache. Note, that
+    `stale` (see options) items are returned as part of this item
+    count.
+
+* `dump()`
+
+    Return an array of the cache entries ready for serialization and usage
+    with 'destinationCache.load(arr)`.
+
+* `load(cacheEntriesArray)`
+
+    Loads another cache entries array, obtained with `sourceCache.dump()`,
+    into the cache. The destination cache is reset before loading new entries
diff --git a/node_modules/lru-cache/lib/lru-cache.js b/node_modules/lru-cache/lib/lru-cache.js
new file mode 100644
index 0000000..2bbe653
--- /dev/null
+++ b/node_modules/lru-cache/lib/lru-cache.js
@@ -0,0 +1,334 @@
+;(function () { // closure for web browsers
+
+if (typeof module === 'object' && module.exports) {
+  module.exports = LRUCache
+} else {
+  // just set the global for non-node platforms.
+  this.LRUCache = LRUCache
+}
+
+function hOP (obj, key) {
+  return Object.prototype.hasOwnProperty.call(obj, key)
+}
+
+function naiveLength () { return 1 }
+
+var didTypeWarning = false
+function typeCheckKey(key) {
+  if (!didTypeWarning && typeof key !== 'string' && typeof key !== 'number') {
+    didTypeWarning = true
+    console.error(new TypeError("LRU: key must be a string or number. Almost certainly a bug! " + typeof key).stack)
+  }
+}
+
+function LRUCache (options) {
+  if (!(this instanceof LRUCache))
+    return new LRUCache(options)
+
+  if (typeof options === 'number')
+    options = { max: options }
+
+  if (!options)
+    options = {}
+
+  this._max = options.max
+  // Kind of weird to have a default max of Infinity, but oh well.
+  if (!this._max || !(typeof this._max === "number") || this._max <= 0 )
+    this._max = Infinity
+
+  this._lengthCalculator = options.length || naiveLength
+  if (typeof this._lengthCalculator !== "function")
+    this._lengthCalculator = naiveLength
+
+  this._allowStale = options.stale || false
+  this._maxAge = options.maxAge || null
+  this._dispose = options.dispose
+  this.reset()
+}
+
+// resize the cache when the max changes.
+Object.defineProperty(LRUCache.prototype, "max",
+  { set : function (mL) {
+      if (!mL || !(typeof mL === "number") || mL <= 0 ) mL = Infinity
+      this._max = mL
+      if (this._length > this._max) trim(this)
+    }
+  , get : function () { return this._max }
+  , enumerable : true
+  })
+
+// resize the cache when the lengthCalculator changes.
+Object.defineProperty(LRUCache.prototype, "lengthCalculator",
+  { set : function (lC) {
+      if (typeof lC !== "function") {
+        this._lengthCalculator = naiveLength
+        this._length = this._itemCount
+        for (var key in this._cache) {
+          this._cache[key].length = 1
+        }
+      } else {
+        this._lengthCalculator = lC
+        this._length = 0
+        for (var key in this._cache) {
+          this._cache[key].length = this._lengthCalculator(this._cache[key].value)
+          this._length += this._cache[key].length
+        }
+      }
+
+      if (this._length > this._max) trim(this)
+    }
+  , get : function () { return this._lengthCalculator }
+  , enumerable : true
+  })
+
+Object.defineProperty(LRUCache.prototype, "length",
+  { get : function () { return this._length }
+  , enumerable : true
+  })
+
+
+Object.defineProperty(LRUCache.prototype, "itemCount",
+  { get : function () { return this._itemCount }
+  , enumerable : true
+  })
+
+LRUCache.prototype.forEach = function (fn, thisp) {
+  thisp = thisp || this
+  var i = 0
+  var itemCount = this._itemCount
+
+  for (var k = this._mru - 1; k >= 0 && i < itemCount; k--) if (this._lruList[k]) {
+    i++
+    var hit = this._lruList[k]
+    if (isStale(this, hit)) {
+      del(this, hit)
+      if (!this._allowStale) hit = undefined
+    }
+    if (hit) {
+      fn.call(thisp, hit.value, hit.key, this)
+    }
+  }
+}
+
+LRUCache.prototype.keys = function () {
+  var keys = new Array(this._itemCount)
+  var i = 0
+  for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) {
+    var hit = this._lruList[k]
+    keys[i++] = hit.key
+  }
+  return keys
+}
+
+LRUCache.prototype.values = function () {
+  var values = new Array(this._itemCount)
+  var i = 0
+  for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) {
+    var hit = this._lruList[k]
+    values[i++] = hit.value
+  }
+  return values
+}
+
+LRUCache.prototype.reset = function () {
+  if (this._dispose && this._cache) {
+    for (var k in this._cache) {
+      this._dispose(k, this._cache[k].value)
+    }
+  }
+
+  this._cache = Object.create(null) // hash of items by key
+  this._lruList = Object.create(null) // list of items in order of use recency
+  this._mru = 0 // most recently used
+  this._lru = 0 // least recently used
+  this._length = 0 // number of items in the list
+  this._itemCount = 0
+}
+
+LRUCache.prototype.dump = function () {
+  var arr = []
+  var i = 0
+
+  for (var k = this._mru - 1; k >= 0 && i < this._itemCount; k--) if (this._lruList[k]) {
+    var hit = this._lruList[k]
+    if (!isStale(this, hit)) {
+      //Do not store staled hits
+      ++i
+      arr.push({
+        k: hit.key,
+        v: hit.value,
+        e: hit.now + (hit.maxAge || 0)
+      });
+    }
+  }
+  //arr has the most read first
+  return arr
+}
+
+LRUCache.prototype.dumpLru = function () {
+  return this._lruList
+}
+
+LRUCache.prototype.set = function (key, value, maxAge) {
+  maxAge = maxAge || this._maxAge
+  typeCheckKey(key)
+
+  var now = maxAge ? Date.now() : 0
+  var len = this._lengthCalculator(value)
+
+  if (hOP(this._cache, key)) {
+    if (len > this._max) {
+      del(this, this._cache[key])
+      return false
+    }
+    // dispose of the old one before overwriting
+    if (this._dispose)
+      this._dispose(key, this._cache[key].value)
+
+    this._cache[key].now = now
+    this._cache[key].maxAge = maxAge
+    this._cache[key].value = value
+    this._length += (len - this._cache[key].length)
+    this._cache[key].length = len
+    this.get(key)
+
+    if (this._length > this._max)
+      trim(this)
+
+    return true
+  }
+
+  var hit = new Entry(key, value, this._mru++, len, now, maxAge)
+
+  // oversized objects fall out of cache automatically.
+  if (hit.length > this._max) {
+    if (this._dispose) this._dispose(key, value)
+    return false
+  }
+
+  this._length += hit.length
+  this._lruList[hit.lu] = this._cache[key] = hit
+  this._itemCount ++
+
+  if (this._length > this._max)
+    trim(this)
+
+  return true
+}
+
+LRUCache.prototype.has = function (key) {
+  typeCheckKey(key)
+  if (!hOP(this._cache, key)) return false
+  var hit = this._cache[key]
+  if (isStale(this, hit)) {
+    return false
+  }
+  return true
+}
+
+LRUCache.prototype.get = function (key) {
+  typeCheckKey(key)
+  return get(this, key, true)
+}
+
+LRUCache.prototype.peek = function (key) {
+  typeCheckKey(key)
+  return get(this, key, false)
+}
+
+LRUCache.prototype.pop = function () {
+  var hit = this._lruList[this._lru]
+  del(this, hit)
+  return hit || null
+}
+
+LRUCache.prototype.del = function (key) {
+  typeCheckKey(key)
+  del(this, this._cache[key])
+}
+
+LRUCache.prototype.load = function (arr) {
+  //reset the cache
+  this.reset();
+
+  var now = Date.now()
+  //A previous serialized cache has the most recent items first
+  for (var l = arr.length - 1; l >= 0; l-- ) {
+    var hit = arr[l]
+    typeCheckKey(hit.k)
+    var expiresAt = hit.e || 0
+    if (expiresAt === 0) {
+      //the item was created without expiration in a non aged cache
+      this.set(hit.k, hit.v)
+    } else {
+      var maxAge = expiresAt - now
+      //dont add already expired items
+      if (maxAge > 0) this.set(hit.k, hit.v, maxAge)
+    }
+  }
+}
+
+function get (self, key, doUse) {
+  typeCheckKey(key)
+  var hit = self._cache[key]
+  if (hit) {
+    if (isStale(self, hit)) {
+      del(self, hit)
+      if (!self._allowStale) hit = undefined
+    } else {
+      if (doUse) use(self, hit)
+    }
+    if (hit) hit = hit.value
+  }
+  return hit
+}
+
+function isStale(self, hit) {
+  if (!hit || (!hit.maxAge && !self._maxAge)) return false
+  var stale = false;
+  var diff = Date.now() - hit.now
+  if (hit.maxAge) {
+    stale = diff > hit.maxAge
+  } else {
+    stale = self._maxAge && (diff > self._maxAge)
+  }
+  return stale;
+}
+
+function use (self, hit) {
+  shiftLU(self, hit)
+  hit.lu = self._mru ++
+  self._lruList[hit.lu] = hit
+}
+
+function trim (self) {
+  while (self._lru < self._mru && self._length > self._max)
+    del(self, self._lruList[self._lru])
+}
+
+function shiftLU (self, hit) {
+  delete self._lruList[ hit.lu ]
+  while (self._lru < self._mru && !self._lruList[self._lru]) self._lru ++
+}
+
+function del (self, hit) {
+  if (hit) {
+    if (self._dispose) self._dispose(hit.key, hit.value)
+    self._length -= hit.length
+    self._itemCount --
+    delete self._cache[ hit.key ]
+    shiftLU(self, hit)
+  }
+}
+
+// classy, since V8 prefers predictable objects.
+function Entry (key, value, lu, length, now, maxAge) {
+  this.key = key
+  this.value = value
+  this.lu = lu
+  this.length = length
+  this.now = now
+  if (maxAge) this.maxAge = maxAge
+}
+
+})()
diff --git a/node_modules/lru-cache/package.json b/node_modules/lru-cache/package.json
new file mode 100644
index 0000000..040f1b7
--- /dev/null
+++ b/node_modules/lru-cache/package.json
@@ -0,0 +1,56 @@
+{
+  "_from": "lru-cache@2",
+  "_id": "lru-cache@2.7.3",
+  "_inBundle": false,
+  "_integrity": "sha1-bUUk6LlV+V1PW1iFHOId1y+06VI=",
+  "_location": "/lru-cache",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "range",
+    "registry": true,
+    "raw": "lru-cache@2",
+    "name": "lru-cache",
+    "escapedName": "lru-cache",
+    "rawSpec": "2",
+    "saveSpec": null,
+    "fetchSpec": "2"
+  },
+  "_requiredBy": [
+    "/minimatch"
+  ],
+  "_resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz",
+  "_shasum": "6d4524e8b955f95d4f5b58851ce21dd72fb4e952",
+  "_spec": "lru-cache@2",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/minimatch",
+  "author": {
+    "name": "Isaac Z. Schlueter",
+    "email": "i@izs.me"
+  },
+  "bugs": {
+    "url": "https://github.com/isaacs/node-lru-cache/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "A cache object that deletes the least-recently-used items.",
+  "devDependencies": {
+    "tap": "^1.2.0",
+    "weak": ""
+  },
+  "homepage": "https://github.com/isaacs/node-lru-cache#readme",
+  "keywords": [
+    "mru",
+    "lru",
+    "cache"
+  ],
+  "license": "ISC",
+  "main": "lib/lru-cache.js",
+  "name": "lru-cache",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/isaacs/node-lru-cache.git"
+  },
+  "scripts": {
+    "test": "tap test --gc"
+  },
+  "version": "2.7.3"
+}
diff --git a/node_modules/lru-cache/test/basic.js b/node_modules/lru-cache/test/basic.js
new file mode 100644
index 0000000..b47225f
--- /dev/null
+++ b/node_modules/lru-cache/test/basic.js
@@ -0,0 +1,396 @@
+var test = require("tap").test
+  , LRU = require("../")
+
+test("basic", function (t) {
+  var cache = new LRU({max: 10})
+  cache.set("key", "value")
+  t.equal(cache.get("key"), "value")
+  t.equal(cache.get("nada"), undefined)
+  t.equal(cache.length, 1)
+  t.equal(cache.max, 10)
+  t.end()
+})
+
+test("least recently set", function (t) {
+  var cache = new LRU(2)
+  cache.set("a", "A")
+  cache.set("b", "B")
+  cache.set("c", "C")
+  t.equal(cache.get("c"), "C")
+  t.equal(cache.get("b"), "B")
+  t.equal(cache.get("a"), undefined)
+  t.end()
+})
+
+test("lru recently gotten", function (t) {
+  var cache = new LRU(2)
+  cache.set("a", "A")
+  cache.set("b", "B")
+  cache.get("a")
+  cache.set("c", "C")
+  t.equal(cache.get("c"), "C")
+  t.equal(cache.get("b"), undefined)
+  t.equal(cache.get("a"), "A")
+  t.end()
+})
+
+test("del", function (t) {
+  var cache = new LRU(2)
+  cache.set("a", "A")
+  cache.del("a")
+  t.equal(cache.get("a"), undefined)
+  t.end()
+})
+
+test("max", function (t) {
+  var cache = new LRU(3)
+
+  // test changing the max, verify that the LRU items get dropped.
+  cache.max = 100
+  for (var i = 0; i < 100; i ++) cache.set(i, i)
+  t.equal(cache.length, 100)
+  for (var i = 0; i < 100; i ++) {
+    t.equal(cache.get(i), i)
+  }
+  cache.max = 3
+  t.equal(cache.length, 3)
+  for (var i = 0; i < 97; i ++) {
+    t.equal(cache.get(i), undefined)
+  }
+  for (var i = 98; i < 100; i ++) {
+    t.equal(cache.get(i), i)
+  }
+
+  // now remove the max restriction, and try again.
+  cache.max = "hello"
+  for (var i = 0; i < 100; i ++) cache.set(i, i)
+  t.equal(cache.length, 100)
+  for (var i = 0; i < 100; i ++) {
+    t.equal(cache.get(i), i)
+  }
+  // should trigger an immediate resize
+  cache.max = 3
+  t.equal(cache.length, 3)
+  for (var i = 0; i < 97; i ++) {
+    t.equal(cache.get(i), undefined)
+  }
+  for (var i = 98; i < 100; i ++) {
+    t.equal(cache.get(i), i)
+  }
+  t.end()
+})
+
+test("reset", function (t) {
+  var cache = new LRU(10)
+  cache.set("a", "A")
+  cache.set("b", "B")
+  cache.reset()
+  t.equal(cache.length, 0)
+  t.equal(cache.max, 10)
+  t.equal(cache.get("a"), undefined)
+  t.equal(cache.get("b"), undefined)
+  t.end()
+})
+
+
+test("basic with weighed length", function (t) {
+  var cache = new LRU({
+    max: 100,
+    length: function (item) { return item.size }
+  })
+  cache.set("key", {val: "value", size: 50})
+  t.equal(cache.get("key").val, "value")
+  t.equal(cache.get("nada"), undefined)
+  t.equal(cache.lengthCalculator(cache.get("key")), 50)
+  t.equal(cache.length, 50)
+  t.equal(cache.max, 100)
+  t.end()
+})
+
+
+test("weighed length item too large", function (t) {
+  var cache = new LRU({
+    max: 10,
+    length: function (item) { return item.size }
+  })
+  t.equal(cache.max, 10)
+
+  // should fall out immediately
+  cache.set("key", {val: "value", size: 50})
+
+  t.equal(cache.length, 0)
+  t.equal(cache.get("key"), undefined)
+  t.end()
+})
+
+test("least recently set with weighed length", function (t) {
+  var cache = new LRU({
+    max:8,
+    length: function (item) { return item.length }
+  })
+  cache.set("a", "A")
+  cache.set("b", "BB")
+  cache.set("c", "CCC")
+  cache.set("d", "DDDD")
+  t.equal(cache.get("d"), "DDDD")
+  t.equal(cache.get("c"), "CCC")
+  t.equal(cache.get("b"), undefined)
+  t.equal(cache.get("a"), undefined)
+  t.end()
+})
+
+test("lru recently gotten with weighed length", function (t) {
+  var cache = new LRU({
+    max: 8,
+    length: function (item) { return item.length }
+  })
+  cache.set("a", "A")
+  cache.set("b", "BB")
+  cache.set("c", "CCC")
+  cache.get("a")
+  cache.get("b")
+  cache.set("d", "DDDD")
+  t.equal(cache.get("c"), undefined)
+  t.equal(cache.get("d"), "DDDD")
+  t.equal(cache.get("b"), "BB")
+  t.equal(cache.get("a"), "A")
+  t.end()
+})
+
+test("lru recently updated with weighed length", function (t) {
+  var cache = new LRU({
+    max: 8,
+    length: function (item) { return item.length }
+  })
+  cache.set("a", "A")
+  cache.set("b", "BB")
+  cache.set("c", "CCC")
+  t.equal(cache.length, 6) //CCC BB A
+  cache.set("a", "+A")
+  t.equal(cache.length, 7) //+A CCC BB
+  cache.set("b", "++BB")
+  t.equal(cache.length, 6) //++BB +A
+  t.equal(cache.get("c"), undefined)
+
+  cache.set("c", "oversized")
+  t.equal(cache.length, 6) //++BB +A
+  t.equal(cache.get("c"), undefined)
+
+  cache.set("a", "oversized")
+  t.equal(cache.length, 4) //++BB
+  t.equal(cache.get("a"), undefined)
+  t.equal(cache.get("b"), "++BB")
+  t.end()
+})
+
+test("set returns proper booleans", function(t) {
+  var cache = new LRU({
+    max: 5,
+    length: function (item) { return item.length }
+  })
+
+  t.equal(cache.set("a", "A"), true)
+
+  // should return false for max exceeded
+  t.equal(cache.set("b", "donuts"), false)
+
+  t.equal(cache.set("b", "B"), true)
+  t.equal(cache.set("c", "CCCC"), true)
+  t.end()
+})
+
+test("drop the old items", function(t) {
+  var cache = new LRU({
+    max: 5,
+    maxAge: 50
+  })
+
+  cache.set("a", "A")
+
+  setTimeout(function () {
+    cache.set("b", "b")
+    t.equal(cache.get("a"), "A")
+  }, 25)
+
+  setTimeout(function () {
+    cache.set("c", "C")
+    // timed out
+    t.notOk(cache.get("a"))
+  }, 60 + 25)
+
+  setTimeout(function () {
+    t.notOk(cache.get("b"))
+    t.equal(cache.get("c"), "C")
+  }, 90)
+
+  setTimeout(function () {
+    t.notOk(cache.get("c"))
+    t.end()
+  }, 155)
+})
+
+test("individual item can have it's own maxAge", function(t) {
+  var cache = new LRU({
+    max: 5,
+    maxAge: 50
+  })
+
+  cache.set("a", "A", 20)
+  setTimeout(function () {
+    t.notOk(cache.get("a"))
+    t.end()
+  }, 25)
+})
+
+test("individual item can have it's own maxAge > cache's", function(t) {
+  var cache = new LRU({
+    max: 5,
+    maxAge: 20
+  })
+
+  cache.set("a", "A", 50)
+  setTimeout(function () {
+    t.equal(cache.get("a"), "A")
+    t.end()
+  }, 25)
+})
+
+test("disposal function", function(t) {
+  var disposed = false
+  var cache = new LRU({
+    max: 1,
+    dispose: function (k, n) {
+      disposed = n
+    }
+  })
+
+  cache.set(1, 1)
+  cache.set(2, 2)
+  t.equal(disposed, 1)
+  cache.set(3, 3)
+  t.equal(disposed, 2)
+  cache.reset()
+  t.equal(disposed, 3)
+  t.end()
+})
+
+test("disposal function on too big of item", function(t) {
+  var disposed = false
+  var cache = new LRU({
+    max: 1,
+    length: function (k) {
+      return k.length
+    },
+    dispose: function (k, n) {
+      disposed = n
+    }
+  })
+  var obj = [ 1, 2 ]
+
+  t.equal(disposed, false)
+  cache.set("obj", obj)
+  t.equal(disposed, obj)
+  t.end()
+})
+
+test("has()", function(t) {
+  var cache = new LRU({
+    max: 1,
+    maxAge: 10
+  })
+
+  cache.set('foo', 'bar')
+  t.equal(cache.has('foo'), true)
+  cache.set('blu', 'baz')
+  t.equal(cache.has('foo'), false)
+  t.equal(cache.has('blu'), true)
+  setTimeout(function() {
+    t.equal(cache.has('blu'), false)
+    t.end()
+  }, 15)
+})
+
+test("stale", function(t) {
+  var cache = new LRU({
+    maxAge: 10,
+    stale: true
+  })
+
+  cache.set('foo', 'bar')
+  t.equal(cache.get('foo'), 'bar')
+  t.equal(cache.has('foo'), true)
+  setTimeout(function() {
+    t.equal(cache.has('foo'), false)
+    t.equal(cache.get('foo'), 'bar')
+    t.equal(cache.get('foo'), undefined)
+    t.end()
+  }, 15)
+})
+
+test("lru update via set", function(t) {
+  var cache = LRU({ max: 2 });
+
+  cache.set('foo', 1);
+  cache.set('bar', 2);
+  cache.del('bar');
+  cache.set('baz', 3);
+  cache.set('qux', 4);
+
+  t.equal(cache.get('foo'), undefined)
+  t.equal(cache.get('bar'), undefined)
+  t.equal(cache.get('baz'), 3)
+  t.equal(cache.get('qux'), 4)
+  t.end()
+})
+
+test("least recently set w/ peek", function (t) {
+  var cache = new LRU(2)
+  cache.set("a", "A")
+  cache.set("b", "B")
+  t.equal(cache.peek("a"), "A")
+  cache.set("c", "C")
+  t.equal(cache.get("c"), "C")
+  t.equal(cache.get("b"), "B")
+  t.equal(cache.get("a"), undefined)
+  t.end()
+})
+
+test("pop the least used item", function (t) {
+  var cache = new LRU(3)
+  , last
+
+  cache.set("a", "A")
+  cache.set("b", "B")
+  cache.set("c", "C")
+
+  t.equal(cache.length, 3)
+  t.equal(cache.max, 3)
+
+  // Ensure we pop a, c, b
+  cache.get("b", "B")
+
+  last = cache.pop()
+  t.equal(last.key, "a")
+  t.equal(last.value, "A")
+  t.equal(cache.length, 2)
+  t.equal(cache.max, 3)
+
+  last = cache.pop()
+  t.equal(last.key, "c")
+  t.equal(last.value, "C")
+  t.equal(cache.length, 1)
+  t.equal(cache.max, 3)
+
+  last = cache.pop()
+  t.equal(last.key, "b")
+  t.equal(last.value, "B")
+  t.equal(cache.length, 0)
+  t.equal(cache.max, 3)
+
+  last = cache.pop()
+  t.equal(last, null)
+  t.equal(cache.length, 0)
+  t.equal(cache.max, 3)
+
+  t.end()
+})
diff --git a/node_modules/lru-cache/test/foreach.js b/node_modules/lru-cache/test/foreach.js
new file mode 100644
index 0000000..4190417
--- /dev/null
+++ b/node_modules/lru-cache/test/foreach.js
@@ -0,0 +1,120 @@
+var test = require('tap').test
+var LRU = require('../')
+
+test('forEach', function (t) {
+  var l = new LRU(5)
+  for (var i = 0; i < 10; i ++) {
+    l.set(i.toString(), i.toString(2))
+  }
+
+  var i = 9
+  l.forEach(function (val, key, cache) {
+    t.equal(cache, l)
+    t.equal(key, i.toString())
+    t.equal(val, i.toString(2))
+    i -= 1
+  })
+
+  // get in order of most recently used
+  l.get(6)
+  l.get(8)
+
+  var order = [ 8, 6, 9, 7, 5 ]
+  var i = 0
+
+  l.forEach(function (val, key, cache) {
+    var j = order[i ++]
+    t.equal(cache, l)
+    t.equal(key, j.toString())
+    t.equal(val, j.toString(2))
+  })
+  t.equal(i, order.length);
+
+  t.end()
+})
+
+test('keys() and values()', function (t) {
+  var l = new LRU(5)
+  for (var i = 0; i < 10; i ++) {
+    l.set(i.toString(), i.toString(2))
+  }
+
+  t.similar(l.keys(), ['9', '8', '7', '6', '5'])
+  t.similar(l.values(), ['1001', '1000', '111', '110', '101'])
+
+  // get in order of most recently used
+  l.get(6)
+  l.get(8)
+
+  t.similar(l.keys(), ['8', '6', '9', '7', '5'])
+  t.similar(l.values(), ['1000', '110', '1001', '111', '101'])
+
+  t.end()
+})
+
+test('all entries are iterated over', function(t) {
+  var l = new LRU(5)
+  for (var i = 0; i < 10; i ++) {
+    l.set(i.toString(), i.toString(2))
+  }
+
+  var i = 0
+  l.forEach(function (val, key, cache) {
+    if (i > 0) {
+      cache.del(key)
+    }
+    i += 1
+  })
+
+  t.equal(i, 5)
+  t.equal(l.keys().length, 1)
+
+  t.end()
+})
+
+test('all stale entries are removed', function(t) {
+  var l = new LRU({ max: 5, maxAge: -5, stale: true })
+  for (var i = 0; i < 10; i ++) {
+    l.set(i.toString(), i.toString(2))
+  }
+
+  var i = 0
+  l.forEach(function () {
+    i += 1
+  })
+
+  t.equal(i, 5)
+  t.equal(l.keys().length, 0)
+
+  t.end()
+})
+
+test('expires', function (t) {
+  var l = new LRU({
+    max: 10,
+    maxAge: 50
+  })
+  for (var i = 0; i < 10; i++) {
+    l.set(i.toString(), i.toString(2), ((i % 2) ? 25 : undefined))
+  }
+
+  var i = 0
+  var order = [ 8, 6, 4, 2, 0 ]
+  setTimeout(function () {
+    l.forEach(function (val, key, cache) {
+      var j = order[i++]
+      t.equal(cache, l)
+      t.equal(key, j.toString())
+      t.equal(val, j.toString(2))
+    })
+    t.equal(i, order.length);
+
+    setTimeout(function () {
+      var count = 0;
+      l.forEach(function (val, key, cache) { count++; })
+      t.equal(0, count);
+      t.end()
+    }, 25)
+
+  }, 26)
+})
diff --git a/node_modules/lru-cache/test/memory-leak.js b/node_modules/lru-cache/test/memory-leak.js
new file mode 100644
index 0000000..b5912f6
--- /dev/null
+++ b/node_modules/lru-cache/test/memory-leak.js
@@ -0,0 +1,51 @@
+#!/usr/bin/env node --expose_gc
+
+
+var weak = require('weak');
+var test = require('tap').test
+var LRU = require('../')
+var l = new LRU({ max: 10 })
+var refs = 0
+function X() {
+  refs ++
+  weak(this, deref)
+}
+
+function deref() {
+  refs --
+}
+
+test('no leaks', function (t) {
+  // fill up the cache
+  for (var i = 0; i < 100; i++) {
+    l.set(i, new X);
+    // throw some gets in there, too.
+    if (i % 2 === 0)
+      l.get(i / 2)
+  }
+
+  gc()
+
+  var start = process.memoryUsage()
+
+  // capture the memory
+  var startRefs = refs
+
+  // do it again, but more
+  for (var i = 0; i < 10000; i++) {
+    l.set(i, new X);
+    // throw some gets in there, too.
+    if (i % 2 === 0)
+      l.get(i / 2)
+  }
+
+  gc()
+
+  var end = process.memoryUsage()
+  t.equal(refs, startRefs, 'no leaky refs')
+
+  console.error('start: %j\n' +
+                'end:   %j', start, end);
+  t.pass();
+  t.end();
+})
diff --git a/node_modules/lru-cache/test/serialize.js b/node_modules/lru-cache/test/serialize.js
new file mode 100644
index 0000000..1094194
--- /dev/null
+++ b/node_modules/lru-cache/test/serialize.js
@@ -0,0 +1,216 @@
+var test = require('tap').test
+var LRU = require('../')
+
+test('dump', function (t) {
+  var cache = new LRU()
+
+  t.equal(cache.dump().length, 0, "nothing in dump for empty cache")
+
+  cache.set("a", "A")
+  cache.set("b", "B")
+  t.deepEqual(cache.dump(), [
+    { k: "b", v: "B", e: 0 },
+    { k: "a", v: "A", e: 0 }
+  ])
+
+  cache.set("a", "A");
+  t.deepEqual(cache.dump(), [
+    { k: "a", v: "A", e: 0 },
+    { k: "b", v: "B", e: 0 }
+  ])
+
+  cache.get("b");
+  t.deepEqual(cache.dump(), [
+    { k: "b", v: "B", e: 0 },
+    { k: "a", v: "A", e: 0 }
+  ])
+
+  cache.del("a");
+  t.deepEqual(cache.dump(), [
+    { k: "b", v: "B",  e: 0 }
+  ])
+
+  t.end()
+})
+
+test("do not dump stale items", function(t) {
+  var cache = new LRU({
+    max: 5,
+    maxAge: 50
+  })
+
+  //expires at 50
+  cache.set("a", "A")
+
+  setTimeout(function () {
+    //expires at 75
+    cache.set("b", "B")
+    var s = cache.dump()
+    t.equal(s.length, 2)
+    t.equal(s[0].k, "b")
+    t.equal(s[1].k, "a")
+  }, 25)
+
+  setTimeout(function () {
+    //expires at 110
+    cache.set("c", "C")
+    var s = cache.dump()
+    t.equal(s.length, 2)
+    t.equal(s[0].k, "c")
+    t.equal(s[1].k, "b")
+  }, 60)
+
+  setTimeout(function () {
+    //expires at 130
+    cache.set("d", "D", 40)
+    var s = cache.dump()
+    t.equal(s.length, 2)
+    t.equal(s[0].k, "d")
+    t.equal(s[1].k, "c")
+  }, 90)
+
+  setTimeout(function () {
+    var s = cache.dump()
+    t.equal(s.length, 1)
+    t.equal(s[0].k, "d")
+  }, 120)
+
+  setTimeout(function () {
+    var s = cache.dump()
+    t.deepEqual(s, [])
+    t.end()
+  }, 155)
+})
+
+test("load basic cache", function(t) {
+  var cache = new LRU(),
+      copy = new LRU()
+
+  cache.set("a", "A")
+  cache.set("b", "B")
+
+  copy.load(cache.dump())
+  t.deepEquals(cache.dump(), copy.dump())
+
+  t.end()
+})
+
+
+test("load staled cache", function(t) {
+  var cache = new LRU({maxAge: 50}),
+      copy = new LRU({maxAge: 50}),
+      arr
+
+  //expires at 50
+  cache.set("a", "A")
+  setTimeout(function () {
+    //expires at 80
+    cache.set("b", "B")
+    arr = cache.dump()
+    t.equal(arr.length, 2)
+  }, 30)
+
+  setTimeout(function () {
+    copy.load(arr)
+    t.equal(copy.get("a"), undefined)
+    t.equal(copy.get("b"), "B")
+  }, 60)
+
+  setTimeout(function () {
+    t.equal(copy.get("b"), undefined)
+    t.end()
+  }, 90)
+})
+
+test("load to other size cache", function(t) {
+  var cache = new LRU({max: 2}),
+      copy = new LRU({max: 1})
+
+  cache.set("a", "A")
+  cache.set("b", "B")
+
+  copy.load(cache.dump())
+  t.equal(copy.get("a"), undefined)
+  t.equal(copy.get("b"), "B")
+
+  //update the last read from original cache
+  cache.get("a")
+  copy.load(cache.dump())
+  t.equal(copy.get("a"), "A")
+  t.equal(copy.get("b"), undefined)
+
+  t.end()
+})
+
+
+test("load to other age cache", function(t) {
+  var cache = new LRU({maxAge: 50}),
+      aged = new LRU({maxAge: 100}),
+      simple = new LRU(),
+      arr,
+      expired
+
+  //created at 0
+  //a would be valid till 0 + 50
+  cache.set("a", "A")
+  setTimeout(function () {
+    //created at 20
+    //b would be valid till 20 + 50
+    cache.set("b", "B")
+    //b would be valid till 20 + 70
+    cache.set("c", "C", 70)
+    arr = cache.dump()
+    t.equal(arr.length, 3)
+  }, 20)
+
+  setTimeout(function () {
+    t.equal(cache.get("a"), undefined)
+    t.equal(cache.get("b"), "B")
+    t.equal(cache.get("c"), "C")
+
+    aged.load(arr)
+    t.equal(aged.get("a"), undefined)
+    t.equal(aged.get("b"), "B")
+    t.equal(aged.get("c"), "C")
+
+    simple.load(arr)
+    t.equal(simple.get("a"), undefined)
+    t.equal(simple.get("b"), "B")
+    t.equal(simple.get("c"), "C")
+  }, 60)
+
+  setTimeout(function () {
+    t.equal(cache.get("a"), undefined)
+    t.equal(cache.get("b"), undefined)
+    t.equal(cache.get("c"), "C")
+
+    aged.load(arr)
+    t.equal(aged.get("a"), undefined)
+    t.equal(aged.get("b"), undefined)
+    t.equal(aged.get("c"), "C")
+
+    simple.load(arr)
+    t.equal(simple.get("a"), undefined)
+    t.equal(simple.get("b"), undefined)
+    t.equal(simple.get("c"), "C")
+  }, 80)
+
+  setTimeout(function () {
+    t.equal(cache.get("a"), undefined)
+    t.equal(cache.get("b"), undefined)
+    t.equal(cache.get("c"), undefined)
+
+    aged.load(arr)
+    t.equal(aged.get("a"), undefined)
+    t.equal(aged.get("b"), undefined)
+    t.equal(aged.get("c"), undefined)
+
+    simple.load(arr)
+    t.equal(simple.get("a"), undefined)
+    t.equal(simple.get("b"), undefined)
+    t.equal(simple.get("c"), undefined)
+    t.end()
+  }, 100)
+
+})
+
diff --git a/node_modules/minimatch/.npmignore b/node_modules/minimatch/.npmignore
new file mode 100644
index 0000000..3c3629e
--- /dev/null
+++ b/node_modules/minimatch/.npmignore
@@ -0,0 +1 @@
+node_modules
diff --git a/node_modules/minimatch/LICENSE b/node_modules/minimatch/LICENSE
new file mode 100644
index 0000000..05a4010
--- /dev/null
+++ b/node_modules/minimatch/LICENSE
@@ -0,0 +1,23 @@
+Copyright 2009, 2010, 2011 Isaac Z. Schlueter.
+All rights reserved.
+
+Permission is hereby granted, free of charge, to any person
+obtaining a copy of this software and associated documentation
+files (the "Software"), to deal in the Software without
+restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following
+conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/minimatch/README.md b/node_modules/minimatch/README.md
new file mode 100644
index 0000000..5b3967e
--- /dev/null
+++ b/node_modules/minimatch/README.md
@@ -0,0 +1,218 @@
+# minimatch
+
+A minimal matching utility.
+
+[![Build Status](https://secure.travis-ci.org/isaacs/minimatch.png)](http://travis-ci.org/isaacs/minimatch)
+
+
+This is the matching library used internally by npm.
+
+Eventually, it will replace the C binding in node-glob.
+
+It works by converting glob expressions into JavaScript `RegExp`
+objects.
+
+## Usage
+
+```javascript
+var minimatch = require("minimatch")
+
+minimatch("bar.foo", "*.foo") // true!
+minimatch("bar.foo", "*.bar") // false!
+minimatch("bar.foo", "*.+(bar|foo)", { debug: true }) // true, and noisy!
+```
+
+## Features
+
+Supports these glob features:
+
+* Brace Expansion
+* Extended glob matching
+* "Globstar" `**` matching
+
+See:
+
+* `man sh`
+* `man bash`
+* `man 3 fnmatch`
+* `man 5 gitignore`
+
+## Minimatch Class
+
+Create a minimatch object by instanting the `minimatch.Minimatch` class.
+
+```javascript
+var Minimatch = require("minimatch").Minimatch
+var mm = new Minimatch(pattern, options)
+```
+
+### Properties
+
+* `pattern` The original pattern the minimatch object represents.
+* `options` The options supplied to the constructor.
+* `set` A 2-dimensional array of regexp or string expressions.
+  Each row in the
+  array corresponds to a brace-expanded pattern.  Each item in the row
+  corresponds to a single path-part.  For example, the pattern
+  `{a,b/c}/d` would expand to a set of patterns like:
+
+        [ [ a, d ]
+        , [ b, c, d ] ]
+
+    If a portion of the pattern doesn't have any "magic" in it
+    (that is, it's something like `"foo"` rather than `fo*o?`), then it
+    will be left as a string rather than converted to a regular
+    expression.
+
+* `regexp` Created by the `makeRe` method.  A single regular expression
+  expressing the entire pattern.  This is useful in cases where you wish
+  to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled.
+* `negate` True if the pattern is negated.
+* `comment` True if the pattern is a comment.
+* `empty` True if the pattern is `""`.
+
+### Methods
+
+* `makeRe` Generate the `regexp` member if necessary, and return it.
+  Will return `false` if the pattern is invalid.
+* `match(fname)` Return true if the filename matches the pattern, or
+  false otherwise.
+* `matchOne(fileArray, patternArray, partial)` Take a `/`-split
+  filename, and match it against a single row in the `regExpSet`.  This
+  method is mainly for internal use, but is exposed so that it can be
+  used by a glob-walker that needs to avoid excessive filesystem calls.
+
+All other methods are internal, and will be called as necessary.
+
+## Functions
+
+The top-level exported function has a `cache` property, which is an LRU
+cache set to store 100 items.  So, calling these methods repeatedly
+with the same pattern and options will use the same Minimatch object,
+saving the cost of parsing it multiple times.
+
+### minimatch(path, pattern, options)
+
+Main export.  Tests a path against the pattern using the options.
+
+```javascript
+var isJS = minimatch(file, "*.js", { matchBase: true })
+```
+
+### minimatch.filter(pattern, options)
+
+Returns a function that tests its
+supplied argument, suitable for use with `Array.filter`.  Example:
+
+```javascript
+var javascripts = fileList.filter(minimatch.filter("*.js", {matchBase: true}))
+```
+
+### minimatch.match(list, pattern, options)
+
+Match against the list of
+files, in the style of fnmatch or glob.  If nothing is matched, and
+options.nonull is set, then return a list containing the pattern itself.
+
+```javascript
+var javascripts = minimatch.match(fileList, "*.js", {matchBase: true}))
+```
+
+### minimatch.makeRe(pattern, options)
+
+Make a regular expression object from the pattern.
+
+## Options
+
+All options are `false` by default.
+
+### debug
+
+Dump a ton of stuff to stderr.
+
+### nobrace
+
+Do not expand `{a,b}` and `{1..3}` brace sets.
+
+### noglobstar
+
+Disable `**` matching against multiple folder names.
+
+### dot
+
+Allow patterns to match filenames starting with a period, even if
+the pattern does not explicitly have a period in that spot.
+
+Note that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot`
+is set.
+
+### noext
+
+Disable "extglob" style patterns like `+(a|b)`.
+
+### nocase
+
+Perform a case-insensitive match.
+
+### nonull
+
+When a match is not found by `minimatch.match`, return a list containing
+the pattern itself if this option is set.  When not set, an empty list
+is returned if there are no matches.
+
+### matchBase
+
+If set, then patterns without slashes will be matched
+against the basename of the path if it contains slashes.  For example,
+`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`.
+
+### nocomment
+
+Suppress the behavior of treating `#` at the start of a pattern as a
+comment.
+
+### nonegate
+
+Suppress the behavior of treating a leading `!` character as negation.
+
+### flipNegate
+
+Returns from negate expressions the same as if they were not negated.
+(Ie, true on a hit, false on a miss.)
+
+
+## Comparisons to other fnmatch/glob implementations
+
+While strict compliance with the existing standards is a worthwhile
+goal, some discrepancies exist between minimatch and other
+implementations, and are intentional.
+
+If the pattern starts with a `!` character, then it is negated.  Set the
+`nonegate` flag to suppress this behavior, and treat leading `!`
+characters normally.  This is perhaps relevant if you wish to start the
+pattern with a negative extglob pattern like `!(a|B)`.  Multiple `!`
+characters at the start of a pattern will negate the pattern multiple
+times.
+
+If a pattern starts with `#`, then it is treated as a comment, and
+will not match anything.  Use `\#` to match a literal `#` at the
+start of a line, or set the `nocomment` flag to suppress this behavior.
+
+The double-star character `**` is supported by default, unless the
+`noglobstar` flag is set.  This is supported in the manner of bsdglob
+and bash 4.1, where `**` only has special significance if it is the only
+thing in a path part.  That is, `a/**/b` will match `a/x/y/b`, but
+`a/**b` will not.
+
+If an escaped pattern has no matches, and the `nonull` flag is set,
+then minimatch.match returns the pattern as-provided, rather than
+interpreting the character escapes.  For example,
+`minimatch.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than
+`"*a?"`.  This is akin to setting the `nullglob` option in bash, except
+that it does not resolve escaped pattern characters.
+
+If brace expansion is not disabled, then it is performed before any
+other interpretation of the glob pattern.  Thus, a pattern like
+`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded
+**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are
+checked for validity.  Since those two are valid, matching proceeds.
diff --git a/node_modules/minimatch/minimatch.js b/node_modules/minimatch/minimatch.js
new file mode 100644
index 0000000..4539678
--- /dev/null
+++ b/node_modules/minimatch/minimatch.js
@@ -0,0 +1,1061 @@
+;(function (require, exports, module, platform) {
+
+if (module) module.exports = minimatch
+else exports.minimatch = minimatch
+
+if (!require) {
+  require = function (id) {
+    switch (id) {
+      case "sigmund": return function sigmund (obj) {
+        return JSON.stringify(obj)
+      }
+      case "path": return { basename: function (f) {
+        f = f.split(/[\/\\]/)
+        var e = f.pop()
+        if (!e) e = f.pop()
+        return e
+      }}
+      case "lru-cache": return function LRUCache () {
+        // not quite an LRU, but still space-limited.
+        var cache = {}
+        var cnt = 0
+        this.set = function (k, v) {
+          cnt ++
+          if (cnt >= 100) cache = {}
+          cache[k] = v
+        }
+        this.get = function (k) { return cache[k] }
+      }
+    }
+  }
+}
+
+minimatch.Minimatch = Minimatch
+
+var LRU = require("lru-cache")
+  , cache = minimatch.cache = new LRU({max: 100})
+  , GLOBSTAR = minimatch.GLOBSTAR = Minimatch.GLOBSTAR = {}
+  , sigmund = require("sigmund")
+
+var path = require("path")
+  // any single thing other than /
+  // don't need to escape / when using new RegExp()
+  , qmark = "[^/]"
+
+  // * => any number of characters
+  , star = qmark + "*?"
+
+  // ** when dots are allowed.  Anything goes, except .. and .
+  // not (^ or / followed by one or two dots followed by $ or /),
+  // followed by anything, any number of times.
+  , twoStarDot = "(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?"
+
+  // not a ^ or / followed by a dot,
+  // followed by anything, any number of times.
+  , twoStarNoDot = "(?:(?!(?:\\\/|^)\\.).)*?"
+
+  // characters that need to be escaped in RegExp.
+  , reSpecials = charSet("().*{}+?[]^$\\!")
+
+// "abc" -> { a:true, b:true, c:true }
+function charSet (s) {
+  return s.split("").reduce(function (set, c) {
+    set[c] = true
+    return set
+  }, {})
+}
+
+// normalizes slashes.
+var slashSplit = /\/+/
+
+minimatch.filter = filter
+function filter (pattern, options) {
+  options = options || {}
+  return function (p, i, list) {
+    return minimatch(p, pattern, options)
+  }
+}
+
+function ext (a, b) {
+  a = a || {}
+  b = b || {}
+  var t = {}
+  Object.keys(b).forEach(function (k) {
+    t[k] = b[k]
+  })
+  Object.keys(a).forEach(function (k) {
+    t[k] = a[k]
+  })
+  return t
+}
+
+minimatch.defaults = function (def) {
+  if (!def || !Object.keys(def).length) return minimatch
+
+  var orig = minimatch
+
+  var m = function minimatch (p, pattern, options) {
+    return orig.minimatch(p, pattern, ext(def, options))
+  }
+
+  m.Minimatch = function Minimatch (pattern, options) {
+    return new orig.Minimatch(pattern, ext(def, options))
+  }
+
+  return m
+}
+
+Minimatch.defaults = function (def) {
+  if (!def || !Object.keys(def).length) return Minimatch
+  return minimatch.defaults(def).Minimatch
+}
+
+
+function minimatch (p, pattern, options) {
+  if (typeof pattern !== "string") {
+    throw new TypeError("glob pattern string required")
+  }
+
+  if (!options) options = {}
+
+  // shortcut: comments match nothing.
+  if (!options.nocomment && pattern.charAt(0) === "#") {
+    return false
+  }
+
+  // "" only matches ""
+  if (pattern.trim() === "") return p === ""
+
+  return new Minimatch(pattern, options).match(p)
+}
+
+function Minimatch (pattern, options) {
+  if (!(this instanceof Minimatch)) {
+    return new Minimatch(pattern, options, cache)
+  }
+
+  if (typeof pattern !== "string") {
+    throw new TypeError("glob pattern string required")
+  }
+
+  if (!options) options = {}
+  pattern = pattern.trim()
+
+  // windows: need to use /, not \
+  // On other platforms, \ is a valid (albeit bad) filename char.
+  if (platform === "win32") {
+    pattern = pattern.split("\\").join("/")
+  }
+
+  // lru storage.
+  // these things aren't particularly big, but walking down the string
+  // and turning it into a regexp can get pretty costly.
+  var cacheKey = pattern + "\n" + sigmund(options)
+  var cached = minimatch.cache.get(cacheKey)
+  if (cached) return cached
+  minimatch.cache.set(cacheKey, this)
+
+  this.options = options
+  this.set = []
+  this.pattern = pattern
+  this.regexp = null
+  this.negate = false
+  this.comment = false
+  this.empty = false
+
+  // make the set of regexps etc.
+  this.make()
+}
+
+Minimatch.prototype.debug = function() {}
+
+Minimatch.prototype.make = make
+function make () {
+  // don't do it more than once.
+  if (this._made) return
+
+  var pattern = this.pattern
+  var options = this.options
+
+  // empty patterns and comments match nothing.
+  if (!options.nocomment && pattern.charAt(0) === "#") {
+    this.comment = true
+    return
+  }
+  if (!pattern) {
+    this.empty = true
+    return
+  }
+
+  // step 1: figure out negation, etc.
+  this.parseNegate()
+
+  // step 2: expand braces
+  var set = this.globSet = this.braceExpand()
+
+  if (options.debug) this.debug = console.error
+
+  this.debug(this.pattern, set)
+
+  // step 3: now we have a set, so turn each one into a series of path-portion
+  // matching patterns.
+  // These will be regexps, except in the case of "**", which is
+  // set to the GLOBSTAR object for globstar behavior,
+  // and will not contain any / characters
+  set = this.globParts = set.map(function (s) {
+    return s.split(slashSplit)
+  })
+
+  this.debug(this.pattern, set)
+
+  // glob --> regexps
+  set = set.map(function (s, si, set) {
+    return s.map(this.parse, this)
+  }, this)
+
+  this.debug(this.pattern, set)
+
+  // filter out everything that didn't compile properly.
+  set = set.filter(function (s) {
+    return -1 === s.indexOf(false)
+  })
+
+  this.debug(this.pattern, set)
+
+  this.set = set
+}
+
+Minimatch.prototype.parseNegate = parseNegate
+function parseNegate () {
+  var pattern = this.pattern
+    , negate = false
+    , options = this.options
+    , negateOffset = 0
+
+  if (options.nonegate) return
+
+  for ( var i = 0, l = pattern.length
+      ; i < l && pattern.charAt(i) === "!"
+      ; i ++) {
+    negate = !negate
+    negateOffset ++
+  }
+
+  if (negateOffset) this.pattern = pattern.substr(negateOffset)
+  this.negate = negate
+}
+
+// Brace expansion:
+// a{b,c}d -> abd acd
+// a{b,}c -> abc ac
+// a{0..3}d -> a0d a1d a2d a3d
+// a{b,c{d,e}f}g -> abg acdfg acefg
+// a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg
+//
+// Invalid sets are not expanded.
+// a{2..}b -> a{2..}b
+// a{b}c -> a{b}c
+minimatch.braceExpand = function (pattern, options) {
+  return new Minimatch(pattern, options).braceExpand()
+}
+
+Minimatch.prototype.braceExpand = braceExpand
+function braceExpand (pattern, options) {
+  options = options || this.options
+  pattern = typeof pattern === "undefined"
+    ? this.pattern : pattern
+
+  if (typeof pattern === "undefined") {
+    throw new Error("undefined pattern")
+  }
+
+  if (options.nobrace ||
+      !pattern.match(/\{.*\}/)) {
+    // shortcut. no need to expand.
+    return [pattern]
+  }
+
+  var escaping = false
+
+  // examples and comments refer to this crazy pattern:
+  // a{b,c{d,e},{f,g}h}x{y,z}
+  // expected:
+  // abxy
+  // abxz
+  // acdxy
+  // acdxz
+  // acexy
+  // acexz
+  // afhxy
+  // afhxz
+  // aghxy
+  // aghxz
+
+  // everything before the first \{ is just a prefix.
+  // So, we pluck that off, and work with the rest,
+  // and then prepend it to everything we find.
+  if (pattern.charAt(0) !== "{") {
+    this.debug(pattern)
+    var prefix = null
+    for (var i = 0, l = pattern.length; i < l; i ++) {
+      var c = pattern.charAt(i)
+      this.debug(i, c)
+      if (c === "\\") {
+        escaping = !escaping
+      } else if (c === "{" && !escaping) {
+        prefix = pattern.substr(0, i)
+        break
+      }
+    }
+
+    // actually no sets, all { were escaped.
+    if (prefix === null) {
+      this.debug("no sets")
+      return [pattern]
+    }
+
+   var tail = braceExpand.call(this, pattern.substr(i), options)
+    return tail.map(function (t) {
+      return prefix + t
+    })
+  }
+
+  // now we have something like:
+  // {b,c{d,e},{f,g}h}x{y,z}
+  // walk through the set, expanding each part, until
+  // the set ends.  then, we'll expand the suffix.
+  // If the set only has a single member, then'll put the {} back
+
+  // first, handle numeric sets, since they're easier
+  var numset = pattern.match(/^\{(-?[0-9]+)\.\.(-?[0-9]+)\}/)
+  if (numset) {
+    this.debug("numset", numset[1], numset[2])
+    var suf = braceExpand.call(this, pattern.substr(numset[0].length), options)
+      , start = +numset[1]
+      , end = +numset[2]
+      , inc = start > end ? -1 : 1
+      , set = []
+    for (var i = start; i != (end + inc); i += inc) {
+      // append all the suffixes
+      for (var ii = 0, ll = suf.length; ii < ll; ii ++) {
+        set.push(i + suf[ii])
+      }
+    }
+    return set
+  }
+
+  // ok, walk through the set
+  // We hope, somewhat optimistically, that there
+  // will be a } at the end.
+  // If the closing brace isn't found, then the pattern is
+  // interpreted as braceExpand("\\" + pattern) so that
+  // the leading \{ will be interpreted literally.
+  var i = 1 // skip the \{
+    , depth = 1
+    , set = []
+    , member = ""
+    , sawEnd = false
+    , escaping = false
+
+  function addMember () {
+    set.push(member)
+    member = ""
+  }
+
+  this.debug("Entering for")
+  FOR: for (i = 1, l = pattern.length; i < l; i ++) {
+    var c = pattern.charAt(i)
+    this.debug("", i, c)
+
+    if (escaping) {
+      escaping = false
+      member += "\\" + c
+    } else {
+      switch (c) {
+        case "\\":
+          escaping = true
+          continue
+
+        case "{":
+          depth ++
+          member += "{"
+          continue
+
+        case "}":
+          depth --
+          // if this closes the actual set, then we're done
+          if (depth === 0) {
+            addMember()
+            // pluck off the close-brace
+            i ++
+            break FOR
+          } else {
+            member += c
+            continue
+          }
+
+        case ",":
+          if (depth === 1) {
+            addMember()
+          } else {
+            member += c
+          }
+          continue
+
+        default:
+          member += c
+          continue
+      } // switch
+    } // else
+  } // for
+
+  // now we've either finished the set, and the suffix is
+  // pattern.substr(i), or we have *not* closed the set,
+  // and need to escape the leading brace
+  if (depth !== 0) {
+    this.debug("didn't close", pattern)
+    return braceExpand.call(this, "\\" + pattern, options)
+  }
+
+  // x{y,z} -> ["xy", "xz"]
+  this.debug("set", set)
+  this.debug("suffix", pattern.substr(i))
+  var suf = braceExpand.call(this, pattern.substr(i), options)
+  // ["b", "c{d,e}","{f,g}h"] ->
+  //   [["b"], ["cd", "ce"], ["fh", "gh"]]
+  var addBraces = set.length === 1
+  this.debug("set pre-expanded", set)
+  set = set.map(function (p) {
+    return braceExpand.call(this, p, options)
+  }, this)
+  this.debug("set expanded", set)
+
+
+  // [["b"], ["cd", "ce"], ["fh", "gh"]] ->
+  //   ["b", "cd", "ce", "fh", "gh"]
+  set = set.reduce(function (l, r) {
+    return l.concat(r)
+  })
+
+  if (addBraces) {
+    set = set.map(function (s) {
+      return "{" + s + "}"
+    })
+  }
+
+  // now attach the suffixes.
+  var ret = []
+  for (var i = 0, l = set.length; i < l; i ++) {
+    for (var ii = 0, ll = suf.length; ii < ll; ii ++) {
+      ret.push(set[i] + suf[ii])
+    }
+  }
+  return ret
+}
+
+// parse a component of the expanded set.
+// At this point, no pattern may contain "/" in it
+// so we're going to return a 2d array, where each entry is the full
+// pattern, split on '/', and then turned into a regular expression.
+// A regexp is made at the end which joins each array with an
+// escaped /, and another full one which joins each regexp with |.
+//
+// Following the lead of Bash 4.1, note that "**" only has special meaning
+// when it is the *only* thing in a path portion.  Otherwise, any series
+// of * is equivalent to a single *.  Globstar behavior is enabled by
+// default, and can be disabled by setting options.noglobstar.
+Minimatch.prototype.parse = parse
+var SUBPARSE = {}
+function parse (pattern, isSub) {
+  var options = this.options
+
+  // shortcuts
+  if (!options.noglobstar && pattern === "**") return GLOBSTAR
+  if (pattern === "") return ""
+
+  var re = ""
+    , hasMagic = !!options.nocase
+    , escaping = false
+    // ? => one single character
+    , patternListStack = []
+    , plType
+    , stateChar
+    , inClass = false
+    , reClassStart = -1
+    , classStart = -1
+    // . and .. never match anything that doesn't start with .,
+    // even when options.dot is set.
+    , patternStart = pattern.charAt(0) === "." ? "" // anything
+      // not (start or / followed by . or .. followed by / or end)
+      : options.dot ? "(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))"
+      : "(?!\\.)"
+    , self = this
+
+  function clearStateChar () {
+    if (stateChar) {
+      // we had some state-tracking character
+      // that wasn't consumed by this pass.
+      switch (stateChar) {
+        case "*":
+          re += star
+          hasMagic = true
+          break
+        case "?":
+          re += qmark
+          hasMagic = true
+          break
+        default:
+          re += "\\"+stateChar
+          break
+      }
+      self.debug('clearStateChar %j %j', stateChar, re)
+      stateChar = false
+    }
+  }
+
+  for ( var i = 0, len = pattern.length, c
+      ; (i < len) && (c = pattern.charAt(i))
+      ; i ++ ) {
+
+    this.debug("%s\t%s %s %j", pattern, i, re, c)
+
+    // skip over any that are escaped.
+    if (escaping && reSpecials[c]) {
+      re += "\\" + c
+      escaping = false
+      continue
+    }
+
+    SWITCH: switch (c) {
+      case "/":
+        // completely not allowed, even escaped.
+        // Should already be path-split by now.
+        return false
+
+      case "\\":
+        clearStateChar()
+        escaping = true
+        continue
+
+      // the various stateChar values
+      // for the "extglob" stuff.
+      case "?":
+      case "*":
+      case "+":
+      case "@":
+      case "!":
+        this.debug("%s\t%s %s %j <-- stateChar", pattern, i, re, c)
+
+        // all of those are literals inside a class, except that
+        // the glob [!a] means [^a] in regexp
+        if (inClass) {
+          this.debug('  in class')
+          if (c === "!" && i === classStart + 1) c = "^"
+          re += c
+          continue
+        }
+
+        // if we already have a stateChar, then it means
+        // that there was something like ** or +? in there.
+        // Handle the stateChar, then proceed with this one.
+        self.debug('call clearStateChar %j', stateChar)
+        clearStateChar()
+        stateChar = c
+        // if extglob is disabled, then +(asdf|foo) isn't a thing.
+        // just clear the statechar *now*, rather than even diving into
+        // the patternList stuff.
+        if (options.noext) clearStateChar()
+        continue
+
+      case "(":
+        if (inClass) {
+          re += "("
+          continue
+        }
+
+        if (!stateChar) {
+          re += "\\("
+          continue
+        }
+
+        plType = stateChar
+        patternListStack.push({ type: plType
+                              , start: i - 1
+                              , reStart: re.length })
+        // negation is (?:(?!js)[^/]*)
+        re += stateChar === "!" ? "(?:(?!" : "(?:"
+        this.debug('plType %j %j', stateChar, re)
+        stateChar = false
+        continue
+
+      case ")":
+        if (inClass || !patternListStack.length) {
+          re += "\\)"
+          continue
+        }
+
+        clearStateChar()
+        hasMagic = true
+        re += ")"
+        plType = patternListStack.pop().type
+        // negation is (?:(?!js)[^/]*)
+        // The others are (?:)
+        switch (plType) {
+          case "!":
+            re += "[^/]*?)"
+            break
+          case "?":
+          case "+":
+          case "*": re += plType
+          case "@": break // the default anyway
+        }
+        continue
+
+      case "|":
+        if (inClass || !patternListStack.length || escaping) {
+          re += "\\|"
+          escaping = false
+          continue
+        }
+
+        clearStateChar()
+        re += "|"
+        continue
+
+      // these are mostly the same in regexp and glob
+      case "[":
+        // swallow any state-tracking char before the [
+        clearStateChar()
+
+        if (inClass) {
+          re += "\\" + c
+          continue
+        }
+
+        inClass = true
+        classStart = i
+        reClassStart = re.length
+        re += c
+        continue
+
+      case "]":
+        //  a right bracket shall lose its special
+        //  meaning and represent itself in
+        //  a bracket expression if it occurs
+        //  first in the list.  -- POSIX.2 2.8.3.2
+        if (i === classStart + 1 || !inClass) {
+          re += "\\" + c
+          escaping = false
+          continue
+        }
+
+        // finish up the class.
+        hasMagic = true
+        inClass = false
+        re += c
+        continue
+
+      default:
+        // swallow any state char that wasn't consumed
+        clearStateChar()
+
+        if (escaping) {
+          // no need
+          escaping = false
+        } else if (reSpecials[c]
+                   && !(c === "^" && inClass)) {
+          re += "\\"
+        }
+
+        re += c
+
+    } // switch
+  } // for
+
+
+  // handle the case where we left a class open.
+  // "[abc" is valid, equivalent to "\[abc"
+  if (inClass) {
+    // split where the last [ was, and escape it
+    // this is a huge pita.  We now have to re-walk
+    // the contents of the would-be class to re-translate
+    // any characters that were passed through as-is
+    var cs = pattern.substr(classStart + 1)
+      , sp = this.parse(cs, SUBPARSE)
+    re = re.substr(0, reClassStart) + "\\[" + sp[0]
+    hasMagic = hasMagic || sp[1]
+  }
+
+  // handle the case where we had a +( thing at the *end*
+  // of the pattern.
+  // each pattern list stack adds 3 chars, and we need to go through
+  // and escape any | chars that were passed through as-is for the regexp.
+  // Go through and escape them, taking care not to double-escape any
+  // | chars that were already escaped.
+  var pl
+  while (pl = patternListStack.pop()) {
+    var tail = re.slice(pl.reStart + 3)
+    // maybe some even number of \, then maybe 1 \, followed by a |
+    tail = tail.replace(/((?:\\{2})*)(\\?)\|/g, function (_, $1, $2) {
+      if (!$2) {
+        // the | isn't already escaped, so escape it.
+        $2 = "\\"
+      }
+
+      // need to escape all those slashes *again*, without escaping the
+      // one that we need for escaping the | character.  As it works out,
+      // escaping an even number of slashes can be done by simply repeating
+      // it exactly after itself.  That's why this trick works.
+      //
+      // I am sorry that you have to see this.
+      return $1 + $1 + $2 + "|"
+    })
+
+    this.debug("tail=%j\n   %s", tail, tail)
+    var t = pl.type === "*" ? star
+          : pl.type === "?" ? qmark
+          : "\\" + pl.type
+
+    hasMagic = true
+    re = re.slice(0, pl.reStart)
+       + t + "\\("
+       + tail
+  }
+
+  // handle trailing things that only matter at the very end.
+  clearStateChar()
+  if (escaping) {
+    // trailing \\
+    re += "\\\\"
+  }
+
+  // only need to apply the nodot start if the re starts with
+  // something that could conceivably capture a dot
+  var addPatternStart = false
+  switch (re.charAt(0)) {
+    case ".":
+    case "[":
+    case "(": addPatternStart = true
+  }
+
+  // if the re is not "" at this point, then we need to make sure
+  // it doesn't match against an empty path part.
+  // Otherwise a/* will match a/, which it should not.
+  if (re !== "" && hasMagic) re = "(?=.)" + re
+
+  if (addPatternStart) re = patternStart + re
+
+  // parsing just a piece of a larger pattern.
+  if (isSub === SUBPARSE) {
+    return [ re, hasMagic ]
+  }
+
+  // skip the regexp for non-magical patterns
+  // unescape anything in it, though, so that it'll be
+  // an exact match against a file etc.
+  if (!hasMagic) {
+    return globUnescape(pattern)
+  }
+
+  var flags = options.nocase ? "i" : ""
+    , regExp = new RegExp("^" + re + "$", flags)
+
+  regExp._glob = pattern
+  regExp._src = re
+
+  return regExp
+}
+
+minimatch.makeRe = function (pattern, options) {
+  return new Minimatch(pattern, options || {}).makeRe()
+}
+
+Minimatch.prototype.makeRe = makeRe
+function makeRe () {
+  if (this.regexp || this.regexp === false) return this.regexp
+
+  // at this point, this.set is a 2d array of partial
+  // pattern strings, or "**".
+  //
+  // It's better to use .match().  This function shouldn't
+  // be used, really, but it's pretty convenient sometimes,
+  // when you just want to work with a regex.
+  var set = this.set
+
+  if (!set.length) return this.regexp = false
+  var options = this.options
+
+  var twoStar = options.noglobstar ? star
+      : options.dot ? twoStarDot
+      : twoStarNoDot
+    , flags = options.nocase ? "i" : ""
+
+  var re = set.map(function (pattern) {
+    return pattern.map(function (p) {
+      return (p === GLOBSTAR) ? twoStar
+           : (typeof p === "string") ? regExpEscape(p)
+           : p._src
+    }).join("\\\/")
+  }).join("|")
+
+  // must match entire pattern
+  // ending in a * or ** will make it less strict.
+  re = "^(?:" + re + ")$"
+
+  // can match anything, as long as it's not this.
+  if (this.negate) re = "^(?!" + re + ").*$"
+
+  try {
+    return this.regexp = new RegExp(re, flags)
+  } catch (ex) {
+    return this.regexp = false
+  }
+}
+
+minimatch.match = function (list, pattern, options) {
+  options = options || {}
+  var mm = new Minimatch(pattern, options)
+  list = list.filter(function (f) {
+    return mm.match(f)
+  })
+  if (mm.options.nonull && !list.length) {
+    list.push(pattern)
+  }
+  return list
+}
+
+Minimatch.prototype.match = match
+function match (f, partial) {
+  this.debug("match", f, this.pattern)
+  // short-circuit in the case of busted things.
+  // comments, etc.
+  if (this.comment) return false
+  if (this.empty) return f === ""
+
+  if (f === "/" && partial) return true
+
+  var options = this.options
+
+  // windows: need to use /, not \
+  // On other platforms, \ is a valid (albeit bad) filename char.
+  if (platform === "win32") {
+    f = f.split("\\").join("/")
+  }
+
+  // treat the test path as a set of pathparts.
+  f = f.split(slashSplit)
+  this.debug(this.pattern, "split", f)
+
+  // just ONE of the pattern sets in this.set needs to match
+  // in order for it to be valid.  If negating, then just one
+  // match means that we have failed.
+  // Either way, return on the first hit.
+
+  var set = this.set
+  this.debug(this.pattern, "set", set)
+
+  // Find the basename of the path by looking for the last non-empty segment
+  var filename;
+  for (var i = f.length - 1; i >= 0; i--) {
+    filename = f[i]
+    if (filename) break
+  }
+
+  for (var i = 0, l = set.length; i < l; i ++) {
+    var pattern = set[i], file = f
+    if (options.matchBase && pattern.length === 1) {
+      file = [filename]
+    }
+    var hit = this.matchOne(file, pattern, partial)
+    if (hit) {
+      if (options.flipNegate) return true
+      return !this.negate
+    }
+  }
+
+  // didn't get any hits.  this is success if it's a negative
+  // pattern, failure otherwise.
+  if (options.flipNegate) return false
+  return this.negate
+}
+
+// set partial to true to test if, for example,
+// "/a/b" matches the start of "/*/b/*/d"
+// Partial means, if you run out of file before you run
+// out of pattern, then that's fine, as long as all
+// the parts match.
+Minimatch.prototype.matchOne = function (file, pattern, partial) {
+  var options = this.options
+
+  this.debug("matchOne",
+              { "this": this
+              , file: file
+              , pattern: pattern })
+
+  this.debug("matchOne", file.length, pattern.length)
+
+  for ( var fi = 0
+          , pi = 0
+          , fl = file.length
+          , pl = pattern.length
+      ; (fi < fl) && (pi < pl)
+      ; fi ++, pi ++ ) {
+
+    this.debug("matchOne loop")
+    var p = pattern[pi]
+      , f = file[fi]
+
+    this.debug(pattern, p, f)
+
+    // should be impossible.
+    // some invalid regexp stuff in the set.
+    if (p === false) return false
+
+    if (p === GLOBSTAR) {
+      this.debug('GLOBSTAR', [pattern, p, f])
+
+      // "**"
+      // a/**/b/**/c would match the following:
+      // a/b/x/y/z/c
+      // a/x/y/z/b/c
+      // a/b/x/b/x/c
+      // a/b/c
+      // To do this, take the rest of the pattern after
+      // the **, and see if it would match the file remainder.
+      // If so, return success.
+      // If not, the ** "swallows" a segment, and try again.
+      // This is recursively awful.
+      //
+      // a/**/b/**/c matching a/b/x/y/z/c
+      // - a matches a
+      // - doublestar
+      //   - matchOne(b/x/y/z/c, b/**/c)
+      //     - b matches b
+      //     - doublestar
+      //       - matchOne(x/y/z/c, c) -> no
+      //       - matchOne(y/z/c, c) -> no
+      //       - matchOne(z/c, c) -> no
+      //       - matchOne(c, c) yes, hit
+      var fr = fi
+        , pr = pi + 1
+      if (pr === pl) {
+        this.debug('** at the end')
+        // a ** at the end will just swallow the rest.
+        // We have found a match.
+        // however, it will not swallow /.x, unless
+        // options.dot is set.
+        // . and .. are *never* matched by **, for explosively
+        // exponential reasons.
+        for ( ; fi < fl; fi ++) {
+          if (file[fi] === "." || file[fi] === ".." ||
+              (!options.dot && file[fi].charAt(0) === ".")) return false
+        }
+        return true
+      }
+
+      // ok, let's see if we can swallow whatever we can.
+      WHILE: while (fr < fl) {
+        var swallowee = file[fr]
+
+        this.debug('\nglobstar while',
+                    file, fr, pattern, pr, swallowee)
+
+        // XXX remove this slice.  Just pass the start index.
+        if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) {
+          this.debug('globstar found match!', fr, fl, swallowee)
+          // found a match.
+          return true
+        } else {
+          // can't swallow "." or ".." ever.
+          // can only swallow ".foo" when explicitly asked.
+          if (swallowee === "." || swallowee === ".." ||
+              (!options.dot && swallowee.charAt(0) === ".")) {
+            this.debug("dot detected!", file, fr, pattern, pr)
+            break WHILE
+          }
+
+          // ** swallows a segment, and continue.
+          this.debug('globstar swallow a segment, and continue')
+          fr ++
+        }
+      }
+      // no match was found.
+      // However, in partial mode, we can't say this is necessarily over.
+      // If there's more *pattern* left, then
+      if (partial) {
+        // ran out of file
+        this.debug("\n>>> no match, partial?", file, fr, pattern, pr)
+        if (fr === fl) return true
+      }
+      return false
+    }
+
+    // something other than **
+    // non-magic patterns just have to match exactly
+    // patterns with magic have been turned into regexps.
+    var hit
+    if (typeof p === "string") {
+      if (options.nocase) {
+        hit = f.toLowerCase() === p.toLowerCase()
+      } else {
+        hit = f === p
+      }
+      this.debug("string match", p, f, hit)
+    } else {
+      hit = f.match(p)
+      this.debug("pattern match", p, f, hit)
+    }
+
+    if (!hit) return false
+  }
+
+  // Note: ending in / means that we'll get a final ""
+  // at the end of the pattern.  This can only match a
+  // corresponding "" at the end of the file.
+  // If the file ends in /, then it can only match a
+  // a pattern that ends in /, unless the pattern just
+  // doesn't have any more for it. But, a/b/ should *not*
+  // match "a/b/*", even though "" matches against the
+  // [^/]*? pattern, except in partial mode, where it might
+  // simply not be reached yet.
+  // However, a/b/ should still satisfy a/*
+
+  // now either we fell off the end of the pattern, or we're done.
+  if (fi === fl && pi === pl) {
+    // ran out of pattern and filename at the same time.
+    // an exact hit!
+    return true
+  } else if (fi === fl) {
+    // ran out of file, but still had pattern left.
+    // this is ok if we're doing the match as part of
+    // a glob fs traversal.
+    return partial
+  } else if (pi === pl) {
+    // ran out of pattern, still have file left.
+    // this is only acceptable if we're on the very last
+    // empty segment of a file with a trailing slash.
+    // a/* should match a/b/
+    var emptyFileEnd = (fi === fl - 1) && (file[fi] === "")
+    return emptyFileEnd
+  }
+
+  // should be unreachable.
+  throw new Error("wtf?")
+}
+
+
+// replace stuff like \* with *
+function globUnescape (s) {
+  return s.replace(/\\(.)/g, "$1")
+}
+
+
+function regExpEscape (s) {
+  return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&")
+}
+
+})( typeof require === "function" ? require : null,
+    this,
+    typeof module === "object" ? module : null,
+    typeof process === "object" ? process.platform : "win32"
+  )
diff --git a/node_modules/minimatch/package.json b/node_modules/minimatch/package.json
new file mode 100644
index 0000000..7f93767
--- /dev/null
+++ b/node_modules/minimatch/package.json
@@ -0,0 +1,61 @@
+{
+  "_from": "minimatch@0.3",
+  "_id": "minimatch@0.3.0",
+  "_inBundle": false,
+  "_integrity": "sha1-J12O2qxPG7MyZHIInnlJyDlGmd0=",
+  "_location": "/minimatch",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "range",
+    "registry": true,
+    "raw": "minimatch@0.3",
+    "name": "minimatch",
+    "escapedName": "minimatch",
+    "rawSpec": "0.3",
+    "saveSpec": null,
+    "fetchSpec": "0.3"
+  },
+  "_requiredBy": [
+    "/glob"
+  ],
+  "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-0.3.0.tgz",
+  "_shasum": "275d8edaac4f1bb3326472089e7949c8394699dd",
+  "_spec": "minimatch@0.3",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/glob",
+  "author": {
+    "name": "Isaac Z. Schlueter",
+    "email": "i@izs.me",
+    "url": "http://blog.izs.me"
+  },
+  "bugs": {
+    "url": "https://github.com/isaacs/minimatch/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {
+    "lru-cache": "2",
+    "sigmund": "~1.0.0"
+  },
+  "deprecated": "Please update to minimatch 3.0.2 or higher to avoid a RegExp DoS issue",
+  "description": "a glob matcher in javascript",
+  "devDependencies": {
+    "tap": ""
+  },
+  "engines": {
+    "node": "*"
+  },
+  "homepage": "https://github.com/isaacs/minimatch#readme",
+  "license": {
+    "type": "MIT",
+    "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE"
+  },
+  "main": "minimatch.js",
+  "name": "minimatch",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/isaacs/minimatch.git"
+  },
+  "scripts": {
+    "test": "tap test/*.js"
+  },
+  "version": "0.3.0"
+}
diff --git a/node_modules/minimatch/test/basic.js b/node_modules/minimatch/test/basic.js
new file mode 100644
index 0000000..ae7ac73
--- /dev/null
+++ b/node_modules/minimatch/test/basic.js
@@ -0,0 +1,399 @@
+// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test
+//
+// TODO: Some of these tests do very bad things with backslashes, and will
+// most likely fail badly on windows.  They should probably be skipped.
+
+var tap = require("tap")
+  , globalBefore = Object.keys(global)
+  , mm = require("../")
+  , files = [ "a", "b", "c", "d", "abc"
+            , "abd", "abe", "bb", "bcd"
+            , "ca", "cb", "dd", "de"
+            , "bdir/", "bdir/cfile"]
+  , next = files.concat([ "a-b", "aXb"
+                        , ".x", ".y" ])
+
+
+var patterns =
+  [ "http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test"
+  , ["a*", ["a", "abc", "abd", "abe"]]
+  , ["X*", ["X*"], {nonull: true}]
+
+  // allow null glob expansion
+  , ["X*", []]
+
+  // isaacs: Slightly different than bash/sh/ksh
+  // \\* is not un-escaped to literal "*" in a failed match,
+  // but it does make it get treated as a literal star
+  , ["\\*", ["\\*"], {nonull: true}]
+  , ["\\**", ["\\**"], {nonull: true}]
+  , ["\\*\\*", ["\\*\\*"], {nonull: true}]
+
+  , ["b*/", ["bdir/"]]
+  , ["c*", ["c", "ca", "cb"]]
+  , ["**", files]
+
+  , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}]
+  , ["s/\\..*//", ["s/\\..*//"], {nonull: true}]
+
+  , "legendary larry crashes bashes"
+  , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"
+    , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}]
+  , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"
+    , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}]
+
+  , "character classes"
+  , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]]
+  , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd",
+     "bdir/", "ca", "cb", "dd", "de"]]
+  , ["a*[^c]", ["abd", "abe"]]
+  , function () { files.push("a-b", "aXb") }
+  , ["a[X-]b", ["a-b", "aXb"]]
+  , function () { files.push(".x", ".y") }
+  , ["[^a-c]*", ["d", "dd", "de"]]
+  , function () { files.push("a*b/", "a*b/ooo") }
+  , ["a\\*b/*", ["a*b/ooo"]]
+  , ["a\\*?/*", ["a*b/ooo"]]
+  , ["*\\\\!*", [], {null: true}, ["echo !7"]]
+  , ["*\\!*", ["echo !7"], null, ["echo !7"]]
+  , ["*.\\*", ["r.*"], null, ["r.*"]]
+  , ["a[b]c", ["abc"]]
+  , ["a[\\b]c", ["abc"]]
+  , ["a?c", ["abc"]]
+  , ["a\\*c", [], {null: true}, ["abc"]]
+  , ["", [""], { null: true }, [""]]
+
+  , "http://www.opensource.apple.com/source/bash/bash-23/" +
+    "bash/tests/glob-test"
+  , function () { files.push("man/", "man/man1/", "man/man1/bash.1") }
+  , ["*/man*/bash.*", ["man/man1/bash.1"]]
+  , ["man/man1/bash.1", ["man/man1/bash.1"]]
+  , ["a***c", ["abc"], null, ["abc"]]
+  , ["a*****?c", ["abc"], null, ["abc"]]
+  , ["?*****??", ["abc"], null, ["abc"]]
+  , ["*****??", ["abc"], null, ["abc"]]
+  , ["?*****?c", ["abc"], null, ["abc"]]
+  , ["?***?****c", ["abc"], null, ["abc"]]
+  , ["?***?****?", ["abc"], null, ["abc"]]
+  , ["?***?****", ["abc"], null, ["abc"]]
+  , ["*******c", ["abc"], null, ["abc"]]
+  , ["*******?", ["abc"], null, ["abc"]]
+  , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+  , ["[-abc]", ["-"], null, ["-"]]
+  , ["[abc-]", ["-"], null, ["-"]]
+  , ["\\", ["\\"], null, ["\\"]]
+  , ["[\\\\]", ["\\"], null, ["\\"]]
+  , ["[[]", ["["], null, ["["]]
+  , ["[", ["["], null, ["["]]
+  , ["[*", ["[abc"], null, ["[abc"]]
+  , "a right bracket shall lose its special meaning and\n" +
+    "represent itself in a bracket expression if it occurs\n" +
+    "first in the list.  -- POSIX.2 2.8.3.2"
+  , ["[]]", ["]"], null, ["]"]]
+  , ["[]-]", ["]"], null, ["]"]]
+  , ["[a-\z]", ["p"], null, ["p"]]
+  , ["??**********?****?", [], { null: true }, ["abc"]]
+  , ["??**********?****c", [], { null: true }, ["abc"]]
+  , ["?************c****?****", [], { null: true }, ["abc"]]
+  , ["*c*?**", [], { null: true }, ["abc"]]
+  , ["a*****c*?**", [], { null: true }, ["abc"]]
+  , ["a********???*******", [], { null: true }, ["abc"]]
+  , ["[]", [], { null: true }, ["a"]]
+  , ["[abc", [], { null: true }, ["["]]
+
+  , "nocase tests"
+  , ["XYZ", ["xYz"], { nocase: true, null: true }
+    , ["xYz", "ABC", "IjK"]]
+  , ["ab*", ["ABC"], { nocase: true, null: true }
+    , ["xYz", "ABC", "IjK"]]
+  , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true }
+    , ["xYz", "ABC", "IjK"]]
+
+  // [ pattern, [matches], MM opts, files, TAP opts]
+  , "onestar/twostar"
+  , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]]
+  , ["{/?,*}", ["/a", "bb"], {null: true}
+    , ["/a", "/b/b", "/a/b/c", "bb"]]
+
+  , "dots should not match unless requested"
+  , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]]
+
+  // .. and . can only match patterns starting with .,
+  // even when options.dot is set.
+  , function () {
+      files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"]
+    }
+  , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}]
+  , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}]
+  , ["a/*/b", ["a/c/b"], {dot:false}]
+  , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}]
+
+
+  // this also tests that changing the options needs
+  // to change the cache key, even if the pattern is
+  // the same!
+  , ["**", ["a/b","a/.d",".a/.d"], { dot: true }
+    , [ ".a/.d", "a/.d", "a/b"]]
+
+  , "paren sets cannot contain slashes"
+  , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]]
+
+  // brace sets trump all else.
+  //
+  // invalid glob pattern.  fails on bash4 and bsdglob.
+  // however, in this implementation, it's easier just
+  // to do the intuitive thing, and let brace-expansion
+  // actually come before parsing any extglob patterns,
+  // like the documentation seems to say.
+  //
+  // XXX: if anyone complains about this, either fix it
+  // or tell them to grow up and stop complaining.
+  //
+  // bash/bsdglob says this:
+  // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]]
+  // but we do this instead:
+  , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]]
+
+  // test partial parsing in the presence of comment/negation chars
+  , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]]
+  , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]]
+
+  // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped.
+  , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g"
+    , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"]
+    , {}
+    , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]]
+
+
+  // crazy nested {,,} and *(||) tests.
+  , function () {
+      files = [ "a", "b", "c", "d"
+              , "ab", "ac", "ad"
+              , "bc", "cb"
+              , "bc,d", "c,db", "c,d"
+              , "d)", "(b|c", "*(b|c"
+              , "b|c", "b|cc", "cb|c"
+              , "x(a|b|c)", "x(a|c)"
+              , "(a|b|c)", "(a|c)"]
+    }
+  , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]]
+  , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]]
+  // a
+  // *(b|c)
+  // *(b|d)
+  , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]]
+  , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]]
+
+
+  // test various flag settings.
+  , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"]
+    , { noext: true } ]
+  , ["a?b", ["x/y/acb", "acb/"], {matchBase: true}
+    , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ]
+  , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]]
+
+
+  // begin channelling Boole and deMorgan...
+  , "negation tests"
+  , function () {
+      files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"]
+    }
+
+  // anything that is NOT a* matches.
+  , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]]
+
+  // anything that IS !a* matches.
+  , ["!a*", ["!ab", "!abc"], {nonegate: true}]
+
+  // anything that IS a* matches
+  , ["!!a*", ["a!b"]]
+
+  // anything that is NOT !a* matches
+  , ["!\\!a*", ["a!b", "d", "e", "\\!a"]]
+
+  // negation nestled within a pattern
+  , function () {
+      files = [ "foo.js"
+              , "foo.bar"
+              // can't match this one without negative lookbehind.
+              , "foo.js.js"
+              , "blar.js"
+              , "foo."
+              , "boo.js.boo" ]
+    }
+  , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ]
+
+  // https://github.com/isaacs/minimatch/issues/5
+  , function () {
+      files = [ 'a/b/.x/c'
+              , 'a/b/.x/c/d'
+              , 'a/b/.x/c/d/e'
+              , 'a/b/.x'
+              , 'a/b/.x/'
+              , 'a/.x/b'
+              , '.x'
+              , '.x/'
+              , '.x/a'
+              , '.x/a/b'
+              , 'a/.x/b/.x/c'
+              , '.x/.x' ]
+  }
+  , ["**/.x/**", [ '.x/'
+                 , '.x/a'
+                 , '.x/a/b'
+                 , 'a/.x/b'
+                 , 'a/b/.x/'
+                 , 'a/b/.x/c'
+                 , 'a/b/.x/c/d'
+                 , 'a/b/.x/c/d/e' ] ]
+
+  ]
+
+var regexps =
+  [ '/^(?:(?=.)a[^/]*?)$/',
+    '/^(?:(?=.)X[^/]*?)$/',
+    '/^(?:(?=.)X[^/]*?)$/',
+    '/^(?:\\*)$/',
+    '/^(?:(?=.)\\*[^/]*?)$/',
+    '/^(?:\\*\\*)$/',
+    '/^(?:(?=.)b[^/]*?\\/)$/',
+    '/^(?:(?=.)c[^/]*?)$/',
+    '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/',
+    '/^(?:\\.\\.\\/(?!\\.)(?=.)[^/]*?\\/)$/',
+    '/^(?:s\\/(?=.)\\.\\.[^/]*?\\/)$/',
+    '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/1\\/)$/',
+    '/^(?:\\/\\^root:\\/\\{s\\/(?=.)\\^[^:][^/]*?:[^:][^/]*?:\\([^:]\\)[^/]*?\\.[^/]*?\\$\\/\u0001\\/)$/',
+    '/^(?:(?!\\.)(?=.)[a-c]b[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[a-y][^/]*?[^c])$/',
+    '/^(?:(?=.)a[^/]*?[^c])$/',
+    '/^(?:(?=.)a[X-]b)$/',
+    '/^(?:(?!\\.)(?=.)[^a-c][^/]*?)$/',
+    '/^(?:a\\*b\\/(?!\\.)(?=.)[^/]*?)$/',
+    '/^(?:(?=.)a\\*[^/]\\/(?!\\.)(?=.)[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\\\\\![^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\![^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\.\\*)$/',
+    '/^(?:(?=.)a[b]c)$/',
+    '/^(?:(?=.)a[b]c)$/',
+    '/^(?:(?=.)a[^/]c)$/',
+    '/^(?:a\\*c)$/',
+    'false',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\/(?=.)man[^/]*?\\/(?=.)bash\\.[^/]*?)$/',
+    '/^(?:man\\/man1\\/bash\\.1)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?c)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/])$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]c)$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/])$/',
+    '/^(?:(?=.)a[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/]k[^/]*?[^/]*?[^/]*?)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/][^/]*?[^/]*?cd[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?k[^/]*?[^/]*?)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[-abc])$/',
+    '/^(?:(?!\\.)(?=.)[abc-])$/',
+    '/^(?:\\\\)$/',
+    '/^(?:(?!\\.)(?=.)[\\\\])$/',
+    '/^(?:(?!\\.)(?=.)[\\[])$/',
+    '/^(?:\\[)$/',
+    '/^(?:(?=.)\\[(?!\\.)(?=.)[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[\\]])$/',
+    '/^(?:(?!\\.)(?=.)[\\]-])$/',
+    '/^(?:(?!\\.)(?=.)[a-z])$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/])$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?c)$/',
+    '/^(?:(?!\\.)(?=.)[^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/]*?[^/]*?[^/]*?[^/]*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?c[^/]*?[^/][^/]*?[^/]*?)$/',
+    '/^(?:(?=.)a[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/][^/][^/][^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?[^/]*?)$/',
+    '/^(?:\\[\\])$/',
+    '/^(?:\\[abc)$/',
+    '/^(?:(?=.)XYZ)$/i',
+    '/^(?:(?=.)ab[^/]*?)$/i',
+    '/^(?:(?!\\.)(?=.)[ia][^/][ck])$/i',
+    '/^(?:\\/(?!\\.)(?=.)[^/]*?|(?!\\.)(?=.)[^/]*?)$/',
+    '/^(?:\\/(?!\\.)(?=.)[^/]|(?!\\.)(?=.)[^/]*?)$/',
+    '/^(?:(?:(?!(?:\\/|^)\\.).)*?)$/',
+    '/^(?:a\\/(?!(?:^|\\/)\\.{1,2}(?:$|\\/))(?=.)[^/]*?\\/b)$/',
+    '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/',
+    '/^(?:a\\/(?!\\.)(?=.)[^/]*?\\/b)$/',
+    '/^(?:a\\/(?=.)\\.[^/]*?\\/b)$/',
+    '/^(?:(?:(?!(?:\\/|^)(?:\\.{1,2})($|\\/)).)*?)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\/b\\))$/',
+    '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/',
+    '/^(?:(?=.)\\[(?=.)\\!a[^/]*?)$/',
+    '/^(?:(?=.)\\[(?=.)#a[^/]*?)$/',
+    '/^(?:(?=.)\\+\\(a\\|[^/]*?\\|c\\\\\\\\\\|d\\\\\\\\\\|e\\\\\\\\\\\\\\\\\\|f\\\\\\\\\\\\\\\\\\|g)$/',
+    '/^(?:(?!\\.)(?=.)(?:a|b)*|(?!\\.)(?=.)(?:a|c)*)$/',
+    '/^(?:a|(?!\\.)(?=.)[^/]*?\\(b\\|c|d\\))$/',
+    '/^(?:a|(?!\\.)(?=.)(?:b|c)*|(?!\\.)(?=.)(?:b|d)*)$/',
+    '/^(?:(?!\\.)(?=.)(?:a|b|c)*|(?!\\.)(?=.)(?:a|c)*)$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\(a\\|b\\|c\\)|(?!\\.)(?=.)[^/]*?\\(a\\|c\\))$/',
+    '/^(?:(?=.)a[^/]b)$/',
+    '/^(?:(?=.)#[^/]*?)$/',
+    '/^(?!^(?:(?=.)a[^/]*?)$).*$/',
+    '/^(?:(?=.)\\!a[^/]*?)$/',
+    '/^(?:(?=.)a[^/]*?)$/',
+    '/^(?!^(?:(?=.)\\!a[^/]*?)$).*$/',
+    '/^(?:(?!\\.)(?=.)[^/]*?\\.(?:(?!js)[^/]*?))$/',
+    '/^(?:(?:(?!(?:\\/|^)\\.).)*?\\/\\.x\\/(?:(?!(?:\\/|^)\\.).)*?)$/' ]
+var re = 0;
+
+tap.test("basic tests", function (t) {
+  var start = Date.now()
+
+  // [ pattern, [matches], MM opts, files, TAP opts]
+  patterns.forEach(function (c) {
+    if (typeof c === "function") return c()
+    if (typeof c === "string") return t.comment(c)
+
+    var pattern = c[0]
+      , expect = c[1].sort(alpha)
+      , options = c[2] || {}
+      , f = c[3] || files
+      , tapOpts = c[4] || {}
+
+    // options.debug = true
+    var m = new mm.Minimatch(pattern, options)
+    var r = m.makeRe()
+    var expectRe = regexps[re++]
+    tapOpts.re = String(r) || JSON.stringify(r)
+    tapOpts.files = JSON.stringify(f)
+    tapOpts.pattern = pattern
+    tapOpts.set = m.set
+    tapOpts.negated = m.negate
+
+    var actual = mm.match(f, pattern, options)
+    actual.sort(alpha)
+
+    t.equivalent( actual, expect
+                , JSON.stringify(pattern) + " " + JSON.stringify(expect)
+                , tapOpts )
+
+    t.equal(tapOpts.re, expectRe, tapOpts)
+  })
+
+  t.comment("time=" + (Date.now() - start) + "ms")
+  t.end()
+})
+
+tap.test("global leak test", function (t) {
+  var globalAfter = Object.keys(global)
+  t.equivalent(globalAfter, globalBefore, "no new globals, please")
+  t.end()
+})
+
+function alpha (a, b) {
+  return a > b ? 1 : -1
+}
diff --git a/node_modules/minimatch/test/brace-expand.js b/node_modules/minimatch/test/brace-expand.js
new file mode 100644
index 0000000..7ee278a
--- /dev/null
+++ b/node_modules/minimatch/test/brace-expand.js
@@ -0,0 +1,33 @@
+var tap = require("tap")
+  , minimatch = require("../")
+
+tap.test("brace expansion", function (t) {
+  // [ pattern, [expanded] ]
+  ; [ [ "a{b,c{d,e},{f,g}h}x{y,z}"
+      , [ "abxy"
+        , "abxz"
+        , "acdxy"
+        , "acdxz"
+        , "acexy"
+        , "acexz"
+        , "afhxy"
+        , "afhxz"
+        , "aghxy"
+        , "aghxz" ] ]
+    , [ "a{1..5}b"
+      , [ "a1b"
+        , "a2b"
+        , "a3b"
+        , "a4b"
+        , "a5b" ] ]
+    , [ "a{b}c", ["a{b}c"] ]
+  ].forEach(function (tc) {
+    var p = tc[0]
+      , expect = tc[1]
+    t.equivalent(minimatch.braceExpand(p), expect, p)
+  })
+  console.error("ending")
+  t.end()
+})
+
+
diff --git a/node_modules/minimatch/test/caching.js b/node_modules/minimatch/test/caching.js
new file mode 100644
index 0000000..0fec4b0
--- /dev/null
+++ b/node_modules/minimatch/test/caching.js
@@ -0,0 +1,14 @@
+var Minimatch = require("../minimatch.js").Minimatch
+var tap = require("tap")
+tap.test("cache test", function (t) {
+  var mm1 = new Minimatch("a?b")
+  var mm2 = new Minimatch("a?b")
+  t.equal(mm1, mm2, "should get the same object")
+  // the lru should drop it after 100 entries
+  for (var i = 0; i < 100; i ++) {
+    new Minimatch("a"+i)
+  }
+  mm2 = new Minimatch("a?b")
+  t.notEqual(mm1, mm2, "cache should have dropped")
+  t.end()
+})
diff --git a/node_modules/minimatch/test/defaults.js b/node_modules/minimatch/test/defaults.js
new file mode 100644
index 0000000..75e0571
--- /dev/null
+++ b/node_modules/minimatch/test/defaults.js
@@ -0,0 +1,274 @@
+// http://www.bashcookbook.com/bashinfo/source/bash-1.14.7/tests/glob-test
+//
+// TODO: Some of these tests do very bad things with backslashes, and will
+// most likely fail badly on windows.  They should probably be skipped.
+
+var tap = require("tap")
+  , globalBefore = Object.keys(global)
+  , mm = require("../")
+  , files = [ "a", "b", "c", "d", "abc"
+            , "abd", "abe", "bb", "bcd"
+            , "ca", "cb", "dd", "de"
+            , "bdir/", "bdir/cfile"]
+  , next = files.concat([ "a-b", "aXb"
+                        , ".x", ".y" ])
+
+tap.test("basic tests", function (t) {
+  var start = Date.now()
+
+  // [ pattern, [matches], MM opts, files, TAP opts]
+  ; [ "http://www.bashcookbook.com/bashinfo" +
+      "/source/bash-1.14.7/tests/glob-test"
+    , ["a*", ["a", "abc", "abd", "abe"]]
+    , ["X*", ["X*"], {nonull: true}]
+
+    // allow null glob expansion
+    , ["X*", []]
+
+    // isaacs: Slightly different than bash/sh/ksh
+    // \\* is not un-escaped to literal "*" in a failed match,
+    // but it does make it get treated as a literal star
+    , ["\\*", ["\\*"], {nonull: true}]
+    , ["\\**", ["\\**"], {nonull: true}]
+    , ["\\*\\*", ["\\*\\*"], {nonull: true}]
+
+    , ["b*/", ["bdir/"]]
+    , ["c*", ["c", "ca", "cb"]]
+    , ["**", files]
+
+    , ["\\.\\./*/", ["\\.\\./*/"], {nonull: true}]
+    , ["s/\\..*//", ["s/\\..*//"], {nonull: true}]
+
+    , "legendary larry crashes bashes"
+    , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"
+      , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\\1/"], {nonull: true}]
+    , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"
+      , ["/^root:/{s/^[^:]*:[^:]*:\([^:]*\).*$/\1/"], {nonull: true}]
+
+    , "character classes"
+    , ["[a-c]b*", ["abc", "abd", "abe", "bb", "cb"]]
+    , ["[a-y]*[^c]", ["abd", "abe", "bb", "bcd",
+       "bdir/", "ca", "cb", "dd", "de"]]
+    , ["a*[^c]", ["abd", "abe"]]
+    , function () { files.push("a-b", "aXb") }
+    , ["a[X-]b", ["a-b", "aXb"]]
+    , function () { files.push(".x", ".y") }
+    , ["[^a-c]*", ["d", "dd", "de"]]
+    , function () { files.push("a*b/", "a*b/ooo") }
+    , ["a\\*b/*", ["a*b/ooo"]]
+    , ["a\\*?/*", ["a*b/ooo"]]
+    , ["*\\\\!*", [], {null: true}, ["echo !7"]]
+    , ["*\\!*", ["echo !7"], null, ["echo !7"]]
+    , ["*.\\*", ["r.*"], null, ["r.*"]]
+    , ["a[b]c", ["abc"]]
+    , ["a[\\b]c", ["abc"]]
+    , ["a?c", ["abc"]]
+    , ["a\\*c", [], {null: true}, ["abc"]]
+    , ["", [""], { null: true }, [""]]
+
+    , "http://www.opensource.apple.com/source/bash/bash-23/" +
+      "bash/tests/glob-test"
+    , function () { files.push("man/", "man/man1/", "man/man1/bash.1") }
+    , ["*/man*/bash.*", ["man/man1/bash.1"]]
+    , ["man/man1/bash.1", ["man/man1/bash.1"]]
+    , ["a***c", ["abc"], null, ["abc"]]
+    , ["a*****?c", ["abc"], null, ["abc"]]
+    , ["?*****??", ["abc"], null, ["abc"]]
+    , ["*****??", ["abc"], null, ["abc"]]
+    , ["?*****?c", ["abc"], null, ["abc"]]
+    , ["?***?****c", ["abc"], null, ["abc"]]
+    , ["?***?****?", ["abc"], null, ["abc"]]
+    , ["?***?****", ["abc"], null, ["abc"]]
+    , ["*******c", ["abc"], null, ["abc"]]
+    , ["*******?", ["abc"], null, ["abc"]]
+    , ["a*cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["a**?**cd**?**??k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["a**?**cd**?**??k***", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["a**?**cd**?**??***k", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["a**?**cd**?**??***k**", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["a****c**?**??*****", ["abcdecdhjk"], null, ["abcdecdhjk"]]
+    , ["[-abc]", ["-"], null, ["-"]]
+    , ["[abc-]", ["-"], null, ["-"]]
+    , ["\\", ["\\"], null, ["\\"]]
+    , ["[\\\\]", ["\\"], null, ["\\"]]
+    , ["[[]", ["["], null, ["["]]
+    , ["[", ["["], null, ["["]]
+    , ["[*", ["[abc"], null, ["[abc"]]
+    , "a right bracket shall lose its special meaning and\n" +
+      "represent itself in a bracket expression if it occurs\n" +
+      "first in the list.  -- POSIX.2 2.8.3.2"
+    , ["[]]", ["]"], null, ["]"]]
+    , ["[]-]", ["]"], null, ["]"]]
+    , ["[a-\z]", ["p"], null, ["p"]]
+    , ["??**********?****?", [], { null: true }, ["abc"]]
+    , ["??**********?****c", [], { null: true }, ["abc"]]
+    , ["?************c****?****", [], { null: true }, ["abc"]]
+    , ["*c*?**", [], { null: true }, ["abc"]]
+    , ["a*****c*?**", [], { null: true }, ["abc"]]
+    , ["a********???*******", [], { null: true }, ["abc"]]
+    , ["[]", [], { null: true }, ["a"]]
+    , ["[abc", [], { null: true }, ["["]]
+
+    , "nocase tests"
+    , ["XYZ", ["xYz"], { nocase: true, null: true }
+      , ["xYz", "ABC", "IjK"]]
+    , ["ab*", ["ABC"], { nocase: true, null: true }
+      , ["xYz", "ABC", "IjK"]]
+    , ["[ia]?[ck]", ["ABC", "IjK"], { nocase: true, null: true }
+      , ["xYz", "ABC", "IjK"]]
+
+    // [ pattern, [matches], MM opts, files, TAP opts]
+    , "onestar/twostar"
+    , ["{/*,*}", [], {null: true}, ["/asdf/asdf/asdf"]]
+    , ["{/?,*}", ["/a", "bb"], {null: true}
+      , ["/a", "/b/b", "/a/b/c", "bb"]]
+
+    , "dots should not match unless requested"
+    , ["**", ["a/b"], {}, ["a/b", "a/.d", ".a/.d"]]
+
+    // .. and . can only match patterns starting with .,
+    // even when options.dot is set.
+    , function () {
+        files = ["a/./b", "a/../b", "a/c/b", "a/.d/b"]
+      }
+    , ["a/*/b", ["a/c/b", "a/.d/b"], {dot: true}]
+    , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: true}]
+    , ["a/*/b", ["a/c/b"], {dot:false}]
+    , ["a/.*/b", ["a/./b", "a/../b", "a/.d/b"], {dot: false}]
+
+
+    // this also tests that changing the options needs
+    // to change the cache key, even if the pattern is
+    // the same!
+    , ["**", ["a/b","a/.d",".a/.d"], { dot: true }
+      , [ ".a/.d", "a/.d", "a/b"]]
+
+    , "paren sets cannot contain slashes"
+    , ["*(a/b)", ["*(a/b)"], {nonull: true}, ["a/b"]]
+
+    // brace sets trump all else.
+    //
+    // invalid glob pattern.  fails on bash4 and bsdglob.
+    // however, in this implementation, it's easier just
+    // to do the intuitive thing, and let brace-expansion
+    // actually come before parsing any extglob patterns,
+    // like the documentation seems to say.
+    //
+    // XXX: if anyone complains about this, either fix it
+    // or tell them to grow up and stop complaining.
+    //
+    // bash/bsdglob says this:
+    // , ["*(a|{b),c)}", ["*(a|{b),c)}"], {}, ["a", "ab", "ac", "ad"]]
+    // but we do this instead:
+    , ["*(a|{b),c)}", ["a", "ab", "ac"], {}, ["a", "ab", "ac", "ad"]]
+
+    // test partial parsing in the presence of comment/negation chars
+    , ["[!a*", ["[!ab"], {}, ["[!ab", "[ab"]]
+    , ["[#a*", ["[#ab"], {}, ["[#ab", "[ab"]]
+
+    // like: {a,b|c\\,d\\\|e} except it's unclosed, so it has to be escaped.
+    , ["+(a|*\\|c\\\\|d\\\\\\|e\\\\\\\\|f\\\\\\\\\\|g"
+      , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g"]
+      , {}
+      , ["+(a|b\\|c\\\\|d\\\\|e\\\\\\\\|f\\\\\\\\|g", "a", "b\\c"]]
+
+
+    // crazy nested {,,} and *(||) tests.
+    , function () {
+        files = [ "a", "b", "c", "d"
+                , "ab", "ac", "ad"
+                , "bc", "cb"
+                , "bc,d", "c,db", "c,d"
+                , "d)", "(b|c", "*(b|c"
+                , "b|c", "b|cc", "cb|c"
+                , "x(a|b|c)", "x(a|c)"
+                , "(a|b|c)", "(a|c)"]
+      }
+    , ["*(a|{b,c})", ["a", "b", "c", "ab", "ac"]]
+    , ["{a,*(b|c,d)}", ["a","(b|c", "*(b|c", "d)"]]
+    // a
+    // *(b|c)
+    // *(b|d)
+    , ["{a,*(b|{c,d})}", ["a","b", "bc", "cb", "c", "d"]]
+    , ["*(a|{b|c,c})", ["a", "b", "c", "ab", "ac", "bc", "cb"]]
+
+
+    // test various flag settings.
+    , [ "*(a|{b|c,c})", ["x(a|b|c)", "x(a|c)", "(a|b|c)", "(a|c)"]
+      , { noext: true } ]
+    , ["a?b", ["x/y/acb", "acb/"], {matchBase: true}
+      , ["x/y/acb", "acb/", "acb/d/e", "x/y/acb/d"] ]
+    , ["#*", ["#a", "#b"], {nocomment: true}, ["#a", "#b", "c#d"]]
+
+
+    // begin channelling Boole and deMorgan...
+    , "negation tests"
+    , function () {
+        files = ["d", "e", "!ab", "!abc", "a!b", "\\!a"]
+      }
+
+    // anything that is NOT a* matches.
+    , ["!a*", ["\\!a", "d", "e", "!ab", "!abc"]]
+
+    // anything that IS !a* matches.
+    , ["!a*", ["!ab", "!abc"], {nonegate: true}]
+
+    // anything that IS a* matches
+    , ["!!a*", ["a!b"]]
+
+    // anything that is NOT !a* matches
+    , ["!\\!a*", ["a!b", "d", "e", "\\!a"]]
+
+    // negation nestled within a pattern
+    , function () {
+        files = [ "foo.js"
+                , "foo.bar"
+                // can't match this one without negative lookbehind.
+                , "foo.js.js"
+                , "blar.js"
+                , "foo."
+                , "boo.js.boo" ]
+      }
+    , ["*.!(js)", ["foo.bar", "foo.", "boo.js.boo"] ]
+
+    ].forEach(function (c) {
+      if (typeof c === "function") return c()
+      if (typeof c === "string") return t.comment(c)
+
+      var pattern = c[0]
+        , expect = c[1].sort(alpha)
+        , options = c[2]
+        , f = c[3] || files
+        , tapOpts = c[4] || {}
+
+      // options.debug = true
+      var Class = mm.defaults(options).Minimatch
+      var m = new Class(pattern, {})
+      var r = m.makeRe()
+      tapOpts.re = String(r) || JSON.stringify(r)
+      tapOpts.files = JSON.stringify(f)
+      tapOpts.pattern = pattern
+      tapOpts.set = m.set
+      tapOpts.negated = m.negate
+
+      var actual = mm.match(f, pattern, options)
+      actual.sort(alpha)
+
+      t.equivalent( actual, expect
+                  , JSON.stringify(pattern) + " " + JSON.stringify(expect)
+                  , tapOpts )
+    })
+
+  t.comment("time=" + (Date.now() - start) + "ms")
+  t.end()
+})
+
+tap.test("global leak test", function (t) {
+  var globalAfter = Object.keys(global)
+  t.equivalent(globalAfter, globalBefore, "no new globals, please")
+  t.end()
+})
+
+function alpha (a, b) {
+  return a > b ? 1 : -1
+}
diff --git a/node_modules/minimatch/test/extglob-ending-with-state-char.js b/node_modules/minimatch/test/extglob-ending-with-state-char.js
new file mode 100644
index 0000000..6676e26
--- /dev/null
+++ b/node_modules/minimatch/test/extglob-ending-with-state-char.js
@@ -0,0 +1,8 @@
+var test = require('tap').test
+var minimatch = require('../')
+
+test('extglob ending with statechar', function(t) {
+  t.notOk(minimatch('ax', 'a?(b*)'))
+  t.ok(minimatch('ax', '?(a*|b)'))
+  t.end()
+})
diff --git a/node_modules/minimist/.travis.yml b/node_modules/minimist/.travis.yml
new file mode 100644
index 0000000..cc4dba2
--- /dev/null
+++ b/node_modules/minimist/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+  - "0.8"
+  - "0.10"
diff --git a/node_modules/minimist/LICENSE b/node_modules/minimist/LICENSE
new file mode 100644
index 0000000..ee27ba4
--- /dev/null
+++ b/node_modules/minimist/LICENSE
@@ -0,0 +1,18 @@
+This software is released under the MIT license:
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/minimist/example/parse.js b/node_modules/minimist/example/parse.js
new file mode 100644
index 0000000..abff3e8
--- /dev/null
+++ b/node_modules/minimist/example/parse.js
@@ -0,0 +1,2 @@
+var argv = require('../')(process.argv.slice(2));
+console.dir(argv);
diff --git a/node_modules/minimist/index.js b/node_modules/minimist/index.js
new file mode 100644
index 0000000..584f551
--- /dev/null
+++ b/node_modules/minimist/index.js
@@ -0,0 +1,187 @@
+module.exports = function (args, opts) {
+    if (!opts) opts = {};
+    
+    var flags = { bools : {}, strings : {} };
+    
+    [].concat(opts['boolean']).filter(Boolean).forEach(function (key) {
+        flags.bools[key] = true;
+    });
+    
+    [].concat(opts.string).filter(Boolean).forEach(function (key) {
+        flags.strings[key] = true;
+    });
+    
+    var aliases = {};
+    Object.keys(opts.alias || {}).forEach(function (key) {
+        aliases[key] = [].concat(opts.alias[key]);
+        aliases[key].forEach(function (x) {
+            aliases[x] = [key].concat(aliases[key].filter(function (y) {
+                return x !== y;
+            }));
+        });
+    });
+    
+    var defaults = opts['default'] || {};
+    
+    var argv = { _ : [] };
+    Object.keys(flags.bools).forEach(function (key) {
+        setArg(key, defaults[key] === undefined ? false : defaults[key]);
+    });
+    
+    var notFlags = [];
+
+    if (args.indexOf('--') !== -1) {
+        notFlags = args.slice(args.indexOf('--')+1);
+        args = args.slice(0, args.indexOf('--'));
+    }
+
+    function setArg (key, val) {
+        var value = !flags.strings[key] && isNumber(val)
+            ? Number(val) : val
+        ;
+        setKey(argv, key.split('.'), value);
+        
+        (aliases[key] || []).forEach(function (x) {
+            setKey(argv, x.split('.'), value);
+        });
+    }
+    
+    for (var i = 0; i < args.length; i++) {
+        var arg = args[i];
+        
+        if (/^--.+=/.test(arg)) {
+            // Using [\s\S] instead of . because js doesn't support the
+            // 'dotall' regex modifier. See:
+            // http://stackoverflow.com/a/1068308/13216
+            var m = arg.match(/^--([^=]+)=([\s\S]*)$/);
+            setArg(m[1], m[2]);
+        }
+        else if (/^--no-.+/.test(arg)) {
+            var key = arg.match(/^--no-(.+)/)[1];
+            setArg(key, false);
+        }
+        else if (/^--.+/.test(arg)) {
+            var key = arg.match(/^--(.+)/)[1];
+            var next = args[i + 1];
+            if (next !== undefined && !/^-/.test(next)
+            && !flags.bools[key]
+            && (aliases[key] ? !flags.bools[aliases[key]] : true)) {
+                setArg(key, next);
+                i++;
+            }
+            else if (/^(true|false)$/.test(next)) {
+                setArg(key, next === 'true');
+                i++;
+            }
+            else {
+                setArg(key, flags.strings[key] ? '' : true);
+            }
+        }
+        else if (/^-[^-]+/.test(arg)) {
+            var letters = arg.slice(1,-1).split('');
+            
+            var broken = false;
+            for (var j = 0; j < letters.length; j++) {
+                var next = arg.slice(j+2);
+                
+                if (next === '-') {
+                    setArg(letters[j], next)
+                    continue;
+                }
+                
+                if (/[A-Za-z]/.test(letters[j])
+                && /-?\d+(\.\d*)?(e-?\d+)?$/.test(next)) {
+                    setArg(letters[j], next);
+                    broken = true;
+                    break;
+                }
+                
+                if (letters[j+1] && letters[j+1].match(/\W/)) {
+                    setArg(letters[j], arg.slice(j+2));
+                    broken = true;
+                    break;
+                }
+                else {
+                    setArg(letters[j], flags.strings[letters[j]] ? '' : true);
+                }
+            }
+            
+            var key = arg.slice(-1)[0];
+            if (!broken && key !== '-') {
+                if (args[i+1] && !/^(-|--)[^-]/.test(args[i+1])
+                && !flags.bools[key]
+                && (aliases[key] ? !flags.bools[aliases[key]] : true)) {
+                    setArg(key, args[i+1]);
+                    i++;
+                }
+                else if (args[i+1] && /true|false/.test(args[i+1])) {
+                    setArg(key, args[i+1] === 'true');
+                    i++;
+                }
+                else {
+                    setArg(key, flags.strings[key] ? '' : true);
+                }
+            }
+        }
+        else {
+            argv._.push(
+                flags.strings['_'] || !isNumber(arg) ? arg : Number(arg)
+            );
+        }
+    }
+    
+    Object.keys(defaults).forEach(function (key) {
+        if (!hasKey(argv, key.split('.'))) {
+            setKey(argv, key.split('.'), defaults[key]);
+            
+            (aliases[key] || []).forEach(function (x) {
+                setKey(argv, x.split('.'), defaults[key]);
+            });
+        }
+    });
+    
+    notFlags.forEach(function(key) {
+        argv._.push(key);
+    });
+
+    return argv;
+};
+
+function hasKey (obj, keys) {
+    var o = obj;
+    keys.slice(0,-1).forEach(function (key) {
+        o = (o[key] || {});
+    });
+
+    var key = keys[keys.length - 1];
+    return key in o;
+}
+
+function setKey (obj, keys, value) {
+    var o = obj;
+    keys.slice(0,-1).forEach(function (key) {
+        if (o[key] === undefined) o[key] = {};
+        o = o[key];
+    });
+    
+    var key = keys[keys.length - 1];
+    if (o[key] === undefined || typeof o[key] === 'boolean') {
+        o[key] = value;
+    }
+    else if (Array.isArray(o[key])) {
+        o[key].push(value);
+    }
+    else {
+        o[key] = [ o[key], value ];
+    }
+}
+
+function isNumber (x) {
+    if (typeof x === 'number') return true;
+    if (/^0x[0-9a-f]+$/i.test(x)) return true;
+    return /^[-+]?(?:\d+(?:\.\d*)?|\.\d+)(e[-+]?\d+)?$/.test(x);
+}
+
+function longest (xs) {
+    return Math.max.apply(null, xs.map(function (x) { return x.length }));
+}
diff --git a/node_modules/minimist/package.json b/node_modules/minimist/package.json
new file mode 100644
index 0000000..bbca973
--- /dev/null
+++ b/node_modules/minimist/package.json
@@ -0,0 +1,71 @@
+{
+  "_from": "minimist@0.0.8",
+  "_id": "minimist@0.0.8",
+  "_inBundle": false,
+  "_integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=",
+  "_location": "/minimist",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "minimist@0.0.8",
+    "name": "minimist",
+    "escapedName": "minimist",
+    "rawSpec": "0.0.8",
+    "saveSpec": null,
+    "fetchSpec": "0.0.8"
+  },
+  "_requiredBy": [
+    "/mkdirp"
+  ],
+  "_resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
+  "_shasum": "857fcabfc3397d2625b8228262e86aa7a011b05d",
+  "_spec": "minimist@0.0.8",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mkdirp",
+  "author": {
+    "name": "James Halliday",
+    "email": "mail@substack.net",
+    "url": "http://substack.net"
+  },
+  "bugs": {
+    "url": "https://github.com/substack/minimist/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "parse argument options",
+  "devDependencies": {
+    "tap": "~0.4.0",
+    "tape": "~1.0.4"
+  },
+  "homepage": "https://github.com/substack/minimist",
+  "keywords": [
+    "argv",
+    "getopt",
+    "parser",
+    "optimist"
+  ],
+  "license": "MIT",
+  "main": "index.js",
+  "name": "minimist",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/substack/minimist.git"
+  },
+  "scripts": {
+    "test": "tap test/*.js"
+  },
+  "testling": {
+    "files": "test/*.js",
+    "browsers": [
+      "ie/6..latest",
+      "ff/5",
+      "firefox/latest",
+      "chrome/10",
+      "chrome/latest",
+      "safari/5.1",
+      "safari/latest",
+      "opera/12"
+    ]
+  },
+  "version": "0.0.8"
+}
diff --git a/node_modules/minimist/readme.markdown b/node_modules/minimist/readme.markdown
new file mode 100644
index 0000000..c256353
--- /dev/null
+++ b/node_modules/minimist/readme.markdown
@@ -0,0 +1,73 @@
+# minimist
+
+parse argument options
+
+This module is the guts of optimist's argument parser without all the
+fanciful decoration.
+
+[![browser support](https://ci.testling.com/substack/minimist.png)](http://ci.testling.com/substack/minimist)
+
+[![build status](https://secure.travis-ci.org/substack/minimist.png)](http://travis-ci.org/substack/minimist)
+
+# example
+
+``` js
+var argv = require('minimist')(process.argv.slice(2));
+console.dir(argv);
+```
+
+```
+$ node example/parse.js -a beep -b boop
+{ _: [], a: 'beep', b: 'boop' }
+```
+
+```
+$ node example/parse.js -x 3 -y 4 -n5 -abc --beep=boop foo bar baz
+{ _: [ 'foo', 'bar', 'baz' ],
+  x: 3,
+  y: 4,
+  n: 5,
+  a: true,
+  b: true,
+  c: true,
+  beep: 'boop' }
+```
+
+# methods
+
+``` js
+var parseArgs = require('minimist')
+```
+
+## var argv = parseArgs(args, opts={})
+
+Return an argument object `argv` populated with the array arguments from `args`.
+
+`argv._` contains all the arguments that didn't have an option associated with
+them.
+
+Numeric-looking arguments will be returned as numbers unless `opts.string` or
+`opts.boolean` is set for that argument name.
+
+Any arguments after `'--'` will not be parsed and will end up in `argv._`.
+
+options can be:
+
+* `opts.string` - a string or array of strings argument names to always treat as
+strings
+* `opts.boolean` - a string or array of strings to always treat as booleans
+* `opts.alias` - an object mapping string names to strings or arrays of string
+argument names to use as aliases
+* `opts.default` - an object mapping string argument names to default values
+
+# install
+
+With [npm](https://npmjs.org) do:
+
+```
+npm install minimist
+```
+
+# license
+
+MIT
diff --git a/node_modules/minimist/test/dash.js b/node_modules/minimist/test/dash.js
new file mode 100644
index 0000000..8b034b9
--- /dev/null
+++ b/node_modules/minimist/test/dash.js
@@ -0,0 +1,24 @@
+var parse = require('../');
+var test = require('tape');
+
+test('-', function (t) {
+    t.plan(5);
+    t.deepEqual(parse([ '-n', '-' ]), { n: '-', _: [] });
+    t.deepEqual(parse([ '-' ]), { _: [ '-' ] });
+    t.deepEqual(parse([ '-f-' ]), { f: '-', _: [] });
+    t.deepEqual(
+        parse([ '-b', '-' ], { boolean: 'b' }),
+        { b: true, _: [ '-' ] }
+    );
+    t.deepEqual(
+        parse([ '-s', '-' ], { string: 's' }),
+        { s: '-', _: [] }
+    );
+});
+
+test('-a -- b', function (t) {
+    t.plan(3);
+    t.deepEqual(parse([ '-a', '--', 'b' ]), { a: true, _: [ 'b' ] });
+    t.deepEqual(parse([ '--a', '--', 'b' ]), { a: true, _: [ 'b' ] });
+    t.deepEqual(parse([ '--a', '--', 'b' ]), { a: true, _: [ 'b' ] });
+});
diff --git a/node_modules/minimist/test/default_bool.js b/node_modules/minimist/test/default_bool.js
new file mode 100644
index 0000000..f0041ee
--- /dev/null
+++ b/node_modules/minimist/test/default_bool.js
@@ -0,0 +1,20 @@
+var test = require('tape');
+var parse = require('../');
+
+test('boolean default true', function (t) {
+    var argv = parse([], {
+        boolean: 'sometrue',
+        default: { sometrue: true }
+    });
+    t.equal(argv.sometrue, true);
+    t.end();
+});
+
+test('boolean default false', function (t) {
+    var argv = parse([], {
+        boolean: 'somefalse',
+        default: { somefalse: false }
+    });
+    t.equal(argv.somefalse, false);
+    t.end();
+});
diff --git a/node_modules/minimist/test/dotted.js b/node_modules/minimist/test/dotted.js
new file mode 100644
index 0000000..ef0ae34
--- /dev/null
+++ b/node_modules/minimist/test/dotted.js
@@ -0,0 +1,16 @@
+var parse = require('../');
+var test = require('tape');
+
+test('dotted alias', function (t) {
+    var argv = parse(['--a.b', '22'], {default: {'a.b': 11}, alias: {'a.b': 'aa.bb'}});
+    t.equal(argv.a.b, 22);
+    t.equal(argv.aa.bb, 22);
+    t.end();
+});
+
+test('dotted default', function (t) {
+    var argv = parse('', {default: {'a.b': 11}, alias: {'a.b': 'aa.bb'}});
+    t.equal(argv.a.b, 11);
+    t.equal(argv.aa.bb, 11);
+    t.end();
+});
diff --git a/node_modules/minimist/test/long.js b/node_modules/minimist/test/long.js
new file mode 100644
index 0000000..5d3a1e0
--- /dev/null
+++ b/node_modules/minimist/test/long.js
@@ -0,0 +1,31 @@
+var test = require('tape');
+var parse = require('../');
+
+test('long opts', function (t) {
+    t.deepEqual(
+        parse([ '--bool' ]),
+        { bool : true, _ : [] },
+        'long boolean'
+    );
+    t.deepEqual(
+        parse([ '--pow', 'xixxle' ]),
+        { pow : 'xixxle', _ : [] },
+        'long capture sp'
+    );
+    t.deepEqual(
+        parse([ '--pow=xixxle' ]),
+        { pow : 'xixxle', _ : [] },
+        'long capture eq'
+    );
+    t.deepEqual(
+        parse([ '--host', 'localhost', '--port', '555' ]),
+        { host : 'localhost', port : 555, _ : [] },
+        'long captures sp'
+    );
+    t.deepEqual(
+        parse([ '--host=localhost', '--port=555' ]),
+        { host : 'localhost', port : 555, _ : [] },
+        'long captures eq'
+    );
+    t.end();
+});
diff --git a/node_modules/minimist/test/parse.js b/node_modules/minimist/test/parse.js
new file mode 100644
index 0000000..8a90646
--- /dev/null
+++ b/node_modules/minimist/test/parse.js
@@ -0,0 +1,318 @@
+var parse = require('../');
+var test = require('tape');
+
+test('parse args', function (t) {
+    t.deepEqual(
+        parse([ '--no-moo' ]),
+        { moo : false, _ : [] },
+        'no'
+    );
+    t.deepEqual(
+        parse([ '-v', 'a', '-v', 'b', '-v', 'c' ]),
+        { v : ['a','b','c'], _ : [] },
+        'multi'
+    );
+    t.end();
+});
+ 
+test('comprehensive', function (t) {
+    t.deepEqual(
+        parse([
+            '--name=meowmers', 'bare', '-cats', 'woo',
+            '-h', 'awesome', '--multi=quux',
+            '--key', 'value',
+            '-b', '--bool', '--no-meep', '--multi=baz',
+            '--', '--not-a-flag', 'eek'
+        ]),
+        {
+            c : true,
+            a : true,
+            t : true,
+            s : 'woo',
+            h : 'awesome',
+            b : true,
+            bool : true,
+            key : 'value',
+            multi : [ 'quux', 'baz' ],
+            meep : false,
+            name : 'meowmers',
+            _ : [ 'bare', '--not-a-flag', 'eek' ]
+        }
+    );
+    t.end();
+});
+
+test('nums', function (t) {
+    var argv = parse([
+        '-x', '1234',
+        '-y', '5.67',
+        '-z', '1e7',
+        '-w', '10f',
+        '--hex', '0xdeadbeef',
+        '789'
+    ]);
+    t.deepEqual(argv, {
+        x : 1234,
+        y : 5.67,
+        z : 1e7,
+        w : '10f',
+        hex : 0xdeadbeef,
+        _ : [ 789 ]
+    });
+    t.deepEqual(typeof argv.x, 'number');
+    t.deepEqual(typeof argv.y, 'number');
+    t.deepEqual(typeof argv.z, 'number');
+    t.deepEqual(typeof argv.w, 'string');
+    t.deepEqual(typeof argv.hex, 'number');
+    t.deepEqual(typeof argv._[0], 'number');
+    t.end();
+});
+
+test('flag boolean', function (t) {
+    var argv = parse([ '-t', 'moo' ], { boolean: 't' });
+    t.deepEqual(argv, { t : true, _ : [ 'moo' ] });
+    t.deepEqual(typeof argv.t, 'boolean');
+    t.end();
+});
+
+test('flag boolean value', function (t) {
+    var argv = parse(['--verbose', 'false', 'moo', '-t', 'true'], {
+        boolean: [ 't', 'verbose' ],
+        default: { verbose: true }
+    });
+    
+    t.deepEqual(argv, {
+        verbose: false,
+        t: true,
+        _: ['moo']
+    });
+    
+    t.deepEqual(typeof argv.verbose, 'boolean');
+    t.deepEqual(typeof argv.t, 'boolean');
+    t.end();
+});
+
+test('flag boolean default false', function (t) {
+    var argv = parse(['moo'], {
+        boolean: ['t', 'verbose'],
+        default: { verbose: false, t: false }
+    });
+    
+    t.deepEqual(argv, {
+        verbose: false,
+        t: false,
+        _: ['moo']
+    });
+    
+    t.deepEqual(typeof argv.verbose, 'boolean');
+    t.deepEqual(typeof argv.t, 'boolean');
+    t.end();
+
+});
+
+test('boolean groups', function (t) {
+    var argv = parse([ '-x', '-z', 'one', 'two', 'three' ], {
+        boolean: ['x','y','z']
+    });
+    
+    t.deepEqual(argv, {
+        x : true,
+        y : false,
+        z : true,
+        _ : [ 'one', 'two', 'three' ]
+    });
+    
+    t.deepEqual(typeof argv.x, 'boolean');
+    t.deepEqual(typeof argv.y, 'boolean');
+    t.deepEqual(typeof argv.z, 'boolean');
+    t.end();
+});
+
+test('newlines in params' , function (t) {
+    var args = parse([ '-s', "X\nX" ])
+    t.deepEqual(args, { _ : [], s : "X\nX" });
+    
+    // reproduce in bash:
+    // VALUE="new
+    // line"
+    // node program.js --s="$VALUE"
+    args = parse([ "--s=X\nX" ])
+    t.deepEqual(args, { _ : [], s : "X\nX" });
+    t.end();
+});
+
+test('strings' , function (t) {
+    var s = parse([ '-s', '0001234' ], { string: 's' }).s;
+    t.equal(s, '0001234');
+    t.equal(typeof s, 'string');
+    
+    var x = parse([ '-x', '56' ], { string: 'x' }).x;
+    t.equal(x, '56');
+    t.equal(typeof x, 'string');
+    t.end();
+});
+
+test('stringArgs', function (t) {
+    var s = parse([ '  ', '  ' ], { string: '_' })._;
+    t.same(s.length, 2);
+    t.same(typeof s[0], 'string');
+    t.same(s[0], '  ');
+    t.same(typeof s[1], 'string');
+    t.same(s[1], '  ');
+    t.end();
+});
+
+test('empty strings', function(t) {
+    var s = parse([ '-s' ], { string: 's' }).s;
+    t.equal(s, '');
+    t.equal(typeof s, 'string');
+
+    var str = parse([ '--str' ], { string: 'str' }).str;
+    t.equal(str, '');
+    t.equal(typeof str, 'string');
+
+    var letters = parse([ '-art' ], {
+        string: [ 'a', 't' ]
+    });
+
+    t.equal(letters.a, '');
+    t.equal(letters.r, true);
+    t.equal(letters.t, '');
+
+    t.end();
+});
+
+
+test('slashBreak', function (t) {
+    t.same(
+        parse([ '-I/foo/bar/baz' ]),
+        { I : '/foo/bar/baz', _ : [] }
+    );
+    t.same(
+        parse([ '-xyz/foo/bar/baz' ]),
+        { x : true, y : true, z : '/foo/bar/baz', _ : [] }
+    );
+    t.end();
+});
+
+test('alias', function (t) {
+    var argv = parse([ '-f', '11', '--zoom', '55' ], {
+        alias: { z: 'zoom' }
+    });
+    t.equal(argv.zoom, 55);
+    t.equal(argv.z, argv.zoom);
+    t.equal(argv.f, 11);
+    t.end();
+});
+
+test('multiAlias', function (t) {
+    var argv = parse([ '-f', '11', '--zoom', '55' ], {
+        alias: { z: [ 'zm', 'zoom' ] }
+    });
+    t.equal(argv.zoom, 55);
+    t.equal(argv.z, argv.zoom);
+    t.equal(argv.z, argv.zm);
+    t.equal(argv.f, 11);
+    t.end();
+});
+
+test('nested dotted objects', function (t) {
+    var argv = parse([
+        '--foo.bar', '3', '--foo.baz', '4',
+        '--foo.quux.quibble', '5', '--foo.quux.o_O',
+        '--beep.boop'
+    ]);
+    
+    t.same(argv.foo, {
+        bar : 3,
+        baz : 4,
+        quux : {
+            quibble : 5,
+            o_O : true
+        }
+    });
+    t.same(argv.beep, { boop : true });
+    t.end();
+});
+
+test('boolean and alias with chainable api', function (t) {
+    var aliased = [ '-h', 'derp' ];
+    var regular = [ '--herp',  'derp' ];
+    var opts = {
+        herp: { alias: 'h', boolean: true }
+    };
+    var aliasedArgv = parse(aliased, {
+        boolean: 'herp',
+        alias: { h: 'herp' }
+    });
+    var propertyArgv = parse(regular, {
+        boolean: 'herp',
+        alias: { h: 'herp' }
+    });
+    var expected = {
+        herp: true,
+        h: true,
+        '_': [ 'derp' ]
+    };
+    
+    t.same(aliasedArgv, expected);
+    t.same(propertyArgv, expected); 
+    t.end();
+});
+
+test('boolean and alias with options hash', function (t) {
+    var aliased = [ '-h', 'derp' ];
+    var regular = [ '--herp', 'derp' ];
+    var opts = {
+        alias: { 'h': 'herp' },
+        boolean: 'herp'
+    };
+    var aliasedArgv = parse(aliased, opts);
+    var propertyArgv = parse(regular, opts);
+    var expected = {
+        herp: true,
+        h: true,
+        '_': [ 'derp' ]
+    };
+    t.same(aliasedArgv, expected);
+    t.same(propertyArgv, expected);
+    t.end();
+});
+
+test('boolean and alias using explicit true', function (t) {
+    var aliased = [ '-h', 'true' ];
+    var regular = [ '--herp',  'true' ];
+    var opts = {
+        alias: { h: 'herp' },
+        boolean: 'h'
+    };
+    var aliasedArgv = parse(aliased, opts);
+    var propertyArgv = parse(regular, opts);
+    var expected = {
+        herp: true,
+        h: true,
+        '_': [ ]
+    };
+
+    t.same(aliasedArgv, expected);
+    t.same(propertyArgv, expected); 
+    t.end();
+});
+
+// regression, see https://github.com/substack/node-optimist/issues/71
+test('boolean and --x=true', function(t) {
+    var parsed = parse(['--boool', '--other=true'], {
+        boolean: 'boool'
+    });
+
+    t.same(parsed.boool, true);
+    t.same(parsed.other, 'true');
+
+    parsed = parse(['--boool', '--other=false'], {
+        boolean: 'boool'
+    });
+    
+    t.same(parsed.boool, true);
+    t.same(parsed.other, 'false');
+    t.end();
+});
diff --git a/node_modules/minimist/test/parse_modified.js b/node_modules/minimist/test/parse_modified.js
new file mode 100644
index 0000000..21851b0
--- /dev/null
+++ b/node_modules/minimist/test/parse_modified.js
@@ -0,0 +1,9 @@
+var parse = require('../');
+var test = require('tape');
+
+test('parse with modifier functions' , function (t) {
+    t.plan(1);
+    
+    var argv = parse([ '-b', '123' ], { boolean: 'b' });
+    t.deepEqual(argv, { b: true, _: ['123'] });
+});
diff --git a/node_modules/minimist/test/short.js b/node_modules/minimist/test/short.js
new file mode 100644
index 0000000..d513a1c
--- /dev/null
+++ b/node_modules/minimist/test/short.js
@@ -0,0 +1,67 @@
+var parse = require('../');
+var test = require('tape');
+
+test('numeric short args', function (t) {
+    t.plan(2);
+    t.deepEqual(parse([ '-n123' ]), { n: 123, _: [] });
+    t.deepEqual(
+        parse([ '-123', '456' ]),
+        { 1: true, 2: true, 3: 456, _: [] }
+    );
+});
+
+test('short', function (t) {
+    t.deepEqual(
+        parse([ '-b' ]),
+        { b : true, _ : [] },
+        'short boolean'
+    );
+    t.deepEqual(
+        parse([ 'foo', 'bar', 'baz' ]),
+        { _ : [ 'foo', 'bar', 'baz' ] },
+        'bare'
+    );
+    t.deepEqual(
+        parse([ '-cats' ]),
+        { c : true, a : true, t : true, s : true, _ : [] },
+        'group'
+    );
+    t.deepEqual(
+        parse([ '-cats', 'meow' ]),
+        { c : true, a : true, t : true, s : 'meow', _ : [] },
+        'short group next'
+    );
+    t.deepEqual(
+        parse([ '-h', 'localhost' ]),
+        { h : 'localhost', _ : [] },
+        'short capture'
+    );
+    t.deepEqual(
+        parse([ '-h', 'localhost', '-p', '555' ]),
+        { h : 'localhost', p : 555, _ : [] },
+        'short captures'
+    );
+    t.end();
+});
+ 
+test('mixed short bool and capture', function (t) {
+    t.same(
+        parse([ '-h', 'localhost', '-fp', '555', 'script.js' ]),
+        {
+            f : true, p : 555, h : 'localhost',
+            _ : [ 'script.js' ]
+        }
+    );
+    t.end();
+});
+ 
+test('short and long', function (t) {
+    t.deepEqual(
+        parse([ '-h', 'localhost', '-fp', '555', 'script.js' ]),
+        {
+            f : true, p : 555, h : 'localhost',
+            _ : [ 'script.js' ]
+        }
+    );
+    t.end();
+});
diff --git a/node_modules/minimist/test/whitespace.js b/node_modules/minimist/test/whitespace.js
new file mode 100644
index 0000000..8a52a58
--- /dev/null
+++ b/node_modules/minimist/test/whitespace.js
@@ -0,0 +1,8 @@
+var parse = require('../');
+var test = require('tape');
+
+test('whitespace should be whitespace' , function (t) {
+    t.plan(1);
+    var x = parse([ '-x', '\t' ]).x;
+    t.equal(x, '\t');
+});
diff --git a/node_modules/mkdirp/.travis.yml b/node_modules/mkdirp/.travis.yml
new file mode 100644
index 0000000..74c57bf
--- /dev/null
+++ b/node_modules/mkdirp/.travis.yml
@@ -0,0 +1,8 @@
+language: node_js
+node_js:
+  - "0.8"
+  - "0.10"
+  - "0.12"
+  - "iojs"
+before_install:
+  - npm install -g npm@~1.4.6
diff --git a/node_modules/mkdirp/LICENSE b/node_modules/mkdirp/LICENSE
new file mode 100644
index 0000000..432d1ae
--- /dev/null
+++ b/node_modules/mkdirp/LICENSE
@@ -0,0 +1,21 @@
+Copyright 2010 James Halliday (mail@substack.net)
+
+This project is free software released under the MIT/X11 license:
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/mkdirp/bin/cmd.js b/node_modules/mkdirp/bin/cmd.js
new file mode 100755
index 0000000..d95de15
--- /dev/null
+++ b/node_modules/mkdirp/bin/cmd.js
@@ -0,0 +1,33 @@
+#!/usr/bin/env node
+
+var mkdirp = require('../');
+var minimist = require('minimist');
+var fs = require('fs');
+
+var argv = minimist(process.argv.slice(2), {
+    alias: { m: 'mode', h: 'help' },
+    string: [ 'mode' ]
+});
+if (argv.help) {
+    fs.createReadStream(__dirname + '/usage.txt').pipe(process.stdout);
+    return;
+}
+
+var paths = argv._.slice();
+var mode = argv.mode ? parseInt(argv.mode, 8) : undefined;
+
+(function next () {
+    if (paths.length === 0) return;
+    var p = paths.shift();
+    
+    if (mode === undefined) mkdirp(p, cb)
+    else mkdirp(p, mode, cb)
+    
+    function cb (err) {
+        if (err) {
+            console.error(err.message);
+            process.exit(1);
+        }
+        else next();
+    }
+})();
diff --git a/node_modules/mkdirp/bin/usage.txt b/node_modules/mkdirp/bin/usage.txt
new file mode 100644
index 0000000..f952aa2
--- /dev/null
+++ b/node_modules/mkdirp/bin/usage.txt
@@ -0,0 +1,12 @@
+usage: mkdirp [DIR1,DIR2..] {OPTIONS}
+
+  Create each supplied directory including any necessary parent directories that
+  don't yet exist.
+  
+  If the directory already exists, do nothing.
+
+OPTIONS are:
+
+  -m, --mode   If a directory needs to be created, set the mode as an octal
+               permission string.
+
diff --git a/node_modules/mkdirp/examples/pow.js b/node_modules/mkdirp/examples/pow.js
new file mode 100644
index 0000000..e692421
--- /dev/null
+++ b/node_modules/mkdirp/examples/pow.js
@@ -0,0 +1,6 @@
+var mkdirp = require('mkdirp');
+
+mkdirp('/tmp/foo/bar/baz', function (err) {
+    if (err) console.error(err)
+    else console.log('pow!')
+});
diff --git a/node_modules/mkdirp/index.js b/node_modules/mkdirp/index.js
new file mode 100644
index 0000000..6ce241b
--- /dev/null
+++ b/node_modules/mkdirp/index.js
@@ -0,0 +1,98 @@
+var path = require('path');
+var fs = require('fs');
+var _0777 = parseInt('0777', 8);
+
+module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP;
+
+function mkdirP (p, opts, f, made) {
+    if (typeof opts === 'function') {
+        f = opts;
+        opts = {};
+    }
+    else if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+    
+    var cb = f || function () {};
+    p = path.resolve(p);
+    
+    xfs.mkdir(p, mode, function (er) {
+        if (!er) {
+            made = made || p;
+            return cb(null, made);
+        }
+        switch (er.code) {
+            case 'ENOENT':
+                mkdirP(path.dirname(p), opts, function (er, made) {
+                    if (er) cb(er, made);
+                    else mkdirP(p, opts, cb, made);
+                });
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                xfs.stat(p, function (er2, stat) {
+                    // if the stat fails, then that's super weird.
+                    // let the original error be the failure reason.
+                    if (er2 || !stat.isDirectory()) cb(er, made)
+                    else cb(null, made);
+                });
+                break;
+        }
+    });
+}
+
+mkdirP.sync = function sync (p, opts, made) {
+    if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+
+    p = path.resolve(p);
+
+    try {
+        xfs.mkdirSync(p, mode);
+        made = made || p;
+    }
+    catch (err0) {
+        switch (err0.code) {
+            case 'ENOENT' :
+                made = sync(path.dirname(p), opts, made);
+                sync(p, opts, made);
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                var stat;
+                try {
+                    stat = xfs.statSync(p);
+                }
+                catch (err1) {
+                    throw err0;
+                }
+                if (!stat.isDirectory()) throw err0;
+                break;
+        }
+    }
+
+    return made;
+};
diff --git a/node_modules/mkdirp/package.json b/node_modules/mkdirp/package.json
new file mode 100644
index 0000000..0971993
--- /dev/null
+++ b/node_modules/mkdirp/package.json
@@ -0,0 +1,62 @@
+{
+  "_from": "mkdirp@0.5.1",
+  "_id": "mkdirp@0.5.1",
+  "_inBundle": false,
+  "_integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
+  "_location": "/mkdirp",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "mkdirp@0.5.1",
+    "name": "mkdirp",
+    "escapedName": "mkdirp",
+    "rawSpec": "0.5.1",
+    "saveSpec": null,
+    "fetchSpec": "0.5.1"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
+  "_shasum": "30057438eac6cf7f8c4767f38648d6697d75c903",
+  "_spec": "mkdirp@0.5.1",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "James Halliday",
+    "email": "mail@substack.net",
+    "url": "http://substack.net"
+  },
+  "bin": {
+    "mkdirp": "bin/cmd.js"
+  },
+  "bugs": {
+    "url": "https://github.com/substack/node-mkdirp/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {
+    "minimist": "0.0.8"
+  },
+  "deprecated": false,
+  "description": "Recursively mkdir, like `mkdir -p`",
+  "devDependencies": {
+    "mock-fs": "2 >=2.7.0",
+    "tap": "1"
+  },
+  "homepage": "https://github.com/substack/node-mkdirp#readme",
+  "keywords": [
+    "mkdir",
+    "directory"
+  ],
+  "license": "MIT",
+  "main": "index.js",
+  "name": "mkdirp",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/substack/node-mkdirp.git"
+  },
+  "scripts": {
+    "test": "tap test/*.js"
+  },
+  "version": "0.5.1"
+}
diff --git a/node_modules/mkdirp/readme.markdown b/node_modules/mkdirp/readme.markdown
new file mode 100644
index 0000000..3cc1315
--- /dev/null
+++ b/node_modules/mkdirp/readme.markdown
@@ -0,0 +1,100 @@
+# mkdirp
+
+Like `mkdir -p`, but in node.js!
+
+[![build status](https://secure.travis-ci.org/substack/node-mkdirp.png)](http://travis-ci.org/substack/node-mkdirp)
+
+# example
+
+## pow.js
+
+```js
+var mkdirp = require('mkdirp');
+    
+mkdirp('/tmp/foo/bar/baz', function (err) {
+    if (err) console.error(err)
+    else console.log('pow!')
+});
+```
+
+Output
+
+```
+pow!
+```
+
+And now /tmp/foo/bar/baz exists, huzzah!
+
+# methods
+
+```js
+var mkdirp = require('mkdirp');
+```
+
+## mkdirp(dir, opts, cb)
+
+Create a new directory and any necessary subdirectories at `dir` with octal
+permission string `opts.mode`. If `opts` is a non-object, it will be treated as
+the `opts.mode`.
+
+If `opts.mode` isn't specified, it defaults to `0777 & (~process.umask())`.
+
+`cb(err, made)` fires with the error or the first directory `made`
+that had to be created, if any.
+
+You can optionally pass in an alternate `fs` implementation by passing in
+`opts.fs`. Your implementation should have `opts.fs.mkdir(path, mode, cb)` and
+`opts.fs.stat(path, cb)`.
+
+## mkdirp.sync(dir, opts)
+
+Synchronously create a new directory and any necessary subdirectories at `dir`
+with octal permission string `opts.mode`. If `opts` is a non-object, it will be
+treated as the `opts.mode`.
+
+If `opts.mode` isn't specified, it defaults to `0777 & (~process.umask())`.
+
+Returns the first directory that had to be created, if any.
+
+You can optionally pass in an alternate `fs` implementation by passing in
+`opts.fs`. Your implementation should have `opts.fs.mkdirSync(path, mode)` and
+`opts.fs.statSync(path)`.
+
+# usage
+
+This package also ships with a `mkdirp` command.
+
+```
+usage: mkdirp [DIR1,DIR2..] {OPTIONS}
+
+  Create each supplied directory including any necessary parent directories that
+  don't yet exist.
+  
+  If the directory already exists, do nothing.
+
+OPTIONS are:
+
+  -m, --mode   If a directory needs to be created, set the mode as an octal
+               permission string.
+
+```
+
+# install
+
+With [npm](http://npmjs.org) do:
+
+```
+npm install mkdirp
+```
+
+to get the library, or
+
+```
+npm install -g mkdirp
+```
+
+to get the command.
+
+# license
+
+MIT
diff --git a/node_modules/mkdirp/test/chmod.js b/node_modules/mkdirp/test/chmod.js
new file mode 100644
index 0000000..6a404b9
--- /dev/null
+++ b/node_modules/mkdirp/test/chmod.js
@@ -0,0 +1,41 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+var _0744 = parseInt('0744', 8);
+
+var ps = [ '', 'tmp' ];
+
+for (var i = 0; i < 25; i++) {
+    var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    ps.push(dir);
+}
+
+var file = ps.join('/');
+
+test('chmod-pre', function (t) {
+    var mode = _0744
+    mkdirp(file, mode, function (er) {
+        t.ifError(er, 'should not error');
+        fs.stat(file, function (er, stat) {
+            t.ifError(er, 'should exist');
+            t.ok(stat && stat.isDirectory(), 'should be directory');
+            t.equal(stat && stat.mode & _0777, mode, 'should be 0744');
+            t.end();
+        });
+    });
+});
+
+test('chmod', function (t) {
+    var mode = _0755
+    mkdirp(file, mode, function (er) {
+        t.ifError(er, 'should not error');
+        fs.stat(file, function (er, stat) {
+            t.ifError(er, 'should exist');
+            t.ok(stat && stat.isDirectory(), 'should be directory');
+            t.end();
+        });
+    });
+});
diff --git a/node_modules/mkdirp/test/clobber.js b/node_modules/mkdirp/test/clobber.js
new file mode 100644
index 0000000..2433b9a
--- /dev/null
+++ b/node_modules/mkdirp/test/clobber.js
@@ -0,0 +1,38 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+var _0755 = parseInt('0755', 8);
+
+var ps = [ '', 'tmp' ];
+
+for (var i = 0; i < 25; i++) {
+    var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    ps.push(dir);
+}
+
+var file = ps.join('/');
+
+// a file in the way
+var itw = ps.slice(0, 3).join('/');
+
+
+test('clobber-pre', function (t) {
+    console.error("about to write to "+itw)
+    fs.writeFileSync(itw, 'I AM IN THE WAY, THE TRUTH, AND THE LIGHT.');
+
+    fs.stat(itw, function (er, stat) {
+        t.ifError(er)
+        t.ok(stat && stat.isFile(), 'should be file')
+        t.end()
+    })
+})
+
+test('clobber', function (t) {
+    t.plan(2);
+    mkdirp(file, _0755, function (err) {
+        t.ok(err);
+        t.equal(err.code, 'ENOTDIR');
+        t.end();
+    });
+});
diff --git a/node_modules/mkdirp/test/mkdirp.js b/node_modules/mkdirp/test/mkdirp.js
new file mode 100644
index 0000000..eaa8921
--- /dev/null
+++ b/node_modules/mkdirp/test/mkdirp.js
@@ -0,0 +1,28 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('woo', function (t) {
+    t.plan(5);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    mkdirp(file, _0755, function (err) {
+        t.ifError(err);
+        exists(file, function (ex) {
+            t.ok(ex, 'file created');
+            fs.stat(file, function (err, stat) {
+                t.ifError(err);
+                t.equal(stat.mode & _0777, _0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+            })
+        })
+    });
+});
diff --git a/node_modules/mkdirp/test/opts_fs.js b/node_modules/mkdirp/test/opts_fs.js
new file mode 100644
index 0000000..97186b6
--- /dev/null
+++ b/node_modules/mkdirp/test/opts_fs.js
@@ -0,0 +1,29 @@
+var mkdirp = require('../');
+var path = require('path');
+var test = require('tap').test;
+var mockfs = require('mock-fs');
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('opts.fs', function (t) {
+    t.plan(5);
+    
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/beep/boop/' + [x,y,z].join('/');
+    var xfs = mockfs.fs();
+    
+    mkdirp(file, { fs: xfs, mode: _0755 }, function (err) {
+        t.ifError(err);
+        xfs.exists(file, function (ex) {
+            t.ok(ex, 'created file');
+            xfs.stat(file, function (err, stat) {
+                t.ifError(err);
+                t.equal(stat.mode & _0777, _0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+            });
+        });
+    });
+});
diff --git a/node_modules/mkdirp/test/opts_fs_sync.js b/node_modules/mkdirp/test/opts_fs_sync.js
new file mode 100644
index 0000000..6c370aa
--- /dev/null
+++ b/node_modules/mkdirp/test/opts_fs_sync.js
@@ -0,0 +1,27 @@
+var mkdirp = require('../');
+var path = require('path');
+var test = require('tap').test;
+var mockfs = require('mock-fs');
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('opts.fs sync', function (t) {
+    t.plan(4);
+    
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/beep/boop/' + [x,y,z].join('/');
+    var xfs = mockfs.fs();
+    
+    mkdirp.sync(file, { fs: xfs, mode: _0755 });
+    xfs.exists(file, function (ex) {
+        t.ok(ex, 'created file');
+        xfs.stat(file, function (err, stat) {
+            t.ifError(err);
+            t.equal(stat.mode & _0777, _0755);
+            t.ok(stat.isDirectory(), 'target not a directory');
+        });
+    });
+});
diff --git a/node_modules/mkdirp/test/perm.js b/node_modules/mkdirp/test/perm.js
new file mode 100644
index 0000000..fbce44b
--- /dev/null
+++ b/node_modules/mkdirp/test/perm.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('async perm', function (t) {
+    t.plan(5);
+    var file = '/tmp/' + (Math.random() * (1<<30)).toString(16);
+    
+    mkdirp(file, _0755, function (err) {
+        t.ifError(err);
+        exists(file, function (ex) {
+            t.ok(ex, 'file created');
+            fs.stat(file, function (err, stat) {
+                t.ifError(err);
+                t.equal(stat.mode & _0777, _0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+            })
+        })
+    });
+});
+
+test('async root perm', function (t) {
+    mkdirp('/tmp', _0755, function (err) {
+        if (err) t.fail(err);
+        t.end();
+    });
+    t.end();
+});
diff --git a/node_modules/mkdirp/test/perm_sync.js b/node_modules/mkdirp/test/perm_sync.js
new file mode 100644
index 0000000..398229f
--- /dev/null
+++ b/node_modules/mkdirp/test/perm_sync.js
@@ -0,0 +1,36 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('sync perm', function (t) {
+    t.plan(4);
+    var file = '/tmp/' + (Math.random() * (1<<30)).toString(16) + '.json';
+    
+    mkdirp.sync(file, _0755);
+    exists(file, function (ex) {
+        t.ok(ex, 'file created');
+        fs.stat(file, function (err, stat) {
+            t.ifError(err);
+            t.equal(stat.mode & _0777, _0755);
+            t.ok(stat.isDirectory(), 'target not a directory');
+        });
+    });
+});
+
+test('sync root perm', function (t) {
+    t.plan(3);
+    
+    var file = '/tmp';
+    mkdirp.sync(file, _0755);
+    exists(file, function (ex) {
+        t.ok(ex, 'file created');
+        fs.stat(file, function (err, stat) {
+            t.ifError(err);
+            t.ok(stat.isDirectory(), 'target not a directory');
+        })
+    });
+});
diff --git a/node_modules/mkdirp/test/race.js b/node_modules/mkdirp/test/race.js
new file mode 100644
index 0000000..b0b9e18
--- /dev/null
+++ b/node_modules/mkdirp/test/race.js
@@ -0,0 +1,37 @@
+var mkdirp = require('../').mkdirp;
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('race', function (t) {
+    t.plan(10);
+    var ps = [ '', 'tmp' ];
+    
+    for (var i = 0; i < 25; i++) {
+        var dir = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+        ps.push(dir);
+    }
+    var file = ps.join('/');
+    
+    var res = 2;
+    mk(file);
+    
+    mk(file);
+    
+    function mk (file, cb) {
+        mkdirp(file, _0755, function (err) {
+            t.ifError(err);
+            exists(file, function (ex) {
+                t.ok(ex, 'file created');
+                fs.stat(file, function (err, stat) {
+                    t.ifError(err);
+                    t.equal(stat.mode & _0777, _0755);
+                    t.ok(stat.isDirectory(), 'target not a directory');
+                });
+            })
+        });
+    }
+});
diff --git a/node_modules/mkdirp/test/rel.js b/node_modules/mkdirp/test/rel.js
new file mode 100644
index 0000000..4ddb342
--- /dev/null
+++ b/node_modules/mkdirp/test/rel.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('rel', function (t) {
+    t.plan(5);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var cwd = process.cwd();
+    process.chdir('/tmp');
+    
+    var file = [x,y,z].join('/');
+    
+    mkdirp(file, _0755, function (err) {
+        t.ifError(err);
+        exists(file, function (ex) {
+            t.ok(ex, 'file created');
+            fs.stat(file, function (err, stat) {
+                t.ifError(err);
+                process.chdir(cwd);
+                t.equal(stat.mode & _0777, _0755);
+                t.ok(stat.isDirectory(), 'target not a directory');
+            })
+        })
+    });
+});
diff --git a/node_modules/mkdirp/test/return.js b/node_modules/mkdirp/test/return.js
new file mode 100644
index 0000000..bce68e5
--- /dev/null
+++ b/node_modules/mkdirp/test/return.js
@@ -0,0 +1,25 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('return value', function (t) {
+    t.plan(4);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+
+    var file = '/tmp/' + [x,y,z].join('/');
+
+    // should return the first dir created.
+    // By this point, it would be profoundly surprising if /tmp didn't
+    // already exist, since every other test makes things in there.
+    mkdirp(file, function (err, made) {
+        t.ifError(err);
+        t.equal(made, '/tmp/' + x);
+        mkdirp(file, function (err, made) {
+          t.ifError(err);
+          t.equal(made, null);
+        });
+    });
+});
diff --git a/node_modules/mkdirp/test/return_sync.js b/node_modules/mkdirp/test/return_sync.js
new file mode 100644
index 0000000..7c222d3
--- /dev/null
+++ b/node_modules/mkdirp/test/return_sync.js
@@ -0,0 +1,24 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+
+test('return value', function (t) {
+    t.plan(2);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+
+    var file = '/tmp/' + [x,y,z].join('/');
+
+    // should return the first dir created.
+    // By this point, it would be profoundly surprising if /tmp didn't
+    // already exist, since every other test makes things in there.
+    // Note that this will throw on failure, which will fail the test.
+    var made = mkdirp.sync(file);
+    t.equal(made, '/tmp/' + x);
+
+    // making the same file again should have no effect.
+    made = mkdirp.sync(file);
+    t.equal(made, null);
+});
diff --git a/node_modules/mkdirp/test/root.js b/node_modules/mkdirp/test/root.js
new file mode 100644
index 0000000..9e7d079
--- /dev/null
+++ b/node_modules/mkdirp/test/root.js
@@ -0,0 +1,19 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var test = require('tap').test;
+var _0755 = parseInt('0755', 8);
+
+test('root', function (t) {
+    // '/' on unix, 'c:/' on windows.
+    var file = path.resolve('/');
+
+    mkdirp(file, _0755, function (err) {
+        if (err) throw err
+        fs.stat(file, function (er, stat) {
+            if (er) throw er
+            t.ok(stat.isDirectory(), 'target is a directory');
+            t.end();
+        })
+    });
+});
diff --git a/node_modules/mkdirp/test/sync.js b/node_modules/mkdirp/test/sync.js
new file mode 100644
index 0000000..8c8dc93
--- /dev/null
+++ b/node_modules/mkdirp/test/sync.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('sync', function (t) {
+    t.plan(4);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+
+    var file = '/tmp/' + [x,y,z].join('/');
+
+    try {
+        mkdirp.sync(file, _0755);
+    } catch (err) {
+        t.fail(err);
+        return t.end();
+    }
+
+    exists(file, function (ex) {
+        t.ok(ex, 'file created');
+        fs.stat(file, function (err, stat) {
+            t.ifError(err);
+            t.equal(stat.mode & _0777, _0755);
+            t.ok(stat.isDirectory(), 'target not a directory');
+        });
+    });
+});
diff --git a/node_modules/mkdirp/test/umask.js b/node_modules/mkdirp/test/umask.js
new file mode 100644
index 0000000..2033c63
--- /dev/null
+++ b/node_modules/mkdirp/test/umask.js
@@ -0,0 +1,28 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('implicit mode from umask', function (t) {
+    t.plan(5);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    
+    var file = '/tmp/' + [x,y,z].join('/');
+    
+    mkdirp(file, function (err) {
+        t.ifError(err);
+        exists(file, function (ex) {
+            t.ok(ex, 'file created');
+            fs.stat(file, function (err, stat) {
+                t.ifError(err);
+                t.equal(stat.mode & _0777, _0777 & (~process.umask()));
+                t.ok(stat.isDirectory(), 'target not a directory');
+            });
+        })
+    });
+});
diff --git a/node_modules/mkdirp/test/umask_sync.js b/node_modules/mkdirp/test/umask_sync.js
new file mode 100644
index 0000000..11a7614
--- /dev/null
+++ b/node_modules/mkdirp/test/umask_sync.js
@@ -0,0 +1,32 @@
+var mkdirp = require('../');
+var path = require('path');
+var fs = require('fs');
+var exists = fs.exists || path.exists;
+var test = require('tap').test;
+var _0777 = parseInt('0777', 8);
+var _0755 = parseInt('0755', 8);
+
+test('umask sync modes', function (t) {
+    t.plan(4);
+    var x = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var y = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+    var z = Math.floor(Math.random() * Math.pow(16,4)).toString(16);
+
+    var file = '/tmp/' + [x,y,z].join('/');
+
+    try {
+        mkdirp.sync(file);
+    } catch (err) {
+        t.fail(err);
+        return t.end();
+    }
+
+    exists(file, function (ex) {
+        t.ok(ex, 'file created');
+        fs.stat(file, function (err, stat) {
+            t.ifError(err);
+            t.equal(stat.mode & _0777, (_0777 & (~process.umask())));
+            t.ok(stat.isDirectory(), 'target not a directory');
+        });
+    });
+});
diff --git a/node_modules/mocha/CHANGELOG.md b/node_modules/mocha/CHANGELOG.md
new file mode 100644
index 0000000..2997f18
--- /dev/null
+++ b/node_modules/mocha/CHANGELOG.md
@@ -0,0 +1,1262 @@
+# 2.5.3 / 2016-05-25
+
+- [#2112] - Fix HTML reporter regression causing duplicate error output ([@danielstjules] via 6d24063)
+- [#2119] - Make HTML reporter failure/passed links preventDefault to avoid SPA's hash navigation ([@jimenglish81] via 9e93efc)
+
+[@danielstjules]: https://github.com/danielstjules
+[@jimenglish81]: https://github.com/jimenglish81
+[#2112]: https://github.com/mochajs/mocha/pull/2112
+[#2119]: https://github.com/mochajs/mocha/pull/2119
+
+# 2.5.2 / 2016-05-24
+
+- [#2178] - Avoid double and triple xUnit XML escaping ([@graingert] via 49b5ff1)
+
+[@graingert]: https://github.com/graingert
+[#2178]: https://github.com/mochajs/mocha/pull/2178
+
+# 2.5.1 / 2016-05-23
+
+- Fix [to-iso-string](https://npmjs.com/package/to-iso-string) dependency ([@boneskull] via bd9450b)
+
+Thanks @entertainyou, @SimenB, @just-paja for the heads-up.
+
+# 2.5.0 / 2016-05-23
+
+> This has been awhile coming!  We needed to feel confident that the next release wouldn't break browser compatibility (e.g. the last few patch releases).
+>
+> ### Browser Tests in CI
+>
+> We now run unit tests against PhantomJS v1.x and an assortment of browsers on [SauceLabs](https://saucelabs.com), including:
+> - Internet Explorer v8.0
+> - Chrome (latest)
+> - Firefox (latest)
+> - Safari (latest)
+> - Microsoft Edge (latest)
+>
+> To accomplish this, we now run Mocha's unit tests (and a handful of integration tests) via [Karma](https://npmjs.com/package/karma) and a modified [karma-mocha](https://npmjs.com/package/karma-mocha).  Along the way, we had to solve issue [#880] (apologies to @mderijcke and @sukima who had PRs addressing this), as well as replace most usages of [should](https://npmjs.com/package/should) with [expect.js](https://npmjs.com/package/expect.js) for IE8.
+>
+> Going forward, when sending PRs, your code will *only* run against PhantomJS v1.x (and not hit SauceLabs) [because security](https://docs.travis-ci.com/user/pull-requests/#Security-Restrictions-when-testing-Pull-Requests).
+>
+> ### Node.js 6.x
+> Node.js 6.x "just worked" before, but now it's in the CI matrix, so it's "officially" supported.  Mocha *still retains support* for Node.js 0.8.x.
+>
+> ### "Minor" Release
+> You'll see mostly bug fixes below, but also a couple features--as such, it's a "minor" release.
+>
+> ### TYVM
+>
+> Thanks to everyone who contributed, and our fabulous [sponsors and backers](https://opencollective.com/mochajs)!
+
+- [#2079] - Add browser checks to CI; update [browserify](https://npmjs.com/package/browserify) to v13.0.0 ([@dasilvacontin], [@ScottFreeCode], [@boneskull] via c04c1d7, 0b1e9b3, 0dde0fa, f8a3d86, 9e8cbaa)
+- [#880] - Make Mocha browserifyable ([@boneskull] via 524862b)
+- [#2121] - Update [glob](https://npmjs.com/package/glob) to v3.2.11 ([@astorije] via 7920fc4)
+- [#2126] - Fix dupe error messages in stack trace filter ([@Turbo87] via 4301caa)
+- [#2109] - Fix certain diffs when objects cannot be coerced into primitives ([@joshlory] via 61fbb7f)
+- [#1827] - Fix TWBS/`mocha.css` collisions ([@irnc] via 0543798)
+- [#1760], [#1936] - Fix `this.skip()` in HTML reporter ([@mislav] via cb4248b)
+- [#2115] - Fix exceptions thrown from hooks in HTML reporter ([@danielstjules] via e290bc0)
+- [#2089] - Handle Symbol values in `util.stringify()` ([@ryym] via ea61d05)
+- [#2097] - Fix diff for objects overriding `Object.prototype.hasOwnProperty` ([@mantoni] via b20fdfe)
+- [#2101] - Properly handle non-string "messages" thrown from assertion libraries ([@jkimbo] via 9c41051)
+- [#2124] - Update [growl](https://npmjs.com/package/growl) ([@benjamine] via 9ae6a85)
+- [#2162], [#2205] - JSDoc fixes ([@OlegTsyba] via 8031f20, [@ScottFreeCode] via f83b1d9)
+- [#2132] - Remove Growl-related cruft ([@julienw] via 00d6469)
+- [#2172] - Add [OpenCollective](https://opencollective.com) badge, sponsors & backers ([@xdamman], [@boneskull] via caee94f)
+- [#1841] - Add new logo, banner assets ([@dasilvacontin] via 00fd0e1)
+- [#2214] - Update `README.md` header ([@dasilvacontin] via c0f9be2)
+- [#2236] - Better checks for Node.js v0.8 compatibility in CI ([@dasilvacontin] via ba5637d)
+- [#2239] - Add Node.js v6.x to CI matrix ([@boneskull] via 3904da4)
+
+[#880]: https://github.com/mochajs/mocha/issues/880
+[#1841]: https://github.com/mochajs/mocha/pull/1841
+[#2239]: https://github.com/mochajs/mocha/issues/2239
+[#2153]: https://github.com/mochajs/mocha/pull/2153
+[#2214]: https://github.com/mochajs/mocha/pull/2214
+[#2236]: https://github.com/mochajs/mocha/pull/2236
+[#2079]: https://github.com/mochajs/mocha/issues/2079
+[#2231]: https://github.com/mochajs/mocha/pull/2231
+[#2089]: https://github.com/mochajs/mocha/issues/2089
+[#2097]: https://github.com/mochajs/mocha/pull/2097
+[#1760]: https://github.com/mochajs/mocha/issues/1760
+[#1936]: https://github.com/mochajs/mocha/issues/1936
+[#2115]: https://github.com/mochajs/mocha/pull/2115
+[#1827]: https://github.com/mochajs/mocha/pull/1827
+[#2101]: https://github.com/mochajs/mocha/pull/2101
+[#2124]: https://github.com/mochajs/mocha/pull/2124
+[#2109]: https://github.com/mochajs/mocha/issues/2109
+[#2162]: https://github.com/mochajs/mocha/pull/2162
+[#2132]: https://github.com/mochajs/mocha/issues/2132
+[#2126]: https://github.com/mochajs/mocha/issues/2126
+[#2121]: https://github.com/mochajs/mocha/issues/2121
+[#2205]: https://github.com/mochajs/mocha/pull/2205
+[#2172]: https://github.com/mochajs/mocha/pull/2172
+[@xdamman]: https://github.com/xdamman
+[@Turbo87]: https://github.com/Turbo87
+[@OlegTsyba]: https://github.com/OlegTsyba
+[@ryym]: https://github.com/ryym
+[@mantoni]: https://github.com/mantoni
+[@mislav]: https://github.com/mislav
+[@irnc]: https://github.com/irnc
+[@jkimbo]: https://github.com/jkimbo
+[@benjamine]: https://github.com/benjamine
+[@joshlory]: https://github.com/joshlory
+[@julienw]: https://github.com/julienw
+[@ScottFreeCode]: https://github.com/ScottFreeCode
+[@astorije]: https://github.com/astorije
+[@dasilvacontin]: https://github.com/dasilvacontin
+
+2.4.5 / 2016-01-28
+==================
+
+* [#2080], [#2078], [#2072], [#2073], [#1200] - Revert changes to console colors in changeset [1192914](https://github.com/mochajs/mocha/commit/119291449cd03a11cdeda9e37cf718a69a012896) and subsequent related changes thereafter.  Restores compatibility with IE8 & PhantomJS.  See also [mantoni/mochify.js#129](https://github.com/mantoni/mochify.js/issues/129) and [openlayers/ol3#4746](https://github.com/openlayers/ol3/pull/4746) ([@boneskull])
+* [#2082] - Fix several test assertions ([@mislav])
+
+[#1200]: https://github.com/mochajs/mocha/issues/1200
+[#2082]: https://github.com/mochajs/mocha/pull/2082
+
+2.4.4 / 2016-01-27
+==================
+
+* [#2080] - Fix broken RequireJS compatibility ([@boneskull])
+
+[#2080]: https://github.com/mochajs/mocha/issues/2080
+
+2.4.3 / 2016-01-27
+==================
+
+* [#2078] - Fix broken IE8 ([@boneskull])
+
+[#2078]: https://github.com/mochajs/mocha/issues/2078
+
+2.4.2 / 2016-01-26
+==================
+
+* [#2053] - Fix web worker compatibility ([@mislav])
+* [#2072] - Fix Windows color output ([@thedark1337])
+* [#2073] - Fix colors in `progress` and `landing` reporters ([@gyandeeps])
+
+[#2053]: https://github.com/mochajs/mocha/pull/2053
+[#2072]: https://github.com/mochajs/mocha/pull/2072
+[#2073]: https://github.com/mochajs/mocha/pull/2073
+[@gyandeeps]: https://github.com/gyandeeps
+[@thedark1337]: https://github.com/thedark1337
+
+2.4.1 / 2016-01-26
+==================
+
+* [#2067] - Fix HTML/doc reporter regressions ([@danielstjules])
+
+[#2067]: https://github.com/mochajs/mocha/pull/2067
+
+2.4.0 / 2016-01-25
+==================
+
+* [#1945] - Correctly skip tests when skipping in suite's before() ([@ryanshawty])
+* [#2056] - chore(license): update license year to 2016 ([@pra85])
+* [#2048] - Fix `this.skip` from spec with HTML reporter ([@mislav])
+* [#2033] - Update tests for newer versions of should.js ([@tomhughes])
+* [#2037] - Fix for memory leak caused by referenced to deferred test ([@bd82])
+* [#2038] - Also run Travis-CI on node.js 4 & 5 ([@bd82])
+* [#2028] - Remove reference to test before afterAll hook runs ([@stonelgh])
+* Bump mkdirp to 0.5.1 to support strict mode ([@danielstjules])
+* [#1977] - safely stringify PhantomJS undefined value ([@ahamid])
+* Add the ability to retry tests ([@@longlho])
+* [#1982] - Enable --log-timer-events option [@Alaneor]
+* Fix #1980: Load mocha.opts from bin/mocha and bin/_mocha ([@danielstjules])
+* [#1976] - Simplify function call ([@iclanzan])
+* [#1963] - Add support --perf-basic-prof ([@robraux])
+* [#1981] - Fix HTML reporter handling of done and exceptions ([@Standard8])
+* [#1993] - propagate "file" property for "exports" interface ([@segrey])
+* [#1999] - Add support for strict mode ([@tmont])
+* [#2005] - XUnit Reporter Writes to stdout, falls back to console.log ([@jonnyreeves])
+* [#2021] - Fix non ES5 compliant regexp ([@zetaben])
+* [#1965] - Don't double install BDD UI ([@cowboyd])
+* [#1995] - Make sure the xunit output dir exists before writing to it ([@ianwremmel])
+* Use chalk for the base reporter colors; closes #1200 ([@boneskull])
+* Fix requiring custom interfaces ([@jgkim])
+* [#1967] Silence Bluebird js warnings ([@krisr])
+
+[#1945]: https://github.com/mochajs/mocha/pull/1945
+[#2056]: https://github.com/mochajs/mocha/pull/2056
+[#2048]: https://github.com/mochajs/mocha/pull/2048
+[#2033]: https://github.com/mochajs/mocha/pull/2033
+[#2037]: https://github.com/mochajs/mocha/pull/2037
+[#2038]: https://github.com/mochajs/mocha/pull/2038
+[#2028]: https://github.com/mochajs/mocha/pull/2028
+[#1977]: https://github.com/mochajs/mocha/pull/1977
+[#1982]: https://github.com/mochajs/mocha/pull/1982
+[#1976]: https://github.com/mochajs/mocha/pull/1976
+[#1963]: https://github.com/mochajs/mocha/pull/1963
+[#1981]: https://github.com/mochajs/mocha/pull/1981
+[#1993]: https://github.com/mochajs/mocha/pull/1993
+[#1999]: https://github.com/mochajs/mocha/pull/1999
+[#2005]: https://github.com/mochajs/mocha/pull/2005
+[#2021]: https://github.com/mochajs/mocha/pull/2021
+[1965#]: https://github.com/mochajs/mocha/pull/1965
+[#1995]: https://github.com/mochajs/mocha/pull/1995
+[#1967]: https://github.com/mochajs/mocha/pull/1967
+[@ryanshawty]: https://github.com/ryanshawty
+[@pra85]: https://github.com/pra85
+[@mislav]: https://github.com/mislav
+[@tomhughes]: https://github.com/tomhughes
+[@bd82]: https://github.com/bd82
+[@stonelgh]: https://github.com/stonelgh
+[@danielstjules]: https://github.com/danielstjules
+[@ahamid]: https://github.com/ahamid
+[@longlho]: https://github.com/longlho
+[@Alaneor]: https://github.com/Alaneor
+[@iclanzan]: https://github.com/iclanzan
+[@robraux]: https://github.com/robraux
+[@Standard8]: https://github.com/Standard8
+[@segrey]: https://github.com/segrey
+[@tmont]: https://github.com/tmont
+[@jonnyreeves]: https://github.com/jonnyreeves
+[@zetaben]: https://github.com/zetaben
+[@cowboyd]: https://github.com/cowboyd
+[@ianwremmel]: https://github.com/ianwremmel
+[@boneskull]: https://github.com/boneskull
+[@jgkim]: https://github.com/jgkim
+[@krisr]: https://github.com/krisr
+
+2.3.4 / 2015-11-15
+==================
+
+  * Update debug dependency to 2.2.0
+  * remove duplication of mocha.opts on process.argv
+  * Fix typo in test/reporters/nyan.js
+
+2.3.3 / 2015-09-19
+==================
+
+ * [#1875] - Fix Markdown reporter exceeds maximum call stack size ([@danielstjules])
+ * [#1864] - Fix xunit missing output with --reporter-options output ([@danielstjules])
+ * [#1846] - Support all harmony flags ([@danielstjules])
+ * Fix fragile xunit reporter spec ([@danielstjules])
+ * [#1669] - Fix catch uncaught errors outside test suite execution ([@danielstjules])
+ * [#1868] - Revert jade to support npm < v1.3.7 ([@danielstjules])
+ * [#1766] - Don't remove modules/components from stack trace in the browser ([@danielstjules])
+ * [#1798] - Fix correctly attribute mutiple done err with hooks ([@danielstjules])
+ * Fix use utils.reduce for IE8 compatibility ([@wsw0108])
+ * Some linting errors fixed by [@danielstjules]
+ * Call the inspect() function if message is not set ([@kevinburke])
+
+[#1875]: https://github.com/mochajs/mocha/issues/1875
+[#1864]: https://github.com/mochajs/mocha/issues/1864
+[#1846]: https://github.com/mochajs/mocha/issues/1846
+[#1669]: https://github.com/mochajs/mocha/issues/1669
+[#1868]: https://github.com/mochajs/mocha/issues/1868
+[#1766]: https://github.com/mochajs/mocha/issues/1766
+[#1798]: https://github.com/mochajs/mocha/issues/1798
+[@danielstjules]: https://github.com/danielstjules
+[@wsw0108]: https://github.com/wsw0108
+[@kevinburke]: https://github.com/kevinburke
+
+2.3.2 / 2015-09-07
+==================
+ * [#1868] - Fix compatibility with older versions of NPM ([@boneskull])
+
+  [#1868]: https://github.com/mochajs/mocha/issues/1868
+
+2.3.1 / 2015-09-06
+==================
+
+  * [#1812] - Fix: Bail flag causes before() hooks to be run even after a failure ([@aaroncrows])
+
+  [#1812]: https://github.com/mochajs/mocha/issues/1812
+  [aaroncrows]: https://github.com/aaroncrows
+
+2.3.0 / 2015-08-30
+==================
+
+  * [#553] - added --allowUncaught option ([@amsul])
+  * [#1490] - Allow --async-only to be satisfied by returning a promise ([@jlai])
+  * [#1829] - support --max-old-space-size ([@gigadude])
+  * [#1811] - upgrade Jade dependency ([@outsideris])
+  * [#1769] - Fix async hook error handling ([@ajaykodali])
+  * [#1230] - More descriptive beforeEach/afterEach messages ([@duncanbeevers])
+  * [#1787] - Scope loading behaviour instead of using early return ([@aryeguy])
+  * [#1789] - Fix: html-runner crashing ([@sunesimonsen])
+  * [#1749] - Fix maximum call stack error on large amount of tests ([@tinganho])
+  * [#1230] - Decorate failed hook titles with test title ([@duncanbeevers])
+  * [#1260] - Build using Browserify ([@ndhoule])
+  * [#1728] - Don't use `__proto__` ([@ndhoule])
+  * [#1781] - Fix hook error tests ([@glenjamin])
+  * [#1754] - Allow boolean --reporter-options ([@papandreou])
+  * [#1766] - Fix overly aggressive stack suppression ([@moll])
+  * [#1752] - Avoid potential infinite loop ([@gsilk])
+  * [#1761] - Fix problems running under PhantomJS ([@chromakode])
+  * [#1700] - Fix more problems running under PhantomJS ([@jbnicolai])
+  * [#1774] - Support escaped spaces in CLI options ([@adamgruber])
+  * [#1687] - Fix HTML reporter links with special chars ([@benvinegar])
+  * [#1359] - Adopt code style and enforce it using ESLint ([@ndhoule] w/ assist from [@jbnicolai] & [@boneskull])
+  * various refactors ([@jbnicolai])
+  * [#1758] - Add cross-frame compatible Error checking ([@outdooricon])
+  * [#1741] - Remove moot `version` property from bower.json ([@kkirsche])
+  * [#1739] - Improve `HISTORY.md` ([@rstacruz])
+  * [#1730] - Support more io.js flags ([@ryedog])
+  * [#1349] - Allow HTML in HTML reporter errors ([@papandreou] / [@sunesimonsen])
+  * [#1572] - Prevent default browser behavior for failure/pass links ([@jschilli])
+  * [#1630] - Support underscored harmony flags ([@dominicbarnes])
+  * [#1718] - Support more harmony flags ([@slyg])
+  * [#1689] - Add stack to JSON-stream reporter ([@jonathandelgado])
+  * [#1654] - Fix `ReferenceError` "location is not defined" ([@jakemmarsh])
+
+  [#553]: https://github.com/mochajs/mocha/issues/553
+  [#1490]: https://github.com/mochajs/mocha/issues/1490
+  [#1829]: https://github.com/mochajs/mocha/issues/1829
+  [#1811]: https://github.com/mochajs/mocha/issues/1811
+  [#1769]: https://github.com/mochajs/mocha/issues/1769
+  [#1230]: https://github.com/mochajs/mocha/issues/1230
+  [#1787]: https://github.com/mochajs/mocha/issues/1787
+  [#1789]: https://github.com/mochajs/mocha/issues/1789
+  [#1749]: https://github.com/mochajs/mocha/issues/1749
+  [#1230]: https://github.com/mochajs/mocha/issues/1230
+  [#1260]: https://github.com/mochajs/mocha/issues/1260
+  [#1728]: https://github.com/mochajs/mocha/issues/1728
+  [#1781]: https://github.com/mochajs/mocha/issues/1781
+  [#1754]: https://github.com/mochajs/mocha/issues/1754
+  [#1766]: https://github.com/mochajs/mocha/issues/1766
+  [#1752]: https://github.com/mochajs/mocha/issues/1752
+  [#1761]: https://github.com/mochajs/mocha/issues/1761
+  [#1700]: https://github.com/mochajs/mocha/issues/1700
+  [#1774]: https://github.com/mochajs/mocha/issues/1774
+  [#1687]: https://github.com/mochajs/mocha/issues/1687
+  [#1359]: https://github.com/mochajs/mocha/issues/1359
+  [#1758]: https://github.com/mochajs/mocha/issues/1758
+  [#1741]: https://github.com/mochajs/mocha/issues/1741
+  [#1739]: https://github.com/mochajs/mocha/issues/1739
+  [#1730]: https://github.com/mochajs/mocha/issues/1730
+  [#1349]: https://github.com/mochajs/mocha/issues/1349
+  [#1572]: https://github.com/mochajs/mocha/issues/1572
+  [#1630]: https://github.com/mochajs/mocha/issues/1630
+  [#1718]: https://github.com/mochajs/mocha/issues/1718
+  [#1689]: https://github.com/mochajs/mocha/issues/1689
+  [#1654]: https://github.com/mochajs/mocha/issues/1654
+  [@adamgruber]: https://github.com/adamgruber
+  [@ajaykodali]: https://github.com/ajaykodali
+  [@amsul]: https://github.com/amsul
+  [@aryeguy]: https://github.com/aryeguy
+  [@benvinegar]: https://github.com/benvinegar
+  [@boneskull]: https://github.com/boneskull
+  [@chromakode]: https://github.com/chromakode
+  [@dominicbarnes]: https://github.com/dominicbarnes
+  [@duncanbeevers]: https://github.com/duncanbeevers
+  [@gigadude]: https://github.com/gigadude
+  [@glenjamin]: https://github.com/glenjamin
+  [@gsilk]: https://github.com/gsilk
+  [@jakemmarsh]: https://github.com/jakemmarsh
+  [@jbnicolai]: https://github.com/jbnicolai
+  [@jlai]: https://github.com/jlai
+  [@jonathandelgado]: https://github.com/jonathandelgado
+  [@jschilli]: https://github.com/jschilli
+  [@kkirsche]: https://github.com/kkirsche
+  [@moll]: https://github.com/moll
+  [@ndhoule]: https://github.com/ndhoule
+  [@outdooricon]: https://github.com/outdooricon
+  [@outsideris]: https://github.com/outsideris
+  [@papandreou]: https://github.com/papandreou
+  [@rstacruz]: https://github.com/rstacruz
+  [@ryedog]: https://github.com/ryedog
+  [@slyg]: https://github.com/slyg
+  [@sunesimonsen]: https://github.com/sunesimonsen
+  [@tinganho]: https://github.com/tinganho
+
+2.2.5 / 2015-05-14
+==================
+
+  * [#1699] - Upgrade jsdiff to v1.4.0 ([@nylen])
+  * [#1648] - fix diff background colors in the console ([@nylen])
+  * [#1327] - fix tests running twice, a regression issue. ([#1686], [@danielstjules])
+  * [#1675] - add integration tests ([@danielstjules])
+  * [#1682] - use a valid SPDX license identifier in package.json ([@kemitchell])
+  * [#1660] - fix assertion of invalid dates ([#1661], [@a8m])
+  * [#1241] - fix issue with multiline diffs appearing as single line ([#1655], [@a8m])
+
+[#1699]: https://github.com/mochajs/mocha/issues/1699
+[#1648]: https://github.com/mochajs/mocha/issues/1648
+[#1327]: https://github.com/mochajs/mocha/issues/1327
+[#1686]: https://github.com/mochajs/mocha/issues/1686
+[#1675]: https://github.com/mochajs/mocha/issues/1675
+[#1682]: https://github.com/mochajs/mocha/issues/1682
+[#1660]: https://github.com/mochajs/mocha/issues/1660
+[#1661]: https://github.com/mochajs/mocha/issues/1661
+[#1241]: https://github.com/mochajs/mocha/issues/1241
+[#1655]: https://github.com/mochajs/mocha/issues/1655
+[@nylen]: https://github.com/nylen
+[@danielstjules]: https://github.com/danielstjules
+[@kemitchell]: https://github.com/kemitchell
+[@a8m]: https://github.com/a8m
+
+2.2.4 / 2015-04-08
+==================
+
+  * Load mocha.opts in _mocha for now (close #1645)
+
+2.2.3 / 2015-04-07
+==================
+
+  * fix(reporter/base): string diff - issue #1241
+  * fix(reporter/base): string diff - issue #1241
+  * fix(reporter/base): don't show diffs for errors without expectation
+  * fix(reporter/base): don't assume error message is first line of stack
+  * improve: dry up reporter/base test
+  * fix(reporter/base): explicitly ignore showDiff #1614
+  * Add iojs to travis build
+  * Pass `--allow-natives-syntax` flag to node.
+  * Support --harmony_classes flag for io.js
+  * Fix 1556: Update utils.clean to handle newlines in func declarations
+  * Fix 1606: fix err handling in IE <= 8 and non-ES5 browsers
+  * Fix 1585: make _mocha executable again
+  * chore(package.json): add a8m as a contributor
+  * Fixed broken link on html-cov reporter
+  * support --es_staging flag
+  * fix issue where menu overlaps content.
+  * update contributors in package.json
+  * Remove trailing whitespace from reporter output
+  * Remove contributors list from readme
+  * log third-party reporter errors
+  * [Fix] Exclude not own properties when looping on options
+  * fix: support node args in mocha.opts (close #1573)
+  * fix(reporter/base): string diff - issue #1241
+
+2.2.1 / 2015-03-09
+==================
+
+  * Fix passing of args intended for node/iojs.
+
+2.2.0 / 2015-03-06
+==================
+
+  * Update mocha.js
+  * Add --fgrep. Use grep for RegExp, fgrep for str
+  * Ignore async global errors after spec resolution
+  * Fixing errors that prevent mocha.js from loading in the browser - fixes #1558
+  * fix(utils): issue #1558 + make
+  * add ability to delay root suite; closes #362, closes #1124
+  * fix insanity in http tests
+  * update travis: add node 0.12, add gitter, remove slack
+  * building
+  * resolve #1548: ensure the environment's "node" executable is used
+  * reporters/base: use supports-color to detect colorable term
+  * travis: use docker containers
+  * small fix: commander option for --expose-gc
+  * Ignore asynchronous errors after global failure
+  * Improve error output when a test fails with a non-error
+  * updated travis badge, uses svg instead of img
+  * Allow skip from test context for #332
+  * [JSHINT] Unnecessary semicolon fixed in bin/_mocha
+  * Added a reminder about the done() callback to test timeout error messages
+  * fixes #1496, in Mocha.run(fn), check if fn exists before executing it, added tests too
+  * Add Harmony Proxy flag for iojs
+  * test(utils|ms|*): test existing units
+  * add support for some iojs flags
+  * fix(utils.stringify): issue #1229, diff viewer
+  * Remove slack link
+  * Prevent multiple 'grep=' querystring params in html reporter
+  * Use grep as regexp (close #1381)
+  * utils.stringify should handle objects without an Object prototype
+  * in runnable test, comparing to undefined error's message rather than a literal
+  * Fix test running output truncation on async STDIO
+  * ammended for deprecated customFds option in child_process
+
+2.1.0 / 2014-12-23
+==================
+
+ * showDiff: don’t stringify strings
+ * Clean up unused module dependencies.
+ * Filter zero-length strings from mocha.opts
+ * only write to stdout in reporters
+ * Revert "only write to stdout in reporters"
+ * Print colored output only to a tty
+ * update summary in README.md
+ * rename Readme.md/History.md to README.md/HISTORY.md because neurotic
+ * add .mailmap to fix "git shortlog" or "git summary" output
+ * fixes #1461: nyan-reporter now respects Base.useColors, fixed bug where Base.color would not return a string when str wasn't a string.
+ * Use existing test URL builder in failed replay links
+ * modify .travis.yml: use travis_retry; closes #1449
+ * fix -t 0 behavior; closes #1446
+ * fix tests (whoops)
+ * improve diff behavior
+ * Preserve pathname when linking to individual tests
+ * Fix test
+ * Tiny typo in comments fixed
+ * after hooks now being called on failed tests when using bail, fixes #1093
+ * fix throwing undefined/null now makes tests fail, fixes #1395
+ * compiler extensions are added as watched extensions, removed non-standard extensions from watch regex, resolves #1221
+ * prefix/namespace for suite titles in markdown reporter, fixes #554
+ * fix more bad markdown in CONTRIBUTING.md
+ * fix bad markdown in CONTRIBUTING.md
+ * add setImmediate/clearImmediate to globals; closes #1435
+ * Fix buffer diffs (closes #1132, closes #1433)
+ * add a CONTRIBUTING.md.  closes #882
+ * fix intermittent build failures (maybe). closes #1407
+ * add Slack notification to .travis.yml
+ * Fix slack link
+ * Add slack room to readme
+ * Update maintainers
+ * update maintainers and contributors
+ * resolves #1393: kill children with more effort on SIGINT
+ * xunit reporter support for optionally writing to a file
+ * if a reporter has a .done method, call it before exiting
+ * add support for reporter options
+ * only write to stdout in reporters
+
+2.0.0 / 2014-10-21
+==================
+
+ * remove: support for node 0.6.x, 0.4.x
+ * fix: landing reporter with non ansi characters (#211)
+ * fix: html reporter - preserve query params when navigating to suites/tests (#1358)
+ * fix: json stream reporter add error message to failed test
+ * fix: fixes for visionmedia -> mochajs
+ * fix: use stdio, fixes node deprecation warnings (#1391)
+
+1.21.5 / 2014-10-11
+==================
+
+ * fix: build for NodeJS v0.6.x
+ * fix: do not attempt to highlight syntax when non-HTML reporter is used
+ * update: escape-string-regexp to 1.0.2.
+ * fix: botched indentation in canonicalize()
+ * fix: .gitignore: ignore .patch and .diff files
+ * fix: changed 'Catched' to 'Caught' in uncaught exception error handler messages
+ * add: `pending` field for json reporter
+ * fix: Runner.prototype.uncaught: don't double-end runnables that already have a state.
+ * fix: --recursive, broken by f0facd2e
+ * update: replaces escapeRegexp with the escape-string-regexp package.
+ * update: commander to 2.3.0.
+ * update: diff to 1.0.8.
+ * fix: ability to disable syntax highlighting (#1329)
+ * fix: added empty object to errorJSON() call to catch when no error is present
+ * fix: never time out after calling enableTimeouts(false)
+ * fix: timeout(0) will work at suite level (#1300)
+ * Fix for --watch+only() issue (#888 )
+ * fix: respect err.showDiff, add Base reporter test (#810)
+
+1.22.1-3 / 2014-07-27
+==================
+
+  * fix: disabling timeouts with this.timeout(0) (#1301)
+
+1.22.1-3 / 2014-07-27
+==================
+
+  * fix: local uis and reporters (#1288)
+  * fix: building 1.21.0's changes in the browser (#1284)
+
+1.21.0 / 2014-07-23
+==================
+
+  * add: --no-timeouts option (#1262, #1268)
+  * add: --*- deprecation node flags (#1217)
+  * add: --watch-extensions argument (#1247)
+  * change: spec reporter is default (#1228)
+  * fix: diff output showing incorrect +/- (#1182)
+  * fix: diffs of circular structures (#1179)
+  * fix: re-render the progress bar when progress has changed only (#1151)
+  * fix support for environments with global and window (#1159)
+  * fix: reverting to previously defined onerror handler (#1178)
+  * fix: stringify non error objects passed to done() (#1270)
+  * fix: using local ui, reporters (#1267)
+  * fix: cleaning es6 arrows (#1176)
+  * fix: don't include attrs in failure tag for xunit (#1244)
+  * fix: fail tests that return a promise if promise is rejected w/o a reason (#1224)
+  * fix: showing failed tests in doc reporter (#1117)
+  * fix: dot reporter dots being off (#1204)
+  * fix: catch empty throws (#1219)
+  * fix: honoring timeout for sync operations (#1242)
+  * update: growl to 1.8.0
+
+1.20.1 / 2014-06-03
+==================
+
+  * update: should dev dependency to ~4.0.0 (#1231)
+
+1.20.0 / 2014-05-28
+==================
+
+  * add: filenames to suite objects (#1222)
+
+1.19.0 / 2014-05-17
+==================
+
+  * add: browser script option to package.json
+  * add: export file in Mocha.Test objects (#1174)
+  * add: add docs for wrapped node flags
+  * fix: mocha.run() to return error status in browser (#1216)
+  * fix: clean() to show failure details (#1205)
+  * fix: regex that generates html for new keyword (#1201)
+  * fix: sibling suites have inherited but separate contexts (#1164)
+
+
+1.18.2 / 2014-03-18
+==================
+
+  * fix: html runner was prevented from using #mocha as the default root el (#1162)
+
+1.18.1 / 2014-03-18
+==================
+
+  * fix: named before/after hooks in bdd, tdd, qunit interfaces (#1161)
+
+1.18.0 / 2014-03-13
+==================
+
+  * add: promise support (#329)
+  * add: named before/after hooks (#966)
+
+1.17.1 / 2014-01-22
+==================
+
+  * fix: expected messages in should.js (should.js#168)
+  * fix: expect errno global in node versions < v0.9.11 (#1111)
+  * fix: unreliable checkGlobals optimization (#1110)
+
+1.17.0 / 2014-01-09
+==================
+
+  * add: able to require globals (describe, it, etc.) through mocha (#1077)
+  * fix: abort previous run on --watch change (#1100)
+  * fix: reset context for each --watch triggered run (#1099)
+  * fix: error when cli can't resolve path or pattern (#799)
+  * fix: canonicalize objects before stringifying and diffing them (#1079)
+  * fix: make CR call behave like carriage return for non tty (#1087)
+
+
+1.16.2 / 2013-12-23
+==================
+
+  * fix: couple issues with ie 8 (#1082, #1081)
+  * fix: issue running the xunit reporter in browsers (#1068)
+  * fix: issue with firefox < 3.5 (#725)
+
+
+1.16.1 / 2013-12-19
+==================
+
+  * fix: recompiled for missed changes from the last release
+
+
+1.16.0 / 2013-12-19
+==================
+
+  * add: Runnable.globals(arr) for per test global whitelist (#1046)
+  * add: mocha.throwError(err) for assertion libs to call (#985)
+  * remove: --watch's spinner (#806)
+  * fix: duplicate test output for multi-line specs in spec reporter (#1006)
+  * fix: gracefully exit on SIGINT (#1063)
+  * fix expose the specified ui only in the browser (#984)
+  * fix: ensure process exit code is preserved when using --no-exit (#1059)
+  * fix: return true from window.onerror handler (#868)
+  * fix: xunit reporter to use process.stdout.write (#1068)
+  * fix: utils.clean(str) indentation (#761)
+  * fix: xunit reporter returning test duration a NaN (#1039)
+
+1.15.1 / 2013-12-03
+==================
+
+  * fix: recompiled for missed changes from the last release
+
+1.15.0 / 2013-12-02
+==================
+
+  * add: `--no-exit` to prevent `process.exit()` (#1018)
+  * fix: using inline diffs (#1044)
+  * fix: show pending test details in xunit reporter (#1051)
+  * fix: faster global leak detection (#1024)
+  * fix: yui compression (#1035)
+  * fix: wrapping long lines in test results (#1030, #1031)
+  * fix: handle errors in hooks (#1043)
+
+1.14.0 / 2013-11-02
+==================
+
+  * add: unified diff (#862)
+  * add: set MOCHA_COLORS env var to use colors (#965)
+  * add: able to override tests links in html reporters (#776)
+  * remove: teamcity reporter (#954)
+  * update: commander dependency to 2.0.0 (#1010)
+  * fix: mocha --ui will try to require the ui if not built in, as --reporter does (#1022)
+  * fix: send cursor commands only if isatty (#184, #1003)
+  * fix: include assertion message in base reporter (#993, #991)
+  * fix: consistent return of it, it.only, and describe, describe.only (#840)
+
+1.13.0 / 2013-09-15
+==================
+
+  * add: sort test files with --sort (#813)
+  * update: diff depedency to 1.0.7
+  * update: glob dependency to 3.2.3 (#927)
+  * fix: diffs show whitespace differences (#976)
+  * fix: improve global leaks (#783)
+  * fix: firefox window.getInterface leak
+  * fix: accessing iframe via window[iframeIndex] leak
+  * fix: faster global leak checking
+  * fix: reporter pending css selector (#970)
+
+1.12.1 / 2013-08-29
+==================
+
+ * remove test.js from .gitignore
+ * update included version of ms.js
+
+1.12.0 / 2013-07-01
+==================
+
+ * add: prevent diffs for differing types. Closes #900
+ * add `Mocha.process` hack for phantomjs
+ * fix: use compilers with requires
+ * fix regexps in diffs. Closes #890
+ * fix xunit NaN on failure. Closes #894
+ * fix: strip tab indentation in `clean` utility method
+ * fix: textmate bundle installation
+
+1.11.0 / 2013-06-12
+==================
+
+ * add --prof support
+ * add --harmony support
+ * add --harmony-generators support
+ * add "Uncaught " prefix to uncaught exceptions
+ * add web workers support
+ * add `suite.skip()`
+ * change to output # of pending / passing even on failures. Closes #872
+ * fix: prevent hooks from being called if we are bailing
+ * fix `this.timeout(0)`
+
+1.10.0 / 2013-05-21
+==================
+
+ * add add better globbing support for windows via `glob` module
+ * add support to pass through flags such as --debug-brk=1234. Closes #852
+ * add test.only, test.skip to qunit interface
+ * change to always use word-based diffs for now. Closes #733
+ * change `mocha init` tests.html to index.html
+ * fix `process` global leak in the browser
+ * fix: use resolve() instead of join() for --require
+ * fix: filterLeaks() condition to not consider indices in global object as leaks
+ * fix: restrict mocha.css styling to #mocha id
+ * fix: save timer references to avoid Sinon interfering in the browser build.
+
+1.9.0 / 2013-04-03
+==================
+
+  * add improved setImmediate implementation
+  * replace --ignore-leaks with --check-leaks
+  * change default of ignoreLeaks to true. Closes #791
+  * remove scrolling for HTML reporter
+  * fix retina support
+  * fix tmbundle, restrict to js scope
+
+1.8.2 / 2013-03-11
+==================
+
+  * add `setImmediate` support for 0.10.x
+  * fix mocha -w spinner on windows
+
+1.8.1 / 2013-01-09
+==================
+
+  * fix .bail() arity check causing it to default to true
+
+1.8.0 / 2013-01-08
+==================
+
+  * add Mocha() options bail support
+  * add `Mocha#bail()` method
+  * add instanceof check back for inheriting from Error
+  * add component.json
+  * add diff.js to browser build
+  * update growl
+  * fix TAP reporter failures comment :D
+
+1.7.4 / 2012-12-06
+==================
+
+  * add total number of passes and failures to TAP
+  * remove .bind() calls. re #680
+  * fix indexOf. Closes #680
+
+1.7.3 / 2012-11-30
+==================
+
+  * fix uncaught error support for the browser
+  * revert uncaught "fix" which breaks node
+
+1.7.2 / 2012-11-28
+==================
+
+  * fix uncaught errors to expose the original error message
+
+1.7.0 / 2012-11-07
+==================
+
+  * add `--async-only` support to prevent false positives for missing `done()`
+  * add sorting by filename in code coverage
+  * add HTML 5 doctype to browser template.
+  * add play button to html reporter to rerun a single test
+  * add `this.timeout(ms)` as Suite#timeout(ms). Closes #599
+  * update growl dependency to 1.6.x
+  * fix encoding of test-case ?grep. Closes #637
+  * fix unicode chars on windows
+  * fix dom globals in Opera/IE. Closes #243
+  * fix markdown reporter a tags
+  * fix `this.timeout("5s")` support
+
+1.6.0 / 2012-10-02
+==================
+
+  * add object diffs when `err.showDiff` is present
+  * add hiding of empty suites when pass/failures are toggled
+  * add faster `.length` checks to `checkGlobals()` before performing the filter
+
+1.5.0 / 2012-09-21
+==================
+
+  * add `ms()` to `.slow()` and `.timeout()`
+  * add `Mocha#checkLeaks()` to re-enable global leak checks
+  * add `this.slow()` option [aheckmann]
+  * add tab, CR, LF to error diffs for now
+  * add faster `.checkGlobals()` solution [guille]
+  * remove `fn.call()` from reduce util
+  * remove `fn.call()` from filter util
+  * fix forEach. Closes #582
+  * fix relaying of signals [TooTallNate]
+  * fix TAP reporter grep number
+
+1.4.2 / 2012-09-01
+==================
+
+  * add support to multiple `Mocha#globals()` calls, and strings
+  * add `mocha.reporter()` constructor support [jfirebaugh]
+  * add `mocha.timeout()`
+  * move query-string parser to utils.js
+  * move highlight code to utils.js
+  * fix third-party reporter support [exogen]
+  * fix client-side API to match node-side [jfirebaugh]
+  * fix mocha in iframe [joliss]
+
+1.4.1 / 2012-08-28
+==================
+
+  * add missing `Markdown` export
+  * fix `Mocha#grep()`, escape regexp strings
+  * fix reference error when `devicePixelRatio` is not defined. Closes #549
+
+1.4.0 / 2012-08-22
+==================
+
+  * add mkdir -p to `mocha init`. Closes #539
+  * add `.only()`. Closes #524
+  * add `.skip()`. Closes #524
+  * change str.trim() to use utils.trim(). Closes #533
+  * fix HTML progress indicator retina display
+  * fix url-encoding of click-to-grep HTML functionality
+
+1.3.2 / 2012-08-01
+==================
+
+  * fix exports double-execution regression. Closes #531
+
+1.3.1 / 2012-08-01
+==================
+
+  * add passes/failures toggling to HTML reporter
+  * add pending state to `xit()` and `xdescribe()` [Brian Moore]
+  * add the @charset "UTF-8"; to fix #522 with FireFox. [Jonathan Creamer]
+  * add border-bottom to #stats links
+  * add check for runnable in `Runner#uncaught()`. Closes #494
+  * add 0.4 and 0.6 back to travis.yml
+  * add `-E, --growl-errors` to growl on failures only
+  * add prefixes to debug() names. Closes #497
+  * add `Mocha#invert()` to js api
+  * change dot reporter to use sexy unicode dots
+  * fix error when clicking pending test in HTML reporter
+  * fix `make tm`
+
+1.3.0 / 2012-07-05
+==================
+
+  * add window scrolling to `HTML` reporter
+  * add v8 `--trace-*` option support
+  * add support for custom reports via `--reporter MODULE`
+  * add `--invert` switch to invert `--grep` matches
+  * fix export of `Nyan` reporter. Closes #495
+  * fix escaping of `HTML` suite titles. Closes #486
+  * fix `done()` called multiple times with an error test
+  * change `--grep` - regexp escape the input
+
+1.2.2 / 2012-06-28
+==================
+
+  * Added 0.8.0 support
+
+1.2.1 / 2012-06-25
+==================
+
+  * Added `this.test.error(err)` support to after each hooks. Closes #287
+  * Added: export top-level suite on global mocha object (mocha.suite). Closes #448
+  * Fixed `js` code block format error in markdown reporter
+  * Fixed deprecation warning when using `path.existsSync`
+  * Fixed --globals with wildcard
+  * Fixed chars in nyan when his head moves back
+  * Remove `--growl` from test/mocha.opts. Closes #289
+
+1.2.0 / 2012-06-17
+==================
+
+  * Added `nyan` reporter [Atsuya Takagi]
+  * Added `mocha init ` to copy client files
+  * Added "specify" synonym for "it" [domenic]
+  * Added global leak wildcard support [nathanbowser]
+  * Fixed runner emitter leak. closes #432
+  * Fixed omission of .js extension. Closes #454
+
+1.1.0 / 2012-05-30
+==================
+
+  * Added: check each `mocha(1)` arg for directories to walk
+  * Added `--recursive` [tricknotes]
+  * Added `context` for BDD [hokaccha]
+  * Added styling for new clickable titles
+  * Added clickable suite titles to HTML reporter
+  * Added warning when strings are thrown as errors
+  * Changed: green arrows again in HTML reporter styling
+  * Changed ul/li elements instead of divs for better copy-and-pasting [joliss]
+  * Fixed issue #325 - add better grep support to js api
+  * Fixed: save timer references to avoid Sinon interfering.
+
+1.0.3 / 2012-04-30
+==================
+
+  * Fixed string diff newlines
+  * Fixed: removed mocha.css target. Closes #401
+
+1.0.2 / 2012-04-25
+==================
+
+  * Added HTML reporter duration. Closes #47
+  * Fixed: one postMessage event listener [exogen]
+  * Fixed: allow --globals to be used multiple times. Closes #100 [brendannee]
+  * Fixed #158: removes jquery include from browser tests
+  * Fixed grep. Closes #372 [brendannee]
+  * Fixed #166 - When grepping don't display the empty suites
+  * Removed test/browser/style.css. Closes #385
+
+1.0.1 / 2012-04-04
+==================
+
+  * Fixed `.timeout()` in hooks
+  * Fixed: allow callback for `mocha.run()` in client version
+  * Fixed browser hook error display. Closes #361
+
+1.0.0 / 2012-03-24
+==================
+
+  * Added js API. Closes #265
+  * Added: initial run of tests with `--watch`. Closes #345
+  * Added: mark `location` as a global on the CS. Closes #311
+  * Added `markdown` reporter (github flavour)
+  * Added: scrolling menu to coverage.html. Closes #335
+  * Added source line to html report for Safari [Tyson Tate]
+  * Added "min" reporter, useful for `--watch` [Jakub Nešetřil]
+  * Added support for arbitrary compilers via . Closes #338 [Ian Young]
+  * Added Teamcity export to lib/reporters/index [Michael Riley]
+  * Fixed chopping of first char in error reporting. Closes #334 [reported by topfunky]
+  * Fixed terrible FF / Opera stack traces
+
+0.14.1 / 2012-03-06
+==================
+
+  * Added lib-cov to _.npmignore_
+  * Added reporter to `mocha.run([reporter])` as argument
+  * Added some margin-top to the HTML reporter
+  * Removed jQuery dependency
+  * Fixed `--watch`: purge require cache. Closes #266
+
+0.14.0 / 2012-03-01
+==================
+
+  * Added string diff support for terminal reporters
+
+0.13.0 / 2012-02-23
+==================
+
+  * Added preliminary test coverage support. Closes #5
+  * Added `HTMLCov` reporter
+  * Added `JSONCov` reporter [kunklejr]
+  * Added `xdescribe()` and `xit()` to the BDD interface. Closes #263 (docs   * Changed: make json reporter output pretty json
+  * Fixed node-inspector support, swapped `--debug` for `debug` to match node.
+needed)
+Closes #247
+
+0.12.1 / 2012-02-14
+==================
+
+  * Added `npm docs mocha` support [TooTallNate]
+  * Added a `Context` object used for hook and test-case this. Closes #253
+  * Fixed `Suite#clone()` `.ctx` reference. Closes #262
+
+0.12.0 / 2012-02-02
+==================
+
+  * Added .coffee `--watch` support. Closes #242
+  * Added support to `--require` files relative to the CWD. Closes #241
+  * Added quick n dirty syntax highlighting. Closes #248
+  * Changed: made HTML progress indicator smaller
+  * Fixed xunit errors attribute [dhendo]
+
+0.10.2 / 2012-01-21
+==================
+
+  * Fixed suite count in reporter stats. Closes #222
+  * Fixed `done()` after timeout error reporting [Phil Sung]
+  * Changed the 0-based errors to 1
+
+0.10.1 / 2012-01-17
+==================
+
+  * Added support for node 0.7.x
+  * Fixed absolute path support. Closes #215 [kompiro]
+  * Fixed `--no-colors` option [Jussi Virtanen]
+  * Fixed Arial CSS typo in the correct file
+
+0.10.0 / 2012-01-13
+==================
+
+  * Added `-b, --bail` to exit on first exception [guillermo]
+  * Added support for `-gc` / `--expose-gc` [TooTallNate]
+  * Added `qunit`-inspired interface
+  * Added MIT LICENSE. Closes #194
+  * Added: `--watch` all .js in the CWD. Closes #139
+  * Fixed `self.test` reference in runner. Closes #189
+  * Fixed double reporting of uncaught exceptions after timeout. Closes #195
+
+0.8.2 / 2012-01-05
+==================
+
+  * Added test-case context support. Closes #113
+  * Fixed exit status. Closes #187
+  * Update commander. Closes #190
+
+0.8.1 / 2011-12-30
+==================
+
+  * Fixed reporting of uncaught exceptions. Closes #183
+  * Fixed error message defaulting [indutny]
+  * Changed mocha(1) from bash to node for windows [Nathan Rajlich]
+
+0.8.0 / 2011-12-28
+==================
+
+  * Added `XUnit` reporter [FeeFighters/visionmedia]
+  * Added `say(1)` notification support [Maciej Małecki]
+  * Changed: fail when done() is invoked with a non-Error. Closes #171
+  * Fixed `err.stack`, defaulting to message. Closes #180
+  * Fixed: `make tm` mkdir -p the dest. Closes #137
+  * Fixed mocha(1) --help bin name
+  * Fixed `-d` for `--debug` support
+
+0.7.1 / 2011-12-22
+==================
+
+  * Removed `mocha-debug(1)`, use `mocha --debug`
+  * Fixed CWD relative requires
+  * Fixed growl issue on windows [Raynos]
+  * Fixed: platform specific line endings [TooTallNate]
+  * Fixed: escape strings in HTML reporter. Closes #164
+
+0.7.0 / 2011-12-18
+==================
+
+  * Added support for IE{7,8} [guille]
+  * Changed: better browser nextTick implementation [guille]
+
+0.6.0 / 2011-12-18
+==================
+
+  * Added setZeroTimeout timeout for browser (nicer stack traces). Closes #153
+  * Added "view source" on hover for HTML reporter to make it obvious
+  * Changed: replace custom growl with growl lib
+  * Fixed duplicate reporting for HTML reporter. Closes #154
+  * Fixed silent hook errors in the HTML reporter. Closes #150
+
+0.5.0 / 2011-12-14
+==================
+
+  * Added: push node_modules directory onto module.paths for relative require Closes #93
+  * Added teamcity reporter [blindsey]
+  * Fixed: recover from uncaught exceptions for tests. Closes #94
+  * Fixed: only emit "test end" for uncaught within test, not hook
+
+0.4.0 / 2011-12-14
+==================
+
+  * Added support for test-specific timeouts via `this.timeout(0)`. Closes #134
+  * Added guillermo's client-side EventEmitter. Closes #132
+  * Added progress indicator to the HTML reporter
+  * Fixed slow browser tests. Closes #135
+  * Fixed "suite" color for light terminals
+  * Fixed `require()` leak spotted by [guillermo]
+
+0.3.6 / 2011-12-09
+==================
+
+  * Removed suite merging (for now)
+
+0.3.5 / 2011-12-08
+==================
+
+  * Added support for `window.onerror` [guillermo]
+  * Fixed: clear timeout on uncaught exceptions. Closes #131 [guillermo]
+  * Added `mocha.css` to PHONY list.
+  * Added `mocha.js` to PHONY list.
+
+0.3.4 / 2011-12-08
+==================
+
+  * Added: allow `done()` to be called with non-Error
+  * Added: return Runner from `mocha.run()`. Closes #126
+  * Fixed: run afterEach even on failures. Closes #125
+  * Fixed clobbering of current runnable. Closes #121
+
+0.3.3 / 2011-12-08
+==================
+
+  * Fixed hook timeouts. Closes #120
+  * Fixed uncaught exceptions in hooks
+
+0.3.2 / 2011-12-05
+==================
+
+  * Fixed weird reporting when `err.message` is not present
+
+0.3.1 / 2011-12-04
+==================
+
+  * Fixed hook event emitter leak. Closes #117
+  * Fixed: export `Spec` constructor. Closes #116
+
+0.3.0 / 2011-12-04
+==================
+
+  * Added `-w, --watch`. Closes #72
+  * Added `--ignore-leaks` to ignore global leak checking
+  * Added browser `?grep=pattern` support
+  * Added `--globals ` to specify accepted globals. Closes #99
+  * Fixed `mocha-debug(1)` on some systems. Closes #232
+  * Fixed growl total, use `runner.total`
+
+0.2.0 / 2011-11-30
+==================
+
+  * Added `--globals ` to specify accepted globals. Closes #99
+  * Fixed funky highlighting of messages. Closes #97
+  * Fixed `mocha-debug(1)`. Closes #232
+  * Fixed growl total, use runner.total
+
+0.1.0 / 2011-11-29
+==================
+
+  * Added `suiteSetup` and `suiteTeardown` to TDD interface [David Henderson]
+  * Added growl icons. Closes #84
+  * Fixed coffee-script support
+
+0.0.8 / 2011-11-25
+==================
+
+  * Fixed: use `Runner#total` for accurate reporting
+
+0.0.7 / 2011-11-25
+==================
+
+  * Added `Hook`
+  * Added `Runnable`
+  * Changed: `Test` is `Runnable`
+  * Fixed global leak reporting in hooks
+  * Fixed: > 2 calls to done() only report the error once
+  * Fixed: clear timer on failure. Closes #80
+
+0.0.6 / 2011-11-25
+==================
+
+  * Fixed return on immediate async error. Closes #80
+
+0.0.5 / 2011-11-24
+==================
+
+  * Fixed: make mocha.opts whitespace less picky [kkaefer]
+
+0.0.4 / 2011-11-24
+==================
+
+  * Added `--interfaces`
+  * Added `--reporters`
+  * Added `-c, --colors`. Closes #69
+  * Fixed hook timeouts
+
+0.0.3 / 2011-11-23
+==================
+
+  * Added `-C, --no-colors` to explicitly disable
+  * Added coffee-script support
+
+0.0.2 / 2011-11-22
+==================
+
+  * Fixed global leak detection due to Safari bind() change
+  * Fixed: escape html entities in Doc reporter
+  * Fixed: escape html entities in HTML reporter
+  * Fixed pending test support for HTML reporter. Closes #66
+
+0.0.1 / 2011-11-22
+==================
+
+  * Added `--timeout` second shorthand support, ex `--timeout 3s`.
+  * Fixed "test end" event for uncaughtExceptions. Closes #61
+
+0.0.1-alpha6 / 2011-11-19
+==================
+
+  * Added travis CI support (needs enabling when public)
+  * Added preliminary browser support
+  * Added `make mocha.css` target. Closes #45
+  * Added stack trace to TAP errors. Closes #52
+  * Renamed tearDown to teardown. Closes #49
+  * Fixed: cascading hooksc. Closes #30
+  * Fixed some colors for non-tty
+  * Fixed errors thrown in sync test-cases due to nextTick
+  * Fixed Base.window.width... again give precedence to 0.6.x
+
+0.0.1-alpha5 / 2011-11-17
+==================
+
+  * Added `doc` reporter. Closes #33
+  * Added suite merging. Closes #28
+  * Added TextMate bundle and `make tm`. Closes #20
+
+0.0.1-alpha4 / 2011-11-15
+==================
+
+  * Fixed getWindowSize() for 0.4.x
+
+0.0.1-alpha3 / 2011-11-15
+==================
+
+  * Added `-s, --slow ` to specify "slow" test threshold
+  * Added `mocha-debug(1)`
+  * Added `mocha.opts` support. Closes #31
+  * Added: default [files] to _test/*.js_
+  * Added protection against multiple calls to `done()`. Closes #35
+  * Changed: bright yellow for slow Dot reporter tests
+
+0.0.1-alpha1 / 2011-11-08
+==================
+
+  * Missed this one :)
+
+0.0.1-alpha1 / 2011-11-08
+==================
+
+  * Initial release
diff --git a/node_modules/mocha/LICENSE b/node_modules/mocha/LICENSE
new file mode 100644
index 0000000..9919641
--- /dev/null
+++ b/node_modules/mocha/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2011-2016 TJ Holowaychuk 
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/mocha/bin/.eslintrc b/node_modules/mocha/bin/.eslintrc
new file mode 100644
index 0000000..db74246
--- /dev/null
+++ b/node_modules/mocha/bin/.eslintrc
@@ -0,0 +1,3 @@
+---
+rules:
+  no-process-exit: 0
diff --git a/node_modules/mocha/bin/_mocha b/node_modules/mocha/bin/_mocha
new file mode 100755
index 0000000..ad4ed40
--- /dev/null
+++ b/node_modules/mocha/bin/_mocha
@@ -0,0 +1,480 @@
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('commander'),
+  path = require('path'),
+  fs = require('fs'),
+  resolve = path.resolve,
+  exists = fs.existsSync || path.existsSync,
+  Mocha = require('../'),
+  utils = Mocha.utils,
+  join = path.join,
+  cwd = process.cwd(),
+  getOptions = require('./options'),
+  mocha = new Mocha;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+var Date = global.Date
+  , setTimeout = global.setTimeout
+  , setInterval = global.setInterval
+  , clearTimeout = global.clearTimeout
+  , clearInterval = global.clearInterval;
+
+/**
+ * Files.
+ */
+
+var files = [];
+
+/**
+ * Globals.
+ */
+
+var globals = [];
+
+/**
+ * Requires.
+ */
+
+var requires = [];
+
+/**
+ * Images.
+ */
+
+var images = {
+    fail: __dirname + '/../images/error.png'
+  , pass: __dirname + '/../images/ok.png'
+};
+
+// options
+
+program
+  .version(JSON.parse(fs.readFileSync(__dirname + '/../package.json', 'utf8')).version)
+  .usage('[debug] [options] [files]')
+  .option('-A, --async-only', "force all tests to take a callback (async) or return a promise")
+  .option('-c, --colors', 'force enabling of colors')
+  .option('-C, --no-colors', 'force disabling of colors')
+  .option('-G, --growl', 'enable growl notification support')
+  .option('-O, --reporter-options ', 'reporter-specific options')
+  .option('-R, --reporter ', 'specify the reporter to use', 'spec')
+  .option('-S, --sort', "sort test files")
+  .option('-b, --bail', "bail after first test failure")
+  .option('-d, --debug', "enable node's debugger, synonym for node --debug")
+  .option('-g, --grep ', 'only run tests matching ')
+  .option('-f, --fgrep ', 'only run tests containing ')
+  .option('-gc, --expose-gc', 'expose gc extension')
+  .option('-i, --invert', 'inverts --grep and --fgrep matches')
+  .option('-r, --require ', 'require the given module')
+  .option('-s, --slow ', '"slow" test threshold in milliseconds [75]')
+  .option('-t, --timeout ', 'set test-case timeout in milliseconds [2000]')
+  .option('-u, --ui ', 'specify user-interface (bdd|tdd|exports)', 'bdd')
+  .option('-w, --watch', 'watch files for changes')
+  .option('--check-leaks', 'check for global variable leaks')
+  .option('--full-trace', 'display the full stack trace')
+  .option('--compilers :,...', 'use the given module(s) to compile files', list, [])
+  .option('--debug-brk', "enable node's debugger breaking on the first line")
+  .option('--globals ', 'allow the given comma-delimited global [names]', list, [])
+  .option('--es_staging', 'enable all staged features')
+  .option('--harmony<_classes,_generators,...>', 'all node --harmony* flags are available')
+  .option('--icu-data-dir', 'include ICU data')
+  .option('--inline-diffs', 'display actual/expected differences inline within each string')
+  .option('--interfaces', 'display available interfaces')
+  .option('--no-deprecation', 'silence deprecation warnings')
+  .option('--no-exit', 'require a clean shutdown of the event loop: mocha will not call process.exit')
+  .option('--no-timeouts', 'disables timeouts, given implicitly with --debug')
+  .option('--opts ', 'specify opts path', 'test/mocha.opts')
+  .option('--perf-basic-prof', 'enable perf linux profiler (basic support)')
+  .option('--prof', 'log statistical profiling information')
+  .option('--log-timer-events', 'Time events including external callbacks')
+  .option('--recursive', 'include sub directories')
+  .option('--reporters', 'display available reporters')
+  .option('--retries ', 'set numbers of time to retry a failed test case')
+  .option('--throw-deprecation', 'throw an exception anytime a deprecated function is used')
+  .option('--trace', 'trace function calls')
+  .option('--trace-deprecation', 'show stack traces on deprecations')
+  .option('--use_strict', 'enforce strict mode')
+  .option('--watch-extensions ,...', 'additional extensions to monitor with --watch', list, [])
+  .option('--delay', 'wait for async suite definition')
+
+program.name = 'mocha';
+
+// init command
+
+program
+  .command('init ')
+  .description('initialize a client-side mocha setup at ')
+  .action(function(path){
+    var mkdir = require('mkdirp');
+    mkdir.sync(path);
+    var css = fs.readFileSync(join(__dirname, '..', 'mocha.css'));
+    var js = fs.readFileSync(join(__dirname, '..', 'mocha.js'));
+    var tmpl = fs.readFileSync(join(__dirname, '..', 'lib/template.html'));
+    fs.writeFileSync(join(path, 'mocha.css'), css);
+    fs.writeFileSync(join(path, 'mocha.js'), js);
+    fs.writeFileSync(join(path, 'tests.js'), '');
+    fs.writeFileSync(join(path, 'index.html'), tmpl);
+    process.exit(0);
+  });
+
+// --globals
+
+program.on('globals', function(val){
+  globals = globals.concat(list(val));
+});
+
+// --reporters
+
+program.on('reporters', function(){
+  console.log();
+  console.log('    dot - dot matrix');
+  console.log('    doc - html documentation');
+  console.log('    spec - hierarchical spec list');
+  console.log('    json - single json object');
+  console.log('    progress - progress bar');
+  console.log('    list - spec-style listing');
+  console.log('    tap - test-anything-protocol');
+  console.log('    landing - unicode landing strip');
+  console.log('    xunit - xunit reporter');
+  console.log('    html-cov - HTML test coverage');
+  console.log('    json-cov - JSON test coverage');
+  console.log('    min - minimal reporter (great with --watch)');
+  console.log('    json-stream - newline delimited json events');
+  console.log('    markdown - markdown documentation (github flavour)');
+  console.log('    nyan - nyan cat!');
+  console.log();
+  process.exit();
+});
+
+// --interfaces
+
+program.on('interfaces', function(){
+  console.log('');
+  console.log('    bdd');
+  console.log('    tdd');
+  console.log('    qunit');
+  console.log('    exports');
+  console.log('');
+  process.exit();
+});
+
+// -r, --require
+
+module.paths.push(cwd, join(cwd, 'node_modules'));
+
+program.on('require', function(mod){
+  var abs = exists(mod) || exists(mod + '.js');
+  if (abs) mod = resolve(mod);
+  requires.push(mod);
+});
+
+// If not already done, load mocha.opts
+if (!process.env.LOADED_MOCHA_OPTS) {
+  getOptions();
+}
+
+// parse args
+
+program.parse(process.argv);
+
+// infinite stack traces
+
+Error.stackTraceLimit = Infinity; // TODO: config
+
+// reporter options
+
+var reporterOptions = {};
+if (program.reporterOptions !== undefined) {
+    program.reporterOptions.split(",").forEach(function(opt) {
+        var L = opt.split("=");
+        if (L.length > 2 || L.length === 0) {
+            throw new Error("invalid reporter option '" + opt + "'");
+        } else if (L.length === 2) {
+            reporterOptions[L[0]] = L[1];
+        } else {
+            reporterOptions[L[0]] = true;
+        }
+    });
+}
+
+// reporter
+
+mocha.reporter(program.reporter, reporterOptions);
+
+// load reporter
+
+var Reporter = null;
+try {
+  Reporter = require('../lib/reporters/' + program.reporter);
+} catch (err) {
+  try {
+    Reporter = require(program.reporter);
+  } catch (err) {
+    throw new Error('reporter "' + program.reporter + '" does not exist');
+  }
+}
+
+// --no-colors
+
+if (!program.colors) mocha.useColors(false);
+
+// --colors
+
+if (~process.argv.indexOf('--colors') ||
+    ~process.argv.indexOf('-c')) {
+  mocha.useColors(true);
+}
+
+// --inline-diffs
+
+if (program.inlineDiffs) mocha.useInlineDiffs(true);
+
+// --slow 
+
+if (program.slow) mocha.suite.slow(program.slow);
+
+// --no-timeouts
+
+if (!program.timeouts) mocha.enableTimeouts(false);
+
+// --timeout
+
+if (program.timeout) mocha.suite.timeout(program.timeout);
+
+// --bail
+
+mocha.suite.bail(program.bail);
+
+// --grep
+
+if (program.grep) mocha.grep(new RegExp(program.grep));
+
+// --fgrep
+
+if (program.fgrep) mocha.grep(program.fgrep);
+
+// --invert
+
+if (program.invert) mocha.invert();
+
+// --check-leaks
+
+if (program.checkLeaks) mocha.checkLeaks();
+
+// --stack-trace
+
+if(program.fullTrace) mocha.fullTrace();
+
+// --growl
+
+if (program.growl) mocha.growl();
+
+// --async-only
+
+if (program.asyncOnly) mocha.asyncOnly();
+
+// --delay
+
+if (program.delay) mocha.delay();
+
+// --globals
+
+mocha.globals(globals);
+
+// --retries
+
+if (program.retries) mocha.suite.retries(program.retries);
+
+// custom compiler support
+
+var extensions = ['js'];
+program.compilers.forEach(function(c) {
+  var compiler = c.split(':')
+    , ext = compiler[0]
+    , mod = compiler[1];
+
+  if (mod[0] == '.') mod = join(process.cwd(), mod);
+  require(mod);
+  extensions.push(ext);
+  program.watchExtensions.push(ext);
+});
+
+// requires
+
+requires.forEach(function(mod) {
+  require(mod);
+});
+
+// interface
+
+mocha.ui(program.ui);
+
+//args
+
+var args = program.args;
+
+// default files to test/*.{js,coffee}
+
+if (!args.length) args.push('test');
+
+args.forEach(function(arg){
+  files = files.concat(utils.lookupFiles(arg, extensions, program.recursive));
+});
+
+// resolve
+
+files = files.map(function(path){
+  return resolve(path);
+});
+
+if (program.sort) {
+  files.sort();
+}
+
+// --watch
+
+var runner;
+if (program.watch) {
+  console.log();
+  hideCursor();
+  process.on('SIGINT', function(){
+    showCursor();
+    console.log('\n');
+    process.exit();
+  });
+
+
+  var watchFiles = utils.files(cwd, [ 'js' ].concat(program.watchExtensions));
+  var runAgain = false;
+
+  function loadAndRun() {
+    try {
+      mocha.files = files;
+      runAgain = false;
+      runner = mocha.run(function(){
+        runner = null;
+        if (runAgain) {
+          rerun();
+        }
+      });
+    } catch(e) {
+      console.log(e.stack);
+    }
+  }
+
+  function purge() {
+    watchFiles.forEach(function(file){
+      delete require.cache[file];
+    });
+  }
+
+  loadAndRun();
+
+  function rerun() {
+    purge();
+    stop()
+    if (!program.grep)
+      mocha.grep(null);
+    mocha.suite = mocha.suite.clone();
+    mocha.suite.ctx = new Mocha.Context;
+    mocha.ui(program.ui);
+    loadAndRun();
+  }
+
+  utils.watch(watchFiles, function(){
+    runAgain = true;
+    if (runner) {
+      runner.abort();
+    } else {
+      rerun();
+    }
+  });
+
+} else {
+
+// load
+
+  mocha.files = files;
+  runner = mocha.run(program.exit ? exit : exitLater);
+
+}
+
+function exitLater(code) {
+  process.on('exit', function() { process.exit(code) })
+}
+
+function exit(code) {
+  // flush output for Node.js Windows pipe bug
+  // https://github.com/joyent/node/issues/6247 is just one bug example
+  // https://github.com/visionmedia/mocha/issues/333 has a good discussion
+  function done() {
+    if (!(draining--)) process.exit(code);
+  }
+
+  var draining = 0;
+  var streams = [process.stdout, process.stderr];
+
+  streams.forEach(function(stream){
+    // submit empty write request and wait for completion
+    draining += 1;
+    stream.write('', done);
+  });
+
+  done();
+}
+
+process.on('SIGINT', function() { runner.abort(); })
+
+/**
+ * Parse list.
+ */
+
+function list(str) {
+  return str.split(/ *, */);
+}
+
+/**
+ * Hide the cursor.
+ */
+
+function hideCursor(){
+  process.stdout.write('\u001b[?25l');
+}
+
+/**
+ * Show the cursor.
+ */
+
+function showCursor(){
+  process.stdout.write('\u001b[?25h');
+}
+
+/**
+ * Stop play()ing.
+ */
+
+function stop() {
+  process.stdout.write('\u001b[2K');
+  clearInterval(play.timer);
+}
+
+/**
+ * Play the given array of strings.
+ */
+
+function play(arr, interval) {
+  var len = arr.length
+    , interval = interval || 100
+    , i = 0;
+
+  play.timer = setInterval(function(){
+    var str = arr[i++ % len];
+    process.stdout.write('\u001b[0G' + str);
+  }, interval);
+}
diff --git a/node_modules/mocha/bin/mocha b/node_modules/mocha/bin/mocha
new file mode 100755
index 0000000..f6606e4
--- /dev/null
+++ b/node_modules/mocha/bin/mocha
@@ -0,0 +1,73 @@
+#!/usr/bin/env node
+
+/**
+ * This tiny wrapper file checks for known node flags and appends them
+ * when found, before invoking the "real" _mocha(1) executable.
+ */
+
+var spawn = require('child_process').spawn,
+  path = require('path'),
+  fs = require('fs'),
+  getOptions = require('./options'),
+  args = [path.join(__dirname, '_mocha')];
+
+// Load mocha.opts into process.argv
+// Must be loaded here to handle node-specific options
+getOptions();
+
+process.argv.slice(2).forEach(function(arg){
+  var flag = arg.split('=')[0];
+
+  switch (flag) {
+    case '-d':
+      args.unshift('--debug');
+      args.push('--no-timeouts');
+      break;
+    case 'debug':
+    case '--debug':
+    case '--debug-brk':
+      args.unshift(arg);
+      args.push('--no-timeouts');
+      break;
+    case '-gc':
+    case '--expose-gc':
+      args.unshift('--expose-gc');
+      break;
+    case '--gc-global':
+    case '--es_staging':
+    case '--no-deprecation':
+    case '--prof':
+    case '--log-timer-events':
+    case '--throw-deprecation':
+    case '--trace-deprecation':
+    case '--use_strict':
+    case '--allow-natives-syntax':
+    case '--perf-basic-prof':
+      args.unshift(arg);
+      break;
+    default:
+      if (0 == arg.indexOf('--harmony')) args.unshift(arg);
+      else if (0 == arg.indexOf('--trace')) args.unshift(arg);
+      else if (0 == arg.indexOf('--icu-data-dir')) args.unshift(arg);
+      else if (0 == arg.indexOf('--max-old-space-size')) args.unshift(arg);
+      else args.push(arg);
+      break;
+  }
+});
+
+var proc = spawn(process.execPath, args, { stdio: 'inherit' });
+proc.on('exit', function (code, signal) {
+  process.on('exit', function(){
+    if (signal) {
+      process.kill(process.pid, signal);
+    } else {
+      process.exit(code);
+    }
+  });
+});
+
+// terminate children.
+process.on('SIGINT', function () {
+  proc.kill('SIGINT'); // calls runner.abort()
+  proc.kill('SIGTERM'); // if that didn't work, we're probably in an infinite loop, so make it die.
+});
diff --git a/node_modules/mocha/bin/options.js b/node_modules/mocha/bin/options.js
new file mode 100644
index 0000000..9d1a18a
--- /dev/null
+++ b/node_modules/mocha/bin/options.js
@@ -0,0 +1,39 @@
+/**
+ * Dependencies.
+ */
+
+var fs = require('fs');
+
+/**
+ * Export `getOptions`.
+ */
+
+module.exports = getOptions;
+
+/**
+ * Get options.
+ */
+
+function getOptions() {
+  var optsPath = process.argv.indexOf('--opts') !== -1
+        ? process.argv[process.argv.indexOf('--opts') + 1]
+        : 'test/mocha.opts';
+
+  try {
+    var opts = fs.readFileSync(optsPath, 'utf8')
+      .replace(/\\\s/g, '%20')
+      .split(/\s/)
+      .filter(Boolean)
+      .map(function(value) {
+        return value.replace(/%20/g, ' ');
+      });
+
+    process.argv = process.argv
+      .slice(0, 2)
+      .concat(opts.concat(process.argv.slice(2)));
+  } catch (err) {
+    // ignore
+  }
+
+  process.env.LOADED_MOCHA_OPTS = true;
+}
diff --git a/node_modules/mocha/images/error.png b/node_modules/mocha/images/error.png
new file mode 100644
index 0000000000000000000000000000000000000000..a07a1ba5efef3e4be01383485cdd59d87691ae7c
GIT binary patch
literal 412
zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xB}@#3=H#t6a&Ky28IX*
zhDI;bT+N
zJ_d#}3=HROY~H+F81S@RY}C7)_Aw#d|MtVb_a~h&)Rp4=QT2WP6Q!Vh`Tbw)C0L`Hjr0=~
z9$q`dGMD9A%ZpEiDeV&BjQ7mTJ@UL?o6p#BvCvJTmtn!~Z$T%V*(ZO9v7FD-TxB)0
zdg`1chBG#&VzR#-Sg`Tz{B++v?;f1y-of{vSo8emT75L`U_{(iyq;*ak
qoLzkFu?=s{K4<0MJ2ut-SB-zNMaS1nOp+JqO9oF@KbLh*2~7Z$dY*9r

literal 0
HcmV?d00001

diff --git a/node_modules/mocha/images/ok.png b/node_modules/mocha/images/ok.png
new file mode 100644
index 0000000000000000000000000000000000000000..b3623a59946024c48067d73d664e070dbc2d8a32
GIT binary patch
literal 388
zcmeAS@N?(olHy`uVBq!ia0vp^5+KaM3?#3wJbMaAB?S0{xJIori(YS*wAUIaKoBJF
zvj!rdveN6mWw-t6ABLwLvMapgS$QL{=59##Dd*y=UgdZE^Uk|v9Cc`W76(-P|8)8t
zpa!9mAiv!{OM$WnJzX3_DsF8(b5f{TLBu6cm|clU
zs#od6hyV36>l!DuJ~i6gRJ|(h>%N=uiCw`>-uwaww$}4;Jh;`b%=GEzCGjs473QC<
zoj;vb)**hkbI|rOH-CY(cRg0*&vrd;aO|w5Y!c5c%l3JVM=TdRUpN+^&tQ1$_04MM
zy$qe->%PkEb(kh#O!>DBXDc!!9W;kOl4QpsMNCpniSgx7V=EJjg 1) {
+        suites.shift();
+      }
+      var suite = Suite.create(suites[0], title);
+      suite.file = file;
+      suites.unshift(suite);
+      return suite;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.suite.only = function(title, fn) {
+      var suite = context.suite(title, fn);
+      mocha.grep(suite.fullTitle());
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.test = function(title, fn) {
+      var test = new Test(title, fn);
+      test.file = file;
+      suites[0].addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      var test = context.test(title, fn);
+      var reString = '^' + escapeRe(test.fullTitle()) + '$';
+      mocha.grep(new RegExp(reString));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
diff --git a/node_modules/mocha/lib/interfaces/tdd.js b/node_modules/mocha/lib/interfaces/tdd.js
new file mode 100644
index 0000000..d37936a
--- /dev/null
+++ b/node_modules/mocha/lib/interfaces/tdd.js
@@ -0,0 +1,106 @@
+/**
+ * Module dependencies.
+ */
+
+var Suite = require('../suite');
+var Test = require('../test');
+var escapeRe = require('escape-string-regexp');
+
+/**
+ * TDD-style interface:
+ *
+ *      suite('Array', function() {
+ *        suite('#indexOf()', function() {
+ *          suiteSetup(function() {
+ *
+ *          });
+ *
+ *          test('should return -1 when not present', function() {
+ *
+ *          });
+ *
+ *          test('should return the index when present', function() {
+ *
+ *          });
+ *
+ *          suiteTeardown(function() {
+ *
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on('pre-require', function(context, file, mocha) {
+    var common = require('./common')(suites, context);
+
+    context.setup = common.beforeEach;
+    context.teardown = common.afterEach;
+    context.suiteSetup = common.before;
+    context.suiteTeardown = common.after;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+
+    /**
+     * Describe a "suite" with the given `title` and callback `fn` containing
+     * nested suites and/or tests.
+     */
+    context.suite = function(title, fn) {
+      var suite = Suite.create(suites[0], title);
+      suite.file = file;
+      suites.unshift(suite);
+      fn.call(suite);
+      suites.shift();
+      return suite;
+    };
+
+    /**
+     * Pending suite.
+     */
+    context.suite.skip = function(title, fn) {
+      var suite = Suite.create(suites[0], title);
+      suite.pending = true;
+      suites.unshift(suite);
+      fn.call(suite);
+      suites.shift();
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+    context.suite.only = function(title, fn) {
+      var suite = context.suite(title, fn);
+      mocha.grep(suite.fullTitle());
+    };
+
+    /**
+     * Describe a specification or test-case with the given `title` and
+     * callback `fn` acting as a thunk.
+     */
+    context.test = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      var test = context.test(title, fn);
+      var reString = '^' + escapeRe(test.fullTitle()) + '$';
+      mocha.grep(new RegExp(reString));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
diff --git a/node_modules/mocha/lib/mocha.js b/node_modules/mocha/lib/mocha.js
new file mode 100644
index 0000000..46775ab
--- /dev/null
+++ b/node_modules/mocha/lib/mocha.js
@@ -0,0 +1,503 @@
+/*!
+ * mocha
+ * Copyright(c) 2011 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var escapeRe = require('escape-string-regexp');
+var path = require('path');
+var reporters = require('./reporters');
+var utils = require('./utils');
+
+/**
+ * Expose `Mocha`.
+ */
+
+exports = module.exports = Mocha;
+
+/**
+ * To require local UIs and reporters when running in node.
+ */
+
+if (!process.browser) {
+  var cwd = process.cwd();
+  module.paths.push(cwd, path.join(cwd, 'node_modules'));
+}
+
+/**
+ * Expose internals.
+ */
+
+exports.utils = utils;
+exports.interfaces = require('./interfaces');
+exports.reporters = reporters;
+exports.Runnable = require('./runnable');
+exports.Context = require('./context');
+exports.Runner = require('./runner');
+exports.Suite = require('./suite');
+exports.Hook = require('./hook');
+exports.Test = require('./test');
+
+/**
+ * Return image `name` path.
+ *
+ * @api private
+ * @param {string} name
+ * @return {string}
+ */
+function image(name) {
+  return path.join(__dirname, '../images', name + '.png');
+}
+
+/**
+ * Set up mocha with `options`.
+ *
+ * Options:
+ *
+ *   - `ui` name "bdd", "tdd", "exports" etc
+ *   - `reporter` reporter instance, defaults to `mocha.reporters.spec`
+ *   - `globals` array of accepted globals
+ *   - `timeout` timeout in milliseconds
+ *   - `retries` number of times to retry failed tests
+ *   - `bail` bail on the first test failure
+ *   - `slow` milliseconds to wait before considering a test slow
+ *   - `ignoreLeaks` ignore global leaks
+ *   - `fullTrace` display the full stack-trace on failing
+ *   - `grep` string or regexp to filter tests with
+ *
+ * @param {Object} options
+ * @api public
+ */
+function Mocha(options) {
+  options = options || {};
+  this.files = [];
+  this.options = options;
+  if (options.grep) {
+    this.grep(new RegExp(options.grep));
+  }
+  if (options.fgrep) {
+    this.grep(options.fgrep);
+  }
+  this.suite = new exports.Suite('', new exports.Context());
+  this.ui(options.ui);
+  this.bail(options.bail);
+  this.reporter(options.reporter, options.reporterOptions);
+  if (typeof options.timeout !== 'undefined' && options.timeout !== null) {
+    this.timeout(options.timeout);
+  }
+  if (typeof options.retries !== 'undefined' && options.retries !== null) {
+    this.retries(options.retries);
+  }
+  this.useColors(options.useColors);
+  if (options.enableTimeouts !== null) {
+    this.enableTimeouts(options.enableTimeouts);
+  }
+  if (options.slow) {
+    this.slow(options.slow);
+  }
+}
+
+/**
+ * Enable or disable bailing on the first failure.
+ *
+ * @api public
+ * @param {boolean} [bail]
+ */
+Mocha.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    bail = true;
+  }
+  this.suite.bail(bail);
+  return this;
+};
+
+/**
+ * Add test `file`.
+ *
+ * @api public
+ * @param {string} file
+ */
+Mocha.prototype.addFile = function(file) {
+  this.files.push(file);
+  return this;
+};
+
+/**
+ * Set reporter to `reporter`, defaults to "spec".
+ *
+ * @param {String|Function} reporter name or constructor
+ * @param {Object} reporterOptions optional options
+ * @api public
+ * @param {string|Function} reporter name or constructor
+ * @param {Object} reporterOptions optional options
+ */
+Mocha.prototype.reporter = function(reporter, reporterOptions) {
+  if (typeof reporter === 'function') {
+    this._reporter = reporter;
+  } else {
+    reporter = reporter || 'spec';
+    var _reporter;
+    // Try to load a built-in reporter.
+    if (reporters[reporter]) {
+      _reporter = reporters[reporter];
+    }
+    // Try to load reporters from process.cwd() and node_modules
+    if (!_reporter) {
+      try {
+        _reporter = require(reporter);
+      } catch (err) {
+        err.message.indexOf('Cannot find module') !== -1
+          ? console.warn('"' + reporter + '" reporter not found')
+          : console.warn('"' + reporter + '" reporter blew up with error:\n' + err.stack);
+      }
+    }
+    if (!_reporter && reporter === 'teamcity') {
+      console.warn('The Teamcity reporter was moved to a package named '
+        + 'mocha-teamcity-reporter '
+        + '(https://npmjs.org/package/mocha-teamcity-reporter).');
+    }
+    if (!_reporter) {
+      throw new Error('invalid reporter "' + reporter + '"');
+    }
+    this._reporter = _reporter;
+  }
+  this.options.reporterOptions = reporterOptions;
+  return this;
+};
+
+/**
+ * Set test UI `name`, defaults to "bdd".
+ *
+ * @api public
+ * @param {string} bdd
+ */
+Mocha.prototype.ui = function(name) {
+  name = name || 'bdd';
+  this._ui = exports.interfaces[name];
+  if (!this._ui) {
+    try {
+      this._ui = require(name);
+    } catch (err) {
+      throw new Error('invalid interface "' + name + '"');
+    }
+  }
+  this._ui = this._ui(this.suite);
+
+  this.suite.on('pre-require', function(context) {
+    exports.afterEach = context.afterEach || context.teardown;
+    exports.after = context.after || context.suiteTeardown;
+    exports.beforeEach = context.beforeEach || context.setup;
+    exports.before = context.before || context.suiteSetup;
+    exports.describe = context.describe || context.suite;
+    exports.it = context.it || context.test;
+    exports.setup = context.setup || context.beforeEach;
+    exports.suiteSetup = context.suiteSetup || context.before;
+    exports.suiteTeardown = context.suiteTeardown || context.after;
+    exports.suite = context.suite || context.describe;
+    exports.teardown = context.teardown || context.afterEach;
+    exports.test = context.test || context.it;
+    exports.run = context.run;
+  });
+
+  return this;
+};
+
+/**
+ * Load registered files.
+ *
+ * @api private
+ */
+Mocha.prototype.loadFiles = function(fn) {
+  var self = this;
+  var suite = this.suite;
+  this.files.forEach(function(file) {
+    file = path.resolve(file);
+    suite.emit('pre-require', global, file, self);
+    suite.emit('require', require(file), file, self);
+    suite.emit('post-require', global, file, self);
+  });
+  fn && fn();
+};
+
+/**
+ * Enable growl support.
+ *
+ * @api private
+ */
+Mocha.prototype._growl = function(runner, reporter) {
+  var notify = require('growl');
+
+  runner.on('end', function() {
+    var stats = reporter.stats;
+    if (stats.failures) {
+      var msg = stats.failures + ' of ' + runner.total + ' tests failed';
+      notify(msg, { name: 'mocha', title: 'Failed', image: image('error') });
+    } else {
+      notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', {
+        name: 'mocha',
+        title: 'Passed',
+        image: image('ok')
+      });
+    }
+  });
+};
+
+/**
+ * Add regexp to grep, if `re` is a string it is escaped.
+ *
+ * @param {RegExp|String} re
+ * @return {Mocha}
+ * @api public
+ * @param {RegExp|string} re
+ * @return {Mocha}
+ */
+Mocha.prototype.grep = function(re) {
+  this.options.grep = typeof re === 'string' ? new RegExp(escapeRe(re)) : re;
+  return this;
+};
+
+/**
+ * Invert `.grep()` matches.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.invert = function() {
+  this.options.invert = true;
+  return this;
+};
+
+/**
+ * Ignore global leaks.
+ *
+ * @param {Boolean} ignore
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} ignore
+ * @return {Mocha}
+ */
+Mocha.prototype.ignoreLeaks = function(ignore) {
+  this.options.ignoreLeaks = Boolean(ignore);
+  return this;
+};
+
+/**
+ * Enable global leak checking.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.checkLeaks = function() {
+  this.options.ignoreLeaks = false;
+  return this;
+};
+
+/**
+ * Display long stack-trace on failing
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.fullTrace = function() {
+  this.options.fullStackTrace = true;
+  return this;
+};
+
+/**
+ * Enable growl support.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.growl = function() {
+  this.options.growl = true;
+  return this;
+};
+
+/**
+ * Ignore `globals` array or string.
+ *
+ * @param {Array|String} globals
+ * @return {Mocha}
+ * @api public
+ * @param {Array|string} globals
+ * @return {Mocha}
+ */
+Mocha.prototype.globals = function(globals) {
+  this.options.globals = (this.options.globals || []).concat(globals);
+  return this;
+};
+
+/**
+ * Emit color output.
+ *
+ * @param {Boolean} colors
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} colors
+ * @return {Mocha}
+ */
+Mocha.prototype.useColors = function(colors) {
+  if (colors !== undefined) {
+    this.options.useColors = colors;
+  }
+  return this;
+};
+
+/**
+ * Use inline diffs rather than +/-.
+ *
+ * @param {Boolean} inlineDiffs
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} inlineDiffs
+ * @return {Mocha}
+ */
+Mocha.prototype.useInlineDiffs = function(inlineDiffs) {
+  this.options.useInlineDiffs = inlineDiffs !== undefined && inlineDiffs;
+  return this;
+};
+
+/**
+ * Set the timeout in milliseconds.
+ *
+ * @param {Number} timeout
+ * @return {Mocha}
+ * @api public
+ * @param {number} timeout
+ * @return {Mocha}
+ */
+Mocha.prototype.timeout = function(timeout) {
+  this.suite.timeout(timeout);
+  return this;
+};
+
+/**
+ * Set the number of times to retry failed tests.
+ *
+ * @param {Number} retry times
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.retries = function(n) {
+  this.suite.retries(n);
+  return this;
+};
+
+/**
+ * Set slowness threshold in milliseconds.
+ *
+ * @param {Number} slow
+ * @return {Mocha}
+ * @api public
+ * @param {number} slow
+ * @return {Mocha}
+ */
+Mocha.prototype.slow = function(slow) {
+  this.suite.slow(slow);
+  return this;
+};
+
+/**
+ * Enable timeouts.
+ *
+ * @param {Boolean} enabled
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} enabled
+ * @return {Mocha}
+ */
+Mocha.prototype.enableTimeouts = function(enabled) {
+  this.suite.enableTimeouts(arguments.length && enabled !== undefined ? enabled : true);
+  return this;
+};
+
+/**
+ * Makes all tests async (accepting a callback)
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.asyncOnly = function() {
+  this.options.asyncOnly = true;
+  return this;
+};
+
+/**
+ * Disable syntax highlighting (in browser).
+ *
+ * @api public
+ */
+Mocha.prototype.noHighlighting = function() {
+  this.options.noHighlighting = true;
+  return this;
+};
+
+/**
+ * Enable uncaught errors to propagate (in browser).
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.allowUncaught = function() {
+  this.options.allowUncaught = true;
+  return this;
+};
+
+/**
+ * Delay root suite execution.
+ * @returns {Mocha}
+ */
+Mocha.prototype.delay = function delay() {
+  this.options.delay = true;
+  return this;
+};
+
+/**
+ * Run tests and invoke `fn()` when complete.
+ *
+ * @api public
+ * @param {Function} fn
+ * @return {Runner}
+ */
+Mocha.prototype.run = function(fn) {
+  if (this.files.length) {
+    this.loadFiles();
+  }
+  var suite = this.suite;
+  var options = this.options;
+  options.files = this.files;
+  var runner = new exports.Runner(suite, options.delay);
+  var reporter = new this._reporter(runner, options);
+  runner.ignoreLeaks = options.ignoreLeaks !== false;
+  runner.fullStackTrace = options.fullStackTrace;
+  runner.asyncOnly = options.asyncOnly;
+  runner.allowUncaught = options.allowUncaught;
+  if (options.grep) {
+    runner.grep(options.grep, options.invert);
+  }
+  if (options.globals) {
+    runner.globals(options.globals);
+  }
+  if (options.growl) {
+    this._growl(runner, reporter);
+  }
+  if (options.useColors !== undefined) {
+    exports.reporters.Base.useColors = options.useColors;
+  }
+  exports.reporters.Base.inlineDiffs = options.useInlineDiffs;
+
+  function done(failures) {
+    if (reporter.done) {
+      reporter.done(failures, fn);
+    } else {
+      fn && fn(failures);
+    }
+  }
+
+  return runner.run(done);
+};
diff --git a/node_modules/mocha/lib/ms.js b/node_modules/mocha/lib/ms.js
new file mode 100644
index 0000000..12fddc1
--- /dev/null
+++ b/node_modules/mocha/lib/ms.js
@@ -0,0 +1,128 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @api public
+ * @param {string|number} val
+ * @param {Object} options
+ * @return {string|number}
+ */
+module.exports = function(val, options) {
+  options = options || {};
+  if (typeof val === 'string') {
+    return parse(val);
+  }
+  // https://github.com/mochajs/mocha/pull/1035
+  return options['long'] ? longFormat(val) : shortFormat(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @api private
+ * @param {string} str
+ * @return {number}
+ */
+function parse(str) {
+  var match = (/^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i).exec(str);
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 's':
+      return n * s;
+    case 'ms':
+      return n;
+    default:
+      // No default case
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @api private
+ * @param {number} ms
+ * @return {string}
+ */
+function shortFormat(ms) {
+  if (ms >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (ms >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (ms >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (ms >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @api private
+ * @param {number} ms
+ * @return {string}
+ */
+function longFormat(ms) {
+  return plural(ms, d, 'day')
+    || plural(ms, h, 'hour')
+    || plural(ms, m, 'minute')
+    || plural(ms, s, 'second')
+    || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ *
+ * @api private
+ * @param {number} ms
+ * @param {number} n
+ * @param {string} name
+ */
+function plural(ms, n, name) {
+  if (ms < n) {
+    return;
+  }
+  if (ms < n * 1.5) {
+    return Math.floor(ms / n) + ' ' + name;
+  }
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}
diff --git a/node_modules/mocha/lib/pending.js b/node_modules/mocha/lib/pending.js
new file mode 100644
index 0000000..c847e04
--- /dev/null
+++ b/node_modules/mocha/lib/pending.js
@@ -0,0 +1,15 @@
+
+/**
+ * Expose `Pending`.
+ */
+
+module.exports = Pending;
+
+/**
+ * Initialize a new `Pending` error with the given message.
+ *
+ * @param {string} message
+ */
+function Pending(message) {
+  this.message = message;
+}
diff --git a/node_modules/mocha/lib/reporters/base.js b/node_modules/mocha/lib/reporters/base.js
new file mode 100644
index 0000000..5fe0eb7
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/base.js
@@ -0,0 +1,487 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var diff = require('diff');
+var ms = require('../ms');
+var utils = require('../utils');
+var supportsColor = process.browser ? null : require('supports-color');
+
+/**
+ * Expose `Base`.
+ */
+
+exports = module.exports = Base;
+
+/**
+ * Save timer references to avoid Sinon interfering.
+ * See: https://github.com/mochajs/mocha/issues/237
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Check if both stdio streams are associated with a tty.
+ */
+
+var isatty = tty.isatty(1) && tty.isatty(2);
+
+/**
+ * Enable coloring by default, except in the browser interface.
+ */
+
+exports.useColors = !process.browser && (supportsColor || (process.env.MOCHA_COLORS !== undefined));
+
+/**
+ * Inline diffs instead of +/-
+ */
+
+exports.inlineDiffs = false;
+
+/**
+ * Default color map.
+ */
+
+exports.colors = {
+  pass: 90,
+  fail: 31,
+  'bright pass': 92,
+  'bright fail': 91,
+  'bright yellow': 93,
+  pending: 36,
+  suite: 0,
+  'error title': 0,
+  'error message': 31,
+  'error stack': 90,
+  checkmark: 32,
+  fast: 90,
+  medium: 33,
+  slow: 31,
+  green: 32,
+  light: 90,
+  'diff gutter': 90,
+  'diff added': 32,
+  'diff removed': 31
+};
+
+/**
+ * Default symbol map.
+ */
+
+exports.symbols = {
+  ok: '✓',
+  err: '✖',
+  dot: '․'
+};
+
+// With node.js on Windows: use symbols available in terminal default fonts
+if (process.platform === 'win32') {
+  exports.symbols.ok = '\u221A';
+  exports.symbols.err = '\u00D7';
+  exports.symbols.dot = '.';
+}
+
+/**
+ * Color `str` with the given `type`,
+ * allowing colors to be disabled,
+ * as well as user-defined color
+ * schemes.
+ *
+ * @param {string} type
+ * @param {string} str
+ * @return {string}
+ * @api private
+ */
+var color = exports.color = function(type, str) {
+  if (!exports.useColors) {
+    return String(str);
+  }
+  return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Expose term window size, with some defaults for when stderr is not a tty.
+ */
+
+exports.window = {
+  width: 75
+};
+
+if (isatty) {
+  exports.window.width = process.stdout.getWindowSize
+      ? process.stdout.getWindowSize(1)[0]
+      : tty.getWindowSize()[1];
+}
+
+/**
+ * Expose some basic cursor interactions that are common among reporters.
+ */
+
+exports.cursor = {
+  hide: function() {
+    isatty && process.stdout.write('\u001b[?25l');
+  },
+
+  show: function() {
+    isatty && process.stdout.write('\u001b[?25h');
+  },
+
+  deleteLine: function() {
+    isatty && process.stdout.write('\u001b[2K');
+  },
+
+  beginningOfLine: function() {
+    isatty && process.stdout.write('\u001b[0G');
+  },
+
+  CR: function() {
+    if (isatty) {
+      exports.cursor.deleteLine();
+      exports.cursor.beginningOfLine();
+    } else {
+      process.stdout.write('\r');
+    }
+  }
+};
+
+/**
+ * Outut the given `failures` as a list.
+ *
+ * @param {Array} failures
+ * @api public
+ */
+
+exports.list = function(failures) {
+  console.log();
+  failures.forEach(function(test, i) {
+    // format
+    var fmt = color('error title', '  %s) %s:\n')
+      + color('error message', '     %s')
+      + color('error stack', '\n%s\n');
+
+    // msg
+    var msg;
+    var err = test.err;
+    var message;
+    if (err.message && typeof err.message.toString === 'function') {
+      message = err.message + '';
+    } else if (typeof err.inspect === 'function') {
+      message = err.inspect() + '';
+    } else {
+      message = '';
+    }
+    var stack = err.stack || message;
+    var index = stack.indexOf(message);
+    var actual = err.actual;
+    var expected = err.expected;
+    var escape = true;
+
+    if (index === -1) {
+      msg = message;
+    } else {
+      index += message.length;
+      msg = stack.slice(0, index);
+      // remove msg from stack
+      stack = stack.slice(index + 1);
+    }
+
+    // uncaught
+    if (err.uncaught) {
+      msg = 'Uncaught ' + msg;
+    }
+    // explicitly show diff
+    if (err.showDiff !== false && sameType(actual, expected) && expected !== undefined) {
+      escape = false;
+      if (!(utils.isString(actual) && utils.isString(expected))) {
+        err.actual = actual = utils.stringify(actual);
+        err.expected = expected = utils.stringify(expected);
+      }
+
+      fmt = color('error title', '  %s) %s:\n%s') + color('error stack', '\n%s\n');
+      var match = message.match(/^([^:]+): expected/);
+      msg = '\n      ' + color('error message', match ? match[1] : msg);
+
+      if (exports.inlineDiffs) {
+        msg += inlineDiff(err, escape);
+      } else {
+        msg += unifiedDiff(err, escape);
+      }
+    }
+
+    // indent stack trace
+    stack = stack.replace(/^/gm, '  ');
+
+    console.log(fmt, (i + 1), test.fullTitle(), msg, stack);
+  });
+};
+
+/**
+ * Initialize a new `Base` reporter.
+ *
+ * All other reporters generally
+ * inherit from this reporter, providing
+ * stats such as test duration, number
+ * of tests passed / failed etc.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+
+function Base(runner) {
+  var stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 };
+  var failures = this.failures = [];
+
+  if (!runner) {
+    return;
+  }
+  this.runner = runner;
+
+  runner.stats = stats;
+
+  runner.on('start', function() {
+    stats.start = new Date();
+  });
+
+  runner.on('suite', function(suite) {
+    stats.suites = stats.suites || 0;
+    suite.root || stats.suites++;
+  });
+
+  runner.on('test end', function() {
+    stats.tests = stats.tests || 0;
+    stats.tests++;
+  });
+
+  runner.on('pass', function(test) {
+    stats.passes = stats.passes || 0;
+
+    if (test.duration > test.slow()) {
+      test.speed = 'slow';
+    } else if (test.duration > test.slow() / 2) {
+      test.speed = 'medium';
+    } else {
+      test.speed = 'fast';
+    }
+
+    stats.passes++;
+  });
+
+  runner.on('fail', function(test, err) {
+    stats.failures = stats.failures || 0;
+    stats.failures++;
+    test.err = err;
+    failures.push(test);
+  });
+
+  runner.on('end', function() {
+    stats.end = new Date();
+    stats.duration = new Date() - stats.start;
+  });
+
+  runner.on('pending', function() {
+    stats.pending++;
+  });
+}
+
+/**
+ * Output common epilogue used by many of
+ * the bundled reporters.
+ *
+ * @api public
+ */
+Base.prototype.epilogue = function() {
+  var stats = this.stats;
+  var fmt;
+
+  console.log();
+
+  // passes
+  fmt = color('bright pass', ' ')
+    + color('green', ' %d passing')
+    + color('light', ' (%s)');
+
+  console.log(fmt,
+    stats.passes || 0,
+    ms(stats.duration));
+
+  // pending
+  if (stats.pending) {
+    fmt = color('pending', ' ')
+      + color('pending', ' %d pending');
+
+    console.log(fmt, stats.pending);
+  }
+
+  // failures
+  if (stats.failures) {
+    fmt = color('fail', '  %d failing');
+
+    console.log(fmt, stats.failures);
+
+    Base.list(this.failures);
+    console.log();
+  }
+
+  console.log();
+};
+
+/**
+ * Pad the given `str` to `len`.
+ *
+ * @api private
+ * @param {string} str
+ * @param {string} len
+ * @return {string}
+ */
+function pad(str, len) {
+  str = String(str);
+  return Array(len - str.length + 1).join(' ') + str;
+}
+
+/**
+ * Returns an inline diff between 2 strings with coloured ANSI output
+ *
+ * @api private
+ * @param {Error} err with actual/expected
+ * @param {boolean} escape
+ * @return {string} Diff
+ */
+function inlineDiff(err, escape) {
+  var msg = errorDiff(err, 'WordsWithSpace', escape);
+
+  // linenos
+  var lines = msg.split('\n');
+  if (lines.length > 4) {
+    var width = String(lines.length).length;
+    msg = lines.map(function(str, i) {
+      return pad(++i, width) + ' |' + ' ' + str;
+    }).join('\n');
+  }
+
+  // legend
+  msg = '\n'
+    + color('diff removed', 'actual')
+    + ' '
+    + color('diff added', 'expected')
+    + '\n\n'
+    + msg
+    + '\n';
+
+  // indent
+  msg = msg.replace(/^/gm, '      ');
+  return msg;
+}
+
+/**
+ * Returns a unified diff between two strings.
+ *
+ * @api private
+ * @param {Error} err with actual/expected
+ * @param {boolean} escape
+ * @return {string} The diff.
+ */
+function unifiedDiff(err, escape) {
+  var indent = '      ';
+  function cleanUp(line) {
+    if (escape) {
+      line = escapeInvisibles(line);
+    }
+    if (line[0] === '+') {
+      return indent + colorLines('diff added', line);
+    }
+    if (line[0] === '-') {
+      return indent + colorLines('diff removed', line);
+    }
+    if (line.match(/\@\@/)) {
+      return null;
+    }
+    if (line.match(/\\ No newline/)) {
+      return null;
+    }
+    return indent + line;
+  }
+  function notBlank(line) {
+    return typeof line !== 'undefined' && line !== null;
+  }
+  var msg = diff.createPatch('string', err.actual, err.expected);
+  var lines = msg.split('\n').splice(4);
+  return '\n      '
+    + colorLines('diff added', '+ expected') + ' '
+    + colorLines('diff removed', '- actual')
+    + '\n\n'
+    + lines.map(cleanUp).filter(notBlank).join('\n');
+}
+
+/**
+ * Return a character diff for `err`.
+ *
+ * @api private
+ * @param {Error} err
+ * @param {string} type
+ * @param {boolean} escape
+ * @return {string}
+ */
+function errorDiff(err, type, escape) {
+  var actual = escape ? escapeInvisibles(err.actual) : err.actual;
+  var expected = escape ? escapeInvisibles(err.expected) : err.expected;
+  return diff['diff' + type](actual, expected).map(function(str) {
+    if (str.added) {
+      return colorLines('diff added', str.value);
+    }
+    if (str.removed) {
+      return colorLines('diff removed', str.value);
+    }
+    return str.value;
+  }).join('');
+}
+
+/**
+ * Returns a string with all invisible characters in plain text
+ *
+ * @api private
+ * @param {string} line
+ * @return {string}
+ */
+function escapeInvisibles(line) {
+  return line.replace(/\t/g, '')
+    .replace(/\r/g, '')
+    .replace(/\n/g, '\n');
+}
+
+/**
+ * Color lines for `str`, using the color `name`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {string} str
+ * @return {string}
+ */
+function colorLines(name, str) {
+  return str.split('\n').map(function(str) {
+    return color(name, str);
+  }).join('\n');
+}
+
+/**
+ * Object#toString reference.
+ */
+var objToString = Object.prototype.toString;
+
+/**
+ * Check that a / b have the same type.
+ *
+ * @api private
+ * @param {Object} a
+ * @param {Object} b
+ * @return {boolean}
+ */
+function sameType(a, b) {
+  return objToString.call(a) === objToString.call(b);
+}
diff --git a/node_modules/mocha/lib/reporters/doc.js b/node_modules/mocha/lib/reporters/doc.js
new file mode 100644
index 0000000..01f3fdc
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/doc.js
@@ -0,0 +1,62 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+
+/**
+ * Expose `Doc`.
+ */
+
+exports = module.exports = Doc;
+
+/**
+ * Initialize a new `Doc` reporter.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+function Doc(runner) {
+  Base.call(this, runner);
+
+  var indents = 2;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on('suite', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    ++indents;
+    console.log('%s
', indent());
+    ++indents;
+    console.log('%s
%s
', indent(), utils.escape(suite.title));
+    console.log('%s
', indent());
+  });
+
+  runner.on('suite end', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    console.log('%s
', indent());
+    --indents;
+    console.log('%s
', indent());
+    --indents;
+  });
+
+  runner.on('pass', function(test) {
+    console.log('%s  
%s
', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.body));
+    console.log('%s  
%s
', indent(), code);
+  });
+
+  runner.on('fail', function(test, err) {
+    console.log('%s  
%s
', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.fn.body));
+    console.log('%s  
%s
', indent(), code);
+    console.log('%s  
%s
', indent(), utils.escape(err));
+  });
+}
diff --git a/node_modules/mocha/lib/reporters/dot.js b/node_modules/mocha/lib/reporters/dot.js
new file mode 100644
index 0000000..e905dc6
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/dot.js
@@ -0,0 +1,66 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = Dot;
+
+/**
+ * Initialize a new `Dot` matrix test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Dot(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var n = -1;
+
+  runner.on('start', function() {
+    process.stdout.write('\n');
+  });
+
+  runner.on('pending', function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(color('pending', Base.symbols.dot));
+  });
+
+  runner.on('pass', function(test) {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    if (test.speed === 'slow') {
+      process.stdout.write(color('bright yellow', Base.symbols.dot));
+    } else {
+      process.stdout.write(color(test.speed, Base.symbols.dot));
+    }
+  });
+
+  runner.on('fail', function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(color('fail', Base.symbols.dot));
+  });
+
+  runner.on('end', function() {
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Dot, Base);
diff --git a/node_modules/mocha/lib/reporters/html-cov.js b/node_modules/mocha/lib/reporters/html-cov.js
new file mode 100644
index 0000000..e3f2dd9
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/html-cov.js
@@ -0,0 +1,56 @@
+/**
+ * Module dependencies.
+ */
+
+var JSONCov = require('./json-cov');
+var readFileSync = require('fs').readFileSync;
+var join = require('path').join;
+
+/**
+ * Expose `HTMLCov`.
+ */
+
+exports = module.exports = HTMLCov;
+
+/**
+ * Initialize a new `JsCoverage` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function HTMLCov(runner) {
+  var jade = require('jade');
+  var file = join(__dirname, '/templates/coverage.jade');
+  var str = readFileSync(file, 'utf8');
+  var fn = jade.compile(str, { filename: file });
+  var self = this;
+
+  JSONCov.call(this, runner, false);
+
+  runner.on('end', function() {
+    process.stdout.write(fn({
+      cov: self.cov,
+      coverageClass: coverageClass
+    }));
+  });
+}
+
+/**
+ * Return coverage class for a given coverage percentage.
+ *
+ * @api private
+ * @param {number} coveragePctg
+ * @return {string}
+ */
+function coverageClass(coveragePctg) {
+  if (coveragePctg >= 75) {
+    return 'high';
+  }
+  if (coveragePctg >= 50) {
+    return 'medium';
+  }
+  if (coveragePctg >= 25) {
+    return 'low';
+  }
+  return 'terrible';
+}
diff --git a/node_modules/mocha/lib/reporters/html.js b/node_modules/mocha/lib/reporters/html.js
new file mode 100644
index 0000000..5167d18
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/html.js
@@ -0,0 +1,343 @@
+/* eslint-env browser */
+
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var Progress = require('../browser/progress');
+var escapeRe = require('escape-string-regexp');
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Expose `HTML`.
+ */
+
+exports = module.exports = HTML;
+
+/**
+ * Stats template.
+ */
+
+var statsTemplate = '';
+
+/**
+ * Initialize a new `HTML` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function HTML(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var stats = this.stats;
+  var stat = fragment(statsTemplate);
+  var items = stat.getElementsByTagName('li');
+  var passes = items[1].getElementsByTagName('em')[0];
+  var passesLink = items[1].getElementsByTagName('a')[0];
+  var failures = items[2].getElementsByTagName('em')[0];
+  var failuresLink = items[2].getElementsByTagName('a')[0];
+  var duration = items[3].getElementsByTagName('em')[0];
+  var canvas = stat.getElementsByTagName('canvas')[0];
+  var report = fragment('
    ');
+  var stack = [report];
+  var progress;
+  var ctx;
+  var root = document.getElementById('mocha');
+
+  if (canvas.getContext) {
+    var ratio = window.devicePixelRatio || 1;
+    canvas.style.width = canvas.width;
+    canvas.style.height = canvas.height;
+    canvas.width *= ratio;
+    canvas.height *= ratio;
+    ctx = canvas.getContext('2d');
+    ctx.scale(ratio, ratio);
+    progress = new Progress();
+  }
+
+  if (!root) {
+    return error('#mocha div missing, add it to your document');
+  }
+
+  // pass toggle
+  on(passesLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = (/pass/).test(report.className) ? '' : ' pass';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test pass');
+    }
+  });
+
+  // failure toggle
+  on(failuresLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = (/fail/).test(report.className) ? '' : ' fail';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test fail');
+    }
+  });
+
+  root.appendChild(stat);
+  root.appendChild(report);
+
+  if (progress) {
+    progress.size(40);
+  }
+
+  runner.on('suite', function(suite) {
+    if (suite.root) {
+      return;
+    }
+
+    // suite
+    var url = self.suiteURL(suite);
+    var el = fragment('
  • %s
    • ', url, escape(suite.title));
+
+    // container
+    stack[0].appendChild(el);
+    stack.unshift(document.createElement('ul'));
+    el.appendChild(stack[0]);
+  });
+
+  runner.on('suite end', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    stack.shift();
+  });
+
+  runner.on('pass', function(test) {
+    var url = self.testURL(test);
+    var markup = '
  • %e%ems '
+      + '‣
    • ';
+    var el = fragment(markup, test.speed, test.title, test.duration, url);
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on('fail', function(test) {
+    var el = fragment('
  • %e ‣
    • ',
+      test.title, self.testURL(test));
+    var stackString; // Note: Includes leading newline
+    var message = test.err.toString();
+
+    // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we
+    // check for the result of the stringifying.
+    if (message === '[object Error]') {
+      message = test.err.message;
+    }
+
+    if (test.err.stack) {
+      var indexOfMessage = test.err.stack.indexOf(test.err.message);
+      if (indexOfMessage === -1) {
+        stackString = test.err.stack;
+      } else {
+        stackString = test.err.stack.substr(test.err.message.length + indexOfMessage);
+      }
+    } else if (test.err.sourceURL && test.err.line !== undefined) {
+      // Safari doesn't give you a stack. Let's at least provide a source line.
+      stackString = '\n(' + test.err.sourceURL + ':' + test.err.line + ')';
+    }
+
+    stackString = stackString || '';
+
+    if (test.err.htmlMessage && stackString) {
+      el.appendChild(fragment('
    %s\n
    %e
    ',
+        test.err.htmlMessage, stackString));
+    } else if (test.err.htmlMessage) {
+      el.appendChild(fragment('
    %s
    ', test.err.htmlMessage));
+    } else {
+      el.appendChild(fragment('
    %e%e
    ', message, stackString));
+    }
+
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on('pending', function(test) {
+    var el = fragment('
  • %e
    • ', test.title);
+    appendToStack(el);
+    updateStats();
+  });
+
+  function appendToStack(el) {
+    // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack.
+    if (stack[0]) {
+      stack[0].appendChild(el);
+    }
+  }
+
+  function updateStats() {
+    // TODO: add to stats
+    var percent = stats.tests / this.total * 100 | 0;
+    if (progress) {
+      progress.update(percent).draw(ctx);
+    }
+
+    // update stats
+    var ms = new Date() - stats.start;
+    text(passes, stats.passes);
+    text(failures, stats.failures);
+    text(duration, (ms / 1000).toFixed(2));
+  }
+}
+
+/**
+ * Makes a URL, preserving querystring ("search") parameters.
+ *
+ * @param {string} s
+ * @return {string} A new URL.
+ */
+function makeUrl(s) {
+  var search = window.location.search;
+
+  // Remove previous grep query parameter if present
+  if (search) {
+    search = search.replace(/[?&]grep=[^&\s]*/g, '').replace(/^&/, '?');
+  }
+
+  return window.location.pathname + (search ? search + '&' : '?') + 'grep=' + encodeURIComponent(escapeRe(s));
+}
+
+/**
+ * Provide suite URL.
+ *
+ * @param {Object} [suite]
+ */
+HTML.prototype.suiteURL = function(suite) {
+  return makeUrl(suite.fullTitle());
+};
+
+/**
+ * Provide test URL.
+ *
+ * @param {Object} [test]
+ */
+HTML.prototype.testURL = function(test) {
+  return makeUrl(test.fullTitle());
+};
+
+/**
+ * Adds code toggle functionality for the provided test's list element.
+ *
+ * @param {HTMLLIElement} el
+ * @param {string} contents
+ */
+HTML.prototype.addCodeToggle = function(el, contents) {
+  var h2 = el.getElementsByTagName('h2')[0];
+
+  on(h2, 'click', function() {
+    pre.style.display = pre.style.display === 'none' ? 'block' : 'none';
+  });
+
+  var pre = fragment('
    %e
    ', utils.clean(contents));
+  el.appendChild(pre);
+  pre.style.display = 'none';
+};
+
+/**
+ * Display error `msg`.
+ *
+ * @param {string} msg
+ */
+function error(msg) {
+  document.body.appendChild(fragment('
    %s
    ', msg));
+}
+
+/**
+ * Return a DOM fragment from `html`.
+ *
+ * @param {string} html
+ */
+function fragment(html) {
+  var args = arguments;
+  var div = document.createElement('div');
+  var i = 1;
+
+  div.innerHTML = html.replace(/%([se])/g, function(_, type) {
+    switch (type) {
+      case 's': return String(args[i++]);
+      case 'e': return escape(args[i++]);
+      // no default
+    }
+  });
+
+  return div.firstChild;
+}
+
+/**
+ * Check for suites that do not have elements
+ * with `classname`, and hide them.
+ *
+ * @param {text} classname
+ */
+function hideSuitesWithout(classname) {
+  var suites = document.getElementsByClassName('suite');
+  for (var i = 0; i < suites.length; i++) {
+    var els = suites[i].getElementsByClassName(classname);
+    if (!els.length) {
+      suites[i].className += ' hidden';
+    }
+  }
+}
+
+/**
+ * Unhide .hidden suites.
+ */
+function unhide() {
+  var els = document.getElementsByClassName('suite hidden');
+  for (var i = 0; i < els.length; ++i) {
+    els[i].className = els[i].className.replace('suite hidden', 'suite');
+  }
+}
+
+/**
+ * Set an element's text contents.
+ *
+ * @param {HTMLElement} el
+ * @param {string} contents
+ */
+function text(el, contents) {
+  if (el.textContent) {
+    el.textContent = contents;
+  } else {
+    el.innerText = contents;
+  }
+}
+
+/**
+ * Listen on `event` with callback `fn`.
+ */
+function on(el, event, fn) {
+  if (el.addEventListener) {
+    el.addEventListener(event, fn, false);
+  } else {
+    el.attachEvent('on' + event, fn);
+  }
+}
diff --git a/node_modules/mocha/lib/reporters/index.js b/node_modules/mocha/lib/reporters/index.js
new file mode 100644
index 0000000..51f5cff
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/index.js
@@ -0,0 +1,19 @@
+// Alias exports to a their normalized format Mocha#reporter to prevent a need
+// for dynamic (try/catch) requires, which Browserify doesn't handle.
+exports.Base = exports.base = require('./base');
+exports.Dot = exports.dot = require('./dot');
+exports.Doc = exports.doc = require('./doc');
+exports.TAP = exports.tap = require('./tap');
+exports.JSON = exports.json = require('./json');
+exports.HTML = exports.html = require('./html');
+exports.List = exports.list = require('./list');
+exports.Min = exports.min = require('./min');
+exports.Spec = exports.spec = require('./spec');
+exports.Nyan = exports.nyan = require('./nyan');
+exports.XUnit = exports.xunit = require('./xunit');
+exports.Markdown = exports.markdown = require('./markdown');
+exports.Progress = exports.progress = require('./progress');
+exports.Landing = exports.landing = require('./landing');
+exports.JSONCov = exports['json-cov'] = require('./json-cov');
+exports.HTMLCov = exports['html-cov'] = require('./html-cov');
+exports.JSONStream = exports['json-stream'] = require('./json-stream');
diff --git a/node_modules/mocha/lib/reporters/json-cov.js b/node_modules/mocha/lib/reporters/json-cov.js
new file mode 100644
index 0000000..5a32569
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/json-cov.js
@@ -0,0 +1,151 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `JSONCov`.
+ */
+
+exports = module.exports = JSONCov;
+
+/**
+ * Initialize a new `JsCoverage` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ * @param {boolean} output
+ */
+function JSONCov(runner, output) {
+  Base.call(this, runner);
+
+  output = arguments.length === 1 || output;
+  var self = this;
+  var tests = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on('test end', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    passes.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    failures.push(test);
+  });
+
+  runner.on('end', function() {
+    var cov = global._$jscoverage || {};
+    var result = self.cov = map(cov);
+    result.stats = self.stats;
+    result.tests = tests.map(clean);
+    result.failures = failures.map(clean);
+    result.passes = passes.map(clean);
+    if (!output) {
+      return;
+    }
+    process.stdout.write(JSON.stringify(result, null, 2));
+  });
+}
+
+/**
+ * Map jscoverage data to a JSON structure
+ * suitable for reporting.
+ *
+ * @api private
+ * @param {Object} cov
+ * @return {Object}
+ */
+
+function map(cov) {
+  var ret = {
+    instrumentation: 'node-jscoverage',
+    sloc: 0,
+    hits: 0,
+    misses: 0,
+    coverage: 0,
+    files: []
+  };
+
+  for (var filename in cov) {
+    if (Object.prototype.hasOwnProperty.call(cov, filename)) {
+      var data = coverage(filename, cov[filename]);
+      ret.files.push(data);
+      ret.hits += data.hits;
+      ret.misses += data.misses;
+      ret.sloc += data.sloc;
+    }
+  }
+
+  ret.files.sort(function(a, b) {
+    return a.filename.localeCompare(b.filename);
+  });
+
+  if (ret.sloc > 0) {
+    ret.coverage = (ret.hits / ret.sloc) * 100;
+  }
+
+  return ret;
+}
+
+/**
+ * Map jscoverage data for a single source file
+ * to a JSON structure suitable for reporting.
+ *
+ * @api private
+ * @param {string} filename name of the source file
+ * @param {Object} data jscoverage coverage data
+ * @return {Object}
+ */
+function coverage(filename, data) {
+  var ret = {
+    filename: filename,
+    coverage: 0,
+    hits: 0,
+    misses: 0,
+    sloc: 0,
+    source: {}
+  };
+
+  data.source.forEach(function(line, num) {
+    num++;
+
+    if (data[num] === 0) {
+      ret.misses++;
+      ret.sloc++;
+    } else if (data[num] !== undefined) {
+      ret.hits++;
+      ret.sloc++;
+    }
+
+    ret.source[num] = {
+      source: line,
+      coverage: data[num] === undefined ? '' : data[num]
+    };
+  });
+
+  ret.coverage = ret.hits / ret.sloc * 100;
+
+  return ret;
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    fullTitle: test.fullTitle(),
+    title: test.title
+  };
+}
diff --git a/node_modules/mocha/lib/reporters/json-stream.js b/node_modules/mocha/lib/reporters/json-stream.js
new file mode 100644
index 0000000..02399e7
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/json-stream.js
@@ -0,0 +1,60 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Initialize a new `List` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function List(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var total = runner.total;
+
+  runner.on('start', function() {
+    console.log(JSON.stringify(['start', { total: total }]));
+  });
+
+  runner.on('pass', function(test) {
+    console.log(JSON.stringify(['pass', clean(test)]));
+  });
+
+  runner.on('fail', function(test, err) {
+    test = clean(test);
+    test.err = err.message;
+    test.stack = err.stack || null;
+    console.log(JSON.stringify(['fail', test]));
+  });
+
+  runner.on('end', function() {
+    process.stdout.write(JSON.stringify(['end', self.stats]));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry()
+  };
+}
diff --git a/node_modules/mocha/lib/reporters/json.js b/node_modules/mocha/lib/reporters/json.js
new file mode 100644
index 0000000..cd9ec28
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/json.js
@@ -0,0 +1,90 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `JSON`.
+ */
+
+exports = module.exports = JSONReporter;
+
+/**
+ * Initialize a new `JSON` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function JSONReporter(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var tests = [];
+  var pending = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on('test end', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    passes.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    failures.push(test);
+  });
+
+  runner.on('pending', function(test) {
+    pending.push(test);
+  });
+
+  runner.on('end', function() {
+    var obj = {
+      stats: self.stats,
+      tests: tests.map(clean),
+      pending: pending.map(clean),
+      failures: failures.map(clean),
+      passes: passes.map(clean)
+    };
+
+    runner.testResults = obj;
+
+    process.stdout.write(JSON.stringify(obj, null, 2));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    err: errorJSON(test.err || {})
+  };
+}
+
+/**
+ * Transform `error` into a JSON object.
+ *
+ * @api private
+ * @param {Error} err
+ * @return {Object}
+ */
+function errorJSON(err) {
+  var res = {};
+  Object.getOwnPropertyNames(err).forEach(function(key) {
+    res[key] = err[key];
+  }, err);
+  return res;
+}
diff --git a/node_modules/mocha/lib/reporters/landing.js b/node_modules/mocha/lib/reporters/landing.js
new file mode 100644
index 0000000..b66b200
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/landing.js
@@ -0,0 +1,92 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var cursor = Base.cursor;
+var color = Base.color;
+
+/**
+ * Expose `Landing`.
+ */
+
+exports = module.exports = Landing;
+
+/**
+ * Airplane color.
+ */
+
+Base.colors.plane = 0;
+
+/**
+ * Airplane crash color.
+ */
+
+Base.colors['plane crash'] = 31;
+
+/**
+ * Runway color.
+ */
+
+Base.colors.runway = 90;
+
+/**
+ * Initialize a new `Landing` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Landing(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var total = runner.total;
+  var stream = process.stdout;
+  var plane = color('plane', '✈');
+  var crashed = -1;
+  var n = 0;
+
+  function runway() {
+    var buf = Array(width).join('-');
+    return '  ' + color('runway', buf);
+  }
+
+  runner.on('start', function() {
+    stream.write('\n\n\n  ');
+    cursor.hide();
+  });
+
+  runner.on('test end', function(test) {
+    // check if the plane crashed
+    var col = crashed === -1 ? width * ++n / total | 0 : crashed;
+
+    // show the crash
+    if (test.state === 'failed') {
+      plane = color('plane crash', '✈');
+      crashed = col;
+    }
+
+    // render landing strip
+    stream.write('\u001b[' + (width + 1) + 'D\u001b[2A');
+    stream.write(runway());
+    stream.write('\n  ');
+    stream.write(color('runway', Array(col).join('⋅')));
+    stream.write(plane);
+    stream.write(color('runway', Array(width - col).join('⋅') + '\n'));
+    stream.write(runway());
+    stream.write('\u001b[0m');
+  });
+
+  runner.on('end', function() {
+    cursor.show();
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Landing, Base);
diff --git a/node_modules/mocha/lib/reporters/list.js b/node_modules/mocha/lib/reporters/list.js
new file mode 100644
index 0000000..0e5f910
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/list.js
@@ -0,0 +1,61 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Initialize a new `List` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function List(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var n = 0;
+
+  runner.on('start', function() {
+    console.log();
+  });
+
+  runner.on('test', function(test) {
+    process.stdout.write(color('pass', '    ' + test.fullTitle() + ': '));
+  });
+
+  runner.on('pending', function(test) {
+    var fmt = color('checkmark', '  -')
+      + color('pending', ' %s');
+    console.log(fmt, test.fullTitle());
+  });
+
+  runner.on('pass', function(test) {
+    var fmt = color('checkmark', '  ' + Base.symbols.dot)
+      + color('pass', ' %s: ')
+      + color(test.speed, '%dms');
+    cursor.CR();
+    console.log(fmt, test.fullTitle(), test.duration);
+  });
+
+  runner.on('fail', function(test) {
+    cursor.CR();
+    console.log(color('fail', '  %d) %s'), ++n, test.fullTitle());
+  });
+
+  runner.on('end', self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(List, Base);
diff --git a/node_modules/mocha/lib/reporters/markdown.js b/node_modules/mocha/lib/reporters/markdown.js
new file mode 100644
index 0000000..680c55d
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/markdown.js
@@ -0,0 +1,97 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+
+/**
+ * Constants
+ */
+
+var SUITE_PREFIX = '$';
+
+/**
+ * Expose `Markdown`.
+ */
+
+exports = module.exports = Markdown;
+
+/**
+ * Initialize a new `Markdown` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Markdown(runner) {
+  Base.call(this, runner);
+
+  var level = 0;
+  var buf = '';
+
+  function title(str) {
+    return Array(level).join('#') + ' ' + str;
+  }
+
+  function mapTOC(suite, obj) {
+    var ret = obj;
+    var key = SUITE_PREFIX + suite.title;
+
+    obj = obj[key] = obj[key] || { suite: suite };
+    suite.suites.forEach(function(suite) {
+      mapTOC(suite, obj);
+    });
+
+    return ret;
+  }
+
+  function stringifyTOC(obj, level) {
+    ++level;
+    var buf = '';
+    var link;
+    for (var key in obj) {
+      if (key === 'suite') {
+        continue;
+      }
+      if (key !== SUITE_PREFIX) {
+        link = ' - [' + key.substring(1) + ']';
+        link += '(#' + utils.slug(obj[key].suite.fullTitle()) + ')\n';
+        buf += Array(level).join('  ') + link;
+      }
+      buf += stringifyTOC(obj[key], level);
+    }
+    return buf;
+  }
+
+  function generateTOC(suite) {
+    var obj = mapTOC(suite, {});
+    return stringifyTOC(obj, 0);
+  }
+
+  generateTOC(runner.suite);
+
+  runner.on('suite', function(suite) {
+    ++level;
+    var slug = utils.slug(suite.fullTitle());
+    buf += '' + '\n';
+    buf += title(suite.title) + '\n';
+  });
+
+  runner.on('suite end', function() {
+    --level;
+  });
+
+  runner.on('pass', function(test) {
+    var code = utils.clean(test.body);
+    buf += test.title + '.\n';
+    buf += '\n```js\n';
+    buf += code + '\n';
+    buf += '```\n\n';
+  });
+
+  runner.on('end', function() {
+    process.stdout.write('# TOC\n');
+    process.stdout.write(generateTOC(runner.suite));
+    process.stdout.write(buf);
+  });
+}
diff --git a/node_modules/mocha/lib/reporters/min.js b/node_modules/mocha/lib/reporters/min.js
new file mode 100644
index 0000000..2b48212
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/min.js
@@ -0,0 +1,36 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+
+/**
+ * Expose `Min`.
+ */
+
+exports = module.exports = Min;
+
+/**
+ * Initialize a new `Min` minimal test reporter (best used with --watch).
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Min(runner) {
+  Base.call(this, runner);
+
+  runner.on('start', function() {
+    // clear screen
+    process.stdout.write('\u001b[2J');
+    // set cursor position
+    process.stdout.write('\u001b[1;3H');
+  });
+
+  runner.on('end', this.epilogue.bind(this));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Min, Base);
diff --git a/node_modules/mocha/lib/reporters/nyan.js b/node_modules/mocha/lib/reporters/nyan.js
new file mode 100644
index 0000000..ba1b050
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/nyan.js
@@ -0,0 +1,261 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = NyanCat;
+
+/**
+ * Initialize a new `Dot` matrix test reporter.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+
+function NyanCat(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var nyanCatWidth = this.nyanCatWidth = 11;
+
+  this.colorIndex = 0;
+  this.numberOfLines = 4;
+  this.rainbowColors = self.generateColors();
+  this.scoreboardWidth = 5;
+  this.tick = 0;
+  this.trajectories = [[], [], [], []];
+  this.trajectoryWidthMax = (width - nyanCatWidth);
+
+  runner.on('start', function() {
+    Base.cursor.hide();
+    self.draw();
+  });
+
+  runner.on('pending', function() {
+    self.draw();
+  });
+
+  runner.on('pass', function() {
+    self.draw();
+  });
+
+  runner.on('fail', function() {
+    self.draw();
+  });
+
+  runner.on('end', function() {
+    Base.cursor.show();
+    for (var i = 0; i < self.numberOfLines; i++) {
+      write('\n');
+    }
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(NyanCat, Base);
+
+/**
+ * Draw the nyan cat
+ *
+ * @api private
+ */
+
+NyanCat.prototype.draw = function() {
+  this.appendRainbow();
+  this.drawScoreboard();
+  this.drawRainbow();
+  this.drawNyanCat();
+  this.tick = !this.tick;
+};
+
+/**
+ * Draw the "scoreboard" showing the number
+ * of passes, failures and pending tests.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.drawScoreboard = function() {
+  var stats = this.stats;
+
+  function draw(type, n) {
+    write(' ');
+    write(Base.color(type, n));
+    write('\n');
+  }
+
+  draw('green', stats.passes);
+  draw('fail', stats.failures);
+  draw('pending', stats.pending);
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Append the rainbow.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.appendRainbow = function() {
+  var segment = this.tick ? '_' : '-';
+  var rainbowified = this.rainbowify(segment);
+
+  for (var index = 0; index < this.numberOfLines; index++) {
+    var trajectory = this.trajectories[index];
+    if (trajectory.length >= this.trajectoryWidthMax) {
+      trajectory.shift();
+    }
+    trajectory.push(rainbowified);
+  }
+};
+
+/**
+ * Draw the rainbow.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.drawRainbow = function() {
+  var self = this;
+
+  this.trajectories.forEach(function(line) {
+    write('\u001b[' + self.scoreboardWidth + 'C');
+    write(line.join(''));
+    write('\n');
+  });
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw the nyan cat
+ *
+ * @api private
+ */
+NyanCat.prototype.drawNyanCat = function() {
+  var self = this;
+  var startWidth = this.scoreboardWidth + this.trajectories[0].length;
+  var dist = '\u001b[' + startWidth + 'C';
+  var padding = '';
+
+  write(dist);
+  write('_,------,');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '  ' : '   ';
+  write('_|' + padding + '/\\_/\\ ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '_' : '__';
+  var tail = self.tick ? '~' : '^';
+  write(tail + '|' + padding + this.face() + ' ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? ' ' : '  ';
+  write(padding + '""  "" ');
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw nyan cat face.
+ *
+ * @api private
+ * @return {string}
+ */
+
+NyanCat.prototype.face = function() {
+  var stats = this.stats;
+  if (stats.failures) {
+    return '( x .x)';
+  } else if (stats.pending) {
+    return '( o .o)';
+  } else if (stats.passes) {
+    return '( ^ .^)';
+  }
+  return '( - .-)';
+};
+
+/**
+ * Move cursor up `n`.
+ *
+ * @api private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorUp = function(n) {
+  write('\u001b[' + n + 'A');
+};
+
+/**
+ * Move cursor down `n`.
+ *
+ * @api private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorDown = function(n) {
+  write('\u001b[' + n + 'B');
+};
+
+/**
+ * Generate rainbow colors.
+ *
+ * @api private
+ * @return {Array}
+ */
+NyanCat.prototype.generateColors = function() {
+  var colors = [];
+
+  for (var i = 0; i < (6 * 7); i++) {
+    var pi3 = Math.floor(Math.PI / 3);
+    var n = (i * (1.0 / 6));
+    var r = Math.floor(3 * Math.sin(n) + 3);
+    var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3);
+    var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3);
+    colors.push(36 * r + 6 * g + b + 16);
+  }
+
+  return colors;
+};
+
+/**
+ * Apply rainbow to the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+NyanCat.prototype.rainbowify = function(str) {
+  if (!Base.useColors) {
+    return str;
+  }
+  var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length];
+  this.colorIndex += 1;
+  return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Stdout helper.
+ *
+ * @param {string} string A message to write to stdout.
+ */
+function write(string) {
+  process.stdout.write(string);
+}
diff --git a/node_modules/mocha/lib/reporters/progress.js b/node_modules/mocha/lib/reporters/progress.js
new file mode 100644
index 0000000..5349ca8
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/progress.js
@@ -0,0 +1,89 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Progress`.
+ */
+
+exports = module.exports = Progress;
+
+/**
+ * General progress bar color.
+ */
+
+Base.colors.progress = 90;
+
+/**
+ * Initialize a new `Progress` bar test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ * @param {Object} options
+ */
+function Progress(runner, options) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .50 | 0;
+  var total = runner.total;
+  var complete = 0;
+  var lastN = -1;
+
+  // default chars
+  options = options || {};
+  options.open = options.open || '[';
+  options.complete = options.complete || '▬';
+  options.incomplete = options.incomplete || Base.symbols.dot;
+  options.close = options.close || ']';
+  options.verbose = false;
+
+  // tests started
+  runner.on('start', function() {
+    console.log();
+    cursor.hide();
+  });
+
+  // tests complete
+  runner.on('test end', function() {
+    complete++;
+
+    var percent = complete / total;
+    var n = width * percent | 0;
+    var i = width - n;
+
+    if (n === lastN && !options.verbose) {
+      // Don't re-render the line if it hasn't changed
+      return;
+    }
+    lastN = n;
+
+    cursor.CR();
+    process.stdout.write('\u001b[J');
+    process.stdout.write(color('progress', '  ' + options.open));
+    process.stdout.write(Array(n).join(options.complete));
+    process.stdout.write(Array(i).join(options.incomplete));
+    process.stdout.write(color('progress', options.close));
+    if (options.verbose) {
+      process.stdout.write(color('progress', ' ' + complete + ' of ' + total));
+    }
+  });
+
+  // tests are complete, output some stats
+  // and the failures if any
+  runner.on('end', function() {
+    cursor.show();
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Progress, Base);
diff --git a/node_modules/mocha/lib/reporters/spec.js b/node_modules/mocha/lib/reporters/spec.js
new file mode 100644
index 0000000..77a73c4
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/spec.js
@@ -0,0 +1,83 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Spec`.
+ */
+
+exports = module.exports = Spec;
+
+/**
+ * Initialize a new `Spec` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Spec(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var indents = 0;
+  var n = 0;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on('start', function() {
+    console.log();
+  });
+
+  runner.on('suite', function(suite) {
+    ++indents;
+    console.log(color('suite', '%s%s'), indent(), suite.title);
+  });
+
+  runner.on('suite end', function() {
+    --indents;
+    if (indents === 1) {
+      console.log();
+    }
+  });
+
+  runner.on('pending', function(test) {
+    var fmt = indent() + color('pending', '  - %s');
+    console.log(fmt, test.title);
+  });
+
+  runner.on('pass', function(test) {
+    var fmt;
+    if (test.speed === 'fast') {
+      fmt = indent()
+        + color('checkmark', '  ' + Base.symbols.ok)
+        + color('pass', ' %s');
+      cursor.CR();
+      console.log(fmt, test.title);
+    } else {
+      fmt = indent()
+        + color('checkmark', '  ' + Base.symbols.ok)
+        + color('pass', ' %s')
+        + color(test.speed, ' (%dms)');
+      cursor.CR();
+      console.log(fmt, test.title, test.duration);
+    }
+  });
+
+  runner.on('fail', function(test) {
+    cursor.CR();
+    console.log(indent() + color('fail', '  %d) %s'), ++n, test.title);
+  });
+
+  runner.on('end', self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Spec, Base);
diff --git a/node_modules/mocha/lib/reporters/tap.js b/node_modules/mocha/lib/reporters/tap.js
new file mode 100644
index 0000000..d9b1b95
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/tap.js
@@ -0,0 +1,68 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `TAP`.
+ */
+
+exports = module.exports = TAP;
+
+/**
+ * Initialize a new `TAP` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function TAP(runner) {
+  Base.call(this, runner);
+
+  var n = 1;
+  var passes = 0;
+  var failures = 0;
+
+  runner.on('start', function() {
+    var total = runner.grepTotal(runner.suite);
+    console.log('%d..%d', 1, total);
+  });
+
+  runner.on('test end', function() {
+    ++n;
+  });
+
+  runner.on('pending', function(test) {
+    console.log('ok %d %s # SKIP -', n, title(test));
+  });
+
+  runner.on('pass', function(test) {
+    passes++;
+    console.log('ok %d %s', n, title(test));
+  });
+
+  runner.on('fail', function(test, err) {
+    failures++;
+    console.log('not ok %d %s', n, title(test));
+    if (err.stack) {
+      console.log(err.stack.replace(/^/gm, '  '));
+    }
+  });
+
+  runner.on('end', function() {
+    console.log('# tests ' + (passes + failures));
+    console.log('# pass ' + passes);
+    console.log('# fail ' + failures);
+  });
+}
+
+/**
+ * Return a TAP-safe title of `test`
+ *
+ * @api private
+ * @param {Object} test
+ * @return {String}
+ */
+function title(test) {
+  return test.fullTitle().replace(/#/g, '');
+}
diff --git a/node_modules/mocha/lib/reporters/templates/coverage.jade b/node_modules/mocha/lib/reporters/templates/coverage.jade
new file mode 100644
index 0000000..edd59d8
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/templates/coverage.jade
@@ -0,0 +1,51 @@
+doctype html
+html
+  head
+    title Coverage
+    meta(charset='utf-8')
+    include script.html
+    include style.html
+  body
+    #coverage
+      h1#overview Coverage
+      include menu
+
+      #stats(class=coverageClass(cov.coverage))
+        .percentage #{cov.coverage | 0}%
+        .sloc= cov.sloc
+        .hits= cov.hits
+        .misses= cov.misses
+
+      #files
+        for file in cov.files
+          .file
+            h2(id=file.filename)= file.filename
+            #stats(class=coverageClass(file.coverage))
+              .percentage #{file.coverage | 0}%
+              .sloc= file.sloc
+              .hits= file.hits
+              .misses= file.misses
+
+            table#source
+              thead
+                tr
+                  th Line
+                  th Hits
+                  th Source
+              tbody
+                for line, number in file.source
+                  if line.coverage > 0
+                    tr.hit
+                      td.line= number
+                      td.hits= line.coverage
+                      td.source= line.source
+                  else if 0 === line.coverage
+                    tr.miss
+                      td.line= number
+                      td.hits 0
+                      td.source= line.source
+                  else
+                    tr
+                      td.line= number
+                      td.hits
+                      td.source= line.source || ' '
diff --git a/node_modules/mocha/lib/reporters/templates/menu.jade b/node_modules/mocha/lib/reporters/templates/menu.jade
new file mode 100644
index 0000000..c682e3f
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/templates/menu.jade
@@ -0,0 +1,13 @@
+#menu
+  li
+    a(href='#overview') overview
+  for file in cov.files
+    li
+      span.cov(class=coverageClass(file.coverage)) #{file.coverage | 0}
+      a(href='##{file.filename}')
+        segments = file.filename.split('/')
+        basename = segments.pop()
+        if segments.length
+          span.dirname= segments.join('/') + '/'
+        span.basename= basename
+  a#logo(href='http://mochajs.org/') m
diff --git a/node_modules/mocha/lib/reporters/templates/script.html b/node_modules/mocha/lib/reporters/templates/script.html
new file mode 100644
index 0000000..073cf79
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/templates/script.html
@@ -0,0 +1,34 @@
+
diff --git a/node_modules/mocha/lib/reporters/templates/style.html b/node_modules/mocha/lib/reporters/templates/style.html
new file mode 100644
index 0000000..4c9c37c
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/templates/style.html
@@ -0,0 +1,324 @@
+
diff --git a/node_modules/mocha/lib/reporters/xunit.js b/node_modules/mocha/lib/reporters/xunit.js
new file mode 100644
index 0000000..1cfd8f4
--- /dev/null
+++ b/node_modules/mocha/lib/reporters/xunit.js
@@ -0,0 +1,166 @@
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var inherits = utils.inherits;
+var fs = require('fs');
+var escape = utils.escape;
+var mkdirp = require('mkdirp');
+var path = require('path');
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Expose `XUnit`.
+ */
+
+exports = module.exports = XUnit;
+
+/**
+ * Initialize a new `XUnit` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function XUnit(runner, options) {
+  Base.call(this, runner);
+
+  var stats = this.stats;
+  var tests = [];
+  var self = this;
+
+  if (options.reporterOptions && options.reporterOptions.output) {
+    if (!fs.createWriteStream) {
+      throw new Error('file output not supported in browser');
+    }
+    mkdirp.sync(path.dirname(options.reporterOptions.output));
+    self.fileStream = fs.createWriteStream(options.reporterOptions.output);
+  }
+
+  runner.on('pending', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('end', function() {
+    self.write(tag('testsuite', {
+      name: 'Mocha Tests',
+      tests: stats.tests,
+      failures: stats.failures,
+      errors: stats.failures,
+      skipped: stats.tests - stats.failures - stats.passes,
+      timestamp: (new Date()).toUTCString(),
+      time: (stats.duration / 1000) || 0
+    }, false));
+
+    tests.forEach(function(t) {
+      self.test(t);
+    });
+
+    self.write('');
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(XUnit, Base);
+
+/**
+ * Override done to close the stream (if it's a file).
+ *
+ * @param failures
+ * @param {Function} fn
+ */
+XUnit.prototype.done = function(failures, fn) {
+  if (this.fileStream) {
+    this.fileStream.end(function() {
+      fn(failures);
+    });
+  } else {
+    fn(failures);
+  }
+};
+
+/**
+ * Write out the given line.
+ *
+ * @param {string} line
+ */
+XUnit.prototype.write = function(line) {
+  if (this.fileStream) {
+    this.fileStream.write(line + '\n');
+  } else if (typeof process === 'object' && process.stdout) {
+    process.stdout.write(line + '\n');
+  } else {
+    console.log(line);
+  }
+};
+
+/**
+ * Output tag for the given `test.`
+ *
+ * @param {Test} test
+ */
+XUnit.prototype.test = function(test) {
+  var attrs = {
+    classname: test.parent.fullTitle(),
+    name: test.title,
+    time: (test.duration / 1000) || 0
+  };
+
+  if (test.state === 'failed') {
+    var err = test.err;
+    this.write(tag('testcase', attrs, false, tag('failure', {}, false, escape(err.message) + '\n' + escape(err.stack))));
+  } else if (test.isPending()) {
+    this.write(tag('testcase', attrs, false, tag('skipped', {}, true)));
+  } else {
+    this.write(tag('testcase', attrs, true));
+  }
+};
+
+/**
+ * HTML tag helper.
+ *
+ * @param name
+ * @param attrs
+ * @param close
+ * @param content
+ * @return {string}
+ */
+function tag(name, attrs, close, content) {
+  var end = close ? '/>' : '>';
+  var pairs = [];
+  var tag;
+
+  for (var key in attrs) {
+    if (Object.prototype.hasOwnProperty.call(attrs, key)) {
+      pairs.push(key + '="' + escape(attrs[key]) + '"');
+    }
+  }
+
+  tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end;
+  if (content) {
+    tag += content + '';
+    }
+    if (key === 'ctx') {
+      return '#';
+    }
+    return val;
+  }, 2);
+};
+
+/**
+ * Reset the timeout.
+ *
+ * @api private
+ */
+Runnable.prototype.resetTimeout = function() {
+  var self = this;
+  var ms = this.timeout() || 1e9;
+
+  if (!this._enableTimeouts) {
+    return;
+  }
+  this.clearTimeout();
+  this.timer = setTimeout(function() {
+    if (!self._enableTimeouts) {
+      return;
+    }
+    self.callback(new Error('timeout of ' + ms + 'ms exceeded. Ensure the done() callback is being called in this test.'));
+    self.timedOut = true;
+  }, ms);
+};
+
+/**
+ * Whitelist a list of globals for this test run.
+ *
+ * @api private
+ * @param {string[]} globals
+ */
+Runnable.prototype.globals = function(globals) {
+  if (!arguments.length) {
+    return this._allowedGlobals;
+  }
+  this._allowedGlobals = globals;
+};
+
+/**
+ * Run the test and invoke `fn(err)`.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runnable.prototype.run = function(fn) {
+  var self = this;
+  var start = new Date();
+  var ctx = this.ctx;
+  var finished;
+  var emitted;
+
+  // Sometimes the ctx exists, but it is not runnable
+  if (ctx && ctx.runnable) {
+    ctx.runnable(this);
+  }
+
+  // called multiple times
+  function multiple(err) {
+    if (emitted) {
+      return;
+    }
+    emitted = true;
+    self.emit('error', err || new Error('done() called multiple times; stacktrace may be inaccurate'));
+  }
+
+  // finished
+  function done(err) {
+    var ms = self.timeout();
+    if (self.timedOut) {
+      return;
+    }
+    if (finished) {
+      return multiple(err || self._trace);
+    }
+
+    self.clearTimeout();
+    self.duration = new Date() - start;
+    finished = true;
+    if (!err && self.duration > ms && self._enableTimeouts) {
+      err = new Error('timeout of ' + ms + 'ms exceeded. Ensure the done() callback is being called in this test.');
+    }
+    fn(err);
+  }
+
+  // for .resetTimeout()
+  this.callback = done;
+
+  // explicit async with `done` argument
+  if (this.async) {
+    this.resetTimeout();
+
+    if (this.allowUncaught) {
+      return callFnAsync(this.fn);
+    }
+    try {
+      callFnAsync(this.fn);
+    } catch (err) {
+      done(utils.getError(err));
+    }
+    return;
+  }
+
+  if (this.allowUncaught) {
+    callFn(this.fn);
+    done();
+    return;
+  }
+
+  // sync or promise-returning
+  try {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+  } catch (err) {
+    done(utils.getError(err));
+  }
+
+  function callFn(fn) {
+    var result = fn.call(ctx);
+    if (result && typeof result.then === 'function') {
+      self.resetTimeout();
+      result
+        .then(function() {
+          done();
+          // Return null so libraries like bluebird do not warn about
+          // subsequently constructed Promises.
+          return null;
+        },
+        function(reason) {
+          done(reason || new Error('Promise rejected with no or falsy reason'));
+        });
+    } else {
+      if (self.asyncOnly) {
+        return done(new Error('--async-only option in use without declaring `done()` or returning a promise'));
+      }
+
+      done();
+    }
+  }
+
+  function callFnAsync(fn) {
+    fn.call(ctx, function(err) {
+      if (err instanceof Error || toString.call(err) === '[object Error]') {
+        return done(err);
+      }
+      if (err) {
+        if (Object.prototype.toString.call(err) === '[object Object]') {
+          return done(new Error('done() invoked with non-Error: '
+            + JSON.stringify(err)));
+        }
+        return done(new Error('done() invoked with non-Error: ' + err));
+      }
+      done();
+    });
+  }
+};
diff --git a/node_modules/mocha/lib/runner.js b/node_modules/mocha/lib/runner.js
new file mode 100644
index 0000000..ba4d7df
--- /dev/null
+++ b/node_modules/mocha/lib/runner.js
@@ -0,0 +1,894 @@
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:runner');
+var Runnable = require('./runnable');
+var filter = utils.filter;
+var indexOf = utils.indexOf;
+var keys = utils.keys;
+var stackFilter = utils.stackTraceFilter();
+var stringify = utils.stringify;
+var type = utils.type;
+var undefinedError = utils.undefinedError;
+var isArray = utils.isArray;
+
+/**
+ * Non-enumerable globals.
+ */
+
+var globals = [
+  'setTimeout',
+  'clearTimeout',
+  'setInterval',
+  'clearInterval',
+  'XMLHttpRequest',
+  'Date',
+  'setImmediate',
+  'clearImmediate'
+];
+
+/**
+ * Expose `Runner`.
+ */
+
+module.exports = Runner;
+
+/**
+ * Initialize a `Runner` for the given `suite`.
+ *
+ * Events:
+ *
+ *   - `start`  execution started
+ *   - `end`  execution complete
+ *   - `suite`  (suite) test suite execution started
+ *   - `suite end`  (suite) all tests (and sub-suites) have finished
+ *   - `test`  (test) test execution started
+ *   - `test end`  (test) test completed
+ *   - `hook`  (hook) hook execution started
+ *   - `hook end`  (hook) hook complete
+ *   - `pass`  (test) test passed
+ *   - `fail`  (test, err) test failed
+ *   - `pending`  (test) test pending
+ *
+ * @api public
+ * @param {Suite} suite Root suite
+ * @param {boolean} [delay] Whether or not to delay execution of root suite
+ * until ready.
+ */
+function Runner(suite, delay) {
+  var self = this;
+  this._globals = [];
+  this._abort = false;
+  this._delay = delay;
+  this.suite = suite;
+  this.started = false;
+  this.total = suite.total();
+  this.failures = 0;
+  this.on('test end', function(test) {
+    self.checkGlobals(test);
+  });
+  this.on('hook end', function(hook) {
+    self.checkGlobals(hook);
+  });
+  this._defaultGrep = /.*/;
+  this.grep(this._defaultGrep);
+  this.globals(this.globalProps().concat(extraGlobals()));
+}
+
+/**
+ * Wrapper for setImmediate, process.nextTick, or browser polyfill.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runner.immediately = global.setImmediate || process.nextTick;
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Runner, EventEmitter);
+
+/**
+ * Run tests with full titles matching `re`. Updates runner.total
+ * with number of tests matched.
+ *
+ * @param {RegExp} re
+ * @param {Boolean} invert
+ * @return {Runner} for chaining
+ * @api public
+ * @param {RegExp} re
+ * @param {boolean} invert
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.grep = function(re, invert) {
+  debug('grep %s', re);
+  this._grep = re;
+  this._invert = invert;
+  this.total = this.grepTotal(this.suite);
+  return this;
+};
+
+/**
+ * Returns the number of tests matching the grep search for the
+ * given suite.
+ *
+ * @param {Suite} suite
+ * @return {Number}
+ * @api public
+ * @param {Suite} suite
+ * @return {number}
+ */
+Runner.prototype.grepTotal = function(suite) {
+  var self = this;
+  var total = 0;
+
+  suite.eachTest(function(test) {
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (match) {
+      total++;
+    }
+  });
+
+  return total;
+};
+
+/**
+ * Return a list of global properties.
+ *
+ * @return {Array}
+ * @api private
+ */
+Runner.prototype.globalProps = function() {
+  var props = keys(global);
+
+  // non-enumerables
+  for (var i = 0; i < globals.length; ++i) {
+    if (~indexOf(props, globals[i])) {
+      continue;
+    }
+    props.push(globals[i]);
+  }
+
+  return props;
+};
+
+/**
+ * Allow the given `arr` of globals.
+ *
+ * @param {Array} arr
+ * @return {Runner} for chaining
+ * @api public
+ * @param {Array} arr
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.globals = function(arr) {
+  if (!arguments.length) {
+    return this._globals;
+  }
+  debug('globals %j', arr);
+  this._globals = this._globals.concat(arr);
+  return this;
+};
+
+/**
+ * Check for global variable leaks.
+ *
+ * @api private
+ */
+Runner.prototype.checkGlobals = function(test) {
+  if (this.ignoreLeaks) {
+    return;
+  }
+  var ok = this._globals;
+
+  var globals = this.globalProps();
+  var leaks;
+
+  if (test) {
+    ok = ok.concat(test._allowedGlobals || []);
+  }
+
+  if (this.prevGlobalsLength === globals.length) {
+    return;
+  }
+  this.prevGlobalsLength = globals.length;
+
+  leaks = filterLeaks(ok, globals);
+  this._globals = this._globals.concat(leaks);
+
+  if (leaks.length > 1) {
+    this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + ''));
+  } else if (leaks.length) {
+    this.fail(test, new Error('global leak detected: ' + leaks[0]));
+  }
+};
+
+/**
+ * Fail the given `test`.
+ *
+ * @api private
+ * @param {Test} test
+ * @param {Error} err
+ */
+Runner.prototype.fail = function(test, err) {
+  ++this.failures;
+  test.state = 'failed';
+
+  if (!(err instanceof Error || err && typeof err.message === 'string')) {
+    err = new Error('the ' + type(err) + ' ' + stringify(err) + ' was thrown, throw an Error :)');
+  }
+
+  err.stack = (this.fullStackTrace || !err.stack)
+    ? err.stack
+    : stackFilter(err.stack);
+
+  this.emit('fail', test, err);
+};
+
+/**
+ * Fail the given `hook` with `err`.
+ *
+ * Hook failures work in the following pattern:
+ * - If bail, then exit
+ * - Failed `before` hook skips all tests in a suite and subsuites,
+ *   but jumps to corresponding `after` hook
+ * - Failed `before each` hook skips remaining tests in a
+ *   suite and jumps to corresponding `after each` hook,
+ *   which is run only once
+ * - Failed `after` hook does not alter
+ *   execution order
+ * - Failed `after each` hook skips remaining tests in a
+ *   suite and subsuites, but executes other `after each`
+ *   hooks
+ *
+ * @api private
+ * @param {Hook} hook
+ * @param {Error} err
+ */
+Runner.prototype.failHook = function(hook, err) {
+  if (hook.ctx && hook.ctx.currentTest) {
+    hook.originalTitle = hook.originalTitle || hook.title;
+    hook.title = hook.originalTitle + ' for "' + hook.ctx.currentTest.title + '"';
+  }
+
+  this.fail(hook, err);
+  if (this.suite.bail()) {
+    this.emit('end');
+  }
+};
+
+/**
+ * Run hook `name` callbacks and then invoke `fn()`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {Function} fn
+ */
+
+Runner.prototype.hook = function(name, fn) {
+  var suite = this.suite;
+  var hooks = suite['_' + name];
+  var self = this;
+
+  function next(i) {
+    var hook = hooks[i];
+    if (!hook) {
+      return fn();
+    }
+    self.currentRunnable = hook;
+
+    hook.ctx.currentTest = self.test;
+
+    self.emit('hook', hook);
+
+    if (!hook.listeners('error').length) {
+      hook.on('error', function(err) {
+        self.failHook(hook, err);
+      });
+    }
+
+    hook.run(function(err) {
+      var testError = hook.error();
+      if (testError) {
+        self.fail(self.test, testError);
+      }
+      if (err) {
+        if (err instanceof Pending) {
+          suite.pending = true;
+        } else {
+          self.failHook(hook, err);
+
+          // stop executing hooks, notify callee of hook err
+          return fn(err);
+        }
+      }
+      self.emit('hook end', hook);
+      delete hook.ctx.currentTest;
+      next(++i);
+    });
+  }
+
+  Runner.immediately(function() {
+    next(0);
+  });
+};
+
+/**
+ * Run hook `name` for the given array of `suites`
+ * in order, and callback `fn(err, errSuite)`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {Array} suites
+ * @param {Function} fn
+ */
+Runner.prototype.hooks = function(name, suites, fn) {
+  var self = this;
+  var orig = this.suite;
+
+  function next(suite) {
+    self.suite = suite;
+
+    if (!suite) {
+      self.suite = orig;
+      return fn();
+    }
+
+    self.hook(name, function(err) {
+      if (err) {
+        var errSuite = self.suite;
+        self.suite = orig;
+        return fn(err, errSuite);
+      }
+
+      next(suites.pop());
+    });
+  }
+
+  next(suites.pop());
+};
+
+/**
+ * Run hooks from the top level down.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.hookUp = function(name, fn) {
+  var suites = [this.suite].concat(this.parents()).reverse();
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Run hooks from the bottom up.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.hookDown = function(name, fn) {
+  var suites = [this.suite].concat(this.parents());
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Return an array of parent Suites from
+ * closest to furthest.
+ *
+ * @return {Array}
+ * @api private
+ */
+Runner.prototype.parents = function() {
+  var suite = this.suite;
+  var suites = [];
+  while (suite.parent) {
+    suite = suite.parent;
+    suites.push(suite);
+  }
+  return suites;
+};
+
+/**
+ * Run the current test and callback `fn(err)`.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.runTest = function(fn) {
+  var self = this;
+  var test = this.test;
+
+  if (this.asyncOnly) {
+    test.asyncOnly = true;
+  }
+
+  if (this.allowUncaught) {
+    test.allowUncaught = true;
+    return test.run(fn);
+  }
+  try {
+    test.on('error', function(err) {
+      self.fail(test, err);
+    });
+    test.run(fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Run tests in the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runTests = function(suite, fn) {
+  var self = this;
+  var tests = suite.tests.slice();
+  var test;
+
+  function hookErr(_, errSuite, after) {
+    // before/after Each hook for errSuite failed:
+    var orig = self.suite;
+
+    // for failed 'after each' hook start from errSuite parent,
+    // otherwise start from errSuite itself
+    self.suite = after ? errSuite.parent : errSuite;
+
+    if (self.suite) {
+      // call hookUp afterEach
+      self.hookUp('afterEach', function(err2, errSuite2) {
+        self.suite = orig;
+        // some hooks may fail even now
+        if (err2) {
+          return hookErr(err2, errSuite2, true);
+        }
+        // report error suite
+        fn(errSuite);
+      });
+    } else {
+      // there is no need calling other 'after each' hooks
+      self.suite = orig;
+      fn(errSuite);
+    }
+  }
+
+  function next(err, errSuite) {
+    // if we bail after first err
+    if (self.failures && suite._bail) {
+      return fn();
+    }
+
+    if (self._abort) {
+      return fn();
+    }
+
+    if (err) {
+      return hookErr(err, errSuite, true);
+    }
+
+    // next test
+    test = tests.shift();
+
+    // all done
+    if (!test) {
+      return fn();
+    }
+
+    // grep
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (!match) {
+      // Run immediately only if we have defined a grep. When we
+      // define a grep — It can cause maximum callstack error if
+      // the grep is doing a large recursive loop by neglecting
+      // all tests. The run immediately function also comes with
+      // a performance cost. So we don't want to run immediately
+      // if we run the whole test suite, because running the whole
+      // test suite don't do any immediate recursive loops. Thus,
+      // allowing a JS runtime to breathe.
+      if (self._grep !== self._defaultGrep) {
+        Runner.immediately(next);
+      } else {
+        next();
+      }
+      return;
+    }
+
+    if (test.isPending()) {
+      self.emit('pending', test);
+      self.emit('test end', test);
+      return next();
+    }
+
+    // execute test and hook(s)
+    self.emit('test', self.test = test);
+    self.hookDown('beforeEach', function(err, errSuite) {
+      if (suite.isPending()) {
+        self.emit('pending', test);
+        self.emit('test end', test);
+        return next();
+      }
+      if (err) {
+        return hookErr(err, errSuite, false);
+      }
+      self.currentRunnable = self.test;
+      self.runTest(function(err) {
+        test = self.test;
+        if (err) {
+          var retry = test.currentRetry();
+          if (err instanceof Pending) {
+            test.pending = true;
+            self.emit('pending', test);
+          } else if (retry < test.retries()) {
+            var clonedTest = test.clone();
+            clonedTest.currentRetry(retry + 1);
+            tests.unshift(clonedTest);
+
+            // Early return + hook trigger so that it doesn't
+            // increment the count wrong
+            return self.hookUp('afterEach', next);
+          } else {
+            self.fail(test, err);
+          }
+          self.emit('test end', test);
+
+          if (err instanceof Pending) {
+            return next();
+          }
+
+          return self.hookUp('afterEach', next);
+        }
+
+        test.state = 'passed';
+        self.emit('pass', test);
+        self.emit('test end', test);
+        self.hookUp('afterEach', next);
+      });
+    });
+  }
+
+  this.next = next;
+  this.hookErr = hookErr;
+  next();
+};
+
+/**
+ * Run the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runSuite = function(suite, fn) {
+  var i = 0;
+  var self = this;
+  var total = this.grepTotal(suite);
+  var afterAllHookCalled = false;
+
+  debug('run suite %s', suite.fullTitle());
+
+  if (!total || (self.failures && suite._bail)) {
+    return fn();
+  }
+
+  this.emit('suite', this.suite = suite);
+
+  function next(errSuite) {
+    if (errSuite) {
+      // current suite failed on a hook from errSuite
+      if (errSuite === suite) {
+        // if errSuite is current suite
+        // continue to the next sibling suite
+        return done();
+      }
+      // errSuite is among the parents of current suite
+      // stop execution of errSuite and all sub-suites
+      return done(errSuite);
+    }
+
+    if (self._abort) {
+      return done();
+    }
+
+    var curr = suite.suites[i++];
+    if (!curr) {
+      return done();
+    }
+
+    // Avoid grep neglecting large number of tests causing a
+    // huge recursive loop and thus a maximum call stack error.
+    // See comment in `this.runTests()` for more information.
+    if (self._grep !== self._defaultGrep) {
+      Runner.immediately(function() {
+        self.runSuite(curr, next);
+      });
+    } else {
+      self.runSuite(curr, next);
+    }
+  }
+
+  function done(errSuite) {
+    self.suite = suite;
+    self.nextSuite = next;
+
+    if (afterAllHookCalled) {
+      fn(errSuite);
+    } else {
+      // mark that the afterAll block has been called once
+      // and so can be skipped if there is an error in it.
+      afterAllHookCalled = true;
+
+      // remove reference to test
+      delete self.test;
+
+      self.hook('afterAll', function() {
+        self.emit('suite end', suite);
+        fn(errSuite);
+      });
+    }
+  }
+
+  this.nextSuite = next;
+
+  this.hook('beforeAll', function(err) {
+    if (err) {
+      return done();
+    }
+    self.runTests(suite, next);
+  });
+};
+
+/**
+ * Handle uncaught exceptions.
+ *
+ * @param {Error} err
+ * @api private
+ */
+Runner.prototype.uncaught = function(err) {
+  if (err) {
+    debug('uncaught exception %s', err !== function() {
+      return this;
+    }.call(err) ? err : (err.message || err));
+  } else {
+    debug('uncaught undefined exception');
+    err = undefinedError();
+  }
+  err.uncaught = true;
+
+  var runnable = this.currentRunnable;
+
+  if (!runnable) {
+    runnable = new Runnable('Uncaught error outside test suite');
+    runnable.parent = this.suite;
+
+    if (this.started) {
+      this.fail(runnable, err);
+    } else {
+      // Can't recover from this failure
+      this.emit('start');
+      this.fail(runnable, err);
+      this.emit('end');
+    }
+
+    return;
+  }
+
+  runnable.clearTimeout();
+
+  // Ignore errors if complete
+  if (runnable.state) {
+    return;
+  }
+  this.fail(runnable, err);
+
+  // recover from test
+  if (runnable.type === 'test') {
+    this.emit('test end', runnable);
+    this.hookUp('afterEach', this.next);
+    return;
+  }
+
+ // recover from hooks
+  if (runnable.type === 'hook') {
+    var errSuite = this.suite;
+    // if hook failure is in afterEach block
+    if (runnable.fullTitle().indexOf('after each') > -1) {
+      return this.hookErr(err, errSuite, true);
+    }
+    // if hook failure is in beforeEach block
+    if (runnable.fullTitle().indexOf('before each') > -1) {
+      return this.hookErr(err, errSuite, false);
+    }
+    // if hook failure is in after or before blocks
+    return this.nextSuite(errSuite);
+  }
+
+  // bail
+  this.emit('end');
+};
+
+/**
+ * Cleans up the references to all the deferred functions
+ * (before/after/beforeEach/afterEach) and tests of a Suite.
+ * These must be deleted otherwise a memory leak can happen,
+ * as those functions may reference variables from closures,
+ * thus those variables can never be garbage collected as long
+ * as the deferred functions exist.
+ *
+ * @param {Suite} suite
+ */
+function cleanSuiteReferences(suite) {
+  function cleanArrReferences(arr) {
+    for (var i = 0; i < arr.length; i++) {
+      delete arr[i].fn;
+    }
+  }
+
+  if (isArray(suite._beforeAll)) {
+    cleanArrReferences(suite._beforeAll);
+  }
+
+  if (isArray(suite._beforeEach)) {
+    cleanArrReferences(suite._beforeEach);
+  }
+
+  if (isArray(suite._afterAll)) {
+    cleanArrReferences(suite._afterAll);
+  }
+
+  if (isArray(suite._afterEach)) {
+    cleanArrReferences(suite._afterEach);
+  }
+
+  for (var i = 0; i < suite.tests.length; i++) {
+    delete suite.tests[i].fn;
+  }
+}
+
+/**
+ * Run the root suite and invoke `fn(failures)`
+ * on completion.
+ *
+ * @param {Function} fn
+ * @return {Runner} for chaining
+ * @api public
+ * @param {Function} fn
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.run = function(fn) {
+  var self = this;
+  var rootSuite = this.suite;
+
+  fn = fn || function() {};
+
+  function uncaught(err) {
+    self.uncaught(err);
+  }
+
+  function start() {
+    self.started = true;
+    self.emit('start');
+    self.runSuite(rootSuite, function() {
+      debug('finished running');
+      self.emit('end');
+    });
+  }
+
+  debug('start');
+
+  // references cleanup to avoid memory leaks
+  this.on('suite end', cleanSuiteReferences);
+
+  // callback
+  this.on('end', function() {
+    debug('end');
+    process.removeListener('uncaughtException', uncaught);
+    fn(self.failures);
+  });
+
+  // uncaught exception
+  process.on('uncaughtException', uncaught);
+
+  if (this._delay) {
+    // for reporters, I guess.
+    // might be nice to debounce some dots while we wait.
+    this.emit('waiting', rootSuite);
+    rootSuite.once('run', start);
+  } else {
+    start();
+  }
+
+  return this;
+};
+
+/**
+ * Cleanly abort execution.
+ *
+ * @api public
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.abort = function() {
+  debug('aborting');
+  this._abort = true;
+
+  return this;
+};
+
+/**
+ * Filter leaks with the given globals flagged as `ok`.
+ *
+ * @api private
+ * @param {Array} ok
+ * @param {Array} globals
+ * @return {Array}
+ */
+function filterLeaks(ok, globals) {
+  return filter(globals, function(key) {
+    // Firefox and Chrome exposes iframes as index inside the window object
+    if (/^d+/.test(key)) {
+      return false;
+    }
+
+    // in firefox
+    // if runner runs in an iframe, this iframe's window.getInterface method not init at first
+    // it is assigned in some seconds
+    if (global.navigator && (/^getInterface/).test(key)) {
+      return false;
+    }
+
+    // an iframe could be approached by window[iframeIndex]
+    // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak
+    if (global.navigator && (/^\d+/).test(key)) {
+      return false;
+    }
+
+    // Opera and IE expose global variables for HTML element IDs (issue #243)
+    if (/^mocha-/.test(key)) {
+      return false;
+    }
+
+    var matched = filter(ok, function(ok) {
+      if (~ok.indexOf('*')) {
+        return key.indexOf(ok.split('*')[0]) === 0;
+      }
+      return key === ok;
+    });
+    return !matched.length && (!global.navigator || key !== 'onerror');
+  });
+}
+
+/**
+ * Array of globals dependent on the environment.
+ *
+ * @return {Array}
+ * @api private
+ */
+function extraGlobals() {
+  if (typeof process === 'object' && typeof process.version === 'string') {
+    var parts = process.version.split('.');
+    var nodeVersion = utils.reduce(parts, function(a, v) {
+      return a << 8 | v;
+    });
+
+    // 'errno' was renamed to process._errno in v0.9.11.
+
+    if (nodeVersion < 0x00090B) {
+      return ['errno'];
+    }
+  }
+
+  return [];
+}
diff --git a/node_modules/mocha/lib/suite.js b/node_modules/mocha/lib/suite.js
new file mode 100644
index 0000000..d43dd45
--- /dev/null
+++ b/node_modules/mocha/lib/suite.js
@@ -0,0 +1,395 @@
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var Hook = require('./hook');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:suite');
+var milliseconds = require('./ms');
+
+/**
+ * Expose `Suite`.
+ */
+
+exports = module.exports = Suite;
+
+/**
+ * Create a new `Suite` with the given `title` and parent `Suite`. When a suite
+ * with the same title is already present, that suite is returned to provide
+ * nicer reporter and more flexible meta-testing.
+ *
+ * @api public
+ * @param {Suite} parent
+ * @param {string} title
+ * @return {Suite}
+ */
+exports.create = function(parent, title) {
+  var suite = new Suite(title, parent.ctx);
+  suite.parent = parent;
+  title = suite.fullTitle();
+  parent.addSuite(suite);
+  return suite;
+};
+
+/**
+ * Initialize a new `Suite` with the given `title` and `ctx`.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Context} parentContext
+ */
+function Suite(title, parentContext) {
+  this.title = title;
+  function Context() {}
+  Context.prototype = parentContext;
+  this.ctx = new Context();
+  this.suites = [];
+  this.tests = [];
+  this.pending = false;
+  this._beforeEach = [];
+  this._beforeAll = [];
+  this._afterEach = [];
+  this._afterAll = [];
+  this.root = !title;
+  this._timeout = 2000;
+  this._enableTimeouts = true;
+  this._slow = 75;
+  this._bail = false;
+  this._retries = -1;
+  this.delayed = false;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Suite, EventEmitter);
+
+/**
+ * Return a clone of this `Suite`.
+ *
+ * @api private
+ * @return {Suite}
+ */
+Suite.prototype.clone = function() {
+  var suite = new Suite(this.title);
+  debug('clone');
+  suite.ctx = this.ctx;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  return suite;
+};
+
+/**
+ * Set timeout `ms` or short-hand such as "2s".
+ *
+ * @api private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (ms.toString() === '0') {
+    this._enableTimeouts = false;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('timeout %d', ms);
+  this._timeout = parseInt(ms, 10);
+  return this;
+};
+
+/**
+ * Set number of times to retry a failed test.
+ *
+ * @api private
+ * @param {number|string} n
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  debug('retries %d', n);
+  this._retries = parseInt(n, 10) || 0;
+  return this;
+};
+
+/**
+  * Set timeout to `enabled`.
+  *
+  * @api private
+  * @param {boolean} enabled
+  * @return {Suite|boolean} self or enabled
+  */
+Suite.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Set slow `ms` or short-hand such as "2s".
+ *
+ * @api private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Sets whether to bail after first error.
+ *
+ * @api private
+ * @param {boolean} bail
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    return this._bail;
+  }
+  debug('bail %s', bail);
+  this._bail = bail;
+  return this;
+};
+
+/**
+ * Check if this suite or its parent suite is marked as pending.
+ *
+ * @api private
+ */
+Suite.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Run `fn(test[, done])` before running tests.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before all" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._beforeAll.push(hook);
+  this.emit('beforeAll', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after running tests.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after all" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._afterAll.push(hook);
+  this.emit('afterAll', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` before each test case.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before each" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._beforeEach.push(hook);
+  this.emit('beforeEach', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after each test case.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after each" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._afterEach.push(hook);
+  this.emit('afterEach', hook);
+  return this;
+};
+
+/**
+ * Add a test `suite`.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addSuite = function(suite) {
+  suite.parent = this;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  this.suites.push(suite);
+  this.emit('suite', suite);
+  return this;
+};
+
+/**
+ * Add a `test` to this suite.
+ *
+ * @api private
+ * @param {Test} test
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addTest = function(test) {
+  test.parent = this;
+  test.timeout(this.timeout());
+  test.retries(this.retries());
+  test.enableTimeouts(this.enableTimeouts());
+  test.slow(this.slow());
+  test.ctx = this.ctx;
+  this.tests.push(test);
+  this.emit('test', test);
+  return this;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @api public
+ * @return {string}
+ */
+Suite.prototype.fullTitle = function() {
+  if (this.parent) {
+    var full = this.parent.fullTitle();
+    if (full) {
+      return full + ' ' + this.title;
+    }
+  }
+  return this.title;
+};
+
+/**
+ * Return the total number of tests.
+ *
+ * @api public
+ * @return {number}
+ */
+Suite.prototype.total = function() {
+  return utils.reduce(this.suites, function(sum, suite) {
+    return sum + suite.total();
+  }, 0) + this.tests.length;
+};
+
+/**
+ * Iterates through each suite recursively to find all tests. Applies a
+ * function in the format `fn(test)`.
+ *
+ * @api private
+ * @param {Function} fn
+ * @return {Suite}
+ */
+Suite.prototype.eachTest = function(fn) {
+  utils.forEach(this.tests, fn);
+  utils.forEach(this.suites, function(suite) {
+    suite.eachTest(fn);
+  });
+  return this;
+};
+
+/**
+ * This will run the root suite if we happen to be running in delayed mode.
+ */
+Suite.prototype.run = function run() {
+  if (this.root) {
+    this.emit('run');
+  }
+};
diff --git a/node_modules/mocha/lib/template.html b/node_modules/mocha/lib/template.html
new file mode 100644
index 0000000..36c5e0b
--- /dev/null
+++ b/node_modules/mocha/lib/template.html
@@ -0,0 +1,18 @@
+
+
+  
+    Mocha
+    
+    
+    
+  
+  
+    
    
+    
+    
+    
+    
+  
+
diff --git a/node_modules/mocha/lib/test.js b/node_modules/mocha/lib/test.js
new file mode 100644
index 0000000..a95cd31
--- /dev/null
+++ b/node_modules/mocha/lib/test.js
@@ -0,0 +1,44 @@
+/**
+ * Module dependencies.
+ */
+
+var Runnable = require('./runnable');
+var inherits = require('./utils').inherits;
+
+/**
+ * Expose `Test`.
+ */
+
+module.exports = Test;
+
+/**
+ * Initialize a new `Test` with the given `title` and callback `fn`.
+ *
+ * @api private
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Test(title, fn) {
+  Runnable.call(this, title, fn);
+  this.pending = !fn;
+  this.type = 'test';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+inherits(Test, Runnable);
+
+Test.prototype.clone = function() {
+  var test = new Test(this.title, this.fn);
+  test.timeout(this.timeout());
+  test.slow(this.slow());
+  test.enableTimeouts(this.enableTimeouts());
+  test.retries(this.retries());
+  test.currentRetry(this.currentRetry());
+  test.globals(this.globals());
+  test.parent = this.parent;
+  test.file = this.file;
+  test.ctx = this.ctx;
+  return test;
+};
diff --git a/node_modules/mocha/lib/utils.js b/node_modules/mocha/lib/utils.js
new file mode 100644
index 0000000..e5d2140
--- /dev/null
+++ b/node_modules/mocha/lib/utils.js
@@ -0,0 +1,750 @@
+/* eslint-env browser */
+
+/**
+ * Module dependencies.
+ */
+
+var basename = require('path').basename;
+var debug = require('debug')('mocha:watch');
+var exists = require('fs').existsSync || require('path').existsSync;
+var glob = require('glob');
+var join = require('path').join;
+var readdirSync = require('fs').readdirSync;
+var statSync = require('fs').statSync;
+var watchFile = require('fs').watchFile;
+var toISOString = require('to-iso-string');
+
+/**
+ * Ignored directories.
+ */
+
+var ignore = ['node_modules', '.git'];
+
+exports.inherits = require('util').inherits;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @api private
+ * @param  {string} html
+ * @return {string}
+ */
+exports.escape = function(html) {
+  return String(html)
+    .replace(/&/g, '&')
+    .replace(/"/g, '"')
+    .replace(//g, '>');
+};
+
+/**
+ * Array#forEach (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} scope
+ */
+exports.forEach = function(arr, fn, scope) {
+  for (var i = 0, l = arr.length; i < l; i++) {
+    fn.call(scope, arr[i], i);
+  }
+};
+
+/**
+ * Test if the given obj is type of string.
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {boolean}
+ */
+exports.isString = function(obj) {
+  return typeof obj === 'string';
+};
+
+/**
+ * Array#map (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} scope
+ * @return {Array}
+ */
+exports.map = function(arr, fn, scope) {
+  var result = [];
+  for (var i = 0, l = arr.length; i < l; i++) {
+    result.push(fn.call(scope, arr[i], i, arr));
+  }
+  return result;
+};
+
+/**
+ * Array#indexOf (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Object} obj to find index of
+ * @param {number} start
+ * @return {number}
+ */
+exports.indexOf = function(arr, obj, start) {
+  for (var i = start || 0, l = arr.length; i < l; i++) {
+    if (arr[i] === obj) {
+      return i;
+    }
+  }
+  return -1;
+};
+
+/**
+ * Array#reduce (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} val Initial value.
+ * @return {*}
+ */
+exports.reduce = function(arr, fn, val) {
+  var rval = val;
+
+  for (var i = 0, l = arr.length; i < l; i++) {
+    rval = fn(rval, arr[i], i, arr);
+  }
+
+  return rval;
+};
+
+/**
+ * Array#filter (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @return {Array}
+ */
+exports.filter = function(arr, fn) {
+  var ret = [];
+
+  for (var i = 0, l = arr.length; i < l; i++) {
+    var val = arr[i];
+    if (fn(val, i, arr)) {
+      ret.push(val);
+    }
+  }
+
+  return ret;
+};
+
+/**
+ * Object.keys (<=IE8)
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {Array} keys
+ */
+exports.keys = typeof Object.keys === 'function' ? Object.keys : function(obj) {
+  var keys = [];
+  var has = Object.prototype.hasOwnProperty; // for `window` on <=IE8
+
+  for (var key in obj) {
+    if (has.call(obj, key)) {
+      keys.push(key);
+    }
+  }
+
+  return keys;
+};
+
+/**
+ * Watch the given `files` for changes
+ * and invoke `fn(file)` on modification.
+ *
+ * @api private
+ * @param {Array} files
+ * @param {Function} fn
+ */
+exports.watch = function(files, fn) {
+  var options = { interval: 100 };
+  files.forEach(function(file) {
+    debug('file %s', file);
+    watchFile(file, options, function(curr, prev) {
+      if (prev.mtime < curr.mtime) {
+        fn(file);
+      }
+    });
+  });
+};
+
+/**
+ * Array.isArray (<=IE8)
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {Boolean}
+ */
+var isArray = typeof Array.isArray === 'function' ? Array.isArray : function(obj) {
+  return Object.prototype.toString.call(obj) === '[object Array]';
+};
+
+exports.isArray = isArray;
+
+/**
+ * Buffer.prototype.toJSON polyfill.
+ *
+ * @type {Function}
+ */
+if (typeof Buffer !== 'undefined' && Buffer.prototype) {
+  Buffer.prototype.toJSON = Buffer.prototype.toJSON || function() {
+    return Array.prototype.slice.call(this, 0);
+  };
+}
+
+/**
+ * Ignored files.
+ *
+ * @api private
+ * @param {string} path
+ * @return {boolean}
+ */
+function ignored(path) {
+  return !~ignore.indexOf(path);
+}
+
+/**
+ * Lookup files in the given `dir`.
+ *
+ * @api private
+ * @param {string} dir
+ * @param {string[]} [ext=['.js']]
+ * @param {Array} [ret=[]]
+ * @return {Array}
+ */
+exports.files = function(dir, ext, ret) {
+  ret = ret || [];
+  ext = ext || ['js'];
+
+  var re = new RegExp('\\.(' + ext.join('|') + ')$');
+
+  readdirSync(dir)
+    .filter(ignored)
+    .forEach(function(path) {
+      path = join(dir, path);
+      if (statSync(path).isDirectory()) {
+        exports.files(path, ext, ret);
+      } else if (path.match(re)) {
+        ret.push(path);
+      }
+    });
+
+  return ret;
+};
+
+/**
+ * Compute a slug from the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+exports.slug = function(str) {
+  return str
+    .toLowerCase()
+    .replace(/ +/g, '-')
+    .replace(/[^-\w]/g, '');
+};
+
+/**
+ * Strip the function definition from `str`, and re-indent for pre whitespace.
+ *
+ * @param {string} str
+ * @return {string}
+ */
+exports.clean = function(str) {
+  str = str
+    .replace(/\r\n?|[\n\u2028\u2029]/g, '\n').replace(/^\uFEFF/, '')
+    .replace(/^function *\(.*\)\s*\{|\(.*\) *=> *\{?/, '')
+    .replace(/\s+\}$/, '');
+
+  var spaces = str.match(/^\n?( *)/)[1].length;
+  var tabs = str.match(/^\n?(\t*)/)[1].length;
+  var re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm');
+
+  str = str.replace(re, '');
+
+  return exports.trim(str);
+};
+
+/**
+ * Trim the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+exports.trim = function(str) {
+  return str.replace(/^\s+|\s+$/g, '');
+};
+
+/**
+ * Parse the given `qs`.
+ *
+ * @api private
+ * @param {string} qs
+ * @return {Object}
+ */
+exports.parseQuery = function(qs) {
+  return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair) {
+    var i = pair.indexOf('=');
+    var key = pair.slice(0, i);
+    var val = pair.slice(++i);
+
+    obj[key] = decodeURIComponent(val);
+    return obj;
+  }, {});
+};
+
+/**
+ * Highlight the given string of `js`.
+ *
+ * @api private
+ * @param {string} js
+ * @return {string}
+ */
+function highlight(js) {
+  return js
+    .replace(//g, '>')
+    .replace(/\/\/(.*)/gm, '//$1')
+    .replace(/('.*?')/gm, '$1')
+    .replace(/(\d+\.\d+)/gm, '$1')
+    .replace(/(\d+)/gm, '$1')
+    .replace(/\bnew[ \t]+(\w+)/gm, 'new $1')
+    .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1');
+}
+
+/**
+ * Highlight the contents of tag `name`.
+ *
+ * @api private
+ * @param {string} name
+ */
+exports.highlightTags = function(name) {
+  var code = document.getElementById('mocha').getElementsByTagName(name);
+  for (var i = 0, len = code.length; i < len; ++i) {
+    code[i].innerHTML = highlight(code[i].innerHTML);
+  }
+};
+
+/**
+ * If a value could have properties, and has none, this function is called,
+ * which returns a string representation of the empty value.
+ *
+ * Functions w/ no properties return `'[Function]'`
+ * Arrays w/ length === 0 return `'[]'`
+ * Objects w/ no properties return `'{}'`
+ * All else: return result of `value.toString()`
+ *
+ * @api private
+ * @param {*} value The value to inspect.
+ * @param {string} [type] The type of the value, if known.
+ * @returns {string}
+ */
+function emptyRepresentation(value, type) {
+  type = type || exports.type(value);
+
+  switch (type) {
+    case 'function':
+      return '[Function]';
+    case 'object':
+      return '{}';
+    case 'array':
+      return '[]';
+    default:
+      return value.toString();
+  }
+}
+
+/**
+ * Takes some variable and asks `Object.prototype.toString()` what it thinks it
+ * is.
+ *
+ * @api private
+ * @see https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/toString
+ * @param {*} value The value to test.
+ * @returns {string}
+ * @example
+ * type({}) // 'object'
+ * type([]) // 'array'
+ * type(1) // 'number'
+ * type(false) // 'boolean'
+ * type(Infinity) // 'number'
+ * type(null) // 'null'
+ * type(new Date()) // 'date'
+ * type(/foo/) // 'regexp'
+ * type('type') // 'string'
+ * type(global) // 'global'
+ */
+exports.type = function type(value) {
+  if (value === undefined) {
+    return 'undefined';
+  } else if (value === null) {
+    return 'null';
+  } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) {
+    return 'buffer';
+  }
+  return Object.prototype.toString.call(value)
+    .replace(/^\[.+\s(.+?)\]$/, '$1')
+    .toLowerCase();
+};
+
+/**
+ * Stringify `value`. Different behavior depending on type of value:
+ *
+ * - If `value` is undefined or null, return `'[undefined]'` or `'[null]'`, respectively.
+ * - If `value` is not an object, function or array, return result of `value.toString()` wrapped in double-quotes.
+ * - If `value` is an *empty* object, function, or array, return result of function
+ *   {@link emptyRepresentation}.
+ * - If `value` has properties, call {@link exports.canonicalize} on it, then return result of
+ *   JSON.stringify().
+ *
+ * @api private
+ * @see exports.type
+ * @param {*} value
+ * @return {string}
+ */
+exports.stringify = function(value) {
+  var type = exports.type(value);
+
+  if (!~exports.indexOf(['object', 'array', 'function'], type)) {
+    if (type !== 'buffer') {
+      return jsonStringify(value);
+    }
+    var json = value.toJSON();
+    // Based on the toJSON result
+    return jsonStringify(json.data && json.type ? json.data : json, 2)
+      .replace(/,(\n|$)/g, '$1');
+  }
+
+  for (var prop in value) {
+    if (Object.prototype.hasOwnProperty.call(value, prop)) {
+      return jsonStringify(exports.canonicalize(value), 2).replace(/,(\n|$)/g, '$1');
+    }
+  }
+
+  return emptyRepresentation(value, type);
+};
+
+/**
+ * like JSON.stringify but more sense.
+ *
+ * @api private
+ * @param {Object}  object
+ * @param {number=} spaces
+ * @param {number=} depth
+ * @returns {*}
+ */
+function jsonStringify(object, spaces, depth) {
+  if (typeof spaces === 'undefined') {
+    // primitive types
+    return _stringify(object);
+  }
+
+  depth = depth || 1;
+  var space = spaces * depth;
+  var str = isArray(object) ? '[' : '{';
+  var end = isArray(object) ? ']' : '}';
+  var length = typeof object.length === 'number' ? object.length : exports.keys(object).length;
+  // `.repeat()` polyfill
+  function repeat(s, n) {
+    return new Array(n).join(s);
+  }
+
+  function _stringify(val) {
+    switch (exports.type(val)) {
+      case 'null':
+      case 'undefined':
+        val = '[' + val + ']';
+        break;
+      case 'array':
+      case 'object':
+        val = jsonStringify(val, spaces, depth + 1);
+        break;
+      case 'boolean':
+      case 'regexp':
+      case 'symbol':
+      case 'number':
+        val = val === 0 && (1 / val) === -Infinity // `-0`
+          ? '-0'
+          : val.toString();
+        break;
+      case 'date':
+        var sDate;
+        if (isNaN(val.getTime())) { // Invalid date
+          sDate = val.toString();
+        } else {
+          sDate = val.toISOString ? val.toISOString() : toISOString(val);
+        }
+        val = '[Date: ' + sDate + ']';
+        break;
+      case 'buffer':
+        var json = val.toJSON();
+        // Based on the toJSON result
+        json = json.data && json.type ? json.data : json;
+        val = '[Buffer: ' + jsonStringify(json, 2, depth + 1) + ']';
+        break;
+      default:
+        val = (val === '[Function]' || val === '[Circular]')
+          ? val
+          : JSON.stringify(val); // string
+    }
+    return val;
+  }
+
+  for (var i in object) {
+    if (!Object.prototype.hasOwnProperty.call(object, i)) {
+      continue; // not my business
+    }
+    --length;
+    str += '\n ' + repeat(' ', space)
+      + (isArray(object) ? '' : '"' + i + '": ') // key
+      + _stringify(object[i])                     // value
+      + (length ? ',' : '');                     // comma
+  }
+
+  return str
+    // [], {}
+    + (str.length !== 1 ? '\n' + repeat(' ', --space) + end : end);
+}
+
+/**
+ * Test if a value is a buffer.
+ *
+ * @api private
+ * @param {*} value The value to test.
+ * @return {boolean} True if `value` is a buffer, otherwise false
+ */
+exports.isBuffer = function(value) {
+  return typeof Buffer !== 'undefined' && Buffer.isBuffer(value);
+};
+
+/**
+ * Return a new Thing that has the keys in sorted order. Recursive.
+ *
+ * If the Thing...
+ * - has already been seen, return string `'[Circular]'`
+ * - is `undefined`, return string `'[undefined]'`
+ * - is `null`, return value `null`
+ * - is some other primitive, return the value
+ * - is not a primitive or an `Array`, `Object`, or `Function`, return the value of the Thing's `toString()` method
+ * - is a non-empty `Array`, `Object`, or `Function`, return the result of calling this function again.
+ * - is an empty `Array`, `Object`, or `Function`, return the result of calling `emptyRepresentation()`
+ *
+ * @api private
+ * @see {@link exports.stringify}
+ * @param {*} value Thing to inspect.  May or may not have properties.
+ * @param {Array} [stack=[]] Stack of seen values
+ * @return {(Object|Array|Function|string|undefined)}
+ */
+exports.canonicalize = function(value, stack) {
+  var canonicalizedObj;
+  /* eslint-disable no-unused-vars */
+  var prop;
+  /* eslint-enable no-unused-vars */
+  var type = exports.type(value);
+  function withStack(value, fn) {
+    stack.push(value);
+    fn();
+    stack.pop();
+  }
+
+  stack = stack || [];
+
+  if (exports.indexOf(stack, value) !== -1) {
+    return '[Circular]';
+  }
+
+  switch (type) {
+    case 'undefined':
+    case 'buffer':
+    case 'null':
+      canonicalizedObj = value;
+      break;
+    case 'array':
+      withStack(value, function() {
+        canonicalizedObj = exports.map(value, function(item) {
+          return exports.canonicalize(item, stack);
+        });
+      });
+      break;
+    case 'function':
+      /* eslint-disable guard-for-in */
+      for (prop in value) {
+        canonicalizedObj = {};
+        break;
+      }
+      /* eslint-enable guard-for-in */
+      if (!canonicalizedObj) {
+        canonicalizedObj = emptyRepresentation(value, type);
+        break;
+      }
+    /* falls through */
+    case 'object':
+      canonicalizedObj = canonicalizedObj || {};
+      withStack(value, function() {
+        exports.forEach(exports.keys(value).sort(), function(key) {
+          canonicalizedObj[key] = exports.canonicalize(value[key], stack);
+        });
+      });
+      break;
+    case 'date':
+    case 'number':
+    case 'regexp':
+    case 'boolean':
+    case 'symbol':
+      canonicalizedObj = value;
+      break;
+    default:
+      canonicalizedObj = value + '';
+  }
+
+  return canonicalizedObj;
+};
+
+/**
+ * Lookup file names at the given `path`.
+ *
+ * @api public
+ * @param {string} path Base path to start searching from.
+ * @param {string[]} extensions File extensions to look for.
+ * @param {boolean} recursive Whether or not to recurse into subdirectories.
+ * @return {string[]} An array of paths.
+ */
+exports.lookupFiles = function lookupFiles(path, extensions, recursive) {
+  var files = [];
+  var re = new RegExp('\\.(' + extensions.join('|') + ')$');
+
+  if (!exists(path)) {
+    if (exists(path + '.js')) {
+      path += '.js';
+    } else {
+      files = glob.sync(path);
+      if (!files.length) {
+        throw new Error("cannot resolve path (or pattern) '" + path + "'");
+      }
+      return files;
+    }
+  }
+
+  try {
+    var stat = statSync(path);
+    if (stat.isFile()) {
+      return path;
+    }
+  } catch (err) {
+    // ignore error
+    return;
+  }
+
+  readdirSync(path).forEach(function(file) {
+    file = join(path, file);
+    try {
+      var stat = statSync(file);
+      if (stat.isDirectory()) {
+        if (recursive) {
+          files = files.concat(lookupFiles(file, extensions, recursive));
+        }
+        return;
+      }
+    } catch (err) {
+      // ignore error
+      return;
+    }
+    if (!stat.isFile() || !re.test(file) || basename(file)[0] === '.') {
+      return;
+    }
+    files.push(file);
+  });
+
+  return files;
+};
+
+/**
+ * Generate an undefined error with a message warning the user.
+ *
+ * @return {Error}
+ */
+
+exports.undefinedError = function() {
+  return new Error('Caught undefined error, did you throw without specifying what?');
+};
+
+/**
+ * Generate an undefined error if `err` is not defined.
+ *
+ * @param {Error} err
+ * @return {Error}
+ */
+
+exports.getError = function(err) {
+  return err || exports.undefinedError();
+};
+
+/**
+ * @summary
+ * This Filter based on `mocha-clean` module.(see: `github.com/rstacruz/mocha-clean`)
+ * @description
+ * When invoking this function you get a filter function that get the Error.stack as an input,
+ * and return a prettify output.
+ * (i.e: strip Mocha and internal node functions from stack trace).
+ * @returns {Function}
+ */
+exports.stackTraceFilter = function() {
+  // TODO: Replace with `process.browser`
+  var slash = '/';
+  var is = typeof document === 'undefined' ? { node: true } : { browser: true };
+  var cwd = is.node
+      ? process.cwd() + slash
+      : (typeof location === 'undefined' ? window.location : location).href.replace(/\/[^\/]*$/, '/');
+
+  function isMochaInternal(line) {
+    return (~line.indexOf('node_modules' + slash + 'mocha' + slash))
+      || (~line.indexOf('components' + slash + 'mochajs' + slash))
+      || (~line.indexOf('components' + slash + 'mocha' + slash))
+      || (~line.indexOf(slash + 'mocha.js'));
+  }
+
+  function isNodeInternal(line) {
+    return (~line.indexOf('(timers.js:'))
+      || (~line.indexOf('(events.js:'))
+      || (~line.indexOf('(node.js:'))
+      || (~line.indexOf('(module.js:'))
+      || (~line.indexOf('GeneratorFunctionPrototype.next (native)'))
+      || false;
+  }
+
+  return function(stack) {
+    stack = stack.split('\n');
+
+    stack = exports.reduce(stack, function(list, line) {
+      if (isMochaInternal(line)) {
+        return list;
+      }
+
+      if (is.node && isNodeInternal(line)) {
+        return list;
+      }
+
+      // Clean up cwd(absolute)
+      if (/\(?.+:\d+:\d+\)?$/.test(line)) {
+        line = line.replace(cwd, '');
+      }
+
+      list.push(line);
+      return list;
+    }, []);
+
+    return stack.join('\n');
+  };
+};
diff --git a/node_modules/mocha/mocha.css b/node_modules/mocha/mocha.css
new file mode 100644
index 0000000..759a6c8
--- /dev/null
+++ b/node_modules/mocha/mocha.css
@@ -0,0 +1,314 @@
+@charset "utf-8";
+
+body {
+  margin:0;
+}
+
+#mocha {
+  font: 20px/1.5 "Helvetica Neue", Helvetica, Arial, sans-serif;
+  margin: 60px 50px;
+}
+
+#mocha ul,
+#mocha li {
+  margin: 0;
+  padding: 0;
+}
+
+#mocha ul {
+  list-style: none;
+}
+
+#mocha h1,
+#mocha h2 {
+  margin: 0;
+}
+
+#mocha h1 {
+  margin-top: 15px;
+  font-size: 1em;
+  font-weight: 200;
+}
+
+#mocha h1 a {
+  text-decoration: none;
+  color: inherit;
+}
+
+#mocha h1 a:hover {
+  text-decoration: underline;
+}
+
+#mocha .suite .suite h1 {
+  margin-top: 0;
+  font-size: .8em;
+}
+
+#mocha .hidden {
+  display: none;
+}
+
+#mocha h2 {
+  font-size: 12px;
+  font-weight: normal;
+  cursor: pointer;
+}
+
+#mocha .suite {
+  margin-left: 15px;
+}
+
+#mocha .test {
+  margin-left: 15px;
+  overflow: hidden;
+}
+
+#mocha .test.pending:hover h2::after {
+  content: '(pending)';
+  font-family: arial, sans-serif;
+}
+
+#mocha .test.pass.medium .duration {
+  background: #c09853;
+}
+
+#mocha .test.pass.slow .duration {
+  background: #b94a48;
+}
+
+#mocha .test.pass::before {
+  content: '✓';
+  font-size: 12px;
+  display: block;
+  float: left;
+  margin-right: 5px;
+  color: #00d6b2;
+}
+
+#mocha .test.pass .duration {
+  font-size: 9px;
+  margin-left: 5px;
+  padding: 2px 5px;
+  color: #fff;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  -webkit-border-radius: 5px;
+  -moz-border-radius: 5px;
+  -ms-border-radius: 5px;
+  -o-border-radius: 5px;
+  border-radius: 5px;
+}
+
+#mocha .test.pass.fast .duration {
+  display: none;
+}
+
+#mocha .test.pending {
+  color: #0b97c4;
+}
+
+#mocha .test.pending::before {
+  content: '◦';
+  color: #0b97c4;
+}
+
+#mocha .test.fail {
+  color: #c00;
+}
+
+#mocha .test.fail pre {
+  color: black;
+}
+
+#mocha .test.fail::before {
+  content: '✖';
+  font-size: 12px;
+  display: block;
+  float: left;
+  margin-right: 5px;
+  color: #c00;
+}
+
+#mocha .test pre.error {
+  color: #c00;
+  max-height: 300px;
+  overflow: auto;
+}
+
+#mocha .test .html-error {
+  overflow: auto;
+  color: black;
+  line-height: 1.5;
+  display: block;
+  float: left;
+  clear: left;
+  font: 12px/1.5 monaco, monospace;
+  margin: 5px;
+  padding: 15px;
+  border: 1px solid #eee;
+  max-width: 85%; /*(1)*/
+  max-width: calc(100% - 42px); /*(2)*/
+  max-height: 300px;
+  word-wrap: break-word;
+  border-bottom-color: #ddd;
+  -webkit-border-radius: 3px;
+  -webkit-box-shadow: 0 1px 3px #eee;
+  -moz-border-radius: 3px;
+  -moz-box-shadow: 0 1px 3px #eee;
+  border-radius: 3px;
+}
+
+#mocha .test .html-error pre.error {
+  border: none;
+  -webkit-border-radius: none;
+  -webkit-box-shadow: none;
+  -moz-border-radius: none;
+  -moz-box-shadow: none;
+  padding: 0;
+  margin: 0;
+  margin-top: 18px;
+  max-height: none;
+}
+
+/**
+ * (1): approximate for browsers not supporting calc
+ * (2): 42 = 2*15 + 2*10 + 2*1 (padding + margin + border)
+ *      ^^ seriously
+ */
+#mocha .test pre {
+  display: block;
+  float: left;
+  clear: left;
+  font: 12px/1.5 monaco, monospace;
+  margin: 5px;
+  padding: 15px;
+  border: 1px solid #eee;
+  max-width: 85%; /*(1)*/
+  max-width: calc(100% - 42px); /*(2)*/
+  word-wrap: break-word;
+  border-bottom-color: #ddd;
+  -webkit-border-radius: 3px;
+  -webkit-box-shadow: 0 1px 3px #eee;
+  -moz-border-radius: 3px;
+  -moz-box-shadow: 0 1px 3px #eee;
+  border-radius: 3px;
+}
+
+#mocha .test h2 {
+  position: relative;
+}
+
+#mocha .test a.replay {
+  position: absolute;
+  top: 3px;
+  right: 0;
+  text-decoration: none;
+  vertical-align: middle;
+  display: block;
+  width: 15px;
+  height: 15px;
+  line-height: 15px;
+  text-align: center;
+  background: #eee;
+  font-size: 15px;
+  -moz-border-radius: 15px;
+  border-radius: 15px;
+  -webkit-transition: opacity 200ms;
+  -moz-transition: opacity 200ms;
+  transition: opacity 200ms;
+  opacity: 0.3;
+  color: #888;
+}
+
+#mocha .test:hover a.replay {
+  opacity: 1;
+}
+
+#mocha-report.pass .test.fail {
+  display: none;
+}
+
+#mocha-report.fail .test.pass {
+  display: none;
+}
+
+#mocha-report.pending .test.pass,
+#mocha-report.pending .test.fail {
+  display: none;
+}
+#mocha-report.pending .test.pass.pending {
+  display: block;
+}
+
+#mocha-error {
+  color: #c00;
+  font-size: 1.5em;
+  font-weight: 100;
+  letter-spacing: 1px;
+}
+
+#mocha-stats {
+  position: fixed;
+  top: 15px;
+  right: 10px;
+  font-size: 12px;
+  margin: 0;
+  color: #888;
+  z-index: 1;
+}
+
+#mocha-stats .progress {
+  float: right;
+  padding-top: 0;
+  
+  /**
+   * Set safe initial values, so mochas .progress does not inherit these
+   * properties from Bootstrap .progress (which causes .progress height to
+   * equal line height set in Bootstrap).
+   */
+  height: auto;
+  box-shadow: none;
+  background-color: initial;
+}
+
+#mocha-stats em {
+  color: black;
+}
+
+#mocha-stats a {
+  text-decoration: none;
+  color: inherit;
+}
+
+#mocha-stats a:hover {
+  border-bottom: 1px solid #eee;
+}
+
+#mocha-stats li {
+  display: inline-block;
+  margin: 0 5px;
+  list-style: none;
+  padding-top: 11px;
+}
+
+#mocha-stats canvas {
+  width: 40px;
+  height: 40px;
+}
+
+#mocha code .comment { color: #ddd; }
+#mocha code .init { color: #2f6fad; }
+#mocha code .string { color: #5890ad; }
+#mocha code .keyword { color: #8a6343; }
+#mocha code .number { color: #2f6fad; }
+
+@media screen and (max-device-width: 480px) {
+  #mocha {
+    margin: 60px 0px;
+  }
+
+  #mocha #stats {
+    position: absolute;
+  }
+}
diff --git a/node_modules/mocha/mocha.js b/node_modules/mocha/mocha.js
new file mode 100644
index 0000000..af90ada
--- /dev/null
+++ b/node_modules/mocha/mocha.js
@@ -0,0 +1,13149 @@
+(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o 1) {
+        suites.shift();
+      }
+      var suite = Suite.create(suites[0], title);
+      suite.file = file;
+      suites.unshift(suite);
+      return suite;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.suite.only = function(title, fn) {
+      var suite = context.suite(title, fn);
+      mocha.grep(suite.fullTitle());
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.test = function(title, fn) {
+      var test = new Test(title, fn);
+      test.file = file;
+      suites[0].addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      var test = context.test(title, fn);
+      var reString = '^' + escapeRe(test.fullTitle()) + '$';
+      mocha.grep(new RegExp(reString));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+},{"../suite":37,"../test":38,"./common":9,"escape-string-regexp":49}],13:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var Suite = require('../suite');
+var Test = require('../test');
+var escapeRe = require('escape-string-regexp');
+
+/**
+ * TDD-style interface:
+ *
+ *      suite('Array', function() {
+ *        suite('#indexOf()', function() {
+ *          suiteSetup(function() {
+ *
+ *          });
+ *
+ *          test('should return -1 when not present', function() {
+ *
+ *          });
+ *
+ *          test('should return the index when present', function() {
+ *
+ *          });
+ *
+ *          suiteTeardown(function() {
+ *
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on('pre-require', function(context, file, mocha) {
+    var common = require('./common')(suites, context);
+
+    context.setup = common.beforeEach;
+    context.teardown = common.afterEach;
+    context.suiteSetup = common.before;
+    context.suiteTeardown = common.after;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+
+    /**
+     * Describe a "suite" with the given `title` and callback `fn` containing
+     * nested suites and/or tests.
+     */
+    context.suite = function(title, fn) {
+      var suite = Suite.create(suites[0], title);
+      suite.file = file;
+      suites.unshift(suite);
+      fn.call(suite);
+      suites.shift();
+      return suite;
+    };
+
+    /**
+     * Pending suite.
+     */
+    context.suite.skip = function(title, fn) {
+      var suite = Suite.create(suites[0], title);
+      suite.pending = true;
+      suites.unshift(suite);
+      fn.call(suite);
+      suites.shift();
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+    context.suite.only = function(title, fn) {
+      var suite = context.suite(title, fn);
+      mocha.grep(suite.fullTitle());
+    };
+
+    /**
+     * Describe a specification or test-case with the given `title` and
+     * callback `fn` acting as a thunk.
+     */
+    context.test = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      var test = context.test(title, fn);
+      var reString = '^' + escapeRe(test.fullTitle()) + '$';
+      mocha.grep(new RegExp(reString));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+},{"../suite":37,"../test":38,"./common":9,"escape-string-regexp":49}],14:[function(require,module,exports){
+(function (process,global,__dirname){
+/*!
+ * mocha
+ * Copyright(c) 2011 TJ Holowaychuk 
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var escapeRe = require('escape-string-regexp');
+var path = require('path');
+var reporters = require('./reporters');
+var utils = require('./utils');
+
+/**
+ * Expose `Mocha`.
+ */
+
+exports = module.exports = Mocha;
+
+/**
+ * To require local UIs and reporters when running in node.
+ */
+
+if (!process.browser) {
+  var cwd = process.cwd();
+  module.paths.push(cwd, path.join(cwd, 'node_modules'));
+}
+
+/**
+ * Expose internals.
+ */
+
+exports.utils = utils;
+exports.interfaces = require('./interfaces');
+exports.reporters = reporters;
+exports.Runnable = require('./runnable');
+exports.Context = require('./context');
+exports.Runner = require('./runner');
+exports.Suite = require('./suite');
+exports.Hook = require('./hook');
+exports.Test = require('./test');
+
+/**
+ * Return image `name` path.
+ *
+ * @api private
+ * @param {string} name
+ * @return {string}
+ */
+function image(name) {
+  return path.join(__dirname, '../images', name + '.png');
+}
+
+/**
+ * Set up mocha with `options`.
+ *
+ * Options:
+ *
+ *   - `ui` name "bdd", "tdd", "exports" etc
+ *   - `reporter` reporter instance, defaults to `mocha.reporters.spec`
+ *   - `globals` array of accepted globals
+ *   - `timeout` timeout in milliseconds
+ *   - `retries` number of times to retry failed tests
+ *   - `bail` bail on the first test failure
+ *   - `slow` milliseconds to wait before considering a test slow
+ *   - `ignoreLeaks` ignore global leaks
+ *   - `fullTrace` display the full stack-trace on failing
+ *   - `grep` string or regexp to filter tests with
+ *
+ * @param {Object} options
+ * @api public
+ */
+function Mocha(options) {
+  options = options || {};
+  this.files = [];
+  this.options = options;
+  if (options.grep) {
+    this.grep(new RegExp(options.grep));
+  }
+  if (options.fgrep) {
+    this.grep(options.fgrep);
+  }
+  this.suite = new exports.Suite('', new exports.Context());
+  this.ui(options.ui);
+  this.bail(options.bail);
+  this.reporter(options.reporter, options.reporterOptions);
+  if (typeof options.timeout !== 'undefined' && options.timeout !== null) {
+    this.timeout(options.timeout);
+  }
+  if (typeof options.retries !== 'undefined' && options.retries !== null) {
+    this.retries(options.retries);
+  }
+  this.useColors(options.useColors);
+  if (options.enableTimeouts !== null) {
+    this.enableTimeouts(options.enableTimeouts);
+  }
+  if (options.slow) {
+    this.slow(options.slow);
+  }
+}
+
+/**
+ * Enable or disable bailing on the first failure.
+ *
+ * @api public
+ * @param {boolean} [bail]
+ */
+Mocha.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    bail = true;
+  }
+  this.suite.bail(bail);
+  return this;
+};
+
+/**
+ * Add test `file`.
+ *
+ * @api public
+ * @param {string} file
+ */
+Mocha.prototype.addFile = function(file) {
+  this.files.push(file);
+  return this;
+};
+
+/**
+ * Set reporter to `reporter`, defaults to "spec".
+ *
+ * @param {String|Function} reporter name or constructor
+ * @param {Object} reporterOptions optional options
+ * @api public
+ * @param {string|Function} reporter name or constructor
+ * @param {Object} reporterOptions optional options
+ */
+Mocha.prototype.reporter = function(reporter, reporterOptions) {
+  if (typeof reporter === 'function') {
+    this._reporter = reporter;
+  } else {
+    reporter = reporter || 'spec';
+    var _reporter;
+    // Try to load a built-in reporter.
+    if (reporters[reporter]) {
+      _reporter = reporters[reporter];
+    }
+    // Try to load reporters from process.cwd() and node_modules
+    if (!_reporter) {
+      try {
+        _reporter = require(reporter);
+      } catch (err) {
+        err.message.indexOf('Cannot find module') !== -1
+          ? console.warn('"' + reporter + '" reporter not found')
+          : console.warn('"' + reporter + '" reporter blew up with error:\n' + err.stack);
+      }
+    }
+    if (!_reporter && reporter === 'teamcity') {
+      console.warn('The Teamcity reporter was moved to a package named '
+        + 'mocha-teamcity-reporter '
+        + '(https://npmjs.org/package/mocha-teamcity-reporter).');
+    }
+    if (!_reporter) {
+      throw new Error('invalid reporter "' + reporter + '"');
+    }
+    this._reporter = _reporter;
+  }
+  this.options.reporterOptions = reporterOptions;
+  return this;
+};
+
+/**
+ * Set test UI `name`, defaults to "bdd".
+ *
+ * @api public
+ * @param {string} bdd
+ */
+Mocha.prototype.ui = function(name) {
+  name = name || 'bdd';
+  this._ui = exports.interfaces[name];
+  if (!this._ui) {
+    try {
+      this._ui = require(name);
+    } catch (err) {
+      throw new Error('invalid interface "' + name + '"');
+    }
+  }
+  this._ui = this._ui(this.suite);
+
+  this.suite.on('pre-require', function(context) {
+    exports.afterEach = context.afterEach || context.teardown;
+    exports.after = context.after || context.suiteTeardown;
+    exports.beforeEach = context.beforeEach || context.setup;
+    exports.before = context.before || context.suiteSetup;
+    exports.describe = context.describe || context.suite;
+    exports.it = context.it || context.test;
+    exports.setup = context.setup || context.beforeEach;
+    exports.suiteSetup = context.suiteSetup || context.before;
+    exports.suiteTeardown = context.suiteTeardown || context.after;
+    exports.suite = context.suite || context.describe;
+    exports.teardown = context.teardown || context.afterEach;
+    exports.test = context.test || context.it;
+    exports.run = context.run;
+  });
+
+  return this;
+};
+
+/**
+ * Load registered files.
+ *
+ * @api private
+ */
+Mocha.prototype.loadFiles = function(fn) {
+  var self = this;
+  var suite = this.suite;
+  this.files.forEach(function(file) {
+    file = path.resolve(file);
+    suite.emit('pre-require', global, file, self);
+    suite.emit('require', require(file), file, self);
+    suite.emit('post-require', global, file, self);
+  });
+  fn && fn();
+};
+
+/**
+ * Enable growl support.
+ *
+ * @api private
+ */
+Mocha.prototype._growl = function(runner, reporter) {
+  var notify = require('growl');
+
+  runner.on('end', function() {
+    var stats = reporter.stats;
+    if (stats.failures) {
+      var msg = stats.failures + ' of ' + runner.total + ' tests failed';
+      notify(msg, { name: 'mocha', title: 'Failed', image: image('error') });
+    } else {
+      notify(stats.passes + ' tests passed in ' + stats.duration + 'ms', {
+        name: 'mocha',
+        title: 'Passed',
+        image: image('ok')
+      });
+    }
+  });
+};
+
+/**
+ * Add regexp to grep, if `re` is a string it is escaped.
+ *
+ * @param {RegExp|String} re
+ * @return {Mocha}
+ * @api public
+ * @param {RegExp|string} re
+ * @return {Mocha}
+ */
+Mocha.prototype.grep = function(re) {
+  this.options.grep = typeof re === 'string' ? new RegExp(escapeRe(re)) : re;
+  return this;
+};
+
+/**
+ * Invert `.grep()` matches.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.invert = function() {
+  this.options.invert = true;
+  return this;
+};
+
+/**
+ * Ignore global leaks.
+ *
+ * @param {Boolean} ignore
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} ignore
+ * @return {Mocha}
+ */
+Mocha.prototype.ignoreLeaks = function(ignore) {
+  this.options.ignoreLeaks = Boolean(ignore);
+  return this;
+};
+
+/**
+ * Enable global leak checking.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.checkLeaks = function() {
+  this.options.ignoreLeaks = false;
+  return this;
+};
+
+/**
+ * Display long stack-trace on failing
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.fullTrace = function() {
+  this.options.fullStackTrace = true;
+  return this;
+};
+
+/**
+ * Enable growl support.
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.growl = function() {
+  this.options.growl = true;
+  return this;
+};
+
+/**
+ * Ignore `globals` array or string.
+ *
+ * @param {Array|String} globals
+ * @return {Mocha}
+ * @api public
+ * @param {Array|string} globals
+ * @return {Mocha}
+ */
+Mocha.prototype.globals = function(globals) {
+  this.options.globals = (this.options.globals || []).concat(globals);
+  return this;
+};
+
+/**
+ * Emit color output.
+ *
+ * @param {Boolean} colors
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} colors
+ * @return {Mocha}
+ */
+Mocha.prototype.useColors = function(colors) {
+  if (colors !== undefined) {
+    this.options.useColors = colors;
+  }
+  return this;
+};
+
+/**
+ * Use inline diffs rather than +/-.
+ *
+ * @param {Boolean} inlineDiffs
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} inlineDiffs
+ * @return {Mocha}
+ */
+Mocha.prototype.useInlineDiffs = function(inlineDiffs) {
+  this.options.useInlineDiffs = inlineDiffs !== undefined && inlineDiffs;
+  return this;
+};
+
+/**
+ * Set the timeout in milliseconds.
+ *
+ * @param {Number} timeout
+ * @return {Mocha}
+ * @api public
+ * @param {number} timeout
+ * @return {Mocha}
+ */
+Mocha.prototype.timeout = function(timeout) {
+  this.suite.timeout(timeout);
+  return this;
+};
+
+/**
+ * Set the number of times to retry failed tests.
+ *
+ * @param {Number} retry times
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.retries = function(n) {
+  this.suite.retries(n);
+  return this;
+};
+
+/**
+ * Set slowness threshold in milliseconds.
+ *
+ * @param {Number} slow
+ * @return {Mocha}
+ * @api public
+ * @param {number} slow
+ * @return {Mocha}
+ */
+Mocha.prototype.slow = function(slow) {
+  this.suite.slow(slow);
+  return this;
+};
+
+/**
+ * Enable timeouts.
+ *
+ * @param {Boolean} enabled
+ * @return {Mocha}
+ * @api public
+ * @param {boolean} enabled
+ * @return {Mocha}
+ */
+Mocha.prototype.enableTimeouts = function(enabled) {
+  this.suite.enableTimeouts(arguments.length && enabled !== undefined ? enabled : true);
+  return this;
+};
+
+/**
+ * Makes all tests async (accepting a callback)
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.asyncOnly = function() {
+  this.options.asyncOnly = true;
+  return this;
+};
+
+/**
+ * Disable syntax highlighting (in browser).
+ *
+ * @api public
+ */
+Mocha.prototype.noHighlighting = function() {
+  this.options.noHighlighting = true;
+  return this;
+};
+
+/**
+ * Enable uncaught errors to propagate (in browser).
+ *
+ * @return {Mocha}
+ * @api public
+ */
+Mocha.prototype.allowUncaught = function() {
+  this.options.allowUncaught = true;
+  return this;
+};
+
+/**
+ * Delay root suite execution.
+ * @returns {Mocha}
+ */
+Mocha.prototype.delay = function delay() {
+  this.options.delay = true;
+  return this;
+};
+
+/**
+ * Run tests and invoke `fn()` when complete.
+ *
+ * @api public
+ * @param {Function} fn
+ * @return {Runner}
+ */
+Mocha.prototype.run = function(fn) {
+  if (this.files.length) {
+    this.loadFiles();
+  }
+  var suite = this.suite;
+  var options = this.options;
+  options.files = this.files;
+  var runner = new exports.Runner(suite, options.delay);
+  var reporter = new this._reporter(runner, options);
+  runner.ignoreLeaks = options.ignoreLeaks !== false;
+  runner.fullStackTrace = options.fullStackTrace;
+  runner.asyncOnly = options.asyncOnly;
+  runner.allowUncaught = options.allowUncaught;
+  if (options.grep) {
+    runner.grep(options.grep, options.invert);
+  }
+  if (options.globals) {
+    runner.globals(options.globals);
+  }
+  if (options.growl) {
+    this._growl(runner, reporter);
+  }
+  if (options.useColors !== undefined) {
+    exports.reporters.Base.useColors = options.useColors;
+  }
+  exports.reporters.Base.inlineDiffs = options.useInlineDiffs;
+
+  function done(failures) {
+    if (reporter.done) {
+      reporter.done(failures, fn);
+    } else {
+      fn && fn(failures);
+    }
+  }
+
+  return runner.run(done);
+};
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {},"/lib")
+},{"./context":6,"./hook":7,"./interfaces":11,"./reporters":22,"./runnable":35,"./runner":36,"./suite":37,"./test":38,"./utils":39,"_process":58,"escape-string-regexp":49,"growl":51,"path":43}],15:[function(require,module,exports){
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @api public
+ * @param {string|number} val
+ * @param {Object} options
+ * @return {string|number}
+ */
+module.exports = function(val, options) {
+  options = options || {};
+  if (typeof val === 'string') {
+    return parse(val);
+  }
+  // https://github.com/mochajs/mocha/pull/1035
+  return options['long'] ? longFormat(val) : shortFormat(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @api private
+ * @param {string} str
+ * @return {number}
+ */
+function parse(str) {
+  var match = (/^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i).exec(str);
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 's':
+      return n * s;
+    case 'ms':
+      return n;
+    default:
+      // No default case
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @api private
+ * @param {number} ms
+ * @return {string}
+ */
+function shortFormat(ms) {
+  if (ms >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (ms >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (ms >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (ms >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @api private
+ * @param {number} ms
+ * @return {string}
+ */
+function longFormat(ms) {
+  return plural(ms, d, 'day')
+    || plural(ms, h, 'hour')
+    || plural(ms, m, 'minute')
+    || plural(ms, s, 'second')
+    || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ *
+ * @api private
+ * @param {number} ms
+ * @param {number} n
+ * @param {string} name
+ */
+function plural(ms, n, name) {
+  if (ms < n) {
+    return;
+  }
+  if (ms < n * 1.5) {
+    return Math.floor(ms / n) + ' ' + name;
+  }
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}
+
+},{}],16:[function(require,module,exports){
+
+/**
+ * Expose `Pending`.
+ */
+
+module.exports = Pending;
+
+/**
+ * Initialize a new `Pending` error with the given message.
+ *
+ * @param {string} message
+ */
+function Pending(message) {
+  this.message = message;
+}
+
+},{}],17:[function(require,module,exports){
+(function (process,global){
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var diff = require('diff');
+var ms = require('../ms');
+var utils = require('../utils');
+var supportsColor = process.browser ? null : require('supports-color');
+
+/**
+ * Expose `Base`.
+ */
+
+exports = module.exports = Base;
+
+/**
+ * Save timer references to avoid Sinon interfering.
+ * See: https://github.com/mochajs/mocha/issues/237
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Check if both stdio streams are associated with a tty.
+ */
+
+var isatty = tty.isatty(1) && tty.isatty(2);
+
+/**
+ * Enable coloring by default, except in the browser interface.
+ */
+
+exports.useColors = !process.browser && (supportsColor || (process.env.MOCHA_COLORS !== undefined));
+
+/**
+ * Inline diffs instead of +/-
+ */
+
+exports.inlineDiffs = false;
+
+/**
+ * Default color map.
+ */
+
+exports.colors = {
+  pass: 90,
+  fail: 31,
+  'bright pass': 92,
+  'bright fail': 91,
+  'bright yellow': 93,
+  pending: 36,
+  suite: 0,
+  'error title': 0,
+  'error message': 31,
+  'error stack': 90,
+  checkmark: 32,
+  fast: 90,
+  medium: 33,
+  slow: 31,
+  green: 32,
+  light: 90,
+  'diff gutter': 90,
+  'diff added': 32,
+  'diff removed': 31
+};
+
+/**
+ * Default symbol map.
+ */
+
+exports.symbols = {
+  ok: '✓',
+  err: '✖',
+  dot: '․'
+};
+
+// With node.js on Windows: use symbols available in terminal default fonts
+if (process.platform === 'win32') {
+  exports.symbols.ok = '\u221A';
+  exports.symbols.err = '\u00D7';
+  exports.symbols.dot = '.';
+}
+
+/**
+ * Color `str` with the given `type`,
+ * allowing colors to be disabled,
+ * as well as user-defined color
+ * schemes.
+ *
+ * @param {string} type
+ * @param {string} str
+ * @return {string}
+ * @api private
+ */
+var color = exports.color = function(type, str) {
+  if (!exports.useColors) {
+    return String(str);
+  }
+  return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Expose term window size, with some defaults for when stderr is not a tty.
+ */
+
+exports.window = {
+  width: 75
+};
+
+if (isatty) {
+  exports.window.width = process.stdout.getWindowSize
+      ? process.stdout.getWindowSize(1)[0]
+      : tty.getWindowSize()[1];
+}
+
+/**
+ * Expose some basic cursor interactions that are common among reporters.
+ */
+
+exports.cursor = {
+  hide: function() {
+    isatty && process.stdout.write('\u001b[?25l');
+  },
+
+  show: function() {
+    isatty && process.stdout.write('\u001b[?25h');
+  },
+
+  deleteLine: function() {
+    isatty && process.stdout.write('\u001b[2K');
+  },
+
+  beginningOfLine: function() {
+    isatty && process.stdout.write('\u001b[0G');
+  },
+
+  CR: function() {
+    if (isatty) {
+      exports.cursor.deleteLine();
+      exports.cursor.beginningOfLine();
+    } else {
+      process.stdout.write('\r');
+    }
+  }
+};
+
+/**
+ * Outut the given `failures` as a list.
+ *
+ * @param {Array} failures
+ * @api public
+ */
+
+exports.list = function(failures) {
+  console.log();
+  failures.forEach(function(test, i) {
+    // format
+    var fmt = color('error title', '  %s) %s:\n')
+      + color('error message', '     %s')
+      + color('error stack', '\n%s\n');
+
+    // msg
+    var msg;
+    var err = test.err;
+    var message;
+    if (err.message && typeof err.message.toString === 'function') {
+      message = err.message + '';
+    } else if (typeof err.inspect === 'function') {
+      message = err.inspect() + '';
+    } else {
+      message = '';
+    }
+    var stack = err.stack || message;
+    var index = stack.indexOf(message);
+    var actual = err.actual;
+    var expected = err.expected;
+    var escape = true;
+
+    if (index === -1) {
+      msg = message;
+    } else {
+      index += message.length;
+      msg = stack.slice(0, index);
+      // remove msg from stack
+      stack = stack.slice(index + 1);
+    }
+
+    // uncaught
+    if (err.uncaught) {
+      msg = 'Uncaught ' + msg;
+    }
+    // explicitly show diff
+    if (err.showDiff !== false && sameType(actual, expected) && expected !== undefined) {
+      escape = false;
+      if (!(utils.isString(actual) && utils.isString(expected))) {
+        err.actual = actual = utils.stringify(actual);
+        err.expected = expected = utils.stringify(expected);
+      }
+
+      fmt = color('error title', '  %s) %s:\n%s') + color('error stack', '\n%s\n');
+      var match = message.match(/^([^:]+): expected/);
+      msg = '\n      ' + color('error message', match ? match[1] : msg);
+
+      if (exports.inlineDiffs) {
+        msg += inlineDiff(err, escape);
+      } else {
+        msg += unifiedDiff(err, escape);
+      }
+    }
+
+    // indent stack trace
+    stack = stack.replace(/^/gm, '  ');
+
+    console.log(fmt, (i + 1), test.fullTitle(), msg, stack);
+  });
+};
+
+/**
+ * Initialize a new `Base` reporter.
+ *
+ * All other reporters generally
+ * inherit from this reporter, providing
+ * stats such as test duration, number
+ * of tests passed / failed etc.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+
+function Base(runner) {
+  var stats = this.stats = { suites: 0, tests: 0, passes: 0, pending: 0, failures: 0 };
+  var failures = this.failures = [];
+
+  if (!runner) {
+    return;
+  }
+  this.runner = runner;
+
+  runner.stats = stats;
+
+  runner.on('start', function() {
+    stats.start = new Date();
+  });
+
+  runner.on('suite', function(suite) {
+    stats.suites = stats.suites || 0;
+    suite.root || stats.suites++;
+  });
+
+  runner.on('test end', function() {
+    stats.tests = stats.tests || 0;
+    stats.tests++;
+  });
+
+  runner.on('pass', function(test) {
+    stats.passes = stats.passes || 0;
+
+    if (test.duration > test.slow()) {
+      test.speed = 'slow';
+    } else if (test.duration > test.slow() / 2) {
+      test.speed = 'medium';
+    } else {
+      test.speed = 'fast';
+    }
+
+    stats.passes++;
+  });
+
+  runner.on('fail', function(test, err) {
+    stats.failures = stats.failures || 0;
+    stats.failures++;
+    test.err = err;
+    failures.push(test);
+  });
+
+  runner.on('end', function() {
+    stats.end = new Date();
+    stats.duration = new Date() - stats.start;
+  });
+
+  runner.on('pending', function() {
+    stats.pending++;
+  });
+}
+
+/**
+ * Output common epilogue used by many of
+ * the bundled reporters.
+ *
+ * @api public
+ */
+Base.prototype.epilogue = function() {
+  var stats = this.stats;
+  var fmt;
+
+  console.log();
+
+  // passes
+  fmt = color('bright pass', ' ')
+    + color('green', ' %d passing')
+    + color('light', ' (%s)');
+
+  console.log(fmt,
+    stats.passes || 0,
+    ms(stats.duration));
+
+  // pending
+  if (stats.pending) {
+    fmt = color('pending', ' ')
+      + color('pending', ' %d pending');
+
+    console.log(fmt, stats.pending);
+  }
+
+  // failures
+  if (stats.failures) {
+    fmt = color('fail', '  %d failing');
+
+    console.log(fmt, stats.failures);
+
+    Base.list(this.failures);
+    console.log();
+  }
+
+  console.log();
+};
+
+/**
+ * Pad the given `str` to `len`.
+ *
+ * @api private
+ * @param {string} str
+ * @param {string} len
+ * @return {string}
+ */
+function pad(str, len) {
+  str = String(str);
+  return Array(len - str.length + 1).join(' ') + str;
+}
+
+/**
+ * Returns an inline diff between 2 strings with coloured ANSI output
+ *
+ * @api private
+ * @param {Error} err with actual/expected
+ * @param {boolean} escape
+ * @return {string} Diff
+ */
+function inlineDiff(err, escape) {
+  var msg = errorDiff(err, 'WordsWithSpace', escape);
+
+  // linenos
+  var lines = msg.split('\n');
+  if (lines.length > 4) {
+    var width = String(lines.length).length;
+    msg = lines.map(function(str, i) {
+      return pad(++i, width) + ' |' + ' ' + str;
+    }).join('\n');
+  }
+
+  // legend
+  msg = '\n'
+    + color('diff removed', 'actual')
+    + ' '
+    + color('diff added', 'expected')
+    + '\n\n'
+    + msg
+    + '\n';
+
+  // indent
+  msg = msg.replace(/^/gm, '      ');
+  return msg;
+}
+
+/**
+ * Returns a unified diff between two strings.
+ *
+ * @api private
+ * @param {Error} err with actual/expected
+ * @param {boolean} escape
+ * @return {string} The diff.
+ */
+function unifiedDiff(err, escape) {
+  var indent = '      ';
+  function cleanUp(line) {
+    if (escape) {
+      line = escapeInvisibles(line);
+    }
+    if (line[0] === '+') {
+      return indent + colorLines('diff added', line);
+    }
+    if (line[0] === '-') {
+      return indent + colorLines('diff removed', line);
+    }
+    if (line.match(/\@\@/)) {
+      return null;
+    }
+    if (line.match(/\\ No newline/)) {
+      return null;
+    }
+    return indent + line;
+  }
+  function notBlank(line) {
+    return typeof line !== 'undefined' && line !== null;
+  }
+  var msg = diff.createPatch('string', err.actual, err.expected);
+  var lines = msg.split('\n').splice(4);
+  return '\n      '
+    + colorLines('diff added', '+ expected') + ' '
+    + colorLines('diff removed', '- actual')
+    + '\n\n'
+    + lines.map(cleanUp).filter(notBlank).join('\n');
+}
+
+/**
+ * Return a character diff for `err`.
+ *
+ * @api private
+ * @param {Error} err
+ * @param {string} type
+ * @param {boolean} escape
+ * @return {string}
+ */
+function errorDiff(err, type, escape) {
+  var actual = escape ? escapeInvisibles(err.actual) : err.actual;
+  var expected = escape ? escapeInvisibles(err.expected) : err.expected;
+  return diff['diff' + type](actual, expected).map(function(str) {
+    if (str.added) {
+      return colorLines('diff added', str.value);
+    }
+    if (str.removed) {
+      return colorLines('diff removed', str.value);
+    }
+    return str.value;
+  }).join('');
+}
+
+/**
+ * Returns a string with all invisible characters in plain text
+ *
+ * @api private
+ * @param {string} line
+ * @return {string}
+ */
+function escapeInvisibles(line) {
+  return line.replace(/\t/g, '')
+    .replace(/\r/g, '')
+    .replace(/\n/g, '\n');
+}
+
+/**
+ * Color lines for `str`, using the color `name`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {string} str
+ * @return {string}
+ */
+function colorLines(name, str) {
+  return str.split('\n').map(function(str) {
+    return color(name, str);
+  }).join('\n');
+}
+
+/**
+ * Object#toString reference.
+ */
+var objToString = Object.prototype.toString;
+
+/**
+ * Check that a / b have the same type.
+ *
+ * @api private
+ * @param {Object} a
+ * @param {Object} b
+ * @return {boolean}
+ */
+function sameType(a, b) {
+  return objToString.call(a) === objToString.call(b);
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../ms":15,"../utils":39,"_process":58,"diff":48,"supports-color":43,"tty":5}],18:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+
+/**
+ * Expose `Doc`.
+ */
+
+exports = module.exports = Doc;
+
+/**
+ * Initialize a new `Doc` reporter.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+function Doc(runner) {
+  Base.call(this, runner);
+
+  var indents = 2;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on('suite', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    ++indents;
+    console.log('%s
    ', indent());
+    ++indents;
+    console.log('%s
    %s
    ', indent(), utils.escape(suite.title));
+    console.log('%s
    ', indent());
+  });
+
+  runner.on('suite end', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    console.log('%s
    ', indent());
+    --indents;
+    console.log('%s
    ', indent());
+    --indents;
+  });
+
+  runner.on('pass', function(test) {
+    console.log('%s  
    %s
    ', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.body));
+    console.log('%s  
    %s
    ', indent(), code);
+  });
+
+  runner.on('fail', function(test, err) {
+    console.log('%s  
    %s
    ', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.fn.body));
+    console.log('%s  
    %s
    ', indent(), code);
+    console.log('%s  
    %s
    ', indent(), utils.escape(err));
+  });
+}
+
+},{"../utils":39,"./base":17}],19:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = Dot;
+
+/**
+ * Initialize a new `Dot` matrix test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Dot(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var n = -1;
+
+  runner.on('start', function() {
+    process.stdout.write('\n');
+  });
+
+  runner.on('pending', function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(color('pending', Base.symbols.dot));
+  });
+
+  runner.on('pass', function(test) {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    if (test.speed === 'slow') {
+      process.stdout.write(color('bright yellow', Base.symbols.dot));
+    } else {
+      process.stdout.write(color(test.speed, Base.symbols.dot));
+    }
+  });
+
+  runner.on('fail', function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(color('fail', Base.symbols.dot));
+  });
+
+  runner.on('end', function() {
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Dot, Base);
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],20:[function(require,module,exports){
+(function (process,__dirname){
+/**
+ * Module dependencies.
+ */
+
+var JSONCov = require('./json-cov');
+var readFileSync = require('fs').readFileSync;
+var join = require('path').join;
+
+/**
+ * Expose `HTMLCov`.
+ */
+
+exports = module.exports = HTMLCov;
+
+/**
+ * Initialize a new `JsCoverage` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function HTMLCov(runner) {
+  var jade = require('jade');
+  var file = join(__dirname, '/templates/coverage.jade');
+  var str = readFileSync(file, 'utf8');
+  var fn = jade.compile(str, { filename: file });
+  var self = this;
+
+  JSONCov.call(this, runner, false);
+
+  runner.on('end', function() {
+    process.stdout.write(fn({
+      cov: self.cov,
+      coverageClass: coverageClass
+    }));
+  });
+}
+
+/**
+ * Return coverage class for a given coverage percentage.
+ *
+ * @api private
+ * @param {number} coveragePctg
+ * @return {string}
+ */
+function coverageClass(coveragePctg) {
+  if (coveragePctg >= 75) {
+    return 'high';
+  }
+  if (coveragePctg >= 50) {
+    return 'medium';
+  }
+  if (coveragePctg >= 25) {
+    return 'low';
+  }
+  return 'terrible';
+}
+
+}).call(this,require('_process'),"/lib/reporters")
+},{"./json-cov":23,"_process":58,"fs":43,"jade":43,"path":43}],21:[function(require,module,exports){
+(function (global){
+/* eslint-env browser */
+
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var Progress = require('../browser/progress');
+var escapeRe = require('escape-string-regexp');
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Expose `HTML`.
+ */
+
+exports = module.exports = HTML;
+
+/**
+ * Stats template.
+ */
+
+var statsTemplate = '';
+
+/**
+ * Initialize a new `HTML` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function HTML(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var stats = this.stats;
+  var stat = fragment(statsTemplate);
+  var items = stat.getElementsByTagName('li');
+  var passes = items[1].getElementsByTagName('em')[0];
+  var passesLink = items[1].getElementsByTagName('a')[0];
+  var failures = items[2].getElementsByTagName('em')[0];
+  var failuresLink = items[2].getElementsByTagName('a')[0];
+  var duration = items[3].getElementsByTagName('em')[0];
+  var canvas = stat.getElementsByTagName('canvas')[0];
+  var report = fragment('
      ');
+  var stack = [report];
+  var progress;
+  var ctx;
+  var root = document.getElementById('mocha');
+
+  if (canvas.getContext) {
+    var ratio = window.devicePixelRatio || 1;
+    canvas.style.width = canvas.width;
+    canvas.style.height = canvas.height;
+    canvas.width *= ratio;
+    canvas.height *= ratio;
+    ctx = canvas.getContext('2d');
+    ctx.scale(ratio, ratio);
+    progress = new Progress();
+  }
+
+  if (!root) {
+    return error('#mocha div missing, add it to your document');
+  }
+
+  // pass toggle
+  on(passesLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = (/pass/).test(report.className) ? '' : ' pass';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test pass');
+    }
+  });
+
+  // failure toggle
+  on(failuresLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = (/fail/).test(report.className) ? '' : ' fail';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test fail');
+    }
+  });
+
+  root.appendChild(stat);
+  root.appendChild(report);
+
+  if (progress) {
+    progress.size(40);
+  }
+
+  runner.on('suite', function(suite) {
+    if (suite.root) {
+      return;
+    }
+
+    // suite
+    var url = self.suiteURL(suite);
+    var el = fragment('
    • %s
      • ', url, escape(suite.title));
+
+    // container
+    stack[0].appendChild(el);
+    stack.unshift(document.createElement('ul'));
+    el.appendChild(stack[0]);
+  });
+
+  runner.on('suite end', function(suite) {
+    if (suite.root) {
+      return;
+    }
+    stack.shift();
+  });
+
+  runner.on('pass', function(test) {
+    var url = self.testURL(test);
+    var markup = '
    • %e%ems '
+      + '‣
      • ';
+    var el = fragment(markup, test.speed, test.title, test.duration, url);
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on('fail', function(test) {
+    var el = fragment('
    • %e ‣
      • ',
+      test.title, self.testURL(test));
+    var stackString; // Note: Includes leading newline
+    var message = test.err.toString();
+
+    // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we
+    // check for the result of the stringifying.
+    if (message === '[object Error]') {
+      message = test.err.message;
+    }
+
+    if (test.err.stack) {
+      var indexOfMessage = test.err.stack.indexOf(test.err.message);
+      if (indexOfMessage === -1) {
+        stackString = test.err.stack;
+      } else {
+        stackString = test.err.stack.substr(test.err.message.length + indexOfMessage);
+      }
+    } else if (test.err.sourceURL && test.err.line !== undefined) {
+      // Safari doesn't give you a stack. Let's at least provide a source line.
+      stackString = '\n(' + test.err.sourceURL + ':' + test.err.line + ')';
+    }
+
+    stackString = stackString || '';
+
+    if (test.err.htmlMessage && stackString) {
+      el.appendChild(fragment('
      %s\n
      %e
      ',
+        test.err.htmlMessage, stackString));
+    } else if (test.err.htmlMessage) {
+      el.appendChild(fragment('
      %s
      ', test.err.htmlMessage));
+    } else {
+      el.appendChild(fragment('
      %e%e
      ', message, stackString));
+    }
+
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on('pending', function(test) {
+    var el = fragment('
    • %e
      • ', test.title);
+    appendToStack(el);
+    updateStats();
+  });
+
+  function appendToStack(el) {
+    // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack.
+    if (stack[0]) {
+      stack[0].appendChild(el);
+    }
+  }
+
+  function updateStats() {
+    // TODO: add to stats
+    var percent = stats.tests / this.total * 100 | 0;
+    if (progress) {
+      progress.update(percent).draw(ctx);
+    }
+
+    // update stats
+    var ms = new Date() - stats.start;
+    text(passes, stats.passes);
+    text(failures, stats.failures);
+    text(duration, (ms / 1000).toFixed(2));
+  }
+}
+
+/**
+ * Makes a URL, preserving querystring ("search") parameters.
+ *
+ * @param {string} s
+ * @return {string} A new URL.
+ */
+function makeUrl(s) {
+  var search = window.location.search;
+
+  // Remove previous grep query parameter if present
+  if (search) {
+    search = search.replace(/[?&]grep=[^&\s]*/g, '').replace(/^&/, '?');
+  }
+
+  return window.location.pathname + (search ? search + '&' : '?') + 'grep=' + encodeURIComponent(escapeRe(s));
+}
+
+/**
+ * Provide suite URL.
+ *
+ * @param {Object} [suite]
+ */
+HTML.prototype.suiteURL = function(suite) {
+  return makeUrl(suite.fullTitle());
+};
+
+/**
+ * Provide test URL.
+ *
+ * @param {Object} [test]
+ */
+HTML.prototype.testURL = function(test) {
+  return makeUrl(test.fullTitle());
+};
+
+/**
+ * Adds code toggle functionality for the provided test's list element.
+ *
+ * @param {HTMLLIElement} el
+ * @param {string} contents
+ */
+HTML.prototype.addCodeToggle = function(el, contents) {
+  var h2 = el.getElementsByTagName('h2')[0];
+
+  on(h2, 'click', function() {
+    pre.style.display = pre.style.display === 'none' ? 'block' : 'none';
+  });
+
+  var pre = fragment('
      %e
      ', utils.clean(contents));
+  el.appendChild(pre);
+  pre.style.display = 'none';
+};
+
+/**
+ * Display error `msg`.
+ *
+ * @param {string} msg
+ */
+function error(msg) {
+  document.body.appendChild(fragment('
      %s
      ', msg));
+}
+
+/**
+ * Return a DOM fragment from `html`.
+ *
+ * @param {string} html
+ */
+function fragment(html) {
+  var args = arguments;
+  var div = document.createElement('div');
+  var i = 1;
+
+  div.innerHTML = html.replace(/%([se])/g, function(_, type) {
+    switch (type) {
+      case 's': return String(args[i++]);
+      case 'e': return escape(args[i++]);
+      // no default
+    }
+  });
+
+  return div.firstChild;
+}
+
+/**
+ * Check for suites that do not have elements
+ * with `classname`, and hide them.
+ *
+ * @param {text} classname
+ */
+function hideSuitesWithout(classname) {
+  var suites = document.getElementsByClassName('suite');
+  for (var i = 0; i < suites.length; i++) {
+    var els = suites[i].getElementsByClassName(classname);
+    if (!els.length) {
+      suites[i].className += ' hidden';
+    }
+  }
+}
+
+/**
+ * Unhide .hidden suites.
+ */
+function unhide() {
+  var els = document.getElementsByClassName('suite hidden');
+  for (var i = 0; i < els.length; ++i) {
+    els[i].className = els[i].className.replace('suite hidden', 'suite');
+  }
+}
+
+/**
+ * Set an element's text contents.
+ *
+ * @param {HTMLElement} el
+ * @param {string} contents
+ */
+function text(el, contents) {
+  if (el.textContent) {
+    el.textContent = contents;
+  } else {
+    el.innerText = contents;
+  }
+}
+
+/**
+ * Listen on `event` with callback `fn`.
+ */
+function on(el, event, fn) {
+  if (el.addEventListener) {
+    el.addEventListener(event, fn, false);
+  } else {
+    el.attachEvent('on' + event, fn);
+  }
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../browser/progress":4,"../utils":39,"./base":17,"escape-string-regexp":49}],22:[function(require,module,exports){
+// Alias exports to a their normalized format Mocha#reporter to prevent a need
+// for dynamic (try/catch) requires, which Browserify doesn't handle.
+exports.Base = exports.base = require('./base');
+exports.Dot = exports.dot = require('./dot');
+exports.Doc = exports.doc = require('./doc');
+exports.TAP = exports.tap = require('./tap');
+exports.JSON = exports.json = require('./json');
+exports.HTML = exports.html = require('./html');
+exports.List = exports.list = require('./list');
+exports.Min = exports.min = require('./min');
+exports.Spec = exports.spec = require('./spec');
+exports.Nyan = exports.nyan = require('./nyan');
+exports.XUnit = exports.xunit = require('./xunit');
+exports.Markdown = exports.markdown = require('./markdown');
+exports.Progress = exports.progress = require('./progress');
+exports.Landing = exports.landing = require('./landing');
+exports.JSONCov = exports['json-cov'] = require('./json-cov');
+exports.HTMLCov = exports['html-cov'] = require('./html-cov');
+exports.JSONStream = exports['json-stream'] = require('./json-stream');
+
+},{"./base":17,"./doc":18,"./dot":19,"./html":21,"./html-cov":20,"./json":25,"./json-cov":23,"./json-stream":24,"./landing":26,"./list":27,"./markdown":28,"./min":29,"./nyan":30,"./progress":31,"./spec":32,"./tap":33,"./xunit":34}],23:[function(require,module,exports){
+(function (process,global){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `JSONCov`.
+ */
+
+exports = module.exports = JSONCov;
+
+/**
+ * Initialize a new `JsCoverage` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ * @param {boolean} output
+ */
+function JSONCov(runner, output) {
+  Base.call(this, runner);
+
+  output = arguments.length === 1 || output;
+  var self = this;
+  var tests = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on('test end', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    passes.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    failures.push(test);
+  });
+
+  runner.on('end', function() {
+    var cov = global._$jscoverage || {};
+    var result = self.cov = map(cov);
+    result.stats = self.stats;
+    result.tests = tests.map(clean);
+    result.failures = failures.map(clean);
+    result.passes = passes.map(clean);
+    if (!output) {
+      return;
+    }
+    process.stdout.write(JSON.stringify(result, null, 2));
+  });
+}
+
+/**
+ * Map jscoverage data to a JSON structure
+ * suitable for reporting.
+ *
+ * @api private
+ * @param {Object} cov
+ * @return {Object}
+ */
+
+function map(cov) {
+  var ret = {
+    instrumentation: 'node-jscoverage',
+    sloc: 0,
+    hits: 0,
+    misses: 0,
+    coverage: 0,
+    files: []
+  };
+
+  for (var filename in cov) {
+    if (Object.prototype.hasOwnProperty.call(cov, filename)) {
+      var data = coverage(filename, cov[filename]);
+      ret.files.push(data);
+      ret.hits += data.hits;
+      ret.misses += data.misses;
+      ret.sloc += data.sloc;
+    }
+  }
+
+  ret.files.sort(function(a, b) {
+    return a.filename.localeCompare(b.filename);
+  });
+
+  if (ret.sloc > 0) {
+    ret.coverage = (ret.hits / ret.sloc) * 100;
+  }
+
+  return ret;
+}
+
+/**
+ * Map jscoverage data for a single source file
+ * to a JSON structure suitable for reporting.
+ *
+ * @api private
+ * @param {string} filename name of the source file
+ * @param {Object} data jscoverage coverage data
+ * @return {Object}
+ */
+function coverage(filename, data) {
+  var ret = {
+    filename: filename,
+    coverage: 0,
+    hits: 0,
+    misses: 0,
+    sloc: 0,
+    source: {}
+  };
+
+  data.source.forEach(function(line, num) {
+    num++;
+
+    if (data[num] === 0) {
+      ret.misses++;
+      ret.sloc++;
+    } else if (data[num] !== undefined) {
+      ret.hits++;
+      ret.sloc++;
+    }
+
+    ret.source[num] = {
+      source: line,
+      coverage: data[num] === undefined ? '' : data[num]
+    };
+  });
+
+  ret.coverage = ret.hits / ret.sloc * 100;
+
+  return ret;
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    fullTitle: test.fullTitle(),
+    title: test.title
+  };
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./base":17,"_process":58}],24:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Initialize a new `List` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function List(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var total = runner.total;
+
+  runner.on('start', function() {
+    console.log(JSON.stringify(['start', { total: total }]));
+  });
+
+  runner.on('pass', function(test) {
+    console.log(JSON.stringify(['pass', clean(test)]));
+  });
+
+  runner.on('fail', function(test, err) {
+    test = clean(test);
+    test.err = err.message;
+    test.stack = err.stack || null;
+    console.log(JSON.stringify(['fail', test]));
+  });
+
+  runner.on('end', function() {
+    process.stdout.write(JSON.stringify(['end', self.stats]));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry()
+  };
+}
+
+}).call(this,require('_process'))
+},{"./base":17,"_process":58}],25:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `JSON`.
+ */
+
+exports = module.exports = JSONReporter;
+
+/**
+ * Initialize a new `JSON` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function JSONReporter(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var tests = [];
+  var pending = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on('test end', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    passes.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    failures.push(test);
+  });
+
+  runner.on('pending', function(test) {
+    pending.push(test);
+  });
+
+  runner.on('end', function() {
+    var obj = {
+      stats: self.stats,
+      tests: tests.map(clean),
+      pending: pending.map(clean),
+      failures: failures.map(clean),
+      passes: passes.map(clean)
+    };
+
+    runner.testResults = obj;
+
+    process.stdout.write(JSON.stringify(obj, null, 2));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @api private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    err: errorJSON(test.err || {})
+  };
+}
+
+/**
+ * Transform `error` into a JSON object.
+ *
+ * @api private
+ * @param {Error} err
+ * @return {Object}
+ */
+function errorJSON(err) {
+  var res = {};
+  Object.getOwnPropertyNames(err).forEach(function(key) {
+    res[key] = err[key];
+  }, err);
+  return res;
+}
+
+}).call(this,require('_process'))
+},{"./base":17,"_process":58}],26:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var cursor = Base.cursor;
+var color = Base.color;
+
+/**
+ * Expose `Landing`.
+ */
+
+exports = module.exports = Landing;
+
+/**
+ * Airplane color.
+ */
+
+Base.colors.plane = 0;
+
+/**
+ * Airplane crash color.
+ */
+
+Base.colors['plane crash'] = 31;
+
+/**
+ * Runway color.
+ */
+
+Base.colors.runway = 90;
+
+/**
+ * Initialize a new `Landing` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Landing(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var total = runner.total;
+  var stream = process.stdout;
+  var plane = color('plane', '✈');
+  var crashed = -1;
+  var n = 0;
+
+  function runway() {
+    var buf = Array(width).join('-');
+    return '  ' + color('runway', buf);
+  }
+
+  runner.on('start', function() {
+    stream.write('\n\n\n  ');
+    cursor.hide();
+  });
+
+  runner.on('test end', function(test) {
+    // check if the plane crashed
+    var col = crashed === -1 ? width * ++n / total | 0 : crashed;
+
+    // show the crash
+    if (test.state === 'failed') {
+      plane = color('plane crash', '✈');
+      crashed = col;
+    }
+
+    // render landing strip
+    stream.write('\u001b[' + (width + 1) + 'D\u001b[2A');
+    stream.write(runway());
+    stream.write('\n  ');
+    stream.write(color('runway', Array(col).join('⋅')));
+    stream.write(plane);
+    stream.write(color('runway', Array(width - col).join('⋅') + '\n'));
+    stream.write(runway());
+    stream.write('\u001b[0m');
+  });
+
+  runner.on('end', function() {
+    cursor.show();
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Landing, Base);
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],27:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Initialize a new `List` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function List(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var n = 0;
+
+  runner.on('start', function() {
+    console.log();
+  });
+
+  runner.on('test', function(test) {
+    process.stdout.write(color('pass', '    ' + test.fullTitle() + ': '));
+  });
+
+  runner.on('pending', function(test) {
+    var fmt = color('checkmark', '  -')
+      + color('pending', ' %s');
+    console.log(fmt, test.fullTitle());
+  });
+
+  runner.on('pass', function(test) {
+    var fmt = color('checkmark', '  ' + Base.symbols.dot)
+      + color('pass', ' %s: ')
+      + color(test.speed, '%dms');
+    cursor.CR();
+    console.log(fmt, test.fullTitle(), test.duration);
+  });
+
+  runner.on('fail', function(test) {
+    cursor.CR();
+    console.log(color('fail', '  %d) %s'), ++n, test.fullTitle());
+  });
+
+  runner.on('end', self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(List, Base);
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],28:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+
+/**
+ * Constants
+ */
+
+var SUITE_PREFIX = '$';
+
+/**
+ * Expose `Markdown`.
+ */
+
+exports = module.exports = Markdown;
+
+/**
+ * Initialize a new `Markdown` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Markdown(runner) {
+  Base.call(this, runner);
+
+  var level = 0;
+  var buf = '';
+
+  function title(str) {
+    return Array(level).join('#') + ' ' + str;
+  }
+
+  function mapTOC(suite, obj) {
+    var ret = obj;
+    var key = SUITE_PREFIX + suite.title;
+
+    obj = obj[key] = obj[key] || { suite: suite };
+    suite.suites.forEach(function(suite) {
+      mapTOC(suite, obj);
+    });
+
+    return ret;
+  }
+
+  function stringifyTOC(obj, level) {
+    ++level;
+    var buf = '';
+    var link;
+    for (var key in obj) {
+      if (key === 'suite') {
+        continue;
+      }
+      if (key !== SUITE_PREFIX) {
+        link = ' - [' + key.substring(1) + ']';
+        link += '(#' + utils.slug(obj[key].suite.fullTitle()) + ')\n';
+        buf += Array(level).join('  ') + link;
+      }
+      buf += stringifyTOC(obj[key], level);
+    }
+    return buf;
+  }
+
+  function generateTOC(suite) {
+    var obj = mapTOC(suite, {});
+    return stringifyTOC(obj, 0);
+  }
+
+  generateTOC(runner.suite);
+
+  runner.on('suite', function(suite) {
+    ++level;
+    var slug = utils.slug(suite.fullTitle());
+    buf += '' + '\n';
+    buf += title(suite.title) + '\n';
+  });
+
+  runner.on('suite end', function() {
+    --level;
+  });
+
+  runner.on('pass', function(test) {
+    var code = utils.clean(test.body);
+    buf += test.title + '.\n';
+    buf += '\n```js\n';
+    buf += code + '\n';
+    buf += '```\n\n';
+  });
+
+  runner.on('end', function() {
+    process.stdout.write('# TOC\n');
+    process.stdout.write(generateTOC(runner.suite));
+    process.stdout.write(buf);
+  });
+}
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],29:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+
+/**
+ * Expose `Min`.
+ */
+
+exports = module.exports = Min;
+
+/**
+ * Initialize a new `Min` minimal test reporter (best used with --watch).
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Min(runner) {
+  Base.call(this, runner);
+
+  runner.on('start', function() {
+    // clear screen
+    process.stdout.write('\u001b[2J');
+    // set cursor position
+    process.stdout.write('\u001b[1;3H');
+  });
+
+  runner.on('end', this.epilogue.bind(this));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Min, Base);
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],30:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = NyanCat;
+
+/**
+ * Initialize a new `Dot` matrix test reporter.
+ *
+ * @param {Runner} runner
+ * @api public
+ */
+
+function NyanCat(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .75 | 0;
+  var nyanCatWidth = this.nyanCatWidth = 11;
+
+  this.colorIndex = 0;
+  this.numberOfLines = 4;
+  this.rainbowColors = self.generateColors();
+  this.scoreboardWidth = 5;
+  this.tick = 0;
+  this.trajectories = [[], [], [], []];
+  this.trajectoryWidthMax = (width - nyanCatWidth);
+
+  runner.on('start', function() {
+    Base.cursor.hide();
+    self.draw();
+  });
+
+  runner.on('pending', function() {
+    self.draw();
+  });
+
+  runner.on('pass', function() {
+    self.draw();
+  });
+
+  runner.on('fail', function() {
+    self.draw();
+  });
+
+  runner.on('end', function() {
+    Base.cursor.show();
+    for (var i = 0; i < self.numberOfLines; i++) {
+      write('\n');
+    }
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(NyanCat, Base);
+
+/**
+ * Draw the nyan cat
+ *
+ * @api private
+ */
+
+NyanCat.prototype.draw = function() {
+  this.appendRainbow();
+  this.drawScoreboard();
+  this.drawRainbow();
+  this.drawNyanCat();
+  this.tick = !this.tick;
+};
+
+/**
+ * Draw the "scoreboard" showing the number
+ * of passes, failures and pending tests.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.drawScoreboard = function() {
+  var stats = this.stats;
+
+  function draw(type, n) {
+    write(' ');
+    write(Base.color(type, n));
+    write('\n');
+  }
+
+  draw('green', stats.passes);
+  draw('fail', stats.failures);
+  draw('pending', stats.pending);
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Append the rainbow.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.appendRainbow = function() {
+  var segment = this.tick ? '_' : '-';
+  var rainbowified = this.rainbowify(segment);
+
+  for (var index = 0; index < this.numberOfLines; index++) {
+    var trajectory = this.trajectories[index];
+    if (trajectory.length >= this.trajectoryWidthMax) {
+      trajectory.shift();
+    }
+    trajectory.push(rainbowified);
+  }
+};
+
+/**
+ * Draw the rainbow.
+ *
+ * @api private
+ */
+
+NyanCat.prototype.drawRainbow = function() {
+  var self = this;
+
+  this.trajectories.forEach(function(line) {
+    write('\u001b[' + self.scoreboardWidth + 'C');
+    write(line.join(''));
+    write('\n');
+  });
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw the nyan cat
+ *
+ * @api private
+ */
+NyanCat.prototype.drawNyanCat = function() {
+  var self = this;
+  var startWidth = this.scoreboardWidth + this.trajectories[0].length;
+  var dist = '\u001b[' + startWidth + 'C';
+  var padding = '';
+
+  write(dist);
+  write('_,------,');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '  ' : '   ';
+  write('_|' + padding + '/\\_/\\ ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '_' : '__';
+  var tail = self.tick ? '~' : '^';
+  write(tail + '|' + padding + this.face() + ' ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? ' ' : '  ';
+  write(padding + '""  "" ');
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw nyan cat face.
+ *
+ * @api private
+ * @return {string}
+ */
+
+NyanCat.prototype.face = function() {
+  var stats = this.stats;
+  if (stats.failures) {
+    return '( x .x)';
+  } else if (stats.pending) {
+    return '( o .o)';
+  } else if (stats.passes) {
+    return '( ^ .^)';
+  }
+  return '( - .-)';
+};
+
+/**
+ * Move cursor up `n`.
+ *
+ * @api private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorUp = function(n) {
+  write('\u001b[' + n + 'A');
+};
+
+/**
+ * Move cursor down `n`.
+ *
+ * @api private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorDown = function(n) {
+  write('\u001b[' + n + 'B');
+};
+
+/**
+ * Generate rainbow colors.
+ *
+ * @api private
+ * @return {Array}
+ */
+NyanCat.prototype.generateColors = function() {
+  var colors = [];
+
+  for (var i = 0; i < (6 * 7); i++) {
+    var pi3 = Math.floor(Math.PI / 3);
+    var n = (i * (1.0 / 6));
+    var r = Math.floor(3 * Math.sin(n) + 3);
+    var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3);
+    var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3);
+    colors.push(36 * r + 6 * g + b + 16);
+  }
+
+  return colors;
+};
+
+/**
+ * Apply rainbow to the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+NyanCat.prototype.rainbowify = function(str) {
+  if (!Base.useColors) {
+    return str;
+  }
+  var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length];
+  this.colorIndex += 1;
+  return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Stdout helper.
+ *
+ * @param {string} string A message to write to stdout.
+ */
+function write(string) {
+  process.stdout.write(string);
+}
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],31:[function(require,module,exports){
+(function (process){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Progress`.
+ */
+
+exports = module.exports = Progress;
+
+/**
+ * General progress bar color.
+ */
+
+Base.colors.progress = 90;
+
+/**
+ * Initialize a new `Progress` bar test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ * @param {Object} options
+ */
+function Progress(runner, options) {
+  Base.call(this, runner);
+
+  var self = this;
+  var width = Base.window.width * .50 | 0;
+  var total = runner.total;
+  var complete = 0;
+  var lastN = -1;
+
+  // default chars
+  options = options || {};
+  options.open = options.open || '[';
+  options.complete = options.complete || '▬';
+  options.incomplete = options.incomplete || Base.symbols.dot;
+  options.close = options.close || ']';
+  options.verbose = false;
+
+  // tests started
+  runner.on('start', function() {
+    console.log();
+    cursor.hide();
+  });
+
+  // tests complete
+  runner.on('test end', function() {
+    complete++;
+
+    var percent = complete / total;
+    var n = width * percent | 0;
+    var i = width - n;
+
+    if (n === lastN && !options.verbose) {
+      // Don't re-render the line if it hasn't changed
+      return;
+    }
+    lastN = n;
+
+    cursor.CR();
+    process.stdout.write('\u001b[J');
+    process.stdout.write(color('progress', '  ' + options.open));
+    process.stdout.write(Array(n).join(options.complete));
+    process.stdout.write(Array(i).join(options.incomplete));
+    process.stdout.write(color('progress', options.close));
+    if (options.verbose) {
+      process.stdout.write(color('progress', ' ' + complete + ' of ' + total));
+    }
+  });
+
+  // tests are complete, output some stats
+  // and the failures if any
+  runner.on('end', function() {
+    cursor.show();
+    console.log();
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Progress, Base);
+
+}).call(this,require('_process'))
+},{"../utils":39,"./base":17,"_process":58}],32:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Spec`.
+ */
+
+exports = module.exports = Spec;
+
+/**
+ * Initialize a new `Spec` test reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function Spec(runner) {
+  Base.call(this, runner);
+
+  var self = this;
+  var indents = 0;
+  var n = 0;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on('start', function() {
+    console.log();
+  });
+
+  runner.on('suite', function(suite) {
+    ++indents;
+    console.log(color('suite', '%s%s'), indent(), suite.title);
+  });
+
+  runner.on('suite end', function() {
+    --indents;
+    if (indents === 1) {
+      console.log();
+    }
+  });
+
+  runner.on('pending', function(test) {
+    var fmt = indent() + color('pending', '  - %s');
+    console.log(fmt, test.title);
+  });
+
+  runner.on('pass', function(test) {
+    var fmt;
+    if (test.speed === 'fast') {
+      fmt = indent()
+        + color('checkmark', '  ' + Base.symbols.ok)
+        + color('pass', ' %s');
+      cursor.CR();
+      console.log(fmt, test.title);
+    } else {
+      fmt = indent()
+        + color('checkmark', '  ' + Base.symbols.ok)
+        + color('pass', ' %s')
+        + color(test.speed, ' (%dms)');
+      cursor.CR();
+      console.log(fmt, test.title, test.duration);
+    }
+  });
+
+  runner.on('fail', function(test) {
+    cursor.CR();
+    console.log(indent() + color('fail', '  %d) %s'), ++n, test.title);
+  });
+
+  runner.on('end', self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Spec, Base);
+
+},{"../utils":39,"./base":17}],33:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+
+/**
+ * Expose `TAP`.
+ */
+
+exports = module.exports = TAP;
+
+/**
+ * Initialize a new `TAP` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function TAP(runner) {
+  Base.call(this, runner);
+
+  var n = 1;
+  var passes = 0;
+  var failures = 0;
+
+  runner.on('start', function() {
+    var total = runner.grepTotal(runner.suite);
+    console.log('%d..%d', 1, total);
+  });
+
+  runner.on('test end', function() {
+    ++n;
+  });
+
+  runner.on('pending', function(test) {
+    console.log('ok %d %s # SKIP -', n, title(test));
+  });
+
+  runner.on('pass', function(test) {
+    passes++;
+    console.log('ok %d %s', n, title(test));
+  });
+
+  runner.on('fail', function(test, err) {
+    failures++;
+    console.log('not ok %d %s', n, title(test));
+    if (err.stack) {
+      console.log(err.stack.replace(/^/gm, '  '));
+    }
+  });
+
+  runner.on('end', function() {
+    console.log('# tests ' + (passes + failures));
+    console.log('# pass ' + passes);
+    console.log('# fail ' + failures);
+  });
+}
+
+/**
+ * Return a TAP-safe title of `test`
+ *
+ * @api private
+ * @param {Object} test
+ * @return {String}
+ */
+function title(test) {
+  return test.fullTitle().replace(/#/g, '');
+}
+
+},{"./base":17}],34:[function(require,module,exports){
+(function (process,global){
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var inherits = utils.inherits;
+var fs = require('fs');
+var escape = utils.escape;
+var mkdirp = require('mkdirp');
+var path = require('path');
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+/* eslint-disable no-unused-vars, no-native-reassign */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+/* eslint-enable no-unused-vars, no-native-reassign */
+
+/**
+ * Expose `XUnit`.
+ */
+
+exports = module.exports = XUnit;
+
+/**
+ * Initialize a new `XUnit` reporter.
+ *
+ * @api public
+ * @param {Runner} runner
+ */
+function XUnit(runner, options) {
+  Base.call(this, runner);
+
+  var stats = this.stats;
+  var tests = [];
+  var self = this;
+
+  if (options.reporterOptions && options.reporterOptions.output) {
+    if (!fs.createWriteStream) {
+      throw new Error('file output not supported in browser');
+    }
+    mkdirp.sync(path.dirname(options.reporterOptions.output));
+    self.fileStream = fs.createWriteStream(options.reporterOptions.output);
+  }
+
+  runner.on('pending', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('pass', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('fail', function(test) {
+    tests.push(test);
+  });
+
+  runner.on('end', function() {
+    self.write(tag('testsuite', {
+      name: 'Mocha Tests',
+      tests: stats.tests,
+      failures: stats.failures,
+      errors: stats.failures,
+      skipped: stats.tests - stats.failures - stats.passes,
+      timestamp: (new Date()).toUTCString(),
+      time: (stats.duration / 1000) || 0
+    }, false));
+
+    tests.forEach(function(t) {
+      self.test(t);
+    });
+
+    self.write('');
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(XUnit, Base);
+
+/**
+ * Override done to close the stream (if it's a file).
+ *
+ * @param failures
+ * @param {Function} fn
+ */
+XUnit.prototype.done = function(failures, fn) {
+  if (this.fileStream) {
+    this.fileStream.end(function() {
+      fn(failures);
+    });
+  } else {
+    fn(failures);
+  }
+};
+
+/**
+ * Write out the given line.
+ *
+ * @param {string} line
+ */
+XUnit.prototype.write = function(line) {
+  if (this.fileStream) {
+    this.fileStream.write(line + '\n');
+  } else if (typeof process === 'object' && process.stdout) {
+    process.stdout.write(line + '\n');
+  } else {
+    console.log(line);
+  }
+};
+
+/**
+ * Output tag for the given `test.`
+ *
+ * @param {Test} test
+ */
+XUnit.prototype.test = function(test) {
+  var attrs = {
+    classname: test.parent.fullTitle(),
+    name: test.title,
+    time: (test.duration / 1000) || 0
+  };
+
+  if (test.state === 'failed') {
+    var err = test.err;
+    this.write(tag('testcase', attrs, false, tag('failure', {}, false, escape(err.message) + '\n' + escape(err.stack))));
+  } else if (test.isPending()) {
+    this.write(tag('testcase', attrs, false, tag('skipped', {}, true)));
+  } else {
+    this.write(tag('testcase', attrs, true));
+  }
+};
+
+/**
+ * HTML tag helper.
+ *
+ * @param name
+ * @param attrs
+ * @param close
+ * @param content
+ * @return {string}
+ */
+function tag(name, attrs, close, content) {
+  var end = close ? '/>' : '>';
+  var pairs = [];
+  var tag;
+
+  for (var key in attrs) {
+    if (Object.prototype.hasOwnProperty.call(attrs, key)) {
+      pairs.push(key + '="' + escape(attrs[key]) + '"');
+    }
+  }
+
+  tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end;
+  if (content) {
+    tag += content + '';
+    }
+    if (key === 'ctx') {
+      return '#';
+    }
+    return val;
+  }, 2);
+};
+
+/**
+ * Reset the timeout.
+ *
+ * @api private
+ */
+Runnable.prototype.resetTimeout = function() {
+  var self = this;
+  var ms = this.timeout() || 1e9;
+
+  if (!this._enableTimeouts) {
+    return;
+  }
+  this.clearTimeout();
+  this.timer = setTimeout(function() {
+    if (!self._enableTimeouts) {
+      return;
+    }
+    self.callback(new Error('timeout of ' + ms + 'ms exceeded. Ensure the done() callback is being called in this test.'));
+    self.timedOut = true;
+  }, ms);
+};
+
+/**
+ * Whitelist a list of globals for this test run.
+ *
+ * @api private
+ * @param {string[]} globals
+ */
+Runnable.prototype.globals = function(globals) {
+  if (!arguments.length) {
+    return this._allowedGlobals;
+  }
+  this._allowedGlobals = globals;
+};
+
+/**
+ * Run the test and invoke `fn(err)`.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runnable.prototype.run = function(fn) {
+  var self = this;
+  var start = new Date();
+  var ctx = this.ctx;
+  var finished;
+  var emitted;
+
+  // Sometimes the ctx exists, but it is not runnable
+  if (ctx && ctx.runnable) {
+    ctx.runnable(this);
+  }
+
+  // called multiple times
+  function multiple(err) {
+    if (emitted) {
+      return;
+    }
+    emitted = true;
+    self.emit('error', err || new Error('done() called multiple times; stacktrace may be inaccurate'));
+  }
+
+  // finished
+  function done(err) {
+    var ms = self.timeout();
+    if (self.timedOut) {
+      return;
+    }
+    if (finished) {
+      return multiple(err || self._trace);
+    }
+
+    self.clearTimeout();
+    self.duration = new Date() - start;
+    finished = true;
+    if (!err && self.duration > ms && self._enableTimeouts) {
+      err = new Error('timeout of ' + ms + 'ms exceeded. Ensure the done() callback is being called in this test.');
+    }
+    fn(err);
+  }
+
+  // for .resetTimeout()
+  this.callback = done;
+
+  // explicit async with `done` argument
+  if (this.async) {
+    this.resetTimeout();
+
+    if (this.allowUncaught) {
+      return callFnAsync(this.fn);
+    }
+    try {
+      callFnAsync(this.fn);
+    } catch (err) {
+      done(utils.getError(err));
+    }
+    return;
+  }
+
+  if (this.allowUncaught) {
+    callFn(this.fn);
+    done();
+    return;
+  }
+
+  // sync or promise-returning
+  try {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+  } catch (err) {
+    done(utils.getError(err));
+  }
+
+  function callFn(fn) {
+    var result = fn.call(ctx);
+    if (result && typeof result.then === 'function') {
+      self.resetTimeout();
+      result
+        .then(function() {
+          done();
+          // Return null so libraries like bluebird do not warn about
+          // subsequently constructed Promises.
+          return null;
+        },
+        function(reason) {
+          done(reason || new Error('Promise rejected with no or falsy reason'));
+        });
+    } else {
+      if (self.asyncOnly) {
+        return done(new Error('--async-only option in use without declaring `done()` or returning a promise'));
+      }
+
+      done();
+    }
+  }
+
+  function callFnAsync(fn) {
+    fn.call(ctx, function(err) {
+      if (err instanceof Error || toString.call(err) === '[object Error]') {
+        return done(err);
+      }
+      if (err) {
+        if (Object.prototype.toString.call(err) === '[object Object]') {
+          return done(new Error('done() invoked with non-Error: '
+            + JSON.stringify(err)));
+        }
+        return done(new Error('done() invoked with non-Error: ' + err));
+      }
+      done();
+    });
+  }
+};
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./ms":15,"./pending":16,"./utils":39,"debug":2,"events":3}],36:[function(require,module,exports){
+(function (process,global){
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:runner');
+var Runnable = require('./runnable');
+var filter = utils.filter;
+var indexOf = utils.indexOf;
+var keys = utils.keys;
+var stackFilter = utils.stackTraceFilter();
+var stringify = utils.stringify;
+var type = utils.type;
+var undefinedError = utils.undefinedError;
+var isArray = utils.isArray;
+
+/**
+ * Non-enumerable globals.
+ */
+
+var globals = [
+  'setTimeout',
+  'clearTimeout',
+  'setInterval',
+  'clearInterval',
+  'XMLHttpRequest',
+  'Date',
+  'setImmediate',
+  'clearImmediate'
+];
+
+/**
+ * Expose `Runner`.
+ */
+
+module.exports = Runner;
+
+/**
+ * Initialize a `Runner` for the given `suite`.
+ *
+ * Events:
+ *
+ *   - `start`  execution started
+ *   - `end`  execution complete
+ *   - `suite`  (suite) test suite execution started
+ *   - `suite end`  (suite) all tests (and sub-suites) have finished
+ *   - `test`  (test) test execution started
+ *   - `test end`  (test) test completed
+ *   - `hook`  (hook) hook execution started
+ *   - `hook end`  (hook) hook complete
+ *   - `pass`  (test) test passed
+ *   - `fail`  (test, err) test failed
+ *   - `pending`  (test) test pending
+ *
+ * @api public
+ * @param {Suite} suite Root suite
+ * @param {boolean} [delay] Whether or not to delay execution of root suite
+ * until ready.
+ */
+function Runner(suite, delay) {
+  var self = this;
+  this._globals = [];
+  this._abort = false;
+  this._delay = delay;
+  this.suite = suite;
+  this.started = false;
+  this.total = suite.total();
+  this.failures = 0;
+  this.on('test end', function(test) {
+    self.checkGlobals(test);
+  });
+  this.on('hook end', function(hook) {
+    self.checkGlobals(hook);
+  });
+  this._defaultGrep = /.*/;
+  this.grep(this._defaultGrep);
+  this.globals(this.globalProps().concat(extraGlobals()));
+}
+
+/**
+ * Wrapper for setImmediate, process.nextTick, or browser polyfill.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runner.immediately = global.setImmediate || process.nextTick;
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Runner, EventEmitter);
+
+/**
+ * Run tests with full titles matching `re`. Updates runner.total
+ * with number of tests matched.
+ *
+ * @param {RegExp} re
+ * @param {Boolean} invert
+ * @return {Runner} for chaining
+ * @api public
+ * @param {RegExp} re
+ * @param {boolean} invert
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.grep = function(re, invert) {
+  debug('grep %s', re);
+  this._grep = re;
+  this._invert = invert;
+  this.total = this.grepTotal(this.suite);
+  return this;
+};
+
+/**
+ * Returns the number of tests matching the grep search for the
+ * given suite.
+ *
+ * @param {Suite} suite
+ * @return {Number}
+ * @api public
+ * @param {Suite} suite
+ * @return {number}
+ */
+Runner.prototype.grepTotal = function(suite) {
+  var self = this;
+  var total = 0;
+
+  suite.eachTest(function(test) {
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (match) {
+      total++;
+    }
+  });
+
+  return total;
+};
+
+/**
+ * Return a list of global properties.
+ *
+ * @return {Array}
+ * @api private
+ */
+Runner.prototype.globalProps = function() {
+  var props = keys(global);
+
+  // non-enumerables
+  for (var i = 0; i < globals.length; ++i) {
+    if (~indexOf(props, globals[i])) {
+      continue;
+    }
+    props.push(globals[i]);
+  }
+
+  return props;
+};
+
+/**
+ * Allow the given `arr` of globals.
+ *
+ * @param {Array} arr
+ * @return {Runner} for chaining
+ * @api public
+ * @param {Array} arr
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.globals = function(arr) {
+  if (!arguments.length) {
+    return this._globals;
+  }
+  debug('globals %j', arr);
+  this._globals = this._globals.concat(arr);
+  return this;
+};
+
+/**
+ * Check for global variable leaks.
+ *
+ * @api private
+ */
+Runner.prototype.checkGlobals = function(test) {
+  if (this.ignoreLeaks) {
+    return;
+  }
+  var ok = this._globals;
+
+  var globals = this.globalProps();
+  var leaks;
+
+  if (test) {
+    ok = ok.concat(test._allowedGlobals || []);
+  }
+
+  if (this.prevGlobalsLength === globals.length) {
+    return;
+  }
+  this.prevGlobalsLength = globals.length;
+
+  leaks = filterLeaks(ok, globals);
+  this._globals = this._globals.concat(leaks);
+
+  if (leaks.length > 1) {
+    this.fail(test, new Error('global leaks detected: ' + leaks.join(', ') + ''));
+  } else if (leaks.length) {
+    this.fail(test, new Error('global leak detected: ' + leaks[0]));
+  }
+};
+
+/**
+ * Fail the given `test`.
+ *
+ * @api private
+ * @param {Test} test
+ * @param {Error} err
+ */
+Runner.prototype.fail = function(test, err) {
+  ++this.failures;
+  test.state = 'failed';
+
+  if (!(err instanceof Error || err && typeof err.message === 'string')) {
+    err = new Error('the ' + type(err) + ' ' + stringify(err) + ' was thrown, throw an Error :)');
+  }
+
+  err.stack = (this.fullStackTrace || !err.stack)
+    ? err.stack
+    : stackFilter(err.stack);
+
+  this.emit('fail', test, err);
+};
+
+/**
+ * Fail the given `hook` with `err`.
+ *
+ * Hook failures work in the following pattern:
+ * - If bail, then exit
+ * - Failed `before` hook skips all tests in a suite and subsuites,
+ *   but jumps to corresponding `after` hook
+ * - Failed `before each` hook skips remaining tests in a
+ *   suite and jumps to corresponding `after each` hook,
+ *   which is run only once
+ * - Failed `after` hook does not alter
+ *   execution order
+ * - Failed `after each` hook skips remaining tests in a
+ *   suite and subsuites, but executes other `after each`
+ *   hooks
+ *
+ * @api private
+ * @param {Hook} hook
+ * @param {Error} err
+ */
+Runner.prototype.failHook = function(hook, err) {
+  if (hook.ctx && hook.ctx.currentTest) {
+    hook.originalTitle = hook.originalTitle || hook.title;
+    hook.title = hook.originalTitle + ' for "' + hook.ctx.currentTest.title + '"';
+  }
+
+  this.fail(hook, err);
+  if (this.suite.bail()) {
+    this.emit('end');
+  }
+};
+
+/**
+ * Run hook `name` callbacks and then invoke `fn()`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {Function} fn
+ */
+
+Runner.prototype.hook = function(name, fn) {
+  var suite = this.suite;
+  var hooks = suite['_' + name];
+  var self = this;
+
+  function next(i) {
+    var hook = hooks[i];
+    if (!hook) {
+      return fn();
+    }
+    self.currentRunnable = hook;
+
+    hook.ctx.currentTest = self.test;
+
+    self.emit('hook', hook);
+
+    if (!hook.listeners('error').length) {
+      hook.on('error', function(err) {
+        self.failHook(hook, err);
+      });
+    }
+
+    hook.run(function(err) {
+      var testError = hook.error();
+      if (testError) {
+        self.fail(self.test, testError);
+      }
+      if (err) {
+        if (err instanceof Pending) {
+          suite.pending = true;
+        } else {
+          self.failHook(hook, err);
+
+          // stop executing hooks, notify callee of hook err
+          return fn(err);
+        }
+      }
+      self.emit('hook end', hook);
+      delete hook.ctx.currentTest;
+      next(++i);
+    });
+  }
+
+  Runner.immediately(function() {
+    next(0);
+  });
+};
+
+/**
+ * Run hook `name` for the given array of `suites`
+ * in order, and callback `fn(err, errSuite)`.
+ *
+ * @api private
+ * @param {string} name
+ * @param {Array} suites
+ * @param {Function} fn
+ */
+Runner.prototype.hooks = function(name, suites, fn) {
+  var self = this;
+  var orig = this.suite;
+
+  function next(suite) {
+    self.suite = suite;
+
+    if (!suite) {
+      self.suite = orig;
+      return fn();
+    }
+
+    self.hook(name, function(err) {
+      if (err) {
+        var errSuite = self.suite;
+        self.suite = orig;
+        return fn(err, errSuite);
+      }
+
+      next(suites.pop());
+    });
+  }
+
+  next(suites.pop());
+};
+
+/**
+ * Run hooks from the top level down.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.hookUp = function(name, fn) {
+  var suites = [this.suite].concat(this.parents()).reverse();
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Run hooks from the bottom up.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.hookDown = function(name, fn) {
+  var suites = [this.suite].concat(this.parents());
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Return an array of parent Suites from
+ * closest to furthest.
+ *
+ * @return {Array}
+ * @api private
+ */
+Runner.prototype.parents = function() {
+  var suite = this.suite;
+  var suites = [];
+  while (suite.parent) {
+    suite = suite.parent;
+    suites.push(suite);
+  }
+  return suites;
+};
+
+/**
+ * Run the current test and callback `fn(err)`.
+ *
+ * @param {Function} fn
+ * @api private
+ */
+Runner.prototype.runTest = function(fn) {
+  var self = this;
+  var test = this.test;
+
+  if (this.asyncOnly) {
+    test.asyncOnly = true;
+  }
+
+  if (this.allowUncaught) {
+    test.allowUncaught = true;
+    return test.run(fn);
+  }
+  try {
+    test.on('error', function(err) {
+      self.fail(test, err);
+    });
+    test.run(fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Run tests in the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runTests = function(suite, fn) {
+  var self = this;
+  var tests = suite.tests.slice();
+  var test;
+
+  function hookErr(_, errSuite, after) {
+    // before/after Each hook for errSuite failed:
+    var orig = self.suite;
+
+    // for failed 'after each' hook start from errSuite parent,
+    // otherwise start from errSuite itself
+    self.suite = after ? errSuite.parent : errSuite;
+
+    if (self.suite) {
+      // call hookUp afterEach
+      self.hookUp('afterEach', function(err2, errSuite2) {
+        self.suite = orig;
+        // some hooks may fail even now
+        if (err2) {
+          return hookErr(err2, errSuite2, true);
+        }
+        // report error suite
+        fn(errSuite);
+      });
+    } else {
+      // there is no need calling other 'after each' hooks
+      self.suite = orig;
+      fn(errSuite);
+    }
+  }
+
+  function next(err, errSuite) {
+    // if we bail after first err
+    if (self.failures && suite._bail) {
+      return fn();
+    }
+
+    if (self._abort) {
+      return fn();
+    }
+
+    if (err) {
+      return hookErr(err, errSuite, true);
+    }
+
+    // next test
+    test = tests.shift();
+
+    // all done
+    if (!test) {
+      return fn();
+    }
+
+    // grep
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (!match) {
+      // Run immediately only if we have defined a grep. When we
+      // define a grep — It can cause maximum callstack error if
+      // the grep is doing a large recursive loop by neglecting
+      // all tests. The run immediately function also comes with
+      // a performance cost. So we don't want to run immediately
+      // if we run the whole test suite, because running the whole
+      // test suite don't do any immediate recursive loops. Thus,
+      // allowing a JS runtime to breathe.
+      if (self._grep !== self._defaultGrep) {
+        Runner.immediately(next);
+      } else {
+        next();
+      }
+      return;
+    }
+
+    if (test.isPending()) {
+      self.emit('pending', test);
+      self.emit('test end', test);
+      return next();
+    }
+
+    // execute test and hook(s)
+    self.emit('test', self.test = test);
+    self.hookDown('beforeEach', function(err, errSuite) {
+      if (suite.isPending()) {
+        self.emit('pending', test);
+        self.emit('test end', test);
+        return next();
+      }
+      if (err) {
+        return hookErr(err, errSuite, false);
+      }
+      self.currentRunnable = self.test;
+      self.runTest(function(err) {
+        test = self.test;
+        if (err) {
+          var retry = test.currentRetry();
+          if (err instanceof Pending) {
+            test.pending = true;
+            self.emit('pending', test);
+          } else if (retry < test.retries()) {
+            var clonedTest = test.clone();
+            clonedTest.currentRetry(retry + 1);
+            tests.unshift(clonedTest);
+
+            // Early return + hook trigger so that it doesn't
+            // increment the count wrong
+            return self.hookUp('afterEach', next);
+          } else {
+            self.fail(test, err);
+          }
+          self.emit('test end', test);
+
+          if (err instanceof Pending) {
+            return next();
+          }
+
+          return self.hookUp('afterEach', next);
+        }
+
+        test.state = 'passed';
+        self.emit('pass', test);
+        self.emit('test end', test);
+        self.hookUp('afterEach', next);
+      });
+    });
+  }
+
+  this.next = next;
+  this.hookErr = hookErr;
+  next();
+};
+
+/**
+ * Run the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runSuite = function(suite, fn) {
+  var i = 0;
+  var self = this;
+  var total = this.grepTotal(suite);
+  var afterAllHookCalled = false;
+
+  debug('run suite %s', suite.fullTitle());
+
+  if (!total || (self.failures && suite._bail)) {
+    return fn();
+  }
+
+  this.emit('suite', this.suite = suite);
+
+  function next(errSuite) {
+    if (errSuite) {
+      // current suite failed on a hook from errSuite
+      if (errSuite === suite) {
+        // if errSuite is current suite
+        // continue to the next sibling suite
+        return done();
+      }
+      // errSuite is among the parents of current suite
+      // stop execution of errSuite and all sub-suites
+      return done(errSuite);
+    }
+
+    if (self._abort) {
+      return done();
+    }
+
+    var curr = suite.suites[i++];
+    if (!curr) {
+      return done();
+    }
+
+    // Avoid grep neglecting large number of tests causing a
+    // huge recursive loop and thus a maximum call stack error.
+    // See comment in `this.runTests()` for more information.
+    if (self._grep !== self._defaultGrep) {
+      Runner.immediately(function() {
+        self.runSuite(curr, next);
+      });
+    } else {
+      self.runSuite(curr, next);
+    }
+  }
+
+  function done(errSuite) {
+    self.suite = suite;
+    self.nextSuite = next;
+
+    if (afterAllHookCalled) {
+      fn(errSuite);
+    } else {
+      // mark that the afterAll block has been called once
+      // and so can be skipped if there is an error in it.
+      afterAllHookCalled = true;
+
+      // remove reference to test
+      delete self.test;
+
+      self.hook('afterAll', function() {
+        self.emit('suite end', suite);
+        fn(errSuite);
+      });
+    }
+  }
+
+  this.nextSuite = next;
+
+  this.hook('beforeAll', function(err) {
+    if (err) {
+      return done();
+    }
+    self.runTests(suite, next);
+  });
+};
+
+/**
+ * Handle uncaught exceptions.
+ *
+ * @param {Error} err
+ * @api private
+ */
+Runner.prototype.uncaught = function(err) {
+  if (err) {
+    debug('uncaught exception %s', err !== function() {
+      return this;
+    }.call(err) ? err : (err.message || err));
+  } else {
+    debug('uncaught undefined exception');
+    err = undefinedError();
+  }
+  err.uncaught = true;
+
+  var runnable = this.currentRunnable;
+
+  if (!runnable) {
+    runnable = new Runnable('Uncaught error outside test suite');
+    runnable.parent = this.suite;
+
+    if (this.started) {
+      this.fail(runnable, err);
+    } else {
+      // Can't recover from this failure
+      this.emit('start');
+      this.fail(runnable, err);
+      this.emit('end');
+    }
+
+    return;
+  }
+
+  runnable.clearTimeout();
+
+  // Ignore errors if complete
+  if (runnable.state) {
+    return;
+  }
+  this.fail(runnable, err);
+
+  // recover from test
+  if (runnable.type === 'test') {
+    this.emit('test end', runnable);
+    this.hookUp('afterEach', this.next);
+    return;
+  }
+
+ // recover from hooks
+  if (runnable.type === 'hook') {
+    var errSuite = this.suite;
+    // if hook failure is in afterEach block
+    if (runnable.fullTitle().indexOf('after each') > -1) {
+      return this.hookErr(err, errSuite, true);
+    }
+    // if hook failure is in beforeEach block
+    if (runnable.fullTitle().indexOf('before each') > -1) {
+      return this.hookErr(err, errSuite, false);
+    }
+    // if hook failure is in after or before blocks
+    return this.nextSuite(errSuite);
+  }
+
+  // bail
+  this.emit('end');
+};
+
+/**
+ * Cleans up the references to all the deferred functions
+ * (before/after/beforeEach/afterEach) and tests of a Suite.
+ * These must be deleted otherwise a memory leak can happen,
+ * as those functions may reference variables from closures,
+ * thus those variables can never be garbage collected as long
+ * as the deferred functions exist.
+ *
+ * @param {Suite} suite
+ */
+function cleanSuiteReferences(suite) {
+  function cleanArrReferences(arr) {
+    for (var i = 0; i < arr.length; i++) {
+      delete arr[i].fn;
+    }
+  }
+
+  if (isArray(suite._beforeAll)) {
+    cleanArrReferences(suite._beforeAll);
+  }
+
+  if (isArray(suite._beforeEach)) {
+    cleanArrReferences(suite._beforeEach);
+  }
+
+  if (isArray(suite._afterAll)) {
+    cleanArrReferences(suite._afterAll);
+  }
+
+  if (isArray(suite._afterEach)) {
+    cleanArrReferences(suite._afterEach);
+  }
+
+  for (var i = 0; i < suite.tests.length; i++) {
+    delete suite.tests[i].fn;
+  }
+}
+
+/**
+ * Run the root suite and invoke `fn(failures)`
+ * on completion.
+ *
+ * @param {Function} fn
+ * @return {Runner} for chaining
+ * @api public
+ * @param {Function} fn
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.run = function(fn) {
+  var self = this;
+  var rootSuite = this.suite;
+
+  fn = fn || function() {};
+
+  function uncaught(err) {
+    self.uncaught(err);
+  }
+
+  function start() {
+    self.started = true;
+    self.emit('start');
+    self.runSuite(rootSuite, function() {
+      debug('finished running');
+      self.emit('end');
+    });
+  }
+
+  debug('start');
+
+  // references cleanup to avoid memory leaks
+  this.on('suite end', cleanSuiteReferences);
+
+  // callback
+  this.on('end', function() {
+    debug('end');
+    process.removeListener('uncaughtException', uncaught);
+    fn(self.failures);
+  });
+
+  // uncaught exception
+  process.on('uncaughtException', uncaught);
+
+  if (this._delay) {
+    // for reporters, I guess.
+    // might be nice to debounce some dots while we wait.
+    this.emit('waiting', rootSuite);
+    rootSuite.once('run', start);
+  } else {
+    start();
+  }
+
+  return this;
+};
+
+/**
+ * Cleanly abort execution.
+ *
+ * @api public
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.abort = function() {
+  debug('aborting');
+  this._abort = true;
+
+  return this;
+};
+
+/**
+ * Filter leaks with the given globals flagged as `ok`.
+ *
+ * @api private
+ * @param {Array} ok
+ * @param {Array} globals
+ * @return {Array}
+ */
+function filterLeaks(ok, globals) {
+  return filter(globals, function(key) {
+    // Firefox and Chrome exposes iframes as index inside the window object
+    if (/^d+/.test(key)) {
+      return false;
+    }
+
+    // in firefox
+    // if runner runs in an iframe, this iframe's window.getInterface method not init at first
+    // it is assigned in some seconds
+    if (global.navigator && (/^getInterface/).test(key)) {
+      return false;
+    }
+
+    // an iframe could be approached by window[iframeIndex]
+    // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak
+    if (global.navigator && (/^\d+/).test(key)) {
+      return false;
+    }
+
+    // Opera and IE expose global variables for HTML element IDs (issue #243)
+    if (/^mocha-/.test(key)) {
+      return false;
+    }
+
+    var matched = filter(ok, function(ok) {
+      if (~ok.indexOf('*')) {
+        return key.indexOf(ok.split('*')[0]) === 0;
+      }
+      return key === ok;
+    });
+    return !matched.length && (!global.navigator || key !== 'onerror');
+  });
+}
+
+/**
+ * Array of globals dependent on the environment.
+ *
+ * @return {Array}
+ * @api private
+ */
+function extraGlobals() {
+  if (typeof process === 'object' && typeof process.version === 'string') {
+    var parts = process.version.split('.');
+    var nodeVersion = utils.reduce(parts, function(a, v) {
+      return a << 8 | v;
+    });
+
+    // 'errno' was renamed to process._errno in v0.9.11.
+
+    if (nodeVersion < 0x00090B) {
+      return ['errno'];
+    }
+  }
+
+  return [];
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./pending":16,"./runnable":35,"./utils":39,"_process":58,"debug":2,"events":3}],37:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var Hook = require('./hook');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:suite');
+var milliseconds = require('./ms');
+
+/**
+ * Expose `Suite`.
+ */
+
+exports = module.exports = Suite;
+
+/**
+ * Create a new `Suite` with the given `title` and parent `Suite`. When a suite
+ * with the same title is already present, that suite is returned to provide
+ * nicer reporter and more flexible meta-testing.
+ *
+ * @api public
+ * @param {Suite} parent
+ * @param {string} title
+ * @return {Suite}
+ */
+exports.create = function(parent, title) {
+  var suite = new Suite(title, parent.ctx);
+  suite.parent = parent;
+  title = suite.fullTitle();
+  parent.addSuite(suite);
+  return suite;
+};
+
+/**
+ * Initialize a new `Suite` with the given `title` and `ctx`.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Context} parentContext
+ */
+function Suite(title, parentContext) {
+  this.title = title;
+  function Context() {}
+  Context.prototype = parentContext;
+  this.ctx = new Context();
+  this.suites = [];
+  this.tests = [];
+  this.pending = false;
+  this._beforeEach = [];
+  this._beforeAll = [];
+  this._afterEach = [];
+  this._afterAll = [];
+  this.root = !title;
+  this._timeout = 2000;
+  this._enableTimeouts = true;
+  this._slow = 75;
+  this._bail = false;
+  this._retries = -1;
+  this.delayed = false;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Suite, EventEmitter);
+
+/**
+ * Return a clone of this `Suite`.
+ *
+ * @api private
+ * @return {Suite}
+ */
+Suite.prototype.clone = function() {
+  var suite = new Suite(this.title);
+  debug('clone');
+  suite.ctx = this.ctx;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  return suite;
+};
+
+/**
+ * Set timeout `ms` or short-hand such as "2s".
+ *
+ * @api private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (ms.toString() === '0') {
+    this._enableTimeouts = false;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('timeout %d', ms);
+  this._timeout = parseInt(ms, 10);
+  return this;
+};
+
+/**
+ * Set number of times to retry a failed test.
+ *
+ * @api private
+ * @param {number|string} n
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  debug('retries %d', n);
+  this._retries = parseInt(n, 10) || 0;
+  return this;
+};
+
+/**
+  * Set timeout to `enabled`.
+  *
+  * @api private
+  * @param {boolean} enabled
+  * @return {Suite|boolean} self or enabled
+  */
+Suite.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Set slow `ms` or short-hand such as "2s".
+ *
+ * @api private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Sets whether to bail after first error.
+ *
+ * @api private
+ * @param {boolean} bail
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    return this._bail;
+  }
+  debug('bail %s', bail);
+  this._bail = bail;
+  return this;
+};
+
+/**
+ * Check if this suite or its parent suite is marked as pending.
+ *
+ * @api private
+ */
+Suite.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Run `fn(test[, done])` before running tests.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before all" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._beforeAll.push(hook);
+  this.emit('beforeAll', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after running tests.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after all" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._afterAll.push(hook);
+  this.emit('afterAll', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` before each test case.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before each" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._beforeEach.push(hook);
+  this.emit('beforeEach', hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after each test case.
+ *
+ * @api private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after each" hook' + (title ? ': ' + title : '');
+
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  this._afterEach.push(hook);
+  this.emit('afterEach', hook);
+  return this;
+};
+
+/**
+ * Add a test `suite`.
+ *
+ * @api private
+ * @param {Suite} suite
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addSuite = function(suite) {
+  suite.parent = this;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  this.suites.push(suite);
+  this.emit('suite', suite);
+  return this;
+};
+
+/**
+ * Add a `test` to this suite.
+ *
+ * @api private
+ * @param {Test} test
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addTest = function(test) {
+  test.parent = this;
+  test.timeout(this.timeout());
+  test.retries(this.retries());
+  test.enableTimeouts(this.enableTimeouts());
+  test.slow(this.slow());
+  test.ctx = this.ctx;
+  this.tests.push(test);
+  this.emit('test', test);
+  return this;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @api public
+ * @return {string}
+ */
+Suite.prototype.fullTitle = function() {
+  if (this.parent) {
+    var full = this.parent.fullTitle();
+    if (full) {
+      return full + ' ' + this.title;
+    }
+  }
+  return this.title;
+};
+
+/**
+ * Return the total number of tests.
+ *
+ * @api public
+ * @return {number}
+ */
+Suite.prototype.total = function() {
+  return utils.reduce(this.suites, function(sum, suite) {
+    return sum + suite.total();
+  }, 0) + this.tests.length;
+};
+
+/**
+ * Iterates through each suite recursively to find all tests. Applies a
+ * function in the format `fn(test)`.
+ *
+ * @api private
+ * @param {Function} fn
+ * @return {Suite}
+ */
+Suite.prototype.eachTest = function(fn) {
+  utils.forEach(this.tests, fn);
+  utils.forEach(this.suites, function(suite) {
+    suite.eachTest(fn);
+  });
+  return this;
+};
+
+/**
+ * This will run the root suite if we happen to be running in delayed mode.
+ */
+Suite.prototype.run = function run() {
+  if (this.root) {
+    this.emit('run');
+  }
+};
+
+},{"./hook":7,"./ms":15,"./utils":39,"debug":2,"events":3}],38:[function(require,module,exports){
+/**
+ * Module dependencies.
+ */
+
+var Runnable = require('./runnable');
+var inherits = require('./utils').inherits;
+
+/**
+ * Expose `Test`.
+ */
+
+module.exports = Test;
+
+/**
+ * Initialize a new `Test` with the given `title` and callback `fn`.
+ *
+ * @api private
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Test(title, fn) {
+  Runnable.call(this, title, fn);
+  this.pending = !fn;
+  this.type = 'test';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+inherits(Test, Runnable);
+
+Test.prototype.clone = function() {
+  var test = new Test(this.title, this.fn);
+  test.timeout(this.timeout());
+  test.slow(this.slow());
+  test.enableTimeouts(this.enableTimeouts());
+  test.retries(this.retries());
+  test.currentRetry(this.currentRetry());
+  test.globals(this.globals());
+  test.parent = this.parent;
+  test.file = this.file;
+  test.ctx = this.ctx;
+  return test;
+};
+
+},{"./runnable":35,"./utils":39}],39:[function(require,module,exports){
+(function (process,Buffer){
+/* eslint-env browser */
+
+/**
+ * Module dependencies.
+ */
+
+var basename = require('path').basename;
+var debug = require('debug')('mocha:watch');
+var exists = require('fs').existsSync || require('path').existsSync;
+var glob = require('glob');
+var join = require('path').join;
+var readdirSync = require('fs').readdirSync;
+var statSync = require('fs').statSync;
+var watchFile = require('fs').watchFile;
+var toISOString = require('to-iso-string');
+
+/**
+ * Ignored directories.
+ */
+
+var ignore = ['node_modules', '.git'];
+
+exports.inherits = require('util').inherits;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @api private
+ * @param  {string} html
+ * @return {string}
+ */
+exports.escape = function(html) {
+  return String(html)
+    .replace(/&/g, '&')
+    .replace(/"/g, '"')
+    .replace(//g, '>');
+};
+
+/**
+ * Array#forEach (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} scope
+ */
+exports.forEach = function(arr, fn, scope) {
+  for (var i = 0, l = arr.length; i < l; i++) {
+    fn.call(scope, arr[i], i);
+  }
+};
+
+/**
+ * Test if the given obj is type of string.
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {boolean}
+ */
+exports.isString = function(obj) {
+  return typeof obj === 'string';
+};
+
+/**
+ * Array#map (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} scope
+ * @return {Array}
+ */
+exports.map = function(arr, fn, scope) {
+  var result = [];
+  for (var i = 0, l = arr.length; i < l; i++) {
+    result.push(fn.call(scope, arr[i], i, arr));
+  }
+  return result;
+};
+
+/**
+ * Array#indexOf (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Object} obj to find index of
+ * @param {number} start
+ * @return {number}
+ */
+exports.indexOf = function(arr, obj, start) {
+  for (var i = start || 0, l = arr.length; i < l; i++) {
+    if (arr[i] === obj) {
+      return i;
+    }
+  }
+  return -1;
+};
+
+/**
+ * Array#reduce (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @param {Object} val Initial value.
+ * @return {*}
+ */
+exports.reduce = function(arr, fn, val) {
+  var rval = val;
+
+  for (var i = 0, l = arr.length; i < l; i++) {
+    rval = fn(rval, arr[i], i, arr);
+  }
+
+  return rval;
+};
+
+/**
+ * Array#filter (<=IE8)
+ *
+ * @api private
+ * @param {Array} arr
+ * @param {Function} fn
+ * @return {Array}
+ */
+exports.filter = function(arr, fn) {
+  var ret = [];
+
+  for (var i = 0, l = arr.length; i < l; i++) {
+    var val = arr[i];
+    if (fn(val, i, arr)) {
+      ret.push(val);
+    }
+  }
+
+  return ret;
+};
+
+/**
+ * Object.keys (<=IE8)
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {Array} keys
+ */
+exports.keys = typeof Object.keys === 'function' ? Object.keys : function(obj) {
+  var keys = [];
+  var has = Object.prototype.hasOwnProperty; // for `window` on <=IE8
+
+  for (var key in obj) {
+    if (has.call(obj, key)) {
+      keys.push(key);
+    }
+  }
+
+  return keys;
+};
+
+/**
+ * Watch the given `files` for changes
+ * and invoke `fn(file)` on modification.
+ *
+ * @api private
+ * @param {Array} files
+ * @param {Function} fn
+ */
+exports.watch = function(files, fn) {
+  var options = { interval: 100 };
+  files.forEach(function(file) {
+    debug('file %s', file);
+    watchFile(file, options, function(curr, prev) {
+      if (prev.mtime < curr.mtime) {
+        fn(file);
+      }
+    });
+  });
+};
+
+/**
+ * Array.isArray (<=IE8)
+ *
+ * @api private
+ * @param {Object} obj
+ * @return {Boolean}
+ */
+var isArray = typeof Array.isArray === 'function' ? Array.isArray : function(obj) {
+  return Object.prototype.toString.call(obj) === '[object Array]';
+};
+
+exports.isArray = isArray;
+
+/**
+ * Buffer.prototype.toJSON polyfill.
+ *
+ * @type {Function}
+ */
+if (typeof Buffer !== 'undefined' && Buffer.prototype) {
+  Buffer.prototype.toJSON = Buffer.prototype.toJSON || function() {
+    return Array.prototype.slice.call(this, 0);
+  };
+}
+
+/**
+ * Ignored files.
+ *
+ * @api private
+ * @param {string} path
+ * @return {boolean}
+ */
+function ignored(path) {
+  return !~ignore.indexOf(path);
+}
+
+/**
+ * Lookup files in the given `dir`.
+ *
+ * @api private
+ * @param {string} dir
+ * @param {string[]} [ext=['.js']]
+ * @param {Array} [ret=[]]
+ * @return {Array}
+ */
+exports.files = function(dir, ext, ret) {
+  ret = ret || [];
+  ext = ext || ['js'];
+
+  var re = new RegExp('\\.(' + ext.join('|') + ')$');
+
+  readdirSync(dir)
+    .filter(ignored)
+    .forEach(function(path) {
+      path = join(dir, path);
+      if (statSync(path).isDirectory()) {
+        exports.files(path, ext, ret);
+      } else if (path.match(re)) {
+        ret.push(path);
+      }
+    });
+
+  return ret;
+};
+
+/**
+ * Compute a slug from the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+exports.slug = function(str) {
+  return str
+    .toLowerCase()
+    .replace(/ +/g, '-')
+    .replace(/[^-\w]/g, '');
+};
+
+/**
+ * Strip the function definition from `str`, and re-indent for pre whitespace.
+ *
+ * @param {string} str
+ * @return {string}
+ */
+exports.clean = function(str) {
+  str = str
+    .replace(/\r\n?|[\n\u2028\u2029]/g, '\n').replace(/^\uFEFF/, '')
+    .replace(/^function *\(.*\)\s*\{|\(.*\) *=> *\{?/, '')
+    .replace(/\s+\}$/, '');
+
+  var spaces = str.match(/^\n?( *)/)[1].length;
+  var tabs = str.match(/^\n?(\t*)/)[1].length;
+  var re = new RegExp('^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs ? tabs : spaces) + '}', 'gm');
+
+  str = str.replace(re, '');
+
+  return exports.trim(str);
+};
+
+/**
+ * Trim the given `str`.
+ *
+ * @api private
+ * @param {string} str
+ * @return {string}
+ */
+exports.trim = function(str) {
+  return str.replace(/^\s+|\s+$/g, '');
+};
+
+/**
+ * Parse the given `qs`.
+ *
+ * @api private
+ * @param {string} qs
+ * @return {Object}
+ */
+exports.parseQuery = function(qs) {
+  return exports.reduce(qs.replace('?', '').split('&'), function(obj, pair) {
+    var i = pair.indexOf('=');
+    var key = pair.slice(0, i);
+    var val = pair.slice(++i);
+
+    obj[key] = decodeURIComponent(val);
+    return obj;
+  }, {});
+};
+
+/**
+ * Highlight the given string of `js`.
+ *
+ * @api private
+ * @param {string} js
+ * @return {string}
+ */
+function highlight(js) {
+  return js
+    .replace(//g, '>')
+    .replace(/\/\/(.*)/gm, '//$1')
+    .replace(/('.*?')/gm, '$1')
+    .replace(/(\d+\.\d+)/gm, '$1')
+    .replace(/(\d+)/gm, '$1')
+    .replace(/\bnew[ \t]+(\w+)/gm, 'new $1')
+    .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '$1');
+}
+
+/**
+ * Highlight the contents of tag `name`.
+ *
+ * @api private
+ * @param {string} name
+ */
+exports.highlightTags = function(name) {
+  var code = document.getElementById('mocha').getElementsByTagName(name);
+  for (var i = 0, len = code.length; i < len; ++i) {
+    code[i].innerHTML = highlight(code[i].innerHTML);
+  }
+};
+
+/**
+ * If a value could have properties, and has none, this function is called,
+ * which returns a string representation of the empty value.
+ *
+ * Functions w/ no properties return `'[Function]'`
+ * Arrays w/ length === 0 return `'[]'`
+ * Objects w/ no properties return `'{}'`
+ * All else: return result of `value.toString()`
+ *
+ * @api private
+ * @param {*} value The value to inspect.
+ * @param {string} [type] The type of the value, if known.
+ * @returns {string}
+ */
+function emptyRepresentation(value, type) {
+  type = type || exports.type(value);
+
+  switch (type) {
+    case 'function':
+      return '[Function]';
+    case 'object':
+      return '{}';
+    case 'array':
+      return '[]';
+    default:
+      return value.toString();
+  }
+}
+
+/**
+ * Takes some variable and asks `Object.prototype.toString()` what it thinks it
+ * is.
+ *
+ * @api private
+ * @see https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/toString
+ * @param {*} value The value to test.
+ * @returns {string}
+ * @example
+ * type({}) // 'object'
+ * type([]) // 'array'
+ * type(1) // 'number'
+ * type(false) // 'boolean'
+ * type(Infinity) // 'number'
+ * type(null) // 'null'
+ * type(new Date()) // 'date'
+ * type(/foo/) // 'regexp'
+ * type('type') // 'string'
+ * type(global) // 'global'
+ */
+exports.type = function type(value) {
+  if (value === undefined) {
+    return 'undefined';
+  } else if (value === null) {
+    return 'null';
+  } else if (typeof Buffer !== 'undefined' && Buffer.isBuffer(value)) {
+    return 'buffer';
+  }
+  return Object.prototype.toString.call(value)
+    .replace(/^\[.+\s(.+?)\]$/, '$1')
+    .toLowerCase();
+};
+
+/**
+ * Stringify `value`. Different behavior depending on type of value:
+ *
+ * - If `value` is undefined or null, return `'[undefined]'` or `'[null]'`, respectively.
+ * - If `value` is not an object, function or array, return result of `value.toString()` wrapped in double-quotes.
+ * - If `value` is an *empty* object, function, or array, return result of function
+ *   {@link emptyRepresentation}.
+ * - If `value` has properties, call {@link exports.canonicalize} on it, then return result of
+ *   JSON.stringify().
+ *
+ * @api private
+ * @see exports.type
+ * @param {*} value
+ * @return {string}
+ */
+exports.stringify = function(value) {
+  var type = exports.type(value);
+
+  if (!~exports.indexOf(['object', 'array', 'function'], type)) {
+    if (type !== 'buffer') {
+      return jsonStringify(value);
+    }
+    var json = value.toJSON();
+    // Based on the toJSON result
+    return jsonStringify(json.data && json.type ? json.data : json, 2)
+      .replace(/,(\n|$)/g, '$1');
+  }
+
+  for (var prop in value) {
+    if (Object.prototype.hasOwnProperty.call(value, prop)) {
+      return jsonStringify(exports.canonicalize(value), 2).replace(/,(\n|$)/g, '$1');
+    }
+  }
+
+  return emptyRepresentation(value, type);
+};
+
+/**
+ * like JSON.stringify but more sense.
+ *
+ * @api private
+ * @param {Object}  object
+ * @param {number=} spaces
+ * @param {number=} depth
+ * @returns {*}
+ */
+function jsonStringify(object, spaces, depth) {
+  if (typeof spaces === 'undefined') {
+    // primitive types
+    return _stringify(object);
+  }
+
+  depth = depth || 1;
+  var space = spaces * depth;
+  var str = isArray(object) ? '[' : '{';
+  var end = isArray(object) ? ']' : '}';
+  var length = typeof object.length === 'number' ? object.length : exports.keys(object).length;
+  // `.repeat()` polyfill
+  function repeat(s, n) {
+    return new Array(n).join(s);
+  }
+
+  function _stringify(val) {
+    switch (exports.type(val)) {
+      case 'null':
+      case 'undefined':
+        val = '[' + val + ']';
+        break;
+      case 'array':
+      case 'object':
+        val = jsonStringify(val, spaces, depth + 1);
+        break;
+      case 'boolean':
+      case 'regexp':
+      case 'symbol':
+      case 'number':
+        val = val === 0 && (1 / val) === -Infinity // `-0`
+          ? '-0'
+          : val.toString();
+        break;
+      case 'date':
+        var sDate;
+        if (isNaN(val.getTime())) { // Invalid date
+          sDate = val.toString();
+        } else {
+          sDate = val.toISOString ? val.toISOString() : toISOString(val);
+        }
+        val = '[Date: ' + sDate + ']';
+        break;
+      case 'buffer':
+        var json = val.toJSON();
+        // Based on the toJSON result
+        json = json.data && json.type ? json.data : json;
+        val = '[Buffer: ' + jsonStringify(json, 2, depth + 1) + ']';
+        break;
+      default:
+        val = (val === '[Function]' || val === '[Circular]')
+          ? val
+          : JSON.stringify(val); // string
+    }
+    return val;
+  }
+
+  for (var i in object) {
+    if (!Object.prototype.hasOwnProperty.call(object, i)) {
+      continue; // not my business
+    }
+    --length;
+    str += '\n ' + repeat(' ', space)
+      + (isArray(object) ? '' : '"' + i + '": ') // key
+      + _stringify(object[i])                     // value
+      + (length ? ',' : '');                     // comma
+  }
+
+  return str
+    // [], {}
+    + (str.length !== 1 ? '\n' + repeat(' ', --space) + end : end);
+}
+
+/**
+ * Test if a value is a buffer.
+ *
+ * @api private
+ * @param {*} value The value to test.
+ * @return {boolean} True if `value` is a buffer, otherwise false
+ */
+exports.isBuffer = function(value) {
+  return typeof Buffer !== 'undefined' && Buffer.isBuffer(value);
+};
+
+/**
+ * Return a new Thing that has the keys in sorted order. Recursive.
+ *
+ * If the Thing...
+ * - has already been seen, return string `'[Circular]'`
+ * - is `undefined`, return string `'[undefined]'`
+ * - is `null`, return value `null`
+ * - is some other primitive, return the value
+ * - is not a primitive or an `Array`, `Object`, or `Function`, return the value of the Thing's `toString()` method
+ * - is a non-empty `Array`, `Object`, or `Function`, return the result of calling this function again.
+ * - is an empty `Array`, `Object`, or `Function`, return the result of calling `emptyRepresentation()`
+ *
+ * @api private
+ * @see {@link exports.stringify}
+ * @param {*} value Thing to inspect.  May or may not have properties.
+ * @param {Array} [stack=[]] Stack of seen values
+ * @return {(Object|Array|Function|string|undefined)}
+ */
+exports.canonicalize = function(value, stack) {
+  var canonicalizedObj;
+  /* eslint-disable no-unused-vars */
+  var prop;
+  /* eslint-enable no-unused-vars */
+  var type = exports.type(value);
+  function withStack(value, fn) {
+    stack.push(value);
+    fn();
+    stack.pop();
+  }
+
+  stack = stack || [];
+
+  if (exports.indexOf(stack, value) !== -1) {
+    return '[Circular]';
+  }
+
+  switch (type) {
+    case 'undefined':
+    case 'buffer':
+    case 'null':
+      canonicalizedObj = value;
+      break;
+    case 'array':
+      withStack(value, function() {
+        canonicalizedObj = exports.map(value, function(item) {
+          return exports.canonicalize(item, stack);
+        });
+      });
+      break;
+    case 'function':
+      /* eslint-disable guard-for-in */
+      for (prop in value) {
+        canonicalizedObj = {};
+        break;
+      }
+      /* eslint-enable guard-for-in */
+      if (!canonicalizedObj) {
+        canonicalizedObj = emptyRepresentation(value, type);
+        break;
+      }
+    /* falls through */
+    case 'object':
+      canonicalizedObj = canonicalizedObj || {};
+      withStack(value, function() {
+        exports.forEach(exports.keys(value).sort(), function(key) {
+          canonicalizedObj[key] = exports.canonicalize(value[key], stack);
+        });
+      });
+      break;
+    case 'date':
+    case 'number':
+    case 'regexp':
+    case 'boolean':
+    case 'symbol':
+      canonicalizedObj = value;
+      break;
+    default:
+      canonicalizedObj = value + '';
+  }
+
+  return canonicalizedObj;
+};
+
+/**
+ * Lookup file names at the given `path`.
+ *
+ * @api public
+ * @param {string} path Base path to start searching from.
+ * @param {string[]} extensions File extensions to look for.
+ * @param {boolean} recursive Whether or not to recurse into subdirectories.
+ * @return {string[]} An array of paths.
+ */
+exports.lookupFiles = function lookupFiles(path, extensions, recursive) {
+  var files = [];
+  var re = new RegExp('\\.(' + extensions.join('|') + ')$');
+
+  if (!exists(path)) {
+    if (exists(path + '.js')) {
+      path += '.js';
+    } else {
+      files = glob.sync(path);
+      if (!files.length) {
+        throw new Error("cannot resolve path (or pattern) '" + path + "'");
+      }
+      return files;
+    }
+  }
+
+  try {
+    var stat = statSync(path);
+    if (stat.isFile()) {
+      return path;
+    }
+  } catch (err) {
+    // ignore error
+    return;
+  }
+
+  readdirSync(path).forEach(function(file) {
+    file = join(path, file);
+    try {
+      var stat = statSync(file);
+      if (stat.isDirectory()) {
+        if (recursive) {
+          files = files.concat(lookupFiles(file, extensions, recursive));
+        }
+        return;
+      }
+    } catch (err) {
+      // ignore error
+      return;
+    }
+    if (!stat.isFile() || !re.test(file) || basename(file)[0] === '.') {
+      return;
+    }
+    files.push(file);
+  });
+
+  return files;
+};
+
+/**
+ * Generate an undefined error with a message warning the user.
+ *
+ * @return {Error}
+ */
+
+exports.undefinedError = function() {
+  return new Error('Caught undefined error, did you throw without specifying what?');
+};
+
+/**
+ * Generate an undefined error if `err` is not defined.
+ *
+ * @param {Error} err
+ * @return {Error}
+ */
+
+exports.getError = function(err) {
+  return err || exports.undefinedError();
+};
+
+/**
+ * @summary
+ * This Filter based on `mocha-clean` module.(see: `github.com/rstacruz/mocha-clean`)
+ * @description
+ * When invoking this function you get a filter function that get the Error.stack as an input,
+ * and return a prettify output.
+ * (i.e: strip Mocha and internal node functions from stack trace).
+ * @returns {Function}
+ */
+exports.stackTraceFilter = function() {
+  // TODO: Replace with `process.browser`
+  var slash = '/';
+  var is = typeof document === 'undefined' ? { node: true } : { browser: true };
+  var cwd = is.node
+      ? process.cwd() + slash
+      : (typeof location === 'undefined' ? window.location : location).href.replace(/\/[^\/]*$/, '/');
+
+  function isMochaInternal(line) {
+    return (~line.indexOf('node_modules' + slash + 'mocha' + slash))
+      || (~line.indexOf('components' + slash + 'mochajs' + slash))
+      || (~line.indexOf('components' + slash + 'mocha' + slash))
+      || (~line.indexOf(slash + 'mocha.js'));
+  }
+
+  function isNodeInternal(line) {
+    return (~line.indexOf('(timers.js:'))
+      || (~line.indexOf('(events.js:'))
+      || (~line.indexOf('(node.js:'))
+      || (~line.indexOf('(module.js:'))
+      || (~line.indexOf('GeneratorFunctionPrototype.next (native)'))
+      || false;
+  }
+
+  return function(stack) {
+    stack = stack.split('\n');
+
+    stack = exports.reduce(stack, function(list, line) {
+      if (isMochaInternal(line)) {
+        return list;
+      }
+
+      if (is.node && isNodeInternal(line)) {
+        return list;
+      }
+
+      // Clean up cwd(absolute)
+      if (/\(?.+:\d+:\d+\)?$/.test(line)) {
+        line = line.replace(cwd, '');
+      }
+
+      list.push(line);
+      return list;
+    }, []);
+
+    return stack.join('\n');
+  };
+};
+
+}).call(this,require('_process'),require("buffer").Buffer)
+},{"_process":58,"buffer":45,"debug":2,"fs":43,"glob":43,"path":43,"to-iso-string":72,"util":75}],40:[function(require,module,exports){
+'use strict'
+
+exports.toByteArray = toByteArray
+exports.fromByteArray = fromByteArray
+
+var lookup = []
+var revLookup = []
+var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array
+
+function init () {
+  var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
+  for (var i = 0, len = code.length; i < len; ++i) {
+    lookup[i] = code[i]
+    revLookup[code.charCodeAt(i)] = i
+  }
+
+  revLookup['-'.charCodeAt(0)] = 62
+  revLookup['_'.charCodeAt(0)] = 63
+}
+
+init()
+
+function toByteArray (b64) {
+  var i, j, l, tmp, placeHolders, arr
+  var len = b64.length
+
+  if (len % 4 > 0) {
+    throw new Error('Invalid string. Length must be a multiple of 4')
+  }
+
+  // the number of equal signs (place holders)
+  // if there are two placeholders, than the two characters before it
+  // represent one byte
+  // if there is only one, then the three characters before it represent 2 bytes
+  // this is just a cheap hack to not do indexOf twice
+  placeHolders = b64[len - 2] === '=' ? 2 : b64[len - 1] === '=' ? 1 : 0
+
+  // base64 is 4/3 + up to two characters of the original data
+  arr = new Arr(len * 3 / 4 - placeHolders)
+
+  // if there are placeholders, only get up to the last complete 4 chars
+  l = placeHolders > 0 ? len - 4 : len
+
+  var L = 0
+
+  for (i = 0, j = 0; i < l; i += 4, j += 3) {
+    tmp = (revLookup[b64.charCodeAt(i)] << 18) | (revLookup[b64.charCodeAt(i + 1)] << 12) | (revLookup[b64.charCodeAt(i + 2)] << 6) | revLookup[b64.charCodeAt(i + 3)]
+    arr[L++] = (tmp >> 16) & 0xFF
+    arr[L++] = (tmp >> 8) & 0xFF
+    arr[L++] = tmp & 0xFF
+  }
+
+  if (placeHolders === 2) {
+    tmp = (revLookup[b64.charCodeAt(i)] << 2) | (revLookup[b64.charCodeAt(i + 1)] >> 4)
+    arr[L++] = tmp & 0xFF
+  } else if (placeHolders === 1) {
+    tmp = (revLookup[b64.charCodeAt(i)] << 10) | (revLookup[b64.charCodeAt(i + 1)] << 4) | (revLookup[b64.charCodeAt(i + 2)] >> 2)
+    arr[L++] = (tmp >> 8) & 0xFF
+    arr[L++] = tmp & 0xFF
+  }
+
+  return arr
+}
+
+function tripletToBase64 (num) {
+  return lookup[num >> 18 & 0x3F] + lookup[num >> 12 & 0x3F] + lookup[num >> 6 & 0x3F] + lookup[num & 0x3F]
+}
+
+function encodeChunk (uint8, start, end) {
+  var tmp
+  var output = []
+  for (var i = start; i < end; i += 3) {
+    tmp = (uint8[i] << 16) + (uint8[i + 1] << 8) + (uint8[i + 2])
+    output.push(tripletToBase64(tmp))
+  }
+  return output.join('')
+}
+
+function fromByteArray (uint8) {
+  var tmp
+  var len = uint8.length
+  var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
+  var output = ''
+  var parts = []
+  var maxChunkLength = 16383 // must be multiple of 3
+
+  // go through the array every three bytes, we'll deal with trailing stuff later
+  for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
+    parts.push(encodeChunk(uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)))
+  }
+
+  // pad the end with zeros, but make sure to not forget the extra bytes
+  if (extraBytes === 1) {
+    tmp = uint8[len - 1]
+    output += lookup[tmp >> 2]
+    output += lookup[(tmp << 4) & 0x3F]
+    output += '=='
+  } else if (extraBytes === 2) {
+    tmp = (uint8[len - 2] << 8) + (uint8[len - 1])
+    output += lookup[tmp >> 10]
+    output += lookup[(tmp >> 4) & 0x3F]
+    output += lookup[(tmp << 2) & 0x3F]
+    output += '='
+  }
+
+  parts.push(output)
+
+  return parts.join('')
+}
+
+},{}],41:[function(require,module,exports){
+
+},{}],42:[function(require,module,exports){
+(function (process){
+var WritableStream = require('stream').Writable
+var inherits = require('util').inherits
+
+module.exports = BrowserStdout
+
+
+inherits(BrowserStdout, WritableStream)
+
+function BrowserStdout(opts) {
+  if (!(this instanceof BrowserStdout)) return new BrowserStdout(opts)
+
+  opts = opts || {}
+  WritableStream.call(this, opts)
+  this.label = (opts.label !== undefined) ? opts.label : 'stdout'
+}
+
+BrowserStdout.prototype._write = function(chunks, encoding, cb) {
+  var output = chunks.toString ? chunks.toString() : chunks
+  if (this.label === false) {
+    console.log(output)
+  } else {
+    console.log(this.label+':', output)
+  }
+  process.nextTick(cb)
+}
+
+}).call(this,require('_process'))
+},{"_process":58,"stream":59,"util":75}],43:[function(require,module,exports){
+arguments[4][41][0].apply(exports,arguments)
+},{"dup":41}],44:[function(require,module,exports){
+(function (global){
+'use strict';
+
+var buffer = require('buffer');
+var Buffer = buffer.Buffer;
+var SlowBuffer = buffer.SlowBuffer;
+var MAX_LEN = buffer.kMaxLength || 2147483647;
+exports.alloc = function alloc(size, fill, encoding) {
+  if (typeof Buffer.alloc === 'function') {
+    return Buffer.alloc(size, fill, encoding);
+  }
+  if (typeof encoding === 'number') {
+    throw new TypeError('encoding must not be number');
+  }
+  if (typeof size !== 'number') {
+    throw new TypeError('size must be a number');
+  }
+  if (size > MAX_LEN) {
+    throw new RangeError('size is too large');
+  }
+  var enc = encoding;
+  var _fill = fill;
+  if (_fill === undefined) {
+    enc = undefined;
+    _fill = 0;
+  }
+  var buf = new Buffer(size);
+  if (typeof _fill === 'string') {
+    var fillBuf = new Buffer(_fill, enc);
+    var flen = fillBuf.length;
+    var i = -1;
+    while (++i < size) {
+      buf[i] = fillBuf[i % flen];
+    }
+  } else {
+    buf.fill(_fill);
+  }
+  return buf;
+}
+exports.allocUnsafe = function allocUnsafe(size) {
+  if (typeof Buffer.allocUnsafe === 'function') {
+    return Buffer.allocUnsafe(size);
+  }
+  if (typeof size !== 'number') {
+    throw new TypeError('size must be a number');
+  }
+  if (size > MAX_LEN) {
+    throw new RangeError('size is too large');
+  }
+  return new Buffer(size);
+}
+exports.from = function from(value, encodingOrOffset, length) {
+  if (typeof Buffer.from === 'function' && (!global.Uint8Array || Uint8Array.from !== Buffer.from)) {
+    return Buffer.from(value, encodingOrOffset, length);
+  }
+  if (typeof value === 'number') {
+    throw new TypeError('"value" argument must not be a number');
+  }
+  if (typeof value === 'string') {
+    return new Buffer(value, encodingOrOffset);
+  }
+  if (typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer) {
+    var offset = encodingOrOffset;
+    if (arguments.length === 1) {
+      return new Buffer(value);
+    }
+    if (typeof offset === 'undefined') {
+      offset = 0;
+    }
+    var len = length;
+    if (typeof len === 'undefined') {
+      len = value.byteLength - offset;
+    }
+    if (offset >= value.byteLength) {
+      throw new RangeError('\'offset\' is out of bounds');
+    }
+    if (len > value.byteLength - offset) {
+      throw new RangeError('\'length\' is out of bounds');
+    }
+    return new Buffer(value.slice(offset, offset + len));
+  }
+  if (Buffer.isBuffer(value)) {
+    var out = new Buffer(value.length);
+    value.copy(out, 0, 0, value.length);
+    return out;
+  }
+  if (value) {
+    if (Array.isArray(value) || (typeof ArrayBuffer !== 'undefined' && value.buffer instanceof ArrayBuffer) || 'length' in value) {
+      return new Buffer(value);
+    }
+    if (value.type === 'Buffer' && Array.isArray(value.data)) {
+      return new Buffer(value.data);
+    }
+  }
+
+  throw new TypeError('First argument must be a string, Buffer, ' + 'ArrayBuffer, Array, or array-like object.');
+}
+exports.allocUnsafeSlow = function allocUnsafeSlow(size) {
+  if (typeof Buffer.allocUnsafeSlow === 'function') {
+    return Buffer.allocUnsafeSlow(size);
+  }
+  if (typeof size !== 'number') {
+    throw new TypeError('size must be a number');
+  }
+  if (size >= MAX_LEN) {
+    throw new RangeError('size is too large');
+  }
+  return new SlowBuffer(size);
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"buffer":45}],45:[function(require,module,exports){
+(function (global){
+/*!
+ * The buffer module from node.js, for the browser.
+ *
+ * @author   Feross Aboukhadijeh  
+ * @license  MIT
+ */
+/* eslint-disable no-proto */
+
+'use strict'
+
+var base64 = require('base64-js')
+var ieee754 = require('ieee754')
+var isArray = require('isarray')
+
+exports.Buffer = Buffer
+exports.SlowBuffer = SlowBuffer
+exports.INSPECT_MAX_BYTES = 50
+
+/**
+ * If `Buffer.TYPED_ARRAY_SUPPORT`:
+ *   === true    Use Uint8Array implementation (fastest)
+ *   === false   Use Object implementation (most compatible, even IE6)
+ *
+ * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+,
+ * Opera 11.6+, iOS 4.2+.
+ *
+ * Due to various browser bugs, sometimes the Object implementation will be used even
+ * when the browser supports typed arrays.
+ *
+ * Note:
+ *
+ *   - Firefox 4-29 lacks support for adding new properties to `Uint8Array` instances,
+ *     See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438.
+ *
+ *   - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function.
+ *
+ *   - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of
+ *     incorrect length in some situations.
+
+ * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they
+ * get the Object implementation, which is slower but behaves correctly.
+ */
+Buffer.TYPED_ARRAY_SUPPORT = global.TYPED_ARRAY_SUPPORT !== undefined
+  ? global.TYPED_ARRAY_SUPPORT
+  : typedArraySupport()
+
+/*
+ * Export kMaxLength after typed array support is determined.
+ */
+exports.kMaxLength = kMaxLength()
+
+function typedArraySupport () {
+  try {
+    var arr = new Uint8Array(1)
+    arr.foo = function () { return 42 }
+    return arr.foo() === 42 && // typed array instances can be augmented
+        typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray`
+        arr.subarray(1, 1).byteLength === 0 // ie10 has broken `subarray`
+  } catch (e) {
+    return false
+  }
+}
+
+function kMaxLength () {
+  return Buffer.TYPED_ARRAY_SUPPORT
+    ? 0x7fffffff
+    : 0x3fffffff
+}
+
+function createBuffer (that, length) {
+  if (kMaxLength() < length) {
+    throw new RangeError('Invalid typed array length')
+  }
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    // Return an augmented `Uint8Array` instance, for best performance
+    that = new Uint8Array(length)
+    that.__proto__ = Buffer.prototype
+  } else {
+    // Fallback: Return an object instance of the Buffer class
+    if (that === null) {
+      that = new Buffer(length)
+    }
+    that.length = length
+  }
+
+  return that
+}
+
+/**
+ * The Buffer constructor returns instances of `Uint8Array` that have their
+ * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of
+ * `Uint8Array`, so the returned instances will have all the node `Buffer` methods
+ * and the `Uint8Array` methods. Square bracket notation works as expected -- it
+ * returns a single octet.
+ *
+ * The `Uint8Array` prototype remains unmodified.
+ */
+
+function Buffer (arg, encodingOrOffset, length) {
+  if (!Buffer.TYPED_ARRAY_SUPPORT && !(this instanceof Buffer)) {
+    return new Buffer(arg, encodingOrOffset, length)
+  }
+
+  // Common case.
+  if (typeof arg === 'number') {
+    if (typeof encodingOrOffset === 'string') {
+      throw new Error(
+        'If encoding is specified then the first argument must be a string'
+      )
+    }
+    return allocUnsafe(this, arg)
+  }
+  return from(this, arg, encodingOrOffset, length)
+}
+
+Buffer.poolSize = 8192 // not used by this implementation
+
+// TODO: Legacy, not needed anymore. Remove in next major version.
+Buffer._augment = function (arr) {
+  arr.__proto__ = Buffer.prototype
+  return arr
+}
+
+function from (that, value, encodingOrOffset, length) {
+  if (typeof value === 'number') {
+    throw new TypeError('"value" argument must not be a number')
+  }
+
+  if (typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer) {
+    return fromArrayBuffer(that, value, encodingOrOffset, length)
+  }
+
+  if (typeof value === 'string') {
+    return fromString(that, value, encodingOrOffset)
+  }
+
+  return fromObject(that, value)
+}
+
+/**
+ * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError
+ * if value is a number.
+ * Buffer.from(str[, encoding])
+ * Buffer.from(array)
+ * Buffer.from(buffer)
+ * Buffer.from(arrayBuffer[, byteOffset[, length]])
+ **/
+Buffer.from = function (value, encodingOrOffset, length) {
+  return from(null, value, encodingOrOffset, length)
+}
+
+if (Buffer.TYPED_ARRAY_SUPPORT) {
+  Buffer.prototype.__proto__ = Uint8Array.prototype
+  Buffer.__proto__ = Uint8Array
+  if (typeof Symbol !== 'undefined' && Symbol.species &&
+      Buffer[Symbol.species] === Buffer) {
+    // Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97
+    Object.defineProperty(Buffer, Symbol.species, {
+      value: null,
+      configurable: true
+    })
+  }
+}
+
+function assertSize (size) {
+  if (typeof size !== 'number') {
+    throw new TypeError('"size" argument must be a number')
+  }
+}
+
+function alloc (that, size, fill, encoding) {
+  assertSize(size)
+  if (size <= 0) {
+    return createBuffer(that, size)
+  }
+  if (fill !== undefined) {
+    // Only pay attention to encoding if it's a string. This
+    // prevents accidentally sending in a number that would
+    // be interpretted as a start offset.
+    return typeof encoding === 'string'
+      ? createBuffer(that, size).fill(fill, encoding)
+      : createBuffer(that, size).fill(fill)
+  }
+  return createBuffer(that, size)
+}
+
+/**
+ * Creates a new filled Buffer instance.
+ * alloc(size[, fill[, encoding]])
+ **/
+Buffer.alloc = function (size, fill, encoding) {
+  return alloc(null, size, fill, encoding)
+}
+
+function allocUnsafe (that, size) {
+  assertSize(size)
+  that = createBuffer(that, size < 0 ? 0 : checked(size) | 0)
+  if (!Buffer.TYPED_ARRAY_SUPPORT) {
+    for (var i = 0; i < size; i++) {
+      that[i] = 0
+    }
+  }
+  return that
+}
+
+/**
+ * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance.
+ * */
+Buffer.allocUnsafe = function (size) {
+  return allocUnsafe(null, size)
+}
+/**
+ * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance.
+ */
+Buffer.allocUnsafeSlow = function (size) {
+  return allocUnsafe(null, size)
+}
+
+function fromString (that, string, encoding) {
+  if (typeof encoding !== 'string' || encoding === '') {
+    encoding = 'utf8'
+  }
+
+  if (!Buffer.isEncoding(encoding)) {
+    throw new TypeError('"encoding" must be a valid string encoding')
+  }
+
+  var length = byteLength(string, encoding) | 0
+  that = createBuffer(that, length)
+
+  that.write(string, encoding)
+  return that
+}
+
+function fromArrayLike (that, array) {
+  var length = checked(array.length) | 0
+  that = createBuffer(that, length)
+  for (var i = 0; i < length; i += 1) {
+    that[i] = array[i] & 255
+  }
+  return that
+}
+
+function fromArrayBuffer (that, array, byteOffset, length) {
+  array.byteLength // this throws if `array` is not a valid ArrayBuffer
+
+  if (byteOffset < 0 || array.byteLength < byteOffset) {
+    throw new RangeError('\'offset\' is out of bounds')
+  }
+
+  if (array.byteLength < byteOffset + (length || 0)) {
+    throw new RangeError('\'length\' is out of bounds')
+  }
+
+  if (length === undefined) {
+    array = new Uint8Array(array, byteOffset)
+  } else {
+    array = new Uint8Array(array, byteOffset, length)
+  }
+
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    // Return an augmented `Uint8Array` instance, for best performance
+    that = array
+    that.__proto__ = Buffer.prototype
+  } else {
+    // Fallback: Return an object instance of the Buffer class
+    that = fromArrayLike(that, array)
+  }
+  return that
+}
+
+function fromObject (that, obj) {
+  if (Buffer.isBuffer(obj)) {
+    var len = checked(obj.length) | 0
+    that = createBuffer(that, len)
+
+    if (that.length === 0) {
+      return that
+    }
+
+    obj.copy(that, 0, 0, len)
+    return that
+  }
+
+  if (obj) {
+    if ((typeof ArrayBuffer !== 'undefined' &&
+        obj.buffer instanceof ArrayBuffer) || 'length' in obj) {
+      if (typeof obj.length !== 'number' || isnan(obj.length)) {
+        return createBuffer(that, 0)
+      }
+      return fromArrayLike(that, obj)
+    }
+
+    if (obj.type === 'Buffer' && isArray(obj.data)) {
+      return fromArrayLike(that, obj.data)
+    }
+  }
+
+  throw new TypeError('First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.')
+}
+
+function checked (length) {
+  // Note: cannot use `length < kMaxLength` here because that fails when
+  // length is NaN (which is otherwise coerced to zero.)
+  if (length >= kMaxLength()) {
+    throw new RangeError('Attempt to allocate Buffer larger than maximum ' +
+                         'size: 0x' + kMaxLength().toString(16) + ' bytes')
+  }
+  return length | 0
+}
+
+function SlowBuffer (length) {
+  if (+length != length) { // eslint-disable-line eqeqeq
+    length = 0
+  }
+  return Buffer.alloc(+length)
+}
+
+Buffer.isBuffer = function isBuffer (b) {
+  return !!(b != null && b._isBuffer)
+}
+
+Buffer.compare = function compare (a, b) {
+  if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
+    throw new TypeError('Arguments must be Buffers')
+  }
+
+  if (a === b) return 0
+
+  var x = a.length
+  var y = b.length
+
+  for (var i = 0, len = Math.min(x, y); i < len; ++i) {
+    if (a[i] !== b[i]) {
+      x = a[i]
+      y = b[i]
+      break
+    }
+  }
+
+  if (x < y) return -1
+  if (y < x) return 1
+  return 0
+}
+
+Buffer.isEncoding = function isEncoding (encoding) {
+  switch (String(encoding).toLowerCase()) {
+    case 'hex':
+    case 'utf8':
+    case 'utf-8':
+    case 'ascii':
+    case 'binary':
+    case 'base64':
+    case 'raw':
+    case 'ucs2':
+    case 'ucs-2':
+    case 'utf16le':
+    case 'utf-16le':
+      return true
+    default:
+      return false
+  }
+}
+
+Buffer.concat = function concat (list, length) {
+  if (!isArray(list)) {
+    throw new TypeError('"list" argument must be an Array of Buffers')
+  }
+
+  if (list.length === 0) {
+    return Buffer.alloc(0)
+  }
+
+  var i
+  if (length === undefined) {
+    length = 0
+    for (i = 0; i < list.length; i++) {
+      length += list[i].length
+    }
+  }
+
+  var buffer = Buffer.allocUnsafe(length)
+  var pos = 0
+  for (i = 0; i < list.length; i++) {
+    var buf = list[i]
+    if (!Buffer.isBuffer(buf)) {
+      throw new TypeError('"list" argument must be an Array of Buffers')
+    }
+    buf.copy(buffer, pos)
+    pos += buf.length
+  }
+  return buffer
+}
+
+function byteLength (string, encoding) {
+  if (Buffer.isBuffer(string)) {
+    return string.length
+  }
+  if (typeof ArrayBuffer !== 'undefined' && typeof ArrayBuffer.isView === 'function' &&
+      (ArrayBuffer.isView(string) || string instanceof ArrayBuffer)) {
+    return string.byteLength
+  }
+  if (typeof string !== 'string') {
+    string = '' + string
+  }
+
+  var len = string.length
+  if (len === 0) return 0
+
+  // Use a for loop to avoid recursion
+  var loweredCase = false
+  for (;;) {
+    switch (encoding) {
+      case 'ascii':
+      case 'binary':
+      // Deprecated
+      case 'raw':
+      case 'raws':
+        return len
+      case 'utf8':
+      case 'utf-8':
+      case undefined:
+        return utf8ToBytes(string).length
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return len * 2
+      case 'hex':
+        return len >>> 1
+      case 'base64':
+        return base64ToBytes(string).length
+      default:
+        if (loweredCase) return utf8ToBytes(string).length // assume utf8
+        encoding = ('' + encoding).toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+Buffer.byteLength = byteLength
+
+function slowToString (encoding, start, end) {
+  var loweredCase = false
+
+  // No need to verify that "this.length <= MAX_UINT32" since it's a read-only
+  // property of a typed array.
+
+  // This behaves neither like String nor Uint8Array in that we set start/end
+  // to their upper/lower bounds if the value passed is out of range.
+  // undefined is handled specially as per ECMA-262 6th Edition,
+  // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization.
+  if (start === undefined || start < 0) {
+    start = 0
+  }
+  // Return early if start > this.length. Done here to prevent potential uint32
+  // coercion fail below.
+  if (start > this.length) {
+    return ''
+  }
+
+  if (end === undefined || end > this.length) {
+    end = this.length
+  }
+
+  if (end <= 0) {
+    return ''
+  }
+
+  // Force coersion to uint32. This will also coerce falsey/NaN values to 0.
+  end >>>= 0
+  start >>>= 0
+
+  if (end <= start) {
+    return ''
+  }
+
+  if (!encoding) encoding = 'utf8'
+
+  while (true) {
+    switch (encoding) {
+      case 'hex':
+        return hexSlice(this, start, end)
+
+      case 'utf8':
+      case 'utf-8':
+        return utf8Slice(this, start, end)
+
+      case 'ascii':
+        return asciiSlice(this, start, end)
+
+      case 'binary':
+        return binarySlice(this, start, end)
+
+      case 'base64':
+        return base64Slice(this, start, end)
+
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return utf16leSlice(this, start, end)
+
+      default:
+        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+        encoding = (encoding + '').toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+
+// The property is used by `Buffer.isBuffer` and `is-buffer` (in Safari 5-7) to detect
+// Buffer instances.
+Buffer.prototype._isBuffer = true
+
+function swap (b, n, m) {
+  var i = b[n]
+  b[n] = b[m]
+  b[m] = i
+}
+
+Buffer.prototype.swap16 = function swap16 () {
+  var len = this.length
+  if (len % 2 !== 0) {
+    throw new RangeError('Buffer size must be a multiple of 16-bits')
+  }
+  for (var i = 0; i < len; i += 2) {
+    swap(this, i, i + 1)
+  }
+  return this
+}
+
+Buffer.prototype.swap32 = function swap32 () {
+  var len = this.length
+  if (len % 4 !== 0) {
+    throw new RangeError('Buffer size must be a multiple of 32-bits')
+  }
+  for (var i = 0; i < len; i += 4) {
+    swap(this, i, i + 3)
+    swap(this, i + 1, i + 2)
+  }
+  return this
+}
+
+Buffer.prototype.toString = function toString () {
+  var length = this.length | 0
+  if (length === 0) return ''
+  if (arguments.length === 0) return utf8Slice(this, 0, length)
+  return slowToString.apply(this, arguments)
+}
+
+Buffer.prototype.equals = function equals (b) {
+  if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer')
+  if (this === b) return true
+  return Buffer.compare(this, b) === 0
+}
+
+Buffer.prototype.inspect = function inspect () {
+  var str = ''
+  var max = exports.INSPECT_MAX_BYTES
+  if (this.length > 0) {
+    str = this.toString('hex', 0, max).match(/.{2}/g).join(' ')
+    if (this.length > max) str += ' ... '
+  }
+  return ''
+}
+
+Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) {
+  if (!Buffer.isBuffer(target)) {
+    throw new TypeError('Argument must be a Buffer')
+  }
+
+  if (start === undefined) {
+    start = 0
+  }
+  if (end === undefined) {
+    end = target ? target.length : 0
+  }
+  if (thisStart === undefined) {
+    thisStart = 0
+  }
+  if (thisEnd === undefined) {
+    thisEnd = this.length
+  }
+
+  if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) {
+    throw new RangeError('out of range index')
+  }
+
+  if (thisStart >= thisEnd && start >= end) {
+    return 0
+  }
+  if (thisStart >= thisEnd) {
+    return -1
+  }
+  if (start >= end) {
+    return 1
+  }
+
+  start >>>= 0
+  end >>>= 0
+  thisStart >>>= 0
+  thisEnd >>>= 0
+
+  if (this === target) return 0
+
+  var x = thisEnd - thisStart
+  var y = end - start
+  var len = Math.min(x, y)
+
+  var thisCopy = this.slice(thisStart, thisEnd)
+  var targetCopy = target.slice(start, end)
+
+  for (var i = 0; i < len; ++i) {
+    if (thisCopy[i] !== targetCopy[i]) {
+      x = thisCopy[i]
+      y = targetCopy[i]
+      break
+    }
+  }
+
+  if (x < y) return -1
+  if (y < x) return 1
+  return 0
+}
+
+function arrayIndexOf (arr, val, byteOffset, encoding) {
+  var indexSize = 1
+  var arrLength = arr.length
+  var valLength = val.length
+
+  if (encoding !== undefined) {
+    encoding = String(encoding).toLowerCase()
+    if (encoding === 'ucs2' || encoding === 'ucs-2' ||
+        encoding === 'utf16le' || encoding === 'utf-16le') {
+      if (arr.length < 2 || val.length < 2) {
+        return -1
+      }
+      indexSize = 2
+      arrLength /= 2
+      valLength /= 2
+      byteOffset /= 2
+    }
+  }
+
+  function read (buf, i) {
+    if (indexSize === 1) {
+      return buf[i]
+    } else {
+      return buf.readUInt16BE(i * indexSize)
+    }
+  }
+
+  var foundIndex = -1
+  for (var i = 0; byteOffset + i < arrLength; i++) {
+    if (read(arr, byteOffset + i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) {
+      if (foundIndex === -1) foundIndex = i
+      if (i - foundIndex + 1 === valLength) return (byteOffset + foundIndex) * indexSize
+    } else {
+      if (foundIndex !== -1) i -= i - foundIndex
+      foundIndex = -1
+    }
+  }
+  return -1
+}
+
+Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) {
+  if (typeof byteOffset === 'string') {
+    encoding = byteOffset
+    byteOffset = 0
+  } else if (byteOffset > 0x7fffffff) {
+    byteOffset = 0x7fffffff
+  } else if (byteOffset < -0x80000000) {
+    byteOffset = -0x80000000
+  }
+  byteOffset >>= 0
+
+  if (this.length === 0) return -1
+  if (byteOffset >= this.length) return -1
+
+  // Negative offsets start from the end of the buffer
+  if (byteOffset < 0) byteOffset = Math.max(this.length + byteOffset, 0)
+
+  if (typeof val === 'string') {
+    val = Buffer.from(val, encoding)
+  }
+
+  if (Buffer.isBuffer(val)) {
+    // special case: looking for empty string/buffer always fails
+    if (val.length === 0) {
+      return -1
+    }
+    return arrayIndexOf(this, val, byteOffset, encoding)
+  }
+  if (typeof val === 'number') {
+    if (Buffer.TYPED_ARRAY_SUPPORT && Uint8Array.prototype.indexOf === 'function') {
+      return Uint8Array.prototype.indexOf.call(this, val, byteOffset)
+    }
+    return arrayIndexOf(this, [ val ], byteOffset, encoding)
+  }
+
+  throw new TypeError('val must be string, number or Buffer')
+}
+
+Buffer.prototype.includes = function includes (val, byteOffset, encoding) {
+  return this.indexOf(val, byteOffset, encoding) !== -1
+}
+
+function hexWrite (buf, string, offset, length) {
+  offset = Number(offset) || 0
+  var remaining = buf.length - offset
+  if (!length) {
+    length = remaining
+  } else {
+    length = Number(length)
+    if (length > remaining) {
+      length = remaining
+    }
+  }
+
+  // must be an even number of digits
+  var strLen = string.length
+  if (strLen % 2 !== 0) throw new Error('Invalid hex string')
+
+  if (length > strLen / 2) {
+    length = strLen / 2
+  }
+  for (var i = 0; i < length; i++) {
+    var parsed = parseInt(string.substr(i * 2, 2), 16)
+    if (isNaN(parsed)) return i
+    buf[offset + i] = parsed
+  }
+  return i
+}
+
+function utf8Write (buf, string, offset, length) {
+  return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length)
+}
+
+function asciiWrite (buf, string, offset, length) {
+  return blitBuffer(asciiToBytes(string), buf, offset, length)
+}
+
+function binaryWrite (buf, string, offset, length) {
+  return asciiWrite(buf, string, offset, length)
+}
+
+function base64Write (buf, string, offset, length) {
+  return blitBuffer(base64ToBytes(string), buf, offset, length)
+}
+
+function ucs2Write (buf, string, offset, length) {
+  return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length)
+}
+
+Buffer.prototype.write = function write (string, offset, length, encoding) {
+  // Buffer#write(string)
+  if (offset === undefined) {
+    encoding = 'utf8'
+    length = this.length
+    offset = 0
+  // Buffer#write(string, encoding)
+  } else if (length === undefined && typeof offset === 'string') {
+    encoding = offset
+    length = this.length
+    offset = 0
+  // Buffer#write(string, offset[, length][, encoding])
+  } else if (isFinite(offset)) {
+    offset = offset | 0
+    if (isFinite(length)) {
+      length = length | 0
+      if (encoding === undefined) encoding = 'utf8'
+    } else {
+      encoding = length
+      length = undefined
+    }
+  // legacy write(string, encoding, offset, length) - remove in v0.13
+  } else {
+    throw new Error(
+      'Buffer.write(string, encoding, offset[, length]) is no longer supported'
+    )
+  }
+
+  var remaining = this.length - offset
+  if (length === undefined || length > remaining) length = remaining
+
+  if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) {
+    throw new RangeError('Attempt to write outside buffer bounds')
+  }
+
+  if (!encoding) encoding = 'utf8'
+
+  var loweredCase = false
+  for (;;) {
+    switch (encoding) {
+      case 'hex':
+        return hexWrite(this, string, offset, length)
+
+      case 'utf8':
+      case 'utf-8':
+        return utf8Write(this, string, offset, length)
+
+      case 'ascii':
+        return asciiWrite(this, string, offset, length)
+
+      case 'binary':
+        return binaryWrite(this, string, offset, length)
+
+      case 'base64':
+        // Warning: maxLength not taken into account in base64Write
+        return base64Write(this, string, offset, length)
+
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return ucs2Write(this, string, offset, length)
+
+      default:
+        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+        encoding = ('' + encoding).toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+
+Buffer.prototype.toJSON = function toJSON () {
+  return {
+    type: 'Buffer',
+    data: Array.prototype.slice.call(this._arr || this, 0)
+  }
+}
+
+function base64Slice (buf, start, end) {
+  if (start === 0 && end === buf.length) {
+    return base64.fromByteArray(buf)
+  } else {
+    return base64.fromByteArray(buf.slice(start, end))
+  }
+}
+
+function utf8Slice (buf, start, end) {
+  end = Math.min(buf.length, end)
+  var res = []
+
+  var i = start
+  while (i < end) {
+    var firstByte = buf[i]
+    var codePoint = null
+    var bytesPerSequence = (firstByte > 0xEF) ? 4
+      : (firstByte > 0xDF) ? 3
+      : (firstByte > 0xBF) ? 2
+      : 1
+
+    if (i + bytesPerSequence <= end) {
+      var secondByte, thirdByte, fourthByte, tempCodePoint
+
+      switch (bytesPerSequence) {
+        case 1:
+          if (firstByte < 0x80) {
+            codePoint = firstByte
+          }
+          break
+        case 2:
+          secondByte = buf[i + 1]
+          if ((secondByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F)
+            if (tempCodePoint > 0x7F) {
+              codePoint = tempCodePoint
+            }
+          }
+          break
+        case 3:
+          secondByte = buf[i + 1]
+          thirdByte = buf[i + 2]
+          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F)
+            if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) {
+              codePoint = tempCodePoint
+            }
+          }
+          break
+        case 4:
+          secondByte = buf[i + 1]
+          thirdByte = buf[i + 2]
+          fourthByte = buf[i + 3]
+          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F)
+            if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) {
+              codePoint = tempCodePoint
+            }
+          }
+      }
+    }
+
+    if (codePoint === null) {
+      // we did not generate a valid codePoint so insert a
+      // replacement char (U+FFFD) and advance only 1 byte
+      codePoint = 0xFFFD
+      bytesPerSequence = 1
+    } else if (codePoint > 0xFFFF) {
+      // encode to utf16 (surrogate pair dance)
+      codePoint -= 0x10000
+      res.push(codePoint >>> 10 & 0x3FF | 0xD800)
+      codePoint = 0xDC00 | codePoint & 0x3FF
+    }
+
+    res.push(codePoint)
+    i += bytesPerSequence
+  }
+
+  return decodeCodePointsArray(res)
+}
+
+// Based on http://stackoverflow.com/a/22747272/680742, the browser with
+// the lowest limit is Chrome, with 0x10000 args.
+// We go 1 magnitude less, for safety
+var MAX_ARGUMENTS_LENGTH = 0x1000
+
+function decodeCodePointsArray (codePoints) {
+  var len = codePoints.length
+  if (len <= MAX_ARGUMENTS_LENGTH) {
+    return String.fromCharCode.apply(String, codePoints) // avoid extra slice()
+  }
+
+  // Decode in chunks to avoid "call stack size exceeded".
+  var res = ''
+  var i = 0
+  while (i < len) {
+    res += String.fromCharCode.apply(
+      String,
+      codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH)
+    )
+  }
+  return res
+}
+
+function asciiSlice (buf, start, end) {
+  var ret = ''
+  end = Math.min(buf.length, end)
+
+  for (var i = start; i < end; i++) {
+    ret += String.fromCharCode(buf[i] & 0x7F)
+  }
+  return ret
+}
+
+function binarySlice (buf, start, end) {
+  var ret = ''
+  end = Math.min(buf.length, end)
+
+  for (var i = start; i < end; i++) {
+    ret += String.fromCharCode(buf[i])
+  }
+  return ret
+}
+
+function hexSlice (buf, start, end) {
+  var len = buf.length
+
+  if (!start || start < 0) start = 0
+  if (!end || end < 0 || end > len) end = len
+
+  var out = ''
+  for (var i = start; i < end; i++) {
+    out += toHex(buf[i])
+  }
+  return out
+}
+
+function utf16leSlice (buf, start, end) {
+  var bytes = buf.slice(start, end)
+  var res = ''
+  for (var i = 0; i < bytes.length; i += 2) {
+    res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256)
+  }
+  return res
+}
+
+Buffer.prototype.slice = function slice (start, end) {
+  var len = this.length
+  start = ~~start
+  end = end === undefined ? len : ~~end
+
+  if (start < 0) {
+    start += len
+    if (start < 0) start = 0
+  } else if (start > len) {
+    start = len
+  }
+
+  if (end < 0) {
+    end += len
+    if (end < 0) end = 0
+  } else if (end > len) {
+    end = len
+  }
+
+  if (end < start) end = start
+
+  var newBuf
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    newBuf = this.subarray(start, end)
+    newBuf.__proto__ = Buffer.prototype
+  } else {
+    var sliceLen = end - start
+    newBuf = new Buffer(sliceLen, undefined)
+    for (var i = 0; i < sliceLen; i++) {
+      newBuf[i] = this[i + start]
+    }
+  }
+
+  return newBuf
+}
+
+/*
+ * Need to make sure that buffer isn't trying to write out of bounds.
+ */
+function checkOffset (offset, ext, length) {
+  if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint')
+  if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length')
+}
+
+Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) {
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var val = this[offset]
+  var mul = 1
+  var i = 0
+  while (++i < byteLength && (mul *= 0x100)) {
+    val += this[offset + i] * mul
+  }
+
+  return val
+}
+
+Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) {
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) {
+    checkOffset(offset, byteLength, this.length)
+  }
+
+  var val = this[offset + --byteLength]
+  var mul = 1
+  while (byteLength > 0 && (mul *= 0x100)) {
+    val += this[offset + --byteLength] * mul
+  }
+
+  return val
+}
+
+Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 1, this.length)
+  return this[offset]
+}
+
+Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  return this[offset] | (this[offset + 1] << 8)
+}
+
+Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  return (this[offset] << 8) | this[offset + 1]
+}
+
+Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return ((this[offset]) |
+      (this[offset + 1] << 8) |
+      (this[offset + 2] << 16)) +
+      (this[offset + 3] * 0x1000000)
+}
+
+Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset] * 0x1000000) +
+    ((this[offset + 1] << 16) |
+    (this[offset + 2] << 8) |
+    this[offset + 3])
+}
+
+Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) {
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var val = this[offset]
+  var mul = 1
+  var i = 0
+  while (++i < byteLength && (mul *= 0x100)) {
+    val += this[offset + i] * mul
+  }
+  mul *= 0x80
+
+  if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+  return val
+}
+
+Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) {
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var i = byteLength
+  var mul = 1
+  var val = this[offset + --i]
+  while (i > 0 && (mul *= 0x100)) {
+    val += this[offset + --i] * mul
+  }
+  mul *= 0x80
+
+  if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+  return val
+}
+
+Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 1, this.length)
+  if (!(this[offset] & 0x80)) return (this[offset])
+  return ((0xff - this[offset] + 1) * -1)
+}
+
+Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  var val = this[offset] | (this[offset + 1] << 8)
+  return (val & 0x8000) ? val | 0xFFFF0000 : val
+}
+
+Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  var val = this[offset + 1] | (this[offset] << 8)
+  return (val & 0x8000) ? val | 0xFFFF0000 : val
+}
+
+Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset]) |
+    (this[offset + 1] << 8) |
+    (this[offset + 2] << 16) |
+    (this[offset + 3] << 24)
+}
+
+Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset] << 24) |
+    (this[offset + 1] << 16) |
+    (this[offset + 2] << 8) |
+    (this[offset + 3])
+}
+
+Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+  return ieee754.read(this, offset, true, 23, 4)
+}
+
+Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 4, this.length)
+  return ieee754.read(this, offset, false, 23, 4)
+}
+
+Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 8, this.length)
+  return ieee754.read(this, offset, true, 52, 8)
+}
+
+Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) {
+  if (!noAssert) checkOffset(offset, 8, this.length)
+  return ieee754.read(this, offset, false, 52, 8)
+}
+
+function checkInt (buf, value, offset, ext, max, min) {
+  if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance')
+  if (value > max || value < min) throw new RangeError('"value" argument is out of bounds')
+  if (offset + ext > buf.length) throw new RangeError('Index out of range')
+}
+
+Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) {
+    var maxBytes = Math.pow(2, 8 * byteLength) - 1
+    checkInt(this, value, offset, byteLength, maxBytes, 0)
+  }
+
+  var mul = 1
+  var i = 0
+  this[offset] = value & 0xFF
+  while (++i < byteLength && (mul *= 0x100)) {
+    this[offset + i] = (value / mul) & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset | 0
+  byteLength = byteLength | 0
+  if (!noAssert) {
+    var maxBytes = Math.pow(2, 8 * byteLength) - 1
+    checkInt(this, value, offset, byteLength, maxBytes, 0)
+  }
+
+  var i = byteLength - 1
+  var mul = 1
+  this[offset + i] = value & 0xFF
+  while (--i >= 0 && (mul *= 0x100)) {
+    this[offset + i] = (value / mul) & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0)
+  if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
+  this[offset] = (value & 0xff)
+  return offset + 1
+}
+
+function objectWriteUInt16 (buf, value, offset, littleEndian) {
+  if (value < 0) value = 0xffff + value + 1
+  for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; i++) {
+    buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>>
+      (littleEndian ? i : 1 - i) * 8
+  }
+}
+
+Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value & 0xff)
+    this[offset + 1] = (value >>> 8)
+  } else {
+    objectWriteUInt16(this, value, offset, true)
+  }
+  return offset + 2
+}
+
+Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value >>> 8)
+    this[offset + 1] = (value & 0xff)
+  } else {
+    objectWriteUInt16(this, value, offset, false)
+  }
+  return offset + 2
+}
+
+function objectWriteUInt32 (buf, value, offset, littleEndian) {
+  if (value < 0) value = 0xffffffff + value + 1
+  for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; i++) {
+    buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff
+  }
+}
+
+Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset + 3] = (value >>> 24)
+    this[offset + 2] = (value >>> 16)
+    this[offset + 1] = (value >>> 8)
+    this[offset] = (value & 0xff)
+  } else {
+    objectWriteUInt32(this, value, offset, true)
+  }
+  return offset + 4
+}
+
+Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value >>> 24)
+    this[offset + 1] = (value >>> 16)
+    this[offset + 2] = (value >>> 8)
+    this[offset + 3] = (value & 0xff)
+  } else {
+    objectWriteUInt32(this, value, offset, false)
+  }
+  return offset + 4
+}
+
+Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) {
+    var limit = Math.pow(2, 8 * byteLength - 1)
+
+    checkInt(this, value, offset, byteLength, limit - 1, -limit)
+  }
+
+  var i = 0
+  var mul = 1
+  var sub = 0
+  this[offset] = value & 0xFF
+  while (++i < byteLength && (mul *= 0x100)) {
+    if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) {
+      sub = 1
+    }
+    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) {
+    var limit = Math.pow(2, 8 * byteLength - 1)
+
+    checkInt(this, value, offset, byteLength, limit - 1, -limit)
+  }
+
+  var i = byteLength - 1
+  var mul = 1
+  var sub = 0
+  this[offset + i] = value & 0xFF
+  while (--i >= 0 && (mul *= 0x100)) {
+    if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) {
+      sub = 1
+    }
+    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80)
+  if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value)
+  if (value < 0) value = 0xff + value + 1
+  this[offset] = (value & 0xff)
+  return offset + 1
+}
+
+Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value & 0xff)
+    this[offset + 1] = (value >>> 8)
+  } else {
+    objectWriteUInt16(this, value, offset, true)
+  }
+  return offset + 2
+}
+
+Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value >>> 8)
+    this[offset + 1] = (value & 0xff)
+  } else {
+    objectWriteUInt16(this, value, offset, false)
+  }
+  return offset + 2
+}
+
+Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value & 0xff)
+    this[offset + 1] = (value >>> 8)
+    this[offset + 2] = (value >>> 16)
+    this[offset + 3] = (value >>> 24)
+  } else {
+    objectWriteUInt32(this, value, offset, true)
+  }
+  return offset + 4
+}
+
+Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) {
+  value = +value
+  offset = offset | 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+  if (value < 0) value = 0xffffffff + value + 1
+  if (Buffer.TYPED_ARRAY_SUPPORT) {
+    this[offset] = (value >>> 24)
+    this[offset + 1] = (value >>> 16)
+    this[offset + 2] = (value >>> 8)
+    this[offset + 3] = (value & 0xff)
+  } else {
+    objectWriteUInt32(this, value, offset, false)
+  }
+  return offset + 4
+}
+
+function checkIEEE754 (buf, value, offset, ext, max, min) {
+  if (offset + ext > buf.length) throw new RangeError('Index out of range')
+  if (offset < 0) throw new RangeError('Index out of range')
+}
+
+function writeFloat (buf, value, offset, littleEndian, noAssert) {
+  if (!noAssert) {
+    checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38)
+  }
+  ieee754.write(buf, value, offset, littleEndian, 23, 4)
+  return offset + 4
+}
+
+Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) {
+  return writeFloat(this, value, offset, true, noAssert)
+}
+
+Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) {
+  return writeFloat(this, value, offset, false, noAssert)
+}
+
+function writeDouble (buf, value, offset, littleEndian, noAssert) {
+  if (!noAssert) {
+    checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308)
+  }
+  ieee754.write(buf, value, offset, littleEndian, 52, 8)
+  return offset + 8
+}
+
+Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) {
+  return writeDouble(this, value, offset, true, noAssert)
+}
+
+Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) {
+  return writeDouble(this, value, offset, false, noAssert)
+}
+
+// copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length)
+Buffer.prototype.copy = function copy (target, targetStart, start, end) {
+  if (!start) start = 0
+  if (!end && end !== 0) end = this.length
+  if (targetStart >= target.length) targetStart = target.length
+  if (!targetStart) targetStart = 0
+  if (end > 0 && end < start) end = start
+
+  // Copy 0 bytes; we're done
+  if (end === start) return 0
+  if (target.length === 0 || this.length === 0) return 0
+
+  // Fatal error conditions
+  if (targetStart < 0) {
+    throw new RangeError('targetStart out of bounds')
+  }
+  if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds')
+  if (end < 0) throw new RangeError('sourceEnd out of bounds')
+
+  // Are we oob?
+  if (end > this.length) end = this.length
+  if (target.length - targetStart < end - start) {
+    end = target.length - targetStart + start
+  }
+
+  var len = end - start
+  var i
+
+  if (this === target && start < targetStart && targetStart < end) {
+    // descending copy from end
+    for (i = len - 1; i >= 0; i--) {
+      target[i + targetStart] = this[i + start]
+    }
+  } else if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) {
+    // ascending copy from start
+    for (i = 0; i < len; i++) {
+      target[i + targetStart] = this[i + start]
+    }
+  } else {
+    Uint8Array.prototype.set.call(
+      target,
+      this.subarray(start, start + len),
+      targetStart
+    )
+  }
+
+  return len
+}
+
+// Usage:
+//    buffer.fill(number[, offset[, end]])
+//    buffer.fill(buffer[, offset[, end]])
+//    buffer.fill(string[, offset[, end]][, encoding])
+Buffer.prototype.fill = function fill (val, start, end, encoding) {
+  // Handle string cases:
+  if (typeof val === 'string') {
+    if (typeof start === 'string') {
+      encoding = start
+      start = 0
+      end = this.length
+    } else if (typeof end === 'string') {
+      encoding = end
+      end = this.length
+    }
+    if (val.length === 1) {
+      var code = val.charCodeAt(0)
+      if (code < 256) {
+        val = code
+      }
+    }
+    if (encoding !== undefined && typeof encoding !== 'string') {
+      throw new TypeError('encoding must be a string')
+    }
+    if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) {
+      throw new TypeError('Unknown encoding: ' + encoding)
+    }
+  } else if (typeof val === 'number') {
+    val = val & 255
+  }
+
+  // Invalid ranges are not set to a default, so can range check early.
+  if (start < 0 || this.length < start || this.length < end) {
+    throw new RangeError('Out of range index')
+  }
+
+  if (end <= start) {
+    return this
+  }
+
+  start = start >>> 0
+  end = end === undefined ? this.length : end >>> 0
+
+  if (!val) val = 0
+
+  var i
+  if (typeof val === 'number') {
+    for (i = start; i < end; i++) {
+      this[i] = val
+    }
+  } else {
+    var bytes = Buffer.isBuffer(val)
+      ? val
+      : utf8ToBytes(new Buffer(val, encoding).toString())
+    var len = bytes.length
+    for (i = 0; i < end - start; i++) {
+      this[i + start] = bytes[i % len]
+    }
+  }
+
+  return this
+}
+
+// HELPER FUNCTIONS
+// ================
+
+var INVALID_BASE64_RE = /[^+\/0-9A-Za-z-_]/g
+
+function base64clean (str) {
+  // Node strips out invalid characters like \n and \t from the string, base64-js does not
+  str = stringtrim(str).replace(INVALID_BASE64_RE, '')
+  // Node converts strings with length < 2 to ''
+  if (str.length < 2) return ''
+  // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not
+  while (str.length % 4 !== 0) {
+    str = str + '='
+  }
+  return str
+}
+
+function stringtrim (str) {
+  if (str.trim) return str.trim()
+  return str.replace(/^\s+|\s+$/g, '')
+}
+
+function toHex (n) {
+  if (n < 16) return '0' + n.toString(16)
+  return n.toString(16)
+}
+
+function utf8ToBytes (string, units) {
+  units = units || Infinity
+  var codePoint
+  var length = string.length
+  var leadSurrogate = null
+  var bytes = []
+
+  for (var i = 0; i < length; i++) {
+    codePoint = string.charCodeAt(i)
+
+    // is surrogate component
+    if (codePoint > 0xD7FF && codePoint < 0xE000) {
+      // last char was a lead
+      if (!leadSurrogate) {
+        // no lead yet
+        if (codePoint > 0xDBFF) {
+          // unexpected trail
+          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+          continue
+        } else if (i + 1 === length) {
+          // unpaired lead
+          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+          continue
+        }
+
+        // valid lead
+        leadSurrogate = codePoint
+
+        continue
+      }
+
+      // 2 leads in a row
+      if (codePoint < 0xDC00) {
+        if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+        leadSurrogate = codePoint
+        continue
+      }
+
+      // valid surrogate pair
+      codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000
+    } else if (leadSurrogate) {
+      // valid bmp char, but last char was a lead
+      if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+    }
+
+    leadSurrogate = null
+
+    // encode utf8
+    if (codePoint < 0x80) {
+      if ((units -= 1) < 0) break
+      bytes.push(codePoint)
+    } else if (codePoint < 0x800) {
+      if ((units -= 2) < 0) break
+      bytes.push(
+        codePoint >> 0x6 | 0xC0,
+        codePoint & 0x3F | 0x80
+      )
+    } else if (codePoint < 0x10000) {
+      if ((units -= 3) < 0) break
+      bytes.push(
+        codePoint >> 0xC | 0xE0,
+        codePoint >> 0x6 & 0x3F | 0x80,
+        codePoint & 0x3F | 0x80
+      )
+    } else if (codePoint < 0x110000) {
+      if ((units -= 4) < 0) break
+      bytes.push(
+        codePoint >> 0x12 | 0xF0,
+        codePoint >> 0xC & 0x3F | 0x80,
+        codePoint >> 0x6 & 0x3F | 0x80,
+        codePoint & 0x3F | 0x80
+      )
+    } else {
+      throw new Error('Invalid code point')
+    }
+  }
+
+  return bytes
+}
+
+function asciiToBytes (str) {
+  var byteArray = []
+  for (var i = 0; i < str.length; i++) {
+    // Node's code seems to be doing this and not & 0x7F..
+    byteArray.push(str.charCodeAt(i) & 0xFF)
+  }
+  return byteArray
+}
+
+function utf16leToBytes (str, units) {
+  var c, hi, lo
+  var byteArray = []
+  for (var i = 0; i < str.length; i++) {
+    if ((units -= 2) < 0) break
+
+    c = str.charCodeAt(i)
+    hi = c >> 8
+    lo = c % 256
+    byteArray.push(lo)
+    byteArray.push(hi)
+  }
+
+  return byteArray
+}
+
+function base64ToBytes (str) {
+  return base64.toByteArray(base64clean(str))
+}
+
+function blitBuffer (src, dst, offset, length) {
+  for (var i = 0; i < length; i++) {
+    if ((i + offset >= dst.length) || (i >= src.length)) break
+    dst[i + offset] = src[i]
+  }
+  return i
+}
+
+function isnan (val) {
+  return val !== val // eslint-disable-line no-self-compare
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"base64-js":40,"ieee754":52,"isarray":46}],46:[function(require,module,exports){
+var toString = {}.toString;
+
+module.exports = Array.isArray || function (arr) {
+  return toString.call(arr) == '[object Array]';
+};
+
+},{}],47:[function(require,module,exports){
+(function (Buffer){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+
+function isArray(arg) {
+  if (Array.isArray) {
+    return Array.isArray(arg);
+  }
+  return objectToString(arg) === '[object Array]';
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+  return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+  return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+  return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+  return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+  return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+  return objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+  return objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+  return (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+  return arg === null ||
+         typeof arg === 'boolean' ||
+         typeof arg === 'number' ||
+         typeof arg === 'string' ||
+         typeof arg === 'symbol' ||  // ES6 symbol
+         typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = Buffer.isBuffer;
+
+function objectToString(o) {
+  return Object.prototype.toString.call(o);
+}
+
+}).call(this,{"isBuffer":require("../../is-buffer/index.js")})
+},{"../../is-buffer/index.js":54}],48:[function(require,module,exports){
+/* See LICENSE file for terms of use */
+
+/*
+ * Text diff implementation.
+ *
+ * This library supports the following APIS:
+ * JsDiff.diffChars: Character by character diff
+ * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+ * JsDiff.diffLines: Line based diff
+ *
+ * JsDiff.diffCss: Diff targeted at CSS content
+ *
+ * These methods are based on the implementation proposed in
+ * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+ * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+ */
+(function(global, undefined) {
+  var objectPrototypeToString = Object.prototype.toString;
+
+  /*istanbul ignore next*/
+  function map(arr, mapper, that) {
+    if (Array.prototype.map) {
+      return Array.prototype.map.call(arr, mapper, that);
+    }
+
+    var other = new Array(arr.length);
+
+    for (var i = 0, n = arr.length; i < n; i++) {
+      other[i] = mapper.call(that, arr[i], i, arr);
+    }
+    return other;
+  }
+  function clonePath(path) {
+    return { newPos: path.newPos, components: path.components.slice(0) };
+  }
+  function removeEmpty(array) {
+    var ret = [];
+    for (var i = 0; i < array.length; i++) {
+      if (array[i]) {
+        ret.push(array[i]);
+      }
+    }
+    return ret;
+  }
+  function escapeHTML(s) {
+    var n = s;
+    n = n.replace(/&/g, '&');
+    n = n.replace(//g, '>');
+    n = n.replace(/"/g, '"');
+
+    return n;
+  }
+
+  // This function handles the presence of circular references by bailing out when encountering an
+  // object that is already on the "stack" of items being processed.
+  function canonicalize(obj, stack, replacementStack) {
+    stack = stack || [];
+    replacementStack = replacementStack || [];
+
+    var i;
+
+    for (i = 0; i < stack.length; i += 1) {
+      if (stack[i] === obj) {
+        return replacementStack[i];
+      }
+    }
+
+    var canonicalizedObj;
+
+    if ('[object Array]' === objectPrototypeToString.call(obj)) {
+      stack.push(obj);
+      canonicalizedObj = new Array(obj.length);
+      replacementStack.push(canonicalizedObj);
+      for (i = 0; i < obj.length; i += 1) {
+        canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack);
+      }
+      stack.pop();
+      replacementStack.pop();
+    } else if (typeof obj === 'object' && obj !== null) {
+      stack.push(obj);
+      canonicalizedObj = {};
+      replacementStack.push(canonicalizedObj);
+      var sortedKeys = [],
+          key;
+      for (key in obj) {
+        sortedKeys.push(key);
+      }
+      sortedKeys.sort();
+      for (i = 0; i < sortedKeys.length; i += 1) {
+        key = sortedKeys[i];
+        canonicalizedObj[key] = canonicalize(obj[key], stack, replacementStack);
+      }
+      stack.pop();
+      replacementStack.pop();
+    } else {
+      canonicalizedObj = obj;
+    }
+    return canonicalizedObj;
+  }
+
+  function buildValues(components, newString, oldString, useLongestToken) {
+    var componentPos = 0,
+        componentLen = components.length,
+        newPos = 0,
+        oldPos = 0;
+
+    for (; componentPos < componentLen; componentPos++) {
+      var component = components[componentPos];
+      if (!component.removed) {
+        if (!component.added && useLongestToken) {
+          var value = newString.slice(newPos, newPos + component.count);
+          value = map(value, function(value, i) {
+            var oldValue = oldString[oldPos + i];
+            return oldValue.length > value.length ? oldValue : value;
+          });
+
+          component.value = value.join('');
+        } else {
+          component.value = newString.slice(newPos, newPos + component.count).join('');
+        }
+        newPos += component.count;
+
+        // Common case
+        if (!component.added) {
+          oldPos += component.count;
+        }
+      } else {
+        component.value = oldString.slice(oldPos, oldPos + component.count).join('');
+        oldPos += component.count;
+
+        // Reverse add and remove so removes are output first to match common convention
+        // The diffing algorithm is tied to add then remove output and this is the simplest
+        // route to get the desired output with minimal overhead.
+        if (componentPos && components[componentPos - 1].added) {
+          var tmp = components[componentPos - 1];
+          components[componentPos - 1] = components[componentPos];
+          components[componentPos] = tmp;
+        }
+      }
+    }
+
+    return components;
+  }
+
+  function Diff(ignoreWhitespace) {
+    this.ignoreWhitespace = ignoreWhitespace;
+  }
+  Diff.prototype = {
+    diff: function(oldString, newString, callback) {
+      var self = this;
+
+      function done(value) {
+        if (callback) {
+          setTimeout(function() { callback(undefined, value); }, 0);
+          return true;
+        } else {
+          return value;
+        }
+      }
+
+      // Handle the identity case (this is due to unrolling editLength == 0
+      if (newString === oldString) {
+        return done([{ value: newString }]);
+      }
+      if (!newString) {
+        return done([{ value: oldString, removed: true }]);
+      }
+      if (!oldString) {
+        return done([{ value: newString, added: true }]);
+      }
+
+      newString = this.tokenize(newString);
+      oldString = this.tokenize(oldString);
+
+      var newLen = newString.length, oldLen = oldString.length;
+      var editLength = 1;
+      var maxEditLength = newLen + oldLen;
+      var bestPath = [{ newPos: -1, components: [] }];
+
+      // Seed editLength = 0, i.e. the content starts with the same values
+      var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+      if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+        // Identity per the equality and tokenizer
+        return done([{value: newString.join('')}]);
+      }
+
+      // Main worker method. checks all permutations of a given edit length for acceptance.
+      function execEditLength() {
+        for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+          var basePath;
+          var addPath = bestPath[diagonalPath - 1],
+              removePath = bestPath[diagonalPath + 1],
+              oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+          if (addPath) {
+            // No one else is going to attempt to use this value, clear it
+            bestPath[diagonalPath - 1] = undefined;
+          }
+
+          var canAdd = addPath && addPath.newPos + 1 < newLen,
+              canRemove = removePath && 0 <= oldPos && oldPos < oldLen;
+          if (!canAdd && !canRemove) {
+            // If this path is a terminal then prune
+            bestPath[diagonalPath] = undefined;
+            continue;
+          }
+
+          // Select the diagonal that we want to branch from. We select the prior
+          // path whose position in the new string is the farthest from the origin
+          // and does not pass the bounds of the diff graph
+          if (!canAdd || (canRemove && addPath.newPos < removePath.newPos)) {
+            basePath = clonePath(removePath);
+            self.pushComponent(basePath.components, undefined, true);
+          } else {
+            basePath = addPath;   // No need to clone, we've pulled it from the list
+            basePath.newPos++;
+            self.pushComponent(basePath.components, true, undefined);
+          }
+
+          oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+          // If we have hit the end of both strings, then we are done
+          if (basePath.newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+            return done(buildValues(basePath.components, newString, oldString, self.useLongestToken));
+          } else {
+            // Otherwise track this path as a potential candidate and continue.
+            bestPath[diagonalPath] = basePath;
+          }
+        }
+
+        editLength++;
+      }
+
+      // Performs the length of edit iteration. Is a bit fugly as this has to support the
+      // sync and async mode which is never fun. Loops over execEditLength until a value
+      // is produced.
+      if (callback) {
+        (function exec() {
+          setTimeout(function() {
+            // This should not happen, but we want to be safe.
+            /*istanbul ignore next */
+            if (editLength > maxEditLength) {
+              return callback();
+            }
+
+            if (!execEditLength()) {
+              exec();
+            }
+          }, 0);
+        }());
+      } else {
+        while (editLength <= maxEditLength) {
+          var ret = execEditLength();
+          if (ret) {
+            return ret;
+          }
+        }
+      }
+    },
+
+    pushComponent: function(components, added, removed) {
+      var last = components[components.length - 1];
+      if (last && last.added === added && last.removed === removed) {
+        // We need to clone here as the component clone operation is just
+        // as shallow array clone
+        components[components.length - 1] = {count: last.count + 1, added: added, removed: removed };
+      } else {
+        components.push({count: 1, added: added, removed: removed });
+      }
+    },
+    extractCommon: function(basePath, newString, oldString, diagonalPath) {
+      var newLen = newString.length,
+          oldLen = oldString.length,
+          newPos = basePath.newPos,
+          oldPos = newPos - diagonalPath,
+
+          commonCount = 0;
+      while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+        newPos++;
+        oldPos++;
+        commonCount++;
+      }
+
+      if (commonCount) {
+        basePath.components.push({count: commonCount});
+      }
+
+      basePath.newPos = newPos;
+      return oldPos;
+    },
+
+    equals: function(left, right) {
+      var reWhitespace = /\S/;
+      return left === right || (this.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right));
+    },
+    tokenize: function(value) {
+      return value.split('');
+    }
+  };
+
+  var CharDiff = new Diff();
+
+  var WordDiff = new Diff(true);
+  var WordWithSpaceDiff = new Diff();
+  WordDiff.tokenize = WordWithSpaceDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/(\s+|\b)/));
+  };
+
+  var CssDiff = new Diff(true);
+  CssDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/([{}:;,]|\s+)/));
+  };
+
+  var LineDiff = new Diff();
+
+  var TrimmedLineDiff = new Diff();
+  TrimmedLineDiff.ignoreTrim = true;
+
+  LineDiff.tokenize = TrimmedLineDiff.tokenize = function(value) {
+    var retLines = [],
+        lines = value.split(/^/m);
+    for (var i = 0; i < lines.length; i++) {
+      var line = lines[i],
+          lastLine = lines[i - 1],
+          lastLineLastChar = lastLine && lastLine[lastLine.length - 1];
+
+      // Merge lines that may contain windows new lines
+      if (line === '\n' && lastLineLastChar === '\r') {
+          retLines[retLines.length - 1] = retLines[retLines.length - 1].slice(0, -1) + '\r\n';
+      } else {
+        if (this.ignoreTrim) {
+          line = line.trim();
+          // add a newline unless this is the last line.
+          if (i < lines.length - 1) {
+            line += '\n';
+          }
+        }
+        retLines.push(line);
+      }
+    }
+
+    return retLines;
+  };
+
+  var PatchDiff = new Diff();
+  PatchDiff.tokenize = function(value) {
+    var ret = [],
+        linesAndNewlines = value.split(/(\n|\r\n)/);
+
+    // Ignore the final empty token that occurs if the string ends with a new line
+    if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+      linesAndNewlines.pop();
+    }
+
+    // Merge the content and line separators into single tokens
+    for (var i = 0; i < linesAndNewlines.length; i++) {
+      var line = linesAndNewlines[i];
+
+      if (i % 2) {
+        ret[ret.length - 1] += line;
+      } else {
+        ret.push(line);
+      }
+    }
+    return ret;
+  };
+
+  var SentenceDiff = new Diff();
+  SentenceDiff.tokenize = function(value) {
+    return removeEmpty(value.split(/(\S.+?[.!?])(?=\s+|$)/));
+  };
+
+  var JsonDiff = new Diff();
+  // Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+  // dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+  JsonDiff.useLongestToken = true;
+  JsonDiff.tokenize = LineDiff.tokenize;
+  JsonDiff.equals = function(left, right) {
+    return LineDiff.equals(left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'));
+  };
+
+  var JsDiff = {
+    Diff: Diff,
+
+    diffChars: function(oldStr, newStr, callback) { return CharDiff.diff(oldStr, newStr, callback); },
+    diffWords: function(oldStr, newStr, callback) { return WordDiff.diff(oldStr, newStr, callback); },
+    diffWordsWithSpace: function(oldStr, newStr, callback) { return WordWithSpaceDiff.diff(oldStr, newStr, callback); },
+    diffLines: function(oldStr, newStr, callback) { return LineDiff.diff(oldStr, newStr, callback); },
+    diffTrimmedLines: function(oldStr, newStr, callback) { return TrimmedLineDiff.diff(oldStr, newStr, callback); },
+
+    diffSentences: function(oldStr, newStr, callback) { return SentenceDiff.diff(oldStr, newStr, callback); },
+
+    diffCss: function(oldStr, newStr, callback) { return CssDiff.diff(oldStr, newStr, callback); },
+    diffJson: function(oldObj, newObj, callback) {
+      return JsonDiff.diff(
+        typeof oldObj === 'string' ? oldObj : JSON.stringify(canonicalize(oldObj), undefined, '  '),
+        typeof newObj === 'string' ? newObj : JSON.stringify(canonicalize(newObj), undefined, '  '),
+        callback
+      );
+    },
+
+    createTwoFilesPatch: function(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader) {
+      var ret = [];
+
+      if (oldFileName == newFileName) {
+        ret.push('Index: ' + oldFileName);
+      }
+      ret.push('===================================================================');
+      ret.push('--- ' + oldFileName + (typeof oldHeader === 'undefined' ? '' : '\t' + oldHeader));
+      ret.push('+++ ' + newFileName + (typeof newHeader === 'undefined' ? '' : '\t' + newHeader));
+
+      var diff = PatchDiff.diff(oldStr, newStr);
+      diff.push({value: '', lines: []});   // Append an empty value to make cleanup easier
+
+      // Formats a given set of lines for printing as context lines in a patch
+      function contextLines(lines) {
+        return map(lines, function(entry) { return ' ' + entry; });
+      }
+
+      // Outputs the no newline at end of file warning if needed
+      function eofNL(curRange, i, current) {
+        var last = diff[diff.length - 2],
+            isLast = i === diff.length - 2,
+            isLastOfType = i === diff.length - 3 && current.added !== last.added;
+
+        // Figure out if this is the last line for the given file and missing NL
+        if (!(/\n$/.test(current.value)) && (isLast || isLastOfType)) {
+          curRange.push('\\ No newline at end of file');
+        }
+      }
+
+      var oldRangeStart = 0, newRangeStart = 0, curRange = [],
+          oldLine = 1, newLine = 1;
+      for (var i = 0; i < diff.length; i++) {
+        var current = diff[i],
+            lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+        current.lines = lines;
+
+        if (current.added || current.removed) {
+          // If we have previous context, start with that
+          if (!oldRangeStart) {
+            var prev = diff[i - 1];
+            oldRangeStart = oldLine;
+            newRangeStart = newLine;
+
+            if (prev) {
+              curRange = contextLines(prev.lines.slice(-4));
+              oldRangeStart -= curRange.length;
+              newRangeStart -= curRange.length;
+            }
+          }
+
+          // Output our changes
+          curRange.push.apply(curRange, map(lines, function(entry) {
+            return (current.added ? '+' : '-') + entry;
+          }));
+          eofNL(curRange, i, current);
+
+          // Track the updated file position
+          if (current.added) {
+            newLine += lines.length;
+          } else {
+            oldLine += lines.length;
+          }
+        } else {
+          // Identical context lines. Track line changes
+          if (oldRangeStart) {
+            // Close out any changes that have been output (or join overlapping)
+            if (lines.length <= 8 && i < diff.length - 2) {
+              // Overlapping
+              curRange.push.apply(curRange, contextLines(lines));
+            } else {
+              // end the range and output
+              var contextSize = Math.min(lines.length, 4);
+              ret.push(
+                  '@@ -' + oldRangeStart + ',' + (oldLine - oldRangeStart + contextSize)
+                  + ' +' + newRangeStart + ',' + (newLine - newRangeStart + contextSize)
+                  + ' @@');
+              ret.push.apply(ret, curRange);
+              ret.push.apply(ret, contextLines(lines.slice(0, contextSize)));
+              if (lines.length <= 4) {
+                eofNL(ret, i, current);
+              }
+
+              oldRangeStart = 0;
+              newRangeStart = 0;
+              curRange = [];
+            }
+          }
+          oldLine += lines.length;
+          newLine += lines.length;
+        }
+      }
+
+      return ret.join('\n') + '\n';
+    },
+
+    createPatch: function(fileName, oldStr, newStr, oldHeader, newHeader) {
+      return JsDiff.createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader);
+    },
+
+    applyPatch: function(oldStr, uniDiff) {
+      var diffstr = uniDiff.split('\n'),
+          hunks = [],
+          i = 0,
+          remEOFNL = false,
+          addEOFNL = false;
+
+      // Skip to the first change hunk
+      while (i < diffstr.length && !(/^@@/.test(diffstr[i]))) {
+        i++;
+      }
+
+      // Parse the unified diff
+      for (; i < diffstr.length; i++) {
+        if (diffstr[i][0] === '@') {
+          var chnukHeader = diffstr[i].split(/@@ -(\d+),(\d+) \+(\d+),(\d+) @@/);
+          hunks.unshift({
+            start: chnukHeader[3],
+            oldlength: +chnukHeader[2],
+            removed: [],
+            newlength: chnukHeader[4],
+            added: []
+          });
+        } else if (diffstr[i][0] === '+') {
+          hunks[0].added.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === '-') {
+          hunks[0].removed.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === ' ') {
+          hunks[0].added.push(diffstr[i].substr(1));
+          hunks[0].removed.push(diffstr[i].substr(1));
+        } else if (diffstr[i][0] === '\\') {
+          if (diffstr[i - 1][0] === '+') {
+            remEOFNL = true;
+          } else if (diffstr[i - 1][0] === '-') {
+            addEOFNL = true;
+          }
+        }
+      }
+
+      // Apply the diff to the input
+      var lines = oldStr.split('\n');
+      for (i = hunks.length - 1; i >= 0; i--) {
+        var hunk = hunks[i];
+        // Sanity check the input string. Bail if we don't match.
+        for (var j = 0; j < hunk.oldlength; j++) {
+          if (lines[hunk.start - 1 + j] !== hunk.removed[j]) {
+            return false;
+          }
+        }
+        Array.prototype.splice.apply(lines, [hunk.start - 1, hunk.oldlength].concat(hunk.added));
+      }
+
+      // Handle EOFNL insertion/removal
+      if (remEOFNL) {
+        while (!lines[lines.length - 1]) {
+          lines.pop();
+        }
+      } else if (addEOFNL) {
+        lines.push('');
+      }
+      return lines.join('\n');
+    },
+
+    convertChangesToXML: function(changes) {
+      var ret = [];
+      for (var i = 0; i < changes.length; i++) {
+        var change = changes[i];
+        if (change.added) {
+          ret.push('');
+        } else if (change.removed) {
+          ret.push('');
+        }
+
+        ret.push(escapeHTML(change.value));
+
+        if (change.added) {
+          ret.push('');
+        } else if (change.removed) {
+          ret.push('');
+        }
+      }
+      return ret.join('');
+    },
+
+    // See: http://code.google.com/p/google-diff-match-patch/wiki/API
+    convertChangesToDMP: function(changes) {
+      var ret = [],
+          change,
+          operation;
+      for (var i = 0; i < changes.length; i++) {
+        change = changes[i];
+        if (change.added) {
+          operation = 1;
+        } else if (change.removed) {
+          operation = -1;
+        } else {
+          operation = 0;
+        }
+
+        ret.push([operation, change.value]);
+      }
+      return ret;
+    },
+
+    canonicalize: canonicalize
+  };
+
+  /*istanbul ignore next */
+  /*global module */
+  if (typeof module !== 'undefined' && module.exports) {
+    module.exports = JsDiff;
+  } else if (typeof define === 'function' && define.amd) {
+    /*global define */
+    define([], function() { return JsDiff; });
+  } else if (typeof global.JsDiff === 'undefined') {
+    global.JsDiff = JsDiff;
+  }
+}(this));
+
+},{}],49:[function(require,module,exports){
+'use strict';
+
+var matchOperatorsRe = /[|\\{}()[\]^$+*?.]/g;
+
+module.exports = function (str) {
+	if (typeof str !== 'string') {
+		throw new TypeError('Expected a string');
+	}
+
+	return str.replace(matchOperatorsRe,  '\\$&');
+};
+
+},{}],50:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+function EventEmitter() {
+  this._events = this._events || {};
+  this._maxListeners = this._maxListeners || undefined;
+}
+module.exports = EventEmitter;
+
+// Backwards-compat with node 0.10.x
+EventEmitter.EventEmitter = EventEmitter;
+
+EventEmitter.prototype._events = undefined;
+EventEmitter.prototype._maxListeners = undefined;
+
+// By default EventEmitters will print a warning if more than 10 listeners are
+// added to it. This is a useful default which helps finding memory leaks.
+EventEmitter.defaultMaxListeners = 10;
+
+// Obviously not all Emitters should be limited to 10. This function allows
+// that to be increased. Set to zero for unlimited.
+EventEmitter.prototype.setMaxListeners = function(n) {
+  if (!isNumber(n) || n < 0 || isNaN(n))
+    throw TypeError('n must be a positive number');
+  this._maxListeners = n;
+  return this;
+};
+
+EventEmitter.prototype.emit = function(type) {
+  var er, handler, len, args, i, listeners;
+
+  if (!this._events)
+    this._events = {};
+
+  // If there is no 'error' event listener then throw.
+  if (type === 'error') {
+    if (!this._events.error ||
+        (isObject(this._events.error) && !this._events.error.length)) {
+      er = arguments[1];
+      if (er instanceof Error) {
+        throw er; // Unhandled 'error' event
+      }
+      throw TypeError('Uncaught, unspecified "error" event.');
+    }
+  }
+
+  handler = this._events[type];
+
+  if (isUndefined(handler))
+    return false;
+
+  if (isFunction(handler)) {
+    switch (arguments.length) {
+      // fast cases
+      case 1:
+        handler.call(this);
+        break;
+      case 2:
+        handler.call(this, arguments[1]);
+        break;
+      case 3:
+        handler.call(this, arguments[1], arguments[2]);
+        break;
+      // slower
+      default:
+        args = Array.prototype.slice.call(arguments, 1);
+        handler.apply(this, args);
+    }
+  } else if (isObject(handler)) {
+    args = Array.prototype.slice.call(arguments, 1);
+    listeners = handler.slice();
+    len = listeners.length;
+    for (i = 0; i < len; i++)
+      listeners[i].apply(this, args);
+  }
+
+  return true;
+};
+
+EventEmitter.prototype.addListener = function(type, listener) {
+  var m;
+
+  if (!isFunction(listener))
+    throw TypeError('listener must be a function');
+
+  if (!this._events)
+    this._events = {};
+
+  // To avoid recursion in the case that type === "newListener"! Before
+  // adding it to the listeners, first emit "newListener".
+  if (this._events.newListener)
+    this.emit('newListener', type,
+              isFunction(listener.listener) ?
+              listener.listener : listener);
+
+  if (!this._events[type])
+    // Optimize the case of one listener. Don't need the extra array object.
+    this._events[type] = listener;
+  else if (isObject(this._events[type]))
+    // If we've already got an array, just append.
+    this._events[type].push(listener);
+  else
+    // Adding the second element, need to change to array.
+    this._events[type] = [this._events[type], listener];
+
+  // Check for listener leak
+  if (isObject(this._events[type]) && !this._events[type].warned) {
+    if (!isUndefined(this._maxListeners)) {
+      m = this._maxListeners;
+    } else {
+      m = EventEmitter.defaultMaxListeners;
+    }
+
+    if (m && m > 0 && this._events[type].length > m) {
+      this._events[type].warned = true;
+      console.error('(node) warning: possible EventEmitter memory ' +
+                    'leak detected. %d listeners added. ' +
+                    'Use emitter.setMaxListeners() to increase limit.',
+                    this._events[type].length);
+      if (typeof console.trace === 'function') {
+        // not supported in IE 10
+        console.trace();
+      }
+    }
+  }
+
+  return this;
+};
+
+EventEmitter.prototype.on = EventEmitter.prototype.addListener;
+
+EventEmitter.prototype.once = function(type, listener) {
+  if (!isFunction(listener))
+    throw TypeError('listener must be a function');
+
+  var fired = false;
+
+  function g() {
+    this.removeListener(type, g);
+
+    if (!fired) {
+      fired = true;
+      listener.apply(this, arguments);
+    }
+  }
+
+  g.listener = listener;
+  this.on(type, g);
+
+  return this;
+};
+
+// emits a 'removeListener' event iff the listener was removed
+EventEmitter.prototype.removeListener = function(type, listener) {
+  var list, position, length, i;
+
+  if (!isFunction(listener))
+    throw TypeError('listener must be a function');
+
+  if (!this._events || !this._events[type])
+    return this;
+
+  list = this._events[type];
+  length = list.length;
+  position = -1;
+
+  if (list === listener ||
+      (isFunction(list.listener) && list.listener === listener)) {
+    delete this._events[type];
+    if (this._events.removeListener)
+      this.emit('removeListener', type, listener);
+
+  } else if (isObject(list)) {
+    for (i = length; i-- > 0;) {
+      if (list[i] === listener ||
+          (list[i].listener && list[i].listener === listener)) {
+        position = i;
+        break;
+      }
+    }
+
+    if (position < 0)
+      return this;
+
+    if (list.length === 1) {
+      list.length = 0;
+      delete this._events[type];
+    } else {
+      list.splice(position, 1);
+    }
+
+    if (this._events.removeListener)
+      this.emit('removeListener', type, listener);
+  }
+
+  return this;
+};
+
+EventEmitter.prototype.removeAllListeners = function(type) {
+  var key, listeners;
+
+  if (!this._events)
+    return this;
+
+  // not listening for removeListener, no need to emit
+  if (!this._events.removeListener) {
+    if (arguments.length === 0)
+      this._events = {};
+    else if (this._events[type])
+      delete this._events[type];
+    return this;
+  }
+
+  // emit removeListener for all listeners on all events
+  if (arguments.length === 0) {
+    for (key in this._events) {
+      if (key === 'removeListener') continue;
+      this.removeAllListeners(key);
+    }
+    this.removeAllListeners('removeListener');
+    this._events = {};
+    return this;
+  }
+
+  listeners = this._events[type];
+
+  if (isFunction(listeners)) {
+    this.removeListener(type, listeners);
+  } else if (listeners) {
+    // LIFO order
+    while (listeners.length)
+      this.removeListener(type, listeners[listeners.length - 1]);
+  }
+  delete this._events[type];
+
+  return this;
+};
+
+EventEmitter.prototype.listeners = function(type) {
+  var ret;
+  if (!this._events || !this._events[type])
+    ret = [];
+  else if (isFunction(this._events[type]))
+    ret = [this._events[type]];
+  else
+    ret = this._events[type].slice();
+  return ret;
+};
+
+EventEmitter.prototype.listenerCount = function(type) {
+  if (this._events) {
+    var evlistener = this._events[type];
+
+    if (isFunction(evlistener))
+      return 1;
+    else if (evlistener)
+      return evlistener.length;
+  }
+  return 0;
+};
+
+EventEmitter.listenerCount = function(emitter, type) {
+  return emitter.listenerCount(type);
+};
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+
+},{}],51:[function(require,module,exports){
+(function (process){
+// Growl - Copyright TJ Holowaychuk  (MIT Licensed)
+
+/**
+ * Module dependencies.
+ */
+
+var exec = require('child_process').exec
+  , fs = require('fs')
+  , path = require('path')
+  , exists = fs.existsSync || path.existsSync
+  , os = require('os')
+  , quote = JSON.stringify
+  , cmd;
+
+function which(name) {
+  var paths = process.env.PATH.split(':');
+  var loc;
+
+  for (var i = 0, len = paths.length; i < len; ++i) {
+    loc = path.join(paths[i], name);
+    if (exists(loc)) return loc;
+  }
+}
+
+switch(os.type()) {
+  case 'Darwin':
+    if (which('terminal-notifier')) {
+      cmd = {
+          type: "Darwin-NotificationCenter"
+        , pkg: "terminal-notifier"
+        , msg: '-message'
+        , title: '-title'
+        , subtitle: '-subtitle'
+        , icon: '-appIcon'
+        , sound:  '-sound'
+        , url: '-open'
+        , priority: {
+              cmd: '-execute'
+            , range: []
+          }
+      };
+    } else {
+      cmd = {
+          type: "Darwin-Growl"
+        , pkg: "growlnotify"
+        , msg: '-m'
+        , sticky: '--sticky'
+        , priority: {
+              cmd: '--priority'
+            , range: [
+                -2
+              , -1
+              , 0
+              , 1
+              , 2
+              , "Very Low"
+              , "Moderate"
+              , "Normal"
+              , "High"
+              , "Emergency"
+            ]
+          }
+      };
+    }
+    break;
+  case 'Linux':
+    if (which('growl')) {
+      cmd = {
+          type: "Linux-Growl"
+        , pkg: "growl"
+        , msg: '-m'
+        , title: '-title'
+        , subtitle: '-subtitle'
+        , host: {
+            cmd: '-H'
+          , hostname: '192.168.33.1'
+        }
+      };
+    } else {
+      cmd = {
+          type: "Linux"
+        , pkg: "notify-send"
+        , msg: ''
+        , sticky: '-t 0'
+        , icon: '-i'
+        , priority: {
+            cmd: '-u'
+          , range: [
+              "low"
+            , "normal"
+            , "critical"
+          ]
+        }
+      };
+    }
+    break;
+  case 'Windows_NT':
+    cmd = {
+        type: "Windows"
+      , pkg: "growlnotify"
+      , msg: ''
+      , sticky: '/s:true'
+      , title: '/t:'
+      , icon: '/i:'
+      , url: '/cu:'
+      , priority: {
+            cmd: '/p:'
+          , range: [
+              -2
+            , -1
+            , 0
+            , 1
+            , 2
+          ]
+        }
+    };
+    break;
+}
+
+/**
+ * Expose `growl`.
+ */
+
+exports = module.exports = growl;
+
+/**
+ * Node-growl version.
+ */
+
+exports.version = '1.4.1'
+
+/**
+ * Send growl notification _msg_ with _options_.
+ *
+ * Options:
+ *
+ *  - title   Notification title
+ *  - sticky  Make the notification stick (defaults to false)
+ *  - priority  Specify an int or named key (default is 0)
+ *  - name    Application name (defaults to growlnotify)
+ *  - sound   Sound efect ( in OSx defined in preferences -> sound -> effects) * works only in OSX > 10.8x
+ *  - image
+ *    - path to an icon sets --iconpath
+ *    - path to an image sets --image
+ *    - capitalized word sets --appIcon
+ *    - filename uses extname as --icon
+ *    - otherwise treated as --icon
+ *
+ * Examples:
+ *
+ *   growl('New email')
+ *   growl('5 new emails', { title: 'Thunderbird' })
+ *   growl('5 new emails', { title: 'Thunderbird', sound: 'Purr' })
+ *   growl('Email sent', function(){
+ *     // ... notification sent
+ *   })
+ *
+ * @param {string} msg
+ * @param {object} options
+ * @param {function} fn
+ * @api public
+ */
+
+function growl(msg, options, fn) {
+  var image
+    , args
+    , options = options || {}
+    , fn = fn || function(){};
+
+  if (options.exec) {
+    cmd = {
+        type: "Custom"
+      , pkg: options.exec
+      , range: []
+    };
+  }
+
+  // noop
+  if (!cmd) return fn(new Error('growl not supported on this platform'));
+  args = [cmd.pkg];
+
+  // image
+  if (image = options.image) {
+    switch(cmd.type) {
+      case 'Darwin-Growl':
+        var flag, ext = path.extname(image).substr(1)
+        flag = flag || ext == 'icns' && 'iconpath'
+        flag = flag || /^[A-Z]/.test(image) && 'appIcon'
+        flag = flag || /^png|gif|jpe?g$/.test(ext) && 'image'
+        flag = flag || ext && (image = ext) && 'icon'
+        flag = flag || 'icon'
+        args.push('--' + flag, quote(image))
+        break;
+      case 'Darwin-NotificationCenter':
+        args.push(cmd.icon, quote(image));
+        break;
+      case 'Linux':
+        args.push(cmd.icon, quote(image));
+        // libnotify defaults to sticky, set a hint for transient notifications
+        if (!options.sticky) args.push('--hint=int:transient:1');
+        break;
+      case 'Windows':
+        args.push(cmd.icon + quote(image));
+        break;
+    }
+  }
+
+  // sticky
+  if (options.sticky) args.push(cmd.sticky);
+
+  // priority
+  if (options.priority) {
+    var priority = options.priority + '';
+    var checkindexOf = cmd.priority.range.indexOf(priority);
+    if (~cmd.priority.range.indexOf(priority)) {
+      args.push(cmd.priority, options.priority);
+    }
+  }
+
+  //sound
+  if(options.sound && cmd.type === 'Darwin-NotificationCenter'){
+    args.push(cmd.sound, options.sound)
+  }
+
+  // name
+  if (options.name && cmd.type === "Darwin-Growl") {
+    args.push('--name', options.name);
+  }
+
+  switch(cmd.type) {
+    case 'Darwin-Growl':
+      args.push(cmd.msg);
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(quote(options.title));
+      break;
+    case 'Darwin-NotificationCenter':
+      args.push(cmd.msg);
+      var stringifiedMsg = quote(msg);
+      var escapedMsg = stringifiedMsg.replace(/\\n/g, '\n');
+      args.push(escapedMsg);
+      if (options.title) {
+        args.push(cmd.title);
+        args.push(quote(options.title));
+      }
+      if (options.subtitle) {
+        args.push(cmd.subtitle);
+        args.push(quote(options.subtitle));
+      }
+      if (options.url) {
+        args.push(cmd.url);
+        args.push(quote(options.url));
+      }
+      break;
+    case 'Linux-Growl':
+      args.push(cmd.msg);
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(quote(options.title));
+      if (cmd.host) {
+        args.push(cmd.host.cmd, cmd.host.hostname)
+      }
+      break;
+    case 'Linux':
+      if (options.title) {
+        args.push(quote(options.title));
+        args.push(cmd.msg);
+        args.push(quote(msg).replace(/\\n/g, '\n'));
+      } else {
+        args.push(quote(msg).replace(/\\n/g, '\n'));
+      }
+      break;
+    case 'Windows':
+      args.push(quote(msg).replace(/\\n/g, '\n'));
+      if (options.title) args.push(cmd.title + quote(options.title));
+      if (options.url) args.push(cmd.url + quote(options.url));
+      break;
+    case 'Custom':
+      args[0] = (function(origCommand) {
+        var message = options.title
+          ? options.title + ': ' + msg
+          : msg;
+        var command = origCommand.replace(/(^|[^%])%s/g, '$1' + quote(message));
+        if (command === origCommand) args.push(quote(message));
+        return command;
+      })(args[0]);
+      break;
+  }
+
+  // execute
+  exec(args.join(' '), fn);
+};
+
+}).call(this,require('_process'))
+},{"_process":58,"child_process":43,"fs":43,"os":56,"path":43}],52:[function(require,module,exports){
+exports.read = function (buffer, offset, isLE, mLen, nBytes) {
+  var e, m
+  var eLen = nBytes * 8 - mLen - 1
+  var eMax = (1 << eLen) - 1
+  var eBias = eMax >> 1
+  var nBits = -7
+  var i = isLE ? (nBytes - 1) : 0
+  var d = isLE ? -1 : 1
+  var s = buffer[offset + i]
+
+  i += d
+
+  e = s & ((1 << (-nBits)) - 1)
+  s >>= (-nBits)
+  nBits += eLen
+  for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8) {}
+
+  m = e & ((1 << (-nBits)) - 1)
+  e >>= (-nBits)
+  nBits += mLen
+  for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8) {}
+
+  if (e === 0) {
+    e = 1 - eBias
+  } else if (e === eMax) {
+    return m ? NaN : ((s ? -1 : 1) * Infinity)
+  } else {
+    m = m + Math.pow(2, mLen)
+    e = e - eBias
+  }
+  return (s ? -1 : 1) * m * Math.pow(2, e - mLen)
+}
+
+exports.write = function (buffer, value, offset, isLE, mLen, nBytes) {
+  var e, m, c
+  var eLen = nBytes * 8 - mLen - 1
+  var eMax = (1 << eLen) - 1
+  var eBias = eMax >> 1
+  var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0)
+  var i = isLE ? 0 : (nBytes - 1)
+  var d = isLE ? 1 : -1
+  var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0
+
+  value = Math.abs(value)
+
+  if (isNaN(value) || value === Infinity) {
+    m = isNaN(value) ? 1 : 0
+    e = eMax
+  } else {
+    e = Math.floor(Math.log(value) / Math.LN2)
+    if (value * (c = Math.pow(2, -e)) < 1) {
+      e--
+      c *= 2
+    }
+    if (e + eBias >= 1) {
+      value += rt / c
+    } else {
+      value += rt * Math.pow(2, 1 - eBias)
+    }
+    if (value * c >= 2) {
+      e++
+      c /= 2
+    }
+
+    if (e + eBias >= eMax) {
+      m = 0
+      e = eMax
+    } else if (e + eBias >= 1) {
+      m = (value * c - 1) * Math.pow(2, mLen)
+      e = e + eBias
+    } else {
+      m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen)
+      e = 0
+    }
+  }
+
+  for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {}
+
+  e = (e << mLen) | m
+  eLen += mLen
+  for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {}
+
+  buffer[offset + i - d] |= s * 128
+}
+
+},{}],53:[function(require,module,exports){
+if (typeof Object.create === 'function') {
+  // implementation from standard node.js 'util' module
+  module.exports = function inherits(ctor, superCtor) {
+    ctor.super_ = superCtor
+    ctor.prototype = Object.create(superCtor.prototype, {
+      constructor: {
+        value: ctor,
+        enumerable: false,
+        writable: true,
+        configurable: true
+      }
+    });
+  };
+} else {
+  // old school shim for old browsers
+  module.exports = function inherits(ctor, superCtor) {
+    ctor.super_ = superCtor
+    var TempCtor = function () {}
+    TempCtor.prototype = superCtor.prototype
+    ctor.prototype = new TempCtor()
+    ctor.prototype.constructor = ctor
+  }
+}
+
+},{}],54:[function(require,module,exports){
+/**
+ * Determine if an object is Buffer
+ *
+ * Author:   Feross Aboukhadijeh  
+ * License:  MIT
+ *
+ * `npm install is-buffer`
+ */
+
+module.exports = function (obj) {
+  return !!(obj != null &&
+    (obj._isBuffer || // For Safari 5-7 (missing Object.prototype.constructor)
+      (obj.constructor &&
+      typeof obj.constructor.isBuffer === 'function' &&
+      obj.constructor.isBuffer(obj))
+    ))
+}
+
+},{}],55:[function(require,module,exports){
+(function (process){
+var path = require('path');
+var fs = require('fs');
+var _0777 = parseInt('0777', 8);
+
+module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP;
+
+function mkdirP (p, opts, f, made) {
+    if (typeof opts === 'function') {
+        f = opts;
+        opts = {};
+    }
+    else if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+    
+    var cb = f || function () {};
+    p = path.resolve(p);
+    
+    xfs.mkdir(p, mode, function (er) {
+        if (!er) {
+            made = made || p;
+            return cb(null, made);
+        }
+        switch (er.code) {
+            case 'ENOENT':
+                mkdirP(path.dirname(p), opts, function (er, made) {
+                    if (er) cb(er, made);
+                    else mkdirP(p, opts, cb, made);
+                });
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                xfs.stat(p, function (er2, stat) {
+                    // if the stat fails, then that's super weird.
+                    // let the original error be the failure reason.
+                    if (er2 || !stat.isDirectory()) cb(er, made)
+                    else cb(null, made);
+                });
+                break;
+        }
+    });
+}
+
+mkdirP.sync = function sync (p, opts, made) {
+    if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+
+    p = path.resolve(p);
+
+    try {
+        xfs.mkdirSync(p, mode);
+        made = made || p;
+    }
+    catch (err0) {
+        switch (err0.code) {
+            case 'ENOENT' :
+                made = sync(path.dirname(p), opts, made);
+                sync(p, opts, made);
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                var stat;
+                try {
+                    stat = xfs.statSync(p);
+                }
+                catch (err1) {
+                    throw err0;
+                }
+                if (!stat.isDirectory()) throw err0;
+                break;
+        }
+    }
+
+    return made;
+};
+
+}).call(this,require('_process'))
+},{"_process":58,"fs":43,"path":43}],56:[function(require,module,exports){
+exports.endianness = function () { return 'LE' };
+
+exports.hostname = function () {
+    if (typeof location !== 'undefined') {
+        return location.hostname
+    }
+    else return '';
+};
+
+exports.loadavg = function () { return [] };
+
+exports.uptime = function () { return 0 };
+
+exports.freemem = function () {
+    return Number.MAX_VALUE;
+};
+
+exports.totalmem = function () {
+    return Number.MAX_VALUE;
+};
+
+exports.cpus = function () { return [] };
+
+exports.type = function () { return 'Browser' };
+
+exports.release = function () {
+    if (typeof navigator !== 'undefined') {
+        return navigator.appVersion;
+    }
+    return '';
+};
+
+exports.networkInterfaces
+= exports.getNetworkInterfaces
+= function () { return {} };
+
+exports.arch = function () { return 'javascript' };
+
+exports.platform = function () { return 'browser' };
+
+exports.tmpdir = exports.tmpDir = function () {
+    return '/tmp';
+};
+
+exports.EOL = '\n';
+
+},{}],57:[function(require,module,exports){
+(function (process){
+'use strict';
+
+if (!process.version ||
+    process.version.indexOf('v0.') === 0 ||
+    process.version.indexOf('v1.') === 0 && process.version.indexOf('v1.8.') !== 0) {
+  module.exports = nextTick;
+} else {
+  module.exports = process.nextTick;
+}
+
+function nextTick(fn, arg1, arg2, arg3) {
+  if (typeof fn !== 'function') {
+    throw new TypeError('"callback" argument must be a function');
+  }
+  var len = arguments.length;
+  var args, i;
+  switch (len) {
+  case 0:
+  case 1:
+    return process.nextTick(fn);
+  case 2:
+    return process.nextTick(function afterTickOne() {
+      fn.call(null, arg1);
+    });
+  case 3:
+    return process.nextTick(function afterTickTwo() {
+      fn.call(null, arg1, arg2);
+    });
+  case 4:
+    return process.nextTick(function afterTickThree() {
+      fn.call(null, arg1, arg2, arg3);
+    });
+  default:
+    args = new Array(len - 1);
+    i = 0;
+    while (i < args.length) {
+      args[i++] = arguments[i];
+    }
+    return process.nextTick(function afterTick() {
+      fn.apply(null, args);
+    });
+  }
+}
+
+}).call(this,require('_process'))
+},{"_process":58}],58:[function(require,module,exports){
+// shim for using process in browser
+
+var process = module.exports = {};
+var queue = [];
+var draining = false;
+var currentQueue;
+var queueIndex = -1;
+
+function cleanUpNextTick() {
+    if (!draining || !currentQueue) {
+        return;
+    }
+    draining = false;
+    if (currentQueue.length) {
+        queue = currentQueue.concat(queue);
+    } else {
+        queueIndex = -1;
+    }
+    if (queue.length) {
+        drainQueue();
+    }
+}
+
+function drainQueue() {
+    if (draining) {
+        return;
+    }
+    var timeout = setTimeout(cleanUpNextTick);
+    draining = true;
+
+    var len = queue.length;
+    while(len) {
+        currentQueue = queue;
+        queue = [];
+        while (++queueIndex < len) {
+            if (currentQueue) {
+                currentQueue[queueIndex].run();
+            }
+        }
+        queueIndex = -1;
+        len = queue.length;
+    }
+    currentQueue = null;
+    draining = false;
+    clearTimeout(timeout);
+}
+
+process.nextTick = function (fun) {
+    var args = new Array(arguments.length - 1);
+    if (arguments.length > 1) {
+        for (var i = 1; i < arguments.length; i++) {
+            args[i - 1] = arguments[i];
+        }
+    }
+    queue.push(new Item(fun, args));
+    if (queue.length === 1 && !draining) {
+        setTimeout(drainQueue, 0);
+    }
+};
+
+// v8 likes predictible objects
+function Item(fun, array) {
+    this.fun = fun;
+    this.array = array;
+}
+Item.prototype.run = function () {
+    this.fun.apply(null, this.array);
+};
+process.title = 'browser';
+process.browser = true;
+process.env = {};
+process.argv = [];
+process.version = ''; // empty string to avoid regexp issues
+process.versions = {};
+
+function noop() {}
+
+process.on = noop;
+process.addListener = noop;
+process.once = noop;
+process.off = noop;
+process.removeListener = noop;
+process.removeAllListeners = noop;
+process.emit = noop;
+
+process.binding = function (name) {
+    throw new Error('process.binding is not supported');
+};
+
+process.cwd = function () { return '/' };
+process.chdir = function (dir) {
+    throw new Error('process.chdir is not supported');
+};
+process.umask = function() { return 0; };
+
+},{}],59:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+module.exports = Stream;
+
+var EE = require('events').EventEmitter;
+var inherits = require('inherits');
+
+inherits(Stream, EE);
+Stream.Readable = require('readable-stream/readable.js');
+Stream.Writable = require('readable-stream/writable.js');
+Stream.Duplex = require('readable-stream/duplex.js');
+Stream.Transform = require('readable-stream/transform.js');
+Stream.PassThrough = require('readable-stream/passthrough.js');
+
+// Backwards-compat with node 0.4.x
+Stream.Stream = Stream;
+
+
+
+// old-style streams.  Note that the pipe method (the only relevant
+// part of this class) is overridden in the Readable class.
+
+function Stream() {
+  EE.call(this);
+}
+
+Stream.prototype.pipe = function(dest, options) {
+  var source = this;
+
+  function ondata(chunk) {
+    if (dest.writable) {
+      if (false === dest.write(chunk) && source.pause) {
+        source.pause();
+      }
+    }
+  }
+
+  source.on('data', ondata);
+
+  function ondrain() {
+    if (source.readable && source.resume) {
+      source.resume();
+    }
+  }
+
+  dest.on('drain', ondrain);
+
+  // If the 'end' option is not supplied, dest.end() will be called when
+  // source gets the 'end' or 'close' events.  Only dest.end() once.
+  if (!dest._isStdio && (!options || options.end !== false)) {
+    source.on('end', onend);
+    source.on('close', onclose);
+  }
+
+  var didOnEnd = false;
+  function onend() {
+    if (didOnEnd) return;
+    didOnEnd = true;
+
+    dest.end();
+  }
+
+
+  function onclose() {
+    if (didOnEnd) return;
+    didOnEnd = true;
+
+    if (typeof dest.destroy === 'function') dest.destroy();
+  }
+
+  // don't leave dangling pipes when there are errors.
+  function onerror(er) {
+    cleanup();
+    if (EE.listenerCount(this, 'error') === 0) {
+      throw er; // Unhandled stream error in pipe.
+    }
+  }
+
+  source.on('error', onerror);
+  dest.on('error', onerror);
+
+  // remove all the event listeners that were added.
+  function cleanup() {
+    source.removeListener('data', ondata);
+    dest.removeListener('drain', ondrain);
+
+    source.removeListener('end', onend);
+    source.removeListener('close', onclose);
+
+    source.removeListener('error', onerror);
+    dest.removeListener('error', onerror);
+
+    source.removeListener('end', cleanup);
+    source.removeListener('close', cleanup);
+
+    dest.removeListener('close', cleanup);
+  }
+
+  source.on('end', cleanup);
+  source.on('close', cleanup);
+
+  dest.on('close', cleanup);
+
+  dest.emit('pipe', source);
+
+  // Allow for unix-like usage: A.pipe(B).pipe(C)
+  return dest;
+};
+
+},{"events":50,"inherits":53,"readable-stream/duplex.js":61,"readable-stream/passthrough.js":67,"readable-stream/readable.js":68,"readable-stream/transform.js":69,"readable-stream/writable.js":70}],60:[function(require,module,exports){
+arguments[4][46][0].apply(exports,arguments)
+},{"dup":46}],61:[function(require,module,exports){
+module.exports = require("./lib/_stream_duplex.js")
+
+},{"./lib/_stream_duplex.js":62}],62:[function(require,module,exports){
+// a duplex stream is just a stream that is both readable and writable.
+// Since JS doesn't have multiple prototypal inheritance, this class
+// prototypally inherits from Readable, and then parasitically from
+// Writable.
+
+'use strict';
+
+/**/
+
+var objectKeys = Object.keys || function (obj) {
+  var keys = [];
+  for (var key in obj) {
+    keys.push(key);
+  }return keys;
+};
+/**/
+
+module.exports = Duplex;
+
+/**/
+var processNextTick = require('process-nextick-args');
+/**/
+
+/**/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/**/
+
+var Readable = require('./_stream_readable');
+var Writable = require('./_stream_writable');
+
+util.inherits(Duplex, Readable);
+
+var keys = objectKeys(Writable.prototype);
+for (var v = 0; v < keys.length; v++) {
+  var method = keys[v];
+  if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method];
+}
+
+function Duplex(options) {
+  if (!(this instanceof Duplex)) return new Duplex(options);
+
+  Readable.call(this, options);
+  Writable.call(this, options);
+
+  if (options && options.readable === false) this.readable = false;
+
+  if (options && options.writable === false) this.writable = false;
+
+  this.allowHalfOpen = true;
+  if (options && options.allowHalfOpen === false) this.allowHalfOpen = false;
+
+  this.once('end', onend);
+}
+
+// the no-half-open enforcer
+function onend() {
+  // if we allow half-open state, or if the writable side ended,
+  // then we're ok.
+  if (this.allowHalfOpen || this._writableState.ended) return;
+
+  // no more data can be written.
+  // But allow more writes to happen in this tick.
+  processNextTick(onEndNT, this);
+}
+
+function onEndNT(self) {
+  self.end();
+}
+
+function forEach(xs, f) {
+  for (var i = 0, l = xs.length; i < l; i++) {
+    f(xs[i], i);
+  }
+}
+},{"./_stream_readable":64,"./_stream_writable":66,"core-util-is":47,"inherits":53,"process-nextick-args":57}],63:[function(require,module,exports){
+// a passthrough stream.
+// basically just the most minimal sort of Transform stream.
+// Every written chunk gets output as-is.
+
+'use strict';
+
+module.exports = PassThrough;
+
+var Transform = require('./_stream_transform');
+
+/**/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/**/
+
+util.inherits(PassThrough, Transform);
+
+function PassThrough(options) {
+  if (!(this instanceof PassThrough)) return new PassThrough(options);
+
+  Transform.call(this, options);
+}
+
+PassThrough.prototype._transform = function (chunk, encoding, cb) {
+  cb(null, chunk);
+};
+},{"./_stream_transform":65,"core-util-is":47,"inherits":53}],64:[function(require,module,exports){
+(function (process){
+'use strict';
+
+module.exports = Readable;
+
+/**/
+var processNextTick = require('process-nextick-args');
+/**/
+
+/**/
+var isArray = require('isarray');
+/**/
+
+Readable.ReadableState = ReadableState;
+
+/**/
+var EE = require('events').EventEmitter;
+
+var EElistenerCount = function (emitter, type) {
+  return emitter.listeners(type).length;
+};
+/**/
+
+/**/
+var Stream;
+(function () {
+  try {
+    Stream = require('st' + 'ream');
+  } catch (_) {} finally {
+    if (!Stream) Stream = require('events').EventEmitter;
+  }
+})();
+/**/
+
+var Buffer = require('buffer').Buffer;
+/**/
+var bufferShim = require('buffer-shims');
+/**/
+
+/**/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/**/
+
+/**/
+var debugUtil = require('util');
+var debug = void 0;
+if (debugUtil && debugUtil.debuglog) {
+  debug = debugUtil.debuglog('stream');
+} else {
+  debug = function () {};
+}
+/**/
+
+var StringDecoder;
+
+util.inherits(Readable, Stream);
+
+var hasPrependListener = typeof EE.prototype.prependListener === 'function';
+
+function prependListener(emitter, event, fn) {
+  if (hasPrependListener) return emitter.prependListener(event, fn);
+
+  // This is a brutally ugly hack to make sure that our error handler
+  // is attached before any userland ones.  NEVER DO THIS. This is here
+  // only because this code needs to continue to work with older versions
+  // of Node.js that do not include the prependListener() method. The goal
+  // is to eventually remove this hack.
+  if (!emitter._events || !emitter._events[event]) emitter.on(event, fn);else if (isArray(emitter._events[event])) emitter._events[event].unshift(fn);else emitter._events[event] = [fn, emitter._events[event]];
+}
+
+var Duplex;
+function ReadableState(options, stream) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  options = options || {};
+
+  // object stream flag. Used to make read(n) ignore n and to
+  // make all the buffer merging and length checks go away
+  this.objectMode = !!options.objectMode;
+
+  if (stream instanceof Duplex) this.objectMode = this.objectMode || !!options.readableObjectMode;
+
+  // the point at which it stops calling _read() to fill the buffer
+  // Note: 0 is a valid value, means "don't call _read preemptively ever"
+  var hwm = options.highWaterMark;
+  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
+  this.highWaterMark = hwm || hwm === 0 ? hwm : defaultHwm;
+
+  // cast to ints.
+  this.highWaterMark = ~ ~this.highWaterMark;
+
+  this.buffer = [];
+  this.length = 0;
+  this.pipes = null;
+  this.pipesCount = 0;
+  this.flowing = null;
+  this.ended = false;
+  this.endEmitted = false;
+  this.reading = false;
+
+  // a flag to be able to tell if the onwrite cb is called immediately,
+  // or on a later tick.  We set this to true at first, because any
+  // actions that shouldn't happen until "later" should generally also
+  // not happen before the first write call.
+  this.sync = true;
+
+  // whenever we return null, then we set a flag to say
+  // that we're awaiting a 'readable' event emission.
+  this.needReadable = false;
+  this.emittedReadable = false;
+  this.readableListening = false;
+  this.resumeScheduled = false;
+
+  // Crypto is kind of old and crusty.  Historically, its default string
+  // encoding is 'binary' so we have to make this configurable.
+  // Everything else in the universe uses 'utf8', though.
+  this.defaultEncoding = options.defaultEncoding || 'utf8';
+
+  // when piping, we only care about 'readable' events that happen
+  // after read()ing all the bytes and not getting any pushback.
+  this.ranOut = false;
+
+  // the number of writers that are awaiting a drain event in .pipe()s
+  this.awaitDrain = 0;
+
+  // if true, a maybeReadMore has been scheduled
+  this.readingMore = false;
+
+  this.decoder = null;
+  this.encoding = null;
+  if (options.encoding) {
+    if (!StringDecoder) StringDecoder = require('string_decoder/').StringDecoder;
+    this.decoder = new StringDecoder(options.encoding);
+    this.encoding = options.encoding;
+  }
+}
+
+var Duplex;
+function Readable(options) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  if (!(this instanceof Readable)) return new Readable(options);
+
+  this._readableState = new ReadableState(options, this);
+
+  // legacy
+  this.readable = true;
+
+  if (options && typeof options.read === 'function') this._read = options.read;
+
+  Stream.call(this);
+}
+
+// Manually shove something into the read() buffer.
+// This returns true if the highWaterMark has not been hit yet,
+// similar to how Writable.write() returns true if you should
+// write() some more.
+Readable.prototype.push = function (chunk, encoding) {
+  var state = this._readableState;
+
+  if (!state.objectMode && typeof chunk === 'string') {
+    encoding = encoding || state.defaultEncoding;
+    if (encoding !== state.encoding) {
+      chunk = bufferShim.from(chunk, encoding);
+      encoding = '';
+    }
+  }
+
+  return readableAddChunk(this, state, chunk, encoding, false);
+};
+
+// Unshift should *always* be something directly out of read()
+Readable.prototype.unshift = function (chunk) {
+  var state = this._readableState;
+  return readableAddChunk(this, state, chunk, '', true);
+};
+
+Readable.prototype.isPaused = function () {
+  return this._readableState.flowing === false;
+};
+
+function readableAddChunk(stream, state, chunk, encoding, addToFront) {
+  var er = chunkInvalid(state, chunk);
+  if (er) {
+    stream.emit('error', er);
+  } else if (chunk === null) {
+    state.reading = false;
+    onEofChunk(stream, state);
+  } else if (state.objectMode || chunk && chunk.length > 0) {
+    if (state.ended && !addToFront) {
+      var e = new Error('stream.push() after EOF');
+      stream.emit('error', e);
+    } else if (state.endEmitted && addToFront) {
+      var _e = new Error('stream.unshift() after end event');
+      stream.emit('error', _e);
+    } else {
+      var skipAdd;
+      if (state.decoder && !addToFront && !encoding) {
+        chunk = state.decoder.write(chunk);
+        skipAdd = !state.objectMode && chunk.length === 0;
+      }
+
+      if (!addToFront) state.reading = false;
+
+      // Don't add to the buffer if we've decoded to an empty string chunk and
+      // we're not in object mode
+      if (!skipAdd) {
+        // if we want the data now, just emit it.
+        if (state.flowing && state.length === 0 && !state.sync) {
+          stream.emit('data', chunk);
+          stream.read(0);
+        } else {
+          // update the buffer info.
+          state.length += state.objectMode ? 1 : chunk.length;
+          if (addToFront) state.buffer.unshift(chunk);else state.buffer.push(chunk);
+
+          if (state.needReadable) emitReadable(stream);
+        }
+      }
+
+      maybeReadMore(stream, state);
+    }
+  } else if (!addToFront) {
+    state.reading = false;
+  }
+
+  return needMoreData(state);
+}
+
+// if it's past the high water mark, we can push in some more.
+// Also, if we have no data yet, we can stand some
+// more bytes.  This is to work around cases where hwm=0,
+// such as the repl.  Also, if the push() triggered a
+// readable event, and the user called read(largeNumber) such that
+// needReadable was set, then we ought to push more, so that another
+// 'readable' event will be triggered.
+function needMoreData(state) {
+  return !state.ended && (state.needReadable || state.length < state.highWaterMark || state.length === 0);
+}
+
+// backwards compatibility.
+Readable.prototype.setEncoding = function (enc) {
+  if (!StringDecoder) StringDecoder = require('string_decoder/').StringDecoder;
+  this._readableState.decoder = new StringDecoder(enc);
+  this._readableState.encoding = enc;
+  return this;
+};
+
+// Don't raise the hwm > 8MB
+var MAX_HWM = 0x800000;
+function computeNewHighWaterMark(n) {
+  if (n >= MAX_HWM) {
+    n = MAX_HWM;
+  } else {
+    // Get the next highest power of 2
+    n--;
+    n |= n >>> 1;
+    n |= n >>> 2;
+    n |= n >>> 4;
+    n |= n >>> 8;
+    n |= n >>> 16;
+    n++;
+  }
+  return n;
+}
+
+function howMuchToRead(n, state) {
+  if (state.length === 0 && state.ended) return 0;
+
+  if (state.objectMode) return n === 0 ? 0 : 1;
+
+  if (n === null || isNaN(n)) {
+    // only flow one buffer at a time
+    if (state.flowing && state.buffer.length) return state.buffer[0].length;else return state.length;
+  }
+
+  if (n <= 0) return 0;
+
+  // If we're asking for more than the target buffer level,
+  // then raise the water mark.  Bump up to the next highest
+  // power of 2, to prevent increasing it excessively in tiny
+  // amounts.
+  if (n > state.highWaterMark) state.highWaterMark = computeNewHighWaterMark(n);
+
+  // don't have that much.  return null, unless we've ended.
+  if (n > state.length) {
+    if (!state.ended) {
+      state.needReadable = true;
+      return 0;
+    } else {
+      return state.length;
+    }
+  }
+
+  return n;
+}
+
+// you can override either this method, or the async _read(n) below.
+Readable.prototype.read = function (n) {
+  debug('read', n);
+  var state = this._readableState;
+  var nOrig = n;
+
+  if (typeof n !== 'number' || n > 0) state.emittedReadable = false;
+
+  // if we're doing read(0) to trigger a readable event, but we
+  // already have a bunch of data in the buffer, then just trigger
+  // the 'readable' event and move on.
+  if (n === 0 && state.needReadable && (state.length >= state.highWaterMark || state.ended)) {
+    debug('read: emitReadable', state.length, state.ended);
+    if (state.length === 0 && state.ended) endReadable(this);else emitReadable(this);
+    return null;
+  }
+
+  n = howMuchToRead(n, state);
+
+  // if we've ended, and we're now clear, then finish it up.
+  if (n === 0 && state.ended) {
+    if (state.length === 0) endReadable(this);
+    return null;
+  }
+
+  // All the actual chunk generation logic needs to be
+  // *below* the call to _read.  The reason is that in certain
+  // synthetic stream cases, such as passthrough streams, _read
+  // may be a completely synchronous operation which may change
+  // the state of the read buffer, providing enough data when
+  // before there was *not* enough.
+  //
+  // So, the steps are:
+  // 1. Figure out what the state of things will be after we do
+  // a read from the buffer.
+  //
+  // 2. If that resulting state will trigger a _read, then call _read.
+  // Note that this may be asynchronous, or synchronous.  Yes, it is
+  // deeply ugly to write APIs this way, but that still doesn't mean
+  // that the Readable class should behave improperly, as streams are
+  // designed to be sync/async agnostic.
+  // Take note if the _read call is sync or async (ie, if the read call
+  // has returned yet), so that we know whether or not it's safe to emit
+  // 'readable' etc.
+  //
+  // 3. Actually pull the requested chunks out of the buffer and return.
+
+  // if we need a readable event, then we need to do some reading.
+  var doRead = state.needReadable;
+  debug('need readable', doRead);
+
+  // if we currently have less than the highWaterMark, then also read some
+  if (state.length === 0 || state.length - n < state.highWaterMark) {
+    doRead = true;
+    debug('length less than watermark', doRead);
+  }
+
+  // however, if we've ended, then there's no point, and if we're already
+  // reading, then it's unnecessary.
+  if (state.ended || state.reading) {
+    doRead = false;
+    debug('reading or ended', doRead);
+  }
+
+  if (doRead) {
+    debug('do read');
+    state.reading = true;
+    state.sync = true;
+    // if the length is currently zero, then we *need* a readable event.
+    if (state.length === 0) state.needReadable = true;
+    // call internal read method
+    this._read(state.highWaterMark);
+    state.sync = false;
+  }
+
+  // If _read pushed data synchronously, then `reading` will be false,
+  // and we need to re-evaluate how much data we can return to the user.
+  if (doRead && !state.reading) n = howMuchToRead(nOrig, state);
+
+  var ret;
+  if (n > 0) ret = fromList(n, state);else ret = null;
+
+  if (ret === null) {
+    state.needReadable = true;
+    n = 0;
+  }
+
+  state.length -= n;
+
+  // If we have nothing in the buffer, then we want to know
+  // as soon as we *do* get something into the buffer.
+  if (state.length === 0 && !state.ended) state.needReadable = true;
+
+  // If we tried to read() past the EOF, then emit end on the next tick.
+  if (nOrig !== n && state.ended && state.length === 0) endReadable(this);
+
+  if (ret !== null) this.emit('data', ret);
+
+  return ret;
+};
+
+function chunkInvalid(state, chunk) {
+  var er = null;
+  if (!Buffer.isBuffer(chunk) && typeof chunk !== 'string' && chunk !== null && chunk !== undefined && !state.objectMode) {
+    er = new TypeError('Invalid non-string/buffer chunk');
+  }
+  return er;
+}
+
+function onEofChunk(stream, state) {
+  if (state.ended) return;
+  if (state.decoder) {
+    var chunk = state.decoder.end();
+    if (chunk && chunk.length) {
+      state.buffer.push(chunk);
+      state.length += state.objectMode ? 1 : chunk.length;
+    }
+  }
+  state.ended = true;
+
+  // emit 'readable' now to make sure it gets picked up.
+  emitReadable(stream);
+}
+
+// Don't emit readable right away in sync mode, because this can trigger
+// another read() call => stack overflow.  This way, it might trigger
+// a nextTick recursion warning, but that's not so bad.
+function emitReadable(stream) {
+  var state = stream._readableState;
+  state.needReadable = false;
+  if (!state.emittedReadable) {
+    debug('emitReadable', state.flowing);
+    state.emittedReadable = true;
+    if (state.sync) processNextTick(emitReadable_, stream);else emitReadable_(stream);
+  }
+}
+
+function emitReadable_(stream) {
+  debug('emit readable');
+  stream.emit('readable');
+  flow(stream);
+}
+
+// at this point, the user has presumably seen the 'readable' event,
+// and called read() to consume some data.  that may have triggered
+// in turn another _read(n) call, in which case reading = true if
+// it's in progress.
+// However, if we're not ended, or reading, and the length < hwm,
+// then go ahead and try to read some more preemptively.
+function maybeReadMore(stream, state) {
+  if (!state.readingMore) {
+    state.readingMore = true;
+    processNextTick(maybeReadMore_, stream, state);
+  }
+}
+
+function maybeReadMore_(stream, state) {
+  var len = state.length;
+  while (!state.reading && !state.flowing && !state.ended && state.length < state.highWaterMark) {
+    debug('maybeReadMore read 0');
+    stream.read(0);
+    if (len === state.length)
+      // didn't get any data, stop spinning.
+      break;else len = state.length;
+  }
+  state.readingMore = false;
+}
+
+// abstract method.  to be overridden in specific implementation classes.
+// call cb(er, data) where data is <= n in length.
+// for virtual (non-string, non-buffer) streams, "length" is somewhat
+// arbitrary, and perhaps not very meaningful.
+Readable.prototype._read = function (n) {
+  this.emit('error', new Error('not implemented'));
+};
+
+Readable.prototype.pipe = function (dest, pipeOpts) {
+  var src = this;
+  var state = this._readableState;
+
+  switch (state.pipesCount) {
+    case 0:
+      state.pipes = dest;
+      break;
+    case 1:
+      state.pipes = [state.pipes, dest];
+      break;
+    default:
+      state.pipes.push(dest);
+      break;
+  }
+  state.pipesCount += 1;
+  debug('pipe count=%d opts=%j', state.pipesCount, pipeOpts);
+
+  var doEnd = (!pipeOpts || pipeOpts.end !== false) && dest !== process.stdout && dest !== process.stderr;
+
+  var endFn = doEnd ? onend : cleanup;
+  if (state.endEmitted) processNextTick(endFn);else src.once('end', endFn);
+
+  dest.on('unpipe', onunpipe);
+  function onunpipe(readable) {
+    debug('onunpipe');
+    if (readable === src) {
+      cleanup();
+    }
+  }
+
+  function onend() {
+    debug('onend');
+    dest.end();
+  }
+
+  // when the dest drains, it reduces the awaitDrain counter
+  // on the source.  This would be more elegant with a .once()
+  // handler in flow(), but adding and removing repeatedly is
+  // too slow.
+  var ondrain = pipeOnDrain(src);
+  dest.on('drain', ondrain);
+
+  var cleanedUp = false;
+  function cleanup() {
+    debug('cleanup');
+    // cleanup event handlers once the pipe is broken
+    dest.removeListener('close', onclose);
+    dest.removeListener('finish', onfinish);
+    dest.removeListener('drain', ondrain);
+    dest.removeListener('error', onerror);
+    dest.removeListener('unpipe', onunpipe);
+    src.removeListener('end', onend);
+    src.removeListener('end', cleanup);
+    src.removeListener('data', ondata);
+
+    cleanedUp = true;
+
+    // if the reader is waiting for a drain event from this
+    // specific writer, then it would cause it to never start
+    // flowing again.
+    // So, if this is awaiting a drain, then we just call it now.
+    // If we don't know, then assume that we are waiting for one.
+    if (state.awaitDrain && (!dest._writableState || dest._writableState.needDrain)) ondrain();
+  }
+
+  src.on('data', ondata);
+  function ondata(chunk) {
+    debug('ondata');
+    var ret = dest.write(chunk);
+    if (false === ret) {
+      // If the user unpiped during `dest.write()`, it is possible
+      // to get stuck in a permanently paused state if that write
+      // also returned false.
+      // => Check whether `dest` is still a piping destination.
+      if ((state.pipesCount === 1 && state.pipes === dest || state.pipesCount > 1 && indexOf(state.pipes, dest) !== -1) && !cleanedUp) {
+        debug('false write response, pause', src._readableState.awaitDrain);
+        src._readableState.awaitDrain++;
+      }
+      src.pause();
+    }
+  }
+
+  // if the dest has an error, then stop piping into it.
+  // however, don't suppress the throwing behavior for this.
+  function onerror(er) {
+    debug('onerror', er);
+    unpipe();
+    dest.removeListener('error', onerror);
+    if (EElistenerCount(dest, 'error') === 0) dest.emit('error', er);
+  }
+
+  // Make sure our error handler is attached before userland ones.
+  prependListener(dest, 'error', onerror);
+
+  // Both close and finish should trigger unpipe, but only once.
+  function onclose() {
+    dest.removeListener('finish', onfinish);
+    unpipe();
+  }
+  dest.once('close', onclose);
+  function onfinish() {
+    debug('onfinish');
+    dest.removeListener('close', onclose);
+    unpipe();
+  }
+  dest.once('finish', onfinish);
+
+  function unpipe() {
+    debug('unpipe');
+    src.unpipe(dest);
+  }
+
+  // tell the dest that it's being piped to
+  dest.emit('pipe', src);
+
+  // start the flow if it hasn't been started already.
+  if (!state.flowing) {
+    debug('pipe resume');
+    src.resume();
+  }
+
+  return dest;
+};
+
+function pipeOnDrain(src) {
+  return function () {
+    var state = src._readableState;
+    debug('pipeOnDrain', state.awaitDrain);
+    if (state.awaitDrain) state.awaitDrain--;
+    if (state.awaitDrain === 0 && EElistenerCount(src, 'data')) {
+      state.flowing = true;
+      flow(src);
+    }
+  };
+}
+
+Readable.prototype.unpipe = function (dest) {
+  var state = this._readableState;
+
+  // if we're not piping anywhere, then do nothing.
+  if (state.pipesCount === 0) return this;
+
+  // just one destination.  most common case.
+  if (state.pipesCount === 1) {
+    // passed in one, but it's not the right one.
+    if (dest && dest !== state.pipes) return this;
+
+    if (!dest) dest = state.pipes;
+
+    // got a match.
+    state.pipes = null;
+    state.pipesCount = 0;
+    state.flowing = false;
+    if (dest) dest.emit('unpipe', this);
+    return this;
+  }
+
+  // slow case. multiple pipe destinations.
+
+  if (!dest) {
+    // remove all.
+    var dests = state.pipes;
+    var len = state.pipesCount;
+    state.pipes = null;
+    state.pipesCount = 0;
+    state.flowing = false;
+
+    for (var _i = 0; _i < len; _i++) {
+      dests[_i].emit('unpipe', this);
+    }return this;
+  }
+
+  // try to find the right one.
+  var i = indexOf(state.pipes, dest);
+  if (i === -1) return this;
+
+  state.pipes.splice(i, 1);
+  state.pipesCount -= 1;
+  if (state.pipesCount === 1) state.pipes = state.pipes[0];
+
+  dest.emit('unpipe', this);
+
+  return this;
+};
+
+// set up data events if they are asked for
+// Ensure readable listeners eventually get something
+Readable.prototype.on = function (ev, fn) {
+  var res = Stream.prototype.on.call(this, ev, fn);
+
+  // If listening to data, and it has not explicitly been paused,
+  // then call resume to start the flow of data on the next tick.
+  if (ev === 'data' && false !== this._readableState.flowing) {
+    this.resume();
+  }
+
+  if (ev === 'readable' && !this._readableState.endEmitted) {
+    var state = this._readableState;
+    if (!state.readableListening) {
+      state.readableListening = true;
+      state.emittedReadable = false;
+      state.needReadable = true;
+      if (!state.reading) {
+        processNextTick(nReadingNextTick, this);
+      } else if (state.length) {
+        emitReadable(this, state);
+      }
+    }
+  }
+
+  return res;
+};
+Readable.prototype.addListener = Readable.prototype.on;
+
+function nReadingNextTick(self) {
+  debug('readable nexttick read 0');
+  self.read(0);
+}
+
+// pause() and resume() are remnants of the legacy readable stream API
+// If the user uses them, then switch into old mode.
+Readable.prototype.resume = function () {
+  var state = this._readableState;
+  if (!state.flowing) {
+    debug('resume');
+    state.flowing = true;
+    resume(this, state);
+  }
+  return this;
+};
+
+function resume(stream, state) {
+  if (!state.resumeScheduled) {
+    state.resumeScheduled = true;
+    processNextTick(resume_, stream, state);
+  }
+}
+
+function resume_(stream, state) {
+  if (!state.reading) {
+    debug('resume read 0');
+    stream.read(0);
+  }
+
+  state.resumeScheduled = false;
+  stream.emit('resume');
+  flow(stream);
+  if (state.flowing && !state.reading) stream.read(0);
+}
+
+Readable.prototype.pause = function () {
+  debug('call pause flowing=%j', this._readableState.flowing);
+  if (false !== this._readableState.flowing) {
+    debug('pause');
+    this._readableState.flowing = false;
+    this.emit('pause');
+  }
+  return this;
+};
+
+function flow(stream) {
+  var state = stream._readableState;
+  debug('flow', state.flowing);
+  if (state.flowing) {
+    do {
+      var chunk = stream.read();
+    } while (null !== chunk && state.flowing);
+  }
+}
+
+// wrap an old-style stream as the async data source.
+// This is *not* part of the readable stream interface.
+// It is an ugly unfortunate mess of history.
+Readable.prototype.wrap = function (stream) {
+  var state = this._readableState;
+  var paused = false;
+
+  var self = this;
+  stream.on('end', function () {
+    debug('wrapped end');
+    if (state.decoder && !state.ended) {
+      var chunk = state.decoder.end();
+      if (chunk && chunk.length) self.push(chunk);
+    }
+
+    self.push(null);
+  });
+
+  stream.on('data', function (chunk) {
+    debug('wrapped data');
+    if (state.decoder) chunk = state.decoder.write(chunk);
+
+    // don't skip over falsy values in objectMode
+    if (state.objectMode && (chunk === null || chunk === undefined)) return;else if (!state.objectMode && (!chunk || !chunk.length)) return;
+
+    var ret = self.push(chunk);
+    if (!ret) {
+      paused = true;
+      stream.pause();
+    }
+  });
+
+  // proxy all the other methods.
+  // important when wrapping filters and duplexes.
+  for (var i in stream) {
+    if (this[i] === undefined && typeof stream[i] === 'function') {
+      this[i] = function (method) {
+        return function () {
+          return stream[method].apply(stream, arguments);
+        };
+      }(i);
+    }
+  }
+
+  // proxy certain important events.
+  var events = ['error', 'close', 'destroy', 'pause', 'resume'];
+  forEach(events, function (ev) {
+    stream.on(ev, self.emit.bind(self, ev));
+  });
+
+  // when we try to consume some more bytes, simply unpause the
+  // underlying stream.
+  self._read = function (n) {
+    debug('wrapped _read', n);
+    if (paused) {
+      paused = false;
+      stream.resume();
+    }
+  };
+
+  return self;
+};
+
+// exposed for testing purposes only.
+Readable._fromList = fromList;
+
+// Pluck off n bytes from an array of buffers.
+// Length is the combined lengths of all the buffers in the list.
+function fromList(n, state) {
+  var list = state.buffer;
+  var length = state.length;
+  var stringMode = !!state.decoder;
+  var objectMode = !!state.objectMode;
+  var ret;
+
+  // nothing in the list, definitely empty.
+  if (list.length === 0) return null;
+
+  if (length === 0) ret = null;else if (objectMode) ret = list.shift();else if (!n || n >= length) {
+    // read it all, truncate the array.
+    if (stringMode) ret = list.join('');else if (list.length === 1) ret = list[0];else ret = Buffer.concat(list, length);
+    list.length = 0;
+  } else {
+    // read just some of it.
+    if (n < list[0].length) {
+      // just take a part of the first list item.
+      // slice is the same for buffers and strings.
+      var buf = list[0];
+      ret = buf.slice(0, n);
+      list[0] = buf.slice(n);
+    } else if (n === list[0].length) {
+      // first list is a perfect match
+      ret = list.shift();
+    } else {
+      // complex case.
+      // we have enough to cover it, but it spans past the first buffer.
+      if (stringMode) ret = '';else ret = bufferShim.allocUnsafe(n);
+
+      var c = 0;
+      for (var i = 0, l = list.length; i < l && c < n; i++) {
+        var _buf = list[0];
+        var cpy = Math.min(n - c, _buf.length);
+
+        if (stringMode) ret += _buf.slice(0, cpy);else _buf.copy(ret, c, 0, cpy);
+
+        if (cpy < _buf.length) list[0] = _buf.slice(cpy);else list.shift();
+
+        c += cpy;
+      }
+    }
+  }
+
+  return ret;
+}
+
+function endReadable(stream) {
+  var state = stream._readableState;
+
+  // If we get here before consuming all the bytes, then that is a
+  // bug in node.  Should never happen.
+  if (state.length > 0) throw new Error('"endReadable()" called on non-empty stream');
+
+  if (!state.endEmitted) {
+    state.ended = true;
+    processNextTick(endReadableNT, state, stream);
+  }
+}
+
+function endReadableNT(state, stream) {
+  // Check that we didn't get one last unshift.
+  if (!state.endEmitted && state.length === 0) {
+    state.endEmitted = true;
+    stream.readable = false;
+    stream.emit('end');
+  }
+}
+
+function forEach(xs, f) {
+  for (var i = 0, l = xs.length; i < l; i++) {
+    f(xs[i], i);
+  }
+}
+
+function indexOf(xs, x) {
+  for (var i = 0, l = xs.length; i < l; i++) {
+    if (xs[i] === x) return i;
+  }
+  return -1;
+}
+}).call(this,require('_process'))
+},{"./_stream_duplex":62,"_process":58,"buffer":45,"buffer-shims":44,"core-util-is":47,"events":50,"inherits":53,"isarray":60,"process-nextick-args":57,"string_decoder/":71,"util":41}],65:[function(require,module,exports){
+// a transform stream is a readable/writable stream where you do
+// something with the data.  Sometimes it's called a "filter",
+// but that's not a great name for it, since that implies a thing where
+// some bits pass through, and others are simply ignored.  (That would
+// be a valid example of a transform, of course.)
+//
+// While the output is causally related to the input, it's not a
+// necessarily symmetric or synchronous transformation.  For example,
+// a zlib stream might take multiple plain-text writes(), and then
+// emit a single compressed chunk some time in the future.
+//
+// Here's how this works:
+//
+// The Transform stream has all the aspects of the readable and writable
+// stream classes.  When you write(chunk), that calls _write(chunk,cb)
+// internally, and returns false if there's a lot of pending writes
+// buffered up.  When you call read(), that calls _read(n) until
+// there's enough pending readable data buffered up.
+//
+// In a transform stream, the written data is placed in a buffer.  When
+// _read(n) is called, it transforms the queued up data, calling the
+// buffered _write cb's as it consumes chunks.  If consuming a single
+// written chunk would result in multiple output chunks, then the first
+// outputted bit calls the readcb, and subsequent chunks just go into
+// the read buffer, and will cause it to emit 'readable' if necessary.
+//
+// This way, back-pressure is actually determined by the reading side,
+// since _read has to be called to start processing a new chunk.  However,
+// a pathological inflate type of transform can cause excessive buffering
+// here.  For example, imagine a stream where every byte of input is
+// interpreted as an integer from 0-255, and then results in that many
+// bytes of output.  Writing the 4 bytes {ff,ff,ff,ff} would result in
+// 1kb of data being output.  In this case, you could write a very small
+// amount of input, and end up with a very large amount of output.  In
+// such a pathological inflating mechanism, there'd be no way to tell
+// the system to stop doing the transform.  A single 4MB write could
+// cause the system to run out of memory.
+//
+// However, even in such a pathological case, only a single written chunk
+// would be consumed, and then the rest would wait (un-transformed) until
+// the results of the previous transformed chunk were consumed.
+
+'use strict';
+
+module.exports = Transform;
+
+var Duplex = require('./_stream_duplex');
+
+/**/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/**/
+
+util.inherits(Transform, Duplex);
+
+function TransformState(stream) {
+  this.afterTransform = function (er, data) {
+    return afterTransform(stream, er, data);
+  };
+
+  this.needTransform = false;
+  this.transforming = false;
+  this.writecb = null;
+  this.writechunk = null;
+  this.writeencoding = null;
+}
+
+function afterTransform(stream, er, data) {
+  var ts = stream._transformState;
+  ts.transforming = false;
+
+  var cb = ts.writecb;
+
+  if (!cb) return stream.emit('error', new Error('no writecb in Transform class'));
+
+  ts.writechunk = null;
+  ts.writecb = null;
+
+  if (data !== null && data !== undefined) stream.push(data);
+
+  cb(er);
+
+  var rs = stream._readableState;
+  rs.reading = false;
+  if (rs.needReadable || rs.length < rs.highWaterMark) {
+    stream._read(rs.highWaterMark);
+  }
+}
+
+function Transform(options) {
+  if (!(this instanceof Transform)) return new Transform(options);
+
+  Duplex.call(this, options);
+
+  this._transformState = new TransformState(this);
+
+  // when the writable side finishes, then flush out anything remaining.
+  var stream = this;
+
+  // start out asking for a readable event once data is transformed.
+  this._readableState.needReadable = true;
+
+  // we have implemented the _read method, and done the other things
+  // that Readable wants before the first _read call, so unset the
+  // sync guard flag.
+  this._readableState.sync = false;
+
+  if (options) {
+    if (typeof options.transform === 'function') this._transform = options.transform;
+
+    if (typeof options.flush === 'function') this._flush = options.flush;
+  }
+
+  this.once('prefinish', function () {
+    if (typeof this._flush === 'function') this._flush(function (er) {
+      done(stream, er);
+    });else done(stream);
+  });
+}
+
+Transform.prototype.push = function (chunk, encoding) {
+  this._transformState.needTransform = false;
+  return Duplex.prototype.push.call(this, chunk, encoding);
+};
+
+// This is the part where you do stuff!
+// override this function in implementation classes.
+// 'chunk' is an input chunk.
+//
+// Call `push(newChunk)` to pass along transformed output
+// to the readable side.  You may call 'push' zero or more times.
+//
+// Call `cb(err)` when you are done with this chunk.  If you pass
+// an error, then that'll put the hurt on the whole operation.  If you
+// never call cb(), then you'll never get another chunk.
+Transform.prototype._transform = function (chunk, encoding, cb) {
+  throw new Error('Not implemented');
+};
+
+Transform.prototype._write = function (chunk, encoding, cb) {
+  var ts = this._transformState;
+  ts.writecb = cb;
+  ts.writechunk = chunk;
+  ts.writeencoding = encoding;
+  if (!ts.transforming) {
+    var rs = this._readableState;
+    if (ts.needTransform || rs.needReadable || rs.length < rs.highWaterMark) this._read(rs.highWaterMark);
+  }
+};
+
+// Doesn't matter what the args are here.
+// _transform does all the work.
+// That we got here means that the readable side wants more data.
+Transform.prototype._read = function (n) {
+  var ts = this._transformState;
+
+  if (ts.writechunk !== null && ts.writecb && !ts.transforming) {
+    ts.transforming = true;
+    this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform);
+  } else {
+    // mark that we need a transform, so that any data that comes in
+    // will get processed, now that we've asked for it.
+    ts.needTransform = true;
+  }
+};
+
+function done(stream, er) {
+  if (er) return stream.emit('error', er);
+
+  // if there's nothing in the write buffer, then that means
+  // that nothing more will ever be provided
+  var ws = stream._writableState;
+  var ts = stream._transformState;
+
+  if (ws.length) throw new Error('Calling transform done when ws.length != 0');
+
+  if (ts.transforming) throw new Error('Calling transform done when still transforming');
+
+  return stream.push(null);
+}
+},{"./_stream_duplex":62,"core-util-is":47,"inherits":53}],66:[function(require,module,exports){
+(function (process){
+// A bit simpler than readable streams.
+// Implement an async ._write(chunk, encoding, cb), and it'll handle all
+// the drain event emission and buffering.
+
+'use strict';
+
+module.exports = Writable;
+
+/**/
+var processNextTick = require('process-nextick-args');
+/**/
+
+/**/
+var asyncWrite = !process.browser && ['v0.10', 'v0.9.'].indexOf(process.version.slice(0, 5)) > -1 ? setImmediate : processNextTick;
+/**/
+
+Writable.WritableState = WritableState;
+
+/**/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/**/
+
+/**/
+var internalUtil = {
+  deprecate: require('util-deprecate')
+};
+/**/
+
+/**/
+var Stream;
+(function () {
+  try {
+    Stream = require('st' + 'ream');
+  } catch (_) {} finally {
+    if (!Stream) Stream = require('events').EventEmitter;
+  }
+})();
+/**/
+
+var Buffer = require('buffer').Buffer;
+/**/
+var bufferShim = require('buffer-shims');
+/**/
+
+util.inherits(Writable, Stream);
+
+function nop() {}
+
+function WriteReq(chunk, encoding, cb) {
+  this.chunk = chunk;
+  this.encoding = encoding;
+  this.callback = cb;
+  this.next = null;
+}
+
+var Duplex;
+function WritableState(options, stream) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  options = options || {};
+
+  // object stream flag to indicate whether or not this stream
+  // contains buffers or objects.
+  this.objectMode = !!options.objectMode;
+
+  if (stream instanceof Duplex) this.objectMode = this.objectMode || !!options.writableObjectMode;
+
+  // the point at which write() starts returning false
+  // Note: 0 is a valid value, means that we always return false if
+  // the entire buffer is not flushed immediately on write()
+  var hwm = options.highWaterMark;
+  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
+  this.highWaterMark = hwm || hwm === 0 ? hwm : defaultHwm;
+
+  // cast to ints.
+  this.highWaterMark = ~ ~this.highWaterMark;
+
+  this.needDrain = false;
+  // at the start of calling end()
+  this.ending = false;
+  // when end() has been called, and returned
+  this.ended = false;
+  // when 'finish' is emitted
+  this.finished = false;
+
+  // should we decode strings into buffers before passing to _write?
+  // this is here so that some node-core streams can optimize string
+  // handling at a lower level.
+  var noDecode = options.decodeStrings === false;
+  this.decodeStrings = !noDecode;
+
+  // Crypto is kind of old and crusty.  Historically, its default string
+  // encoding is 'binary' so we have to make this configurable.
+  // Everything else in the universe uses 'utf8', though.
+  this.defaultEncoding = options.defaultEncoding || 'utf8';
+
+  // not an actual buffer we keep track of, but a measurement
+  // of how much we're waiting to get pushed to some underlying
+  // socket or file.
+  this.length = 0;
+
+  // a flag to see when we're in the middle of a write.
+  this.writing = false;
+
+  // when true all writes will be buffered until .uncork() call
+  this.corked = 0;
+
+  // a flag to be able to tell if the onwrite cb is called immediately,
+  // or on a later tick.  We set this to true at first, because any
+  // actions that shouldn't happen until "later" should generally also
+  // not happen before the first write call.
+  this.sync = true;
+
+  // a flag to know if we're processing previously buffered items, which
+  // may call the _write() callback in the same tick, so that we don't
+  // end up in an overlapped onwrite situation.
+  this.bufferProcessing = false;
+
+  // the callback that's passed to _write(chunk,cb)
+  this.onwrite = function (er) {
+    onwrite(stream, er);
+  };
+
+  // the callback that the user supplies to write(chunk,encoding,cb)
+  this.writecb = null;
+
+  // the amount that is being written when _write is called.
+  this.writelen = 0;
+
+  this.bufferedRequest = null;
+  this.lastBufferedRequest = null;
+
+  // number of pending user-supplied write callbacks
+  // this must be 0 before 'finish' can be emitted
+  this.pendingcb = 0;
+
+  // emit prefinish if the only thing we're waiting for is _write cbs
+  // This is relevant for synchronous Transform streams
+  this.prefinished = false;
+
+  // True if the error was already emitted and should not be thrown again
+  this.errorEmitted = false;
+
+  // count buffered requests
+  this.bufferedRequestCount = 0;
+
+  // allocate the first CorkedRequest, there is always
+  // one allocated and free to use, and we maintain at most two
+  this.corkedRequestsFree = new CorkedRequest(this);
+}
+
+WritableState.prototype.getBuffer = function writableStateGetBuffer() {
+  var current = this.bufferedRequest;
+  var out = [];
+  while (current) {
+    out.push(current);
+    current = current.next;
+  }
+  return out;
+};
+
+(function () {
+  try {
+    Object.defineProperty(WritableState.prototype, 'buffer', {
+      get: internalUtil.deprecate(function () {
+        return this.getBuffer();
+      }, '_writableState.buffer is deprecated. Use _writableState.getBuffer ' + 'instead.')
+    });
+  } catch (_) {}
+})();
+
+var Duplex;
+function Writable(options) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  // Writable ctor is applied to Duplexes, though they're not
+  // instanceof Writable, they're instanceof Readable.
+  if (!(this instanceof Writable) && !(this instanceof Duplex)) return new Writable(options);
+
+  this._writableState = new WritableState(options, this);
+
+  // legacy.
+  this.writable = true;
+
+  if (options) {
+    if (typeof options.write === 'function') this._write = options.write;
+
+    if (typeof options.writev === 'function') this._writev = options.writev;
+  }
+
+  Stream.call(this);
+}
+
+// Otherwise people can pipe Writable streams, which is just wrong.
+Writable.prototype.pipe = function () {
+  this.emit('error', new Error('Cannot pipe, not readable'));
+};
+
+function writeAfterEnd(stream, cb) {
+  var er = new Error('write after end');
+  // TODO: defer error events consistently everywhere, not just the cb
+  stream.emit('error', er);
+  processNextTick(cb, er);
+}
+
+// If we get something that is not a buffer, string, null, or undefined,
+// and we're not in objectMode, then that's an error.
+// Otherwise stream chunks are all considered to be of length=1, and the
+// watermarks determine how many objects to keep in the buffer, rather than
+// how many bytes or characters.
+function validChunk(stream, state, chunk, cb) {
+  var valid = true;
+  var er = false;
+  // Always throw error if a null is written
+  // if we are not in object mode then throw
+  // if it is not a buffer, string, or undefined.
+  if (chunk === null) {
+    er = new TypeError('May not write null values to stream');
+  } else if (!Buffer.isBuffer(chunk) && typeof chunk !== 'string' && chunk !== undefined && !state.objectMode) {
+    er = new TypeError('Invalid non-string/buffer chunk');
+  }
+  if (er) {
+    stream.emit('error', er);
+    processNextTick(cb, er);
+    valid = false;
+  }
+  return valid;
+}
+
+Writable.prototype.write = function (chunk, encoding, cb) {
+  var state = this._writableState;
+  var ret = false;
+
+  if (typeof encoding === 'function') {
+    cb = encoding;
+    encoding = null;
+  }
+
+  if (Buffer.isBuffer(chunk)) encoding = 'buffer';else if (!encoding) encoding = state.defaultEncoding;
+
+  if (typeof cb !== 'function') cb = nop;
+
+  if (state.ended) writeAfterEnd(this, cb);else if (validChunk(this, state, chunk, cb)) {
+    state.pendingcb++;
+    ret = writeOrBuffer(this, state, chunk, encoding, cb);
+  }
+
+  return ret;
+};
+
+Writable.prototype.cork = function () {
+  var state = this._writableState;
+
+  state.corked++;
+};
+
+Writable.prototype.uncork = function () {
+  var state = this._writableState;
+
+  if (state.corked) {
+    state.corked--;
+
+    if (!state.writing && !state.corked && !state.finished && !state.bufferProcessing && state.bufferedRequest) clearBuffer(this, state);
+  }
+};
+
+Writable.prototype.setDefaultEncoding = function setDefaultEncoding(encoding) {
+  // node::ParseEncoding() requires lower case.
+  if (typeof encoding === 'string') encoding = encoding.toLowerCase();
+  if (!(['hex', 'utf8', 'utf-8', 'ascii', 'binary', 'base64', 'ucs2', 'ucs-2', 'utf16le', 'utf-16le', 'raw'].indexOf((encoding + '').toLowerCase()) > -1)) throw new TypeError('Unknown encoding: ' + encoding);
+  this._writableState.defaultEncoding = encoding;
+  return this;
+};
+
+function decodeChunk(state, chunk, encoding) {
+  if (!state.objectMode && state.decodeStrings !== false && typeof chunk === 'string') {
+    chunk = bufferShim.from(chunk, encoding);
+  }
+  return chunk;
+}
+
+// if we're already writing something, then just put this
+// in the queue, and wait our turn.  Otherwise, call _write
+// If we return false, then we need a drain event, so set that flag.
+function writeOrBuffer(stream, state, chunk, encoding, cb) {
+  chunk = decodeChunk(state, chunk, encoding);
+
+  if (Buffer.isBuffer(chunk)) encoding = 'buffer';
+  var len = state.objectMode ? 1 : chunk.length;
+
+  state.length += len;
+
+  var ret = state.length < state.highWaterMark;
+  // we must ensure that previous needDrain will not be reset to false.
+  if (!ret) state.needDrain = true;
+
+  if (state.writing || state.corked) {
+    var last = state.lastBufferedRequest;
+    state.lastBufferedRequest = new WriteReq(chunk, encoding, cb);
+    if (last) {
+      last.next = state.lastBufferedRequest;
+    } else {
+      state.bufferedRequest = state.lastBufferedRequest;
+    }
+    state.bufferedRequestCount += 1;
+  } else {
+    doWrite(stream, state, false, len, chunk, encoding, cb);
+  }
+
+  return ret;
+}
+
+function doWrite(stream, state, writev, len, chunk, encoding, cb) {
+  state.writelen = len;
+  state.writecb = cb;
+  state.writing = true;
+  state.sync = true;
+  if (writev) stream._writev(chunk, state.onwrite);else stream._write(chunk, encoding, state.onwrite);
+  state.sync = false;
+}
+
+function onwriteError(stream, state, sync, er, cb) {
+  --state.pendingcb;
+  if (sync) processNextTick(cb, er);else cb(er);
+
+  stream._writableState.errorEmitted = true;
+  stream.emit('error', er);
+}
+
+function onwriteStateUpdate(state) {
+  state.writing = false;
+  state.writecb = null;
+  state.length -= state.writelen;
+  state.writelen = 0;
+}
+
+function onwrite(stream, er) {
+  var state = stream._writableState;
+  var sync = state.sync;
+  var cb = state.writecb;
+
+  onwriteStateUpdate(state);
+
+  if (er) onwriteError(stream, state, sync, er, cb);else {
+    // Check if we're actually ready to finish, but don't emit yet
+    var finished = needFinish(state);
+
+    if (!finished && !state.corked && !state.bufferProcessing && state.bufferedRequest) {
+      clearBuffer(stream, state);
+    }
+
+    if (sync) {
+      /**/
+      asyncWrite(afterWrite, stream, state, finished, cb);
+      /**/
+    } else {
+        afterWrite(stream, state, finished, cb);
+      }
+  }
+}
+
+function afterWrite(stream, state, finished, cb) {
+  if (!finished) onwriteDrain(stream, state);
+  state.pendingcb--;
+  cb();
+  finishMaybe(stream, state);
+}
+
+// Must force callback to be called on nextTick, so that we don't
+// emit 'drain' before the write() consumer gets the 'false' return
+// value, and has a chance to attach a 'drain' listener.
+function onwriteDrain(stream, state) {
+  if (state.length === 0 && state.needDrain) {
+    state.needDrain = false;
+    stream.emit('drain');
+  }
+}
+
+// if there's something in the buffer waiting, then process it
+function clearBuffer(stream, state) {
+  state.bufferProcessing = true;
+  var entry = state.bufferedRequest;
+
+  if (stream._writev && entry && entry.next) {
+    // Fast case, write everything using _writev()
+    var l = state.bufferedRequestCount;
+    var buffer = new Array(l);
+    var holder = state.corkedRequestsFree;
+    holder.entry = entry;
+
+    var count = 0;
+    while (entry) {
+      buffer[count] = entry;
+      entry = entry.next;
+      count += 1;
+    }
+
+    doWrite(stream, state, true, state.length, buffer, '', holder.finish);
+
+    // doWrite is almost always async, defer these to save a bit of time
+    // as the hot path ends with doWrite
+    state.pendingcb++;
+    state.lastBufferedRequest = null;
+    if (holder.next) {
+      state.corkedRequestsFree = holder.next;
+      holder.next = null;
+    } else {
+      state.corkedRequestsFree = new CorkedRequest(state);
+    }
+  } else {
+    // Slow case, write chunks one-by-one
+    while (entry) {
+      var chunk = entry.chunk;
+      var encoding = entry.encoding;
+      var cb = entry.callback;
+      var len = state.objectMode ? 1 : chunk.length;
+
+      doWrite(stream, state, false, len, chunk, encoding, cb);
+      entry = entry.next;
+      // if we didn't call the onwrite immediately, then
+      // it means that we need to wait until it does.
+      // also, that means that the chunk and cb are currently
+      // being processed, so move the buffer counter past them.
+      if (state.writing) {
+        break;
+      }
+    }
+
+    if (entry === null) state.lastBufferedRequest = null;
+  }
+
+  state.bufferedRequestCount = 0;
+  state.bufferedRequest = entry;
+  state.bufferProcessing = false;
+}
+
+Writable.prototype._write = function (chunk, encoding, cb) {
+  cb(new Error('not implemented'));
+};
+
+Writable.prototype._writev = null;
+
+Writable.prototype.end = function (chunk, encoding, cb) {
+  var state = this._writableState;
+
+  if (typeof chunk === 'function') {
+    cb = chunk;
+    chunk = null;
+    encoding = null;
+  } else if (typeof encoding === 'function') {
+    cb = encoding;
+    encoding = null;
+  }
+
+  if (chunk !== null && chunk !== undefined) this.write(chunk, encoding);
+
+  // .end() fully uncorks
+  if (state.corked) {
+    state.corked = 1;
+    this.uncork();
+  }
+
+  // ignore unnecessary end() calls.
+  if (!state.ending && !state.finished) endWritable(this, state, cb);
+};
+
+function needFinish(state) {
+  return state.ending && state.length === 0 && state.bufferedRequest === null && !state.finished && !state.writing;
+}
+
+function prefinish(stream, state) {
+  if (!state.prefinished) {
+    state.prefinished = true;
+    stream.emit('prefinish');
+  }
+}
+
+function finishMaybe(stream, state) {
+  var need = needFinish(state);
+  if (need) {
+    if (state.pendingcb === 0) {
+      prefinish(stream, state);
+      state.finished = true;
+      stream.emit('finish');
+    } else {
+      prefinish(stream, state);
+    }
+  }
+  return need;
+}
+
+function endWritable(stream, state, cb) {
+  state.ending = true;
+  finishMaybe(stream, state);
+  if (cb) {
+    if (state.finished) processNextTick(cb);else stream.once('finish', cb);
+  }
+  state.ended = true;
+  stream.writable = false;
+}
+
+// It seems a linked list but it is not
+// there will be only 2 of these for each stream
+function CorkedRequest(state) {
+  var _this = this;
+
+  this.next = null;
+  this.entry = null;
+
+  this.finish = function (err) {
+    var entry = _this.entry;
+    _this.entry = null;
+    while (entry) {
+      var cb = entry.callback;
+      state.pendingcb--;
+      cb(err);
+      entry = entry.next;
+    }
+    if (state.corkedRequestsFree) {
+      state.corkedRequestsFree.next = _this;
+    } else {
+      state.corkedRequestsFree = _this;
+    }
+  };
+}
+}).call(this,require('_process'))
+},{"./_stream_duplex":62,"_process":58,"buffer":45,"buffer-shims":44,"core-util-is":47,"events":50,"inherits":53,"process-nextick-args":57,"util-deprecate":73}],67:[function(require,module,exports){
+module.exports = require("./lib/_stream_passthrough.js")
+
+},{"./lib/_stream_passthrough.js":63}],68:[function(require,module,exports){
+(function (process){
+var Stream = (function (){
+  try {
+    return require('st' + 'ream'); // hack to fix a circular dependency issue when used with browserify
+  } catch(_){}
+}());
+exports = module.exports = require('./lib/_stream_readable.js');
+exports.Stream = Stream || exports;
+exports.Readable = exports;
+exports.Writable = require('./lib/_stream_writable.js');
+exports.Duplex = require('./lib/_stream_duplex.js');
+exports.Transform = require('./lib/_stream_transform.js');
+exports.PassThrough = require('./lib/_stream_passthrough.js');
+
+if (!process.browser && process.env.READABLE_STREAM === 'disable' && Stream) {
+  module.exports = Stream;
+}
+
+}).call(this,require('_process'))
+},{"./lib/_stream_duplex.js":62,"./lib/_stream_passthrough.js":63,"./lib/_stream_readable.js":64,"./lib/_stream_transform.js":65,"./lib/_stream_writable.js":66,"_process":58}],69:[function(require,module,exports){
+module.exports = require("./lib/_stream_transform.js")
+
+},{"./lib/_stream_transform.js":65}],70:[function(require,module,exports){
+module.exports = require("./lib/_stream_writable.js")
+
+},{"./lib/_stream_writable.js":66}],71:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+var Buffer = require('buffer').Buffer;
+
+var isBufferEncoding = Buffer.isEncoding
+  || function(encoding) {
+       switch (encoding && encoding.toLowerCase()) {
+         case 'hex': case 'utf8': case 'utf-8': case 'ascii': case 'binary': case 'base64': case 'ucs2': case 'ucs-2': case 'utf16le': case 'utf-16le': case 'raw': return true;
+         default: return false;
+       }
+     }
+
+
+function assertEncoding(encoding) {
+  if (encoding && !isBufferEncoding(encoding)) {
+    throw new Error('Unknown encoding: ' + encoding);
+  }
+}
+
+// StringDecoder provides an interface for efficiently splitting a series of
+// buffers into a series of JS strings without breaking apart multi-byte
+// characters. CESU-8 is handled as part of the UTF-8 encoding.
+//
+// @TODO Handling all encodings inside a single object makes it very difficult
+// to reason about this code, so it should be split up in the future.
+// @TODO There should be a utf8-strict encoding that rejects invalid UTF-8 code
+// points as used by CESU-8.
+var StringDecoder = exports.StringDecoder = function(encoding) {
+  this.encoding = (encoding || 'utf8').toLowerCase().replace(/[-_]/, '');
+  assertEncoding(encoding);
+  switch (this.encoding) {
+    case 'utf8':
+      // CESU-8 represents each of Surrogate Pair by 3-bytes
+      this.surrogateSize = 3;
+      break;
+    case 'ucs2':
+    case 'utf16le':
+      // UTF-16 represents each of Surrogate Pair by 2-bytes
+      this.surrogateSize = 2;
+      this.detectIncompleteChar = utf16DetectIncompleteChar;
+      break;
+    case 'base64':
+      // Base-64 stores 3 bytes in 4 chars, and pads the remainder.
+      this.surrogateSize = 3;
+      this.detectIncompleteChar = base64DetectIncompleteChar;
+      break;
+    default:
+      this.write = passThroughWrite;
+      return;
+  }
+
+  // Enough space to store all bytes of a single character. UTF-8 needs 4
+  // bytes, but CESU-8 may require up to 6 (3 bytes per surrogate).
+  this.charBuffer = new Buffer(6);
+  // Number of bytes received for the current incomplete multi-byte character.
+  this.charReceived = 0;
+  // Number of bytes expected for the current incomplete multi-byte character.
+  this.charLength = 0;
+};
+
+
+// write decodes the given buffer and returns it as JS string that is
+// guaranteed to not contain any partial multi-byte characters. Any partial
+// character found at the end of the buffer is buffered up, and will be
+// returned when calling write again with the remaining bytes.
+//
+// Note: Converting a Buffer containing an orphan surrogate to a String
+// currently works, but converting a String to a Buffer (via `new Buffer`, or
+// Buffer#write) will replace incomplete surrogates with the unicode
+// replacement character. See https://codereview.chromium.org/121173009/ .
+StringDecoder.prototype.write = function(buffer) {
+  var charStr = '';
+  // if our last write ended with an incomplete multibyte character
+  while (this.charLength) {
+    // determine how many remaining bytes this buffer has to offer for this char
+    var available = (buffer.length >= this.charLength - this.charReceived) ?
+        this.charLength - this.charReceived :
+        buffer.length;
+
+    // add the new bytes to the char buffer
+    buffer.copy(this.charBuffer, this.charReceived, 0, available);
+    this.charReceived += available;
+
+    if (this.charReceived < this.charLength) {
+      // still not enough chars in this buffer? wait for more ...
+      return '';
+    }
+
+    // remove bytes belonging to the current character from the buffer
+    buffer = buffer.slice(available, buffer.length);
+
+    // get the character that was split
+    charStr = this.charBuffer.slice(0, this.charLength).toString(this.encoding);
+
+    // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character
+    var charCode = charStr.charCodeAt(charStr.length - 1);
+    if (charCode >= 0xD800 && charCode <= 0xDBFF) {
+      this.charLength += this.surrogateSize;
+      charStr = '';
+      continue;
+    }
+    this.charReceived = this.charLength = 0;
+
+    // if there are no more bytes in this buffer, just emit our char
+    if (buffer.length === 0) {
+      return charStr;
+    }
+    break;
+  }
+
+  // determine and set charLength / charReceived
+  this.detectIncompleteChar(buffer);
+
+  var end = buffer.length;
+  if (this.charLength) {
+    // buffer the incomplete character bytes we got
+    buffer.copy(this.charBuffer, 0, buffer.length - this.charReceived, end);
+    end -= this.charReceived;
+  }
+
+  charStr += buffer.toString(this.encoding, 0, end);
+
+  var end = charStr.length - 1;
+  var charCode = charStr.charCodeAt(end);
+  // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character
+  if (charCode >= 0xD800 && charCode <= 0xDBFF) {
+    var size = this.surrogateSize;
+    this.charLength += size;
+    this.charReceived += size;
+    this.charBuffer.copy(this.charBuffer, size, 0, size);
+    buffer.copy(this.charBuffer, 0, 0, size);
+    return charStr.substring(0, end);
+  }
+
+  // or just emit the charStr
+  return charStr;
+};
+
+// detectIncompleteChar determines if there is an incomplete UTF-8 character at
+// the end of the given buffer. If so, it sets this.charLength to the byte
+// length that character, and sets this.charReceived to the number of bytes
+// that are available for this character.
+StringDecoder.prototype.detectIncompleteChar = function(buffer) {
+  // determine how many bytes we have to check at the end of this buffer
+  var i = (buffer.length >= 3) ? 3 : buffer.length;
+
+  // Figure out if one of the last i bytes of our buffer announces an
+  // incomplete char.
+  for (; i > 0; i--) {
+    var c = buffer[buffer.length - i];
+
+    // See http://en.wikipedia.org/wiki/UTF-8#Description
+
+    // 110XXXXX
+    if (i == 1 && c >> 5 == 0x06) {
+      this.charLength = 2;
+      break;
+    }
+
+    // 1110XXXX
+    if (i <= 2 && c >> 4 == 0x0E) {
+      this.charLength = 3;
+      break;
+    }
+
+    // 11110XXX
+    if (i <= 3 && c >> 3 == 0x1E) {
+      this.charLength = 4;
+      break;
+    }
+  }
+  this.charReceived = i;
+};
+
+StringDecoder.prototype.end = function(buffer) {
+  var res = '';
+  if (buffer && buffer.length)
+    res = this.write(buffer);
+
+  if (this.charReceived) {
+    var cr = this.charReceived;
+    var buf = this.charBuffer;
+    var enc = this.encoding;
+    res += buf.slice(0, cr).toString(enc);
+  }
+
+  return res;
+};
+
+function passThroughWrite(buffer) {
+  return buffer.toString(this.encoding);
+}
+
+function utf16DetectIncompleteChar(buffer) {
+  this.charReceived = buffer.length % 2;
+  this.charLength = this.charReceived ? 2 : 0;
+}
+
+function base64DetectIncompleteChar(buffer) {
+  this.charReceived = buffer.length % 3;
+  this.charLength = this.charReceived ? 3 : 0;
+}
+
+},{"buffer":45}],72:[function(require,module,exports){
+
+/**
+ * Expose `toIsoString`.
+ */
+
+module.exports = toIsoString;
+
+
+/**
+ * Turn a `date` into an ISO string.
+ *
+ * https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/toISOString
+ *
+ * @param {Date} date
+ * @return {String}
+ */
+
+function toIsoString (date) {
+  return date.getUTCFullYear()
+    + '-' + pad(date.getUTCMonth() + 1)
+    + '-' + pad(date.getUTCDate())
+    + 'T' + pad(date.getUTCHours())
+    + ':' + pad(date.getUTCMinutes())
+    + ':' + pad(date.getUTCSeconds())
+    + '.' + String((date.getUTCMilliseconds()/1000).toFixed(3)).slice(2, 5)
+    + 'Z';
+}
+
+
+/**
+ * Pad a `number` with a ten's place zero.
+ *
+ * @param {Number} number
+ * @return {String}
+ */
+
+function pad (number) {
+  var n = number.toString();
+  return n.length === 1 ? '0' + n : n;
+}
+},{}],73:[function(require,module,exports){
+(function (global){
+
+/**
+ * Module exports.
+ */
+
+module.exports = deprecate;
+
+/**
+ * Mark that a method should not be used.
+ * Returns a modified function which warns once by default.
+ *
+ * If `localStorage.noDeprecation = true` is set, then it is a no-op.
+ *
+ * If `localStorage.throwDeprecation = true` is set, then deprecated functions
+ * will throw an Error when invoked.
+ *
+ * If `localStorage.traceDeprecation = true` is set, then deprecated functions
+ * will invoke `console.trace()` instead of `console.error()`.
+ *
+ * @param {Function} fn - the function to deprecate
+ * @param {String} msg - the string to print to the console when `fn` is invoked
+ * @returns {Function} a new "deprecated" version of `fn`
+ * @api public
+ */
+
+function deprecate (fn, msg) {
+  if (config('noDeprecation')) {
+    return fn;
+  }
+
+  var warned = false;
+  function deprecated() {
+    if (!warned) {
+      if (config('throwDeprecation')) {
+        throw new Error(msg);
+      } else if (config('traceDeprecation')) {
+        console.trace(msg);
+      } else {
+        console.warn(msg);
+      }
+      warned = true;
+    }
+    return fn.apply(this, arguments);
+  }
+
+  return deprecated;
+}
+
+/**
+ * Checks `localStorage` for boolean values for the given `name`.
+ *
+ * @param {String} name
+ * @returns {Boolean}
+ * @api private
+ */
+
+function config (name) {
+  // accessing global.localStorage can trigger a DOMException in sandboxed iframes
+  try {
+    if (!global.localStorage) return false;
+  } catch (_) {
+    return false;
+  }
+  var val = global.localStorage[name];
+  if (null == val) return false;
+  return String(val).toLowerCase() === 'true';
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],74:[function(require,module,exports){
+module.exports = function isBuffer(arg) {
+  return arg && typeof arg === 'object'
+    && typeof arg.copy === 'function'
+    && typeof arg.fill === 'function'
+    && typeof arg.readUInt8 === 'function';
+}
+},{}],75:[function(require,module,exports){
+(function (process,global){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+var formatRegExp = /%[sdj%]/g;
+exports.format = function(f) {
+  if (!isString(f)) {
+    var objects = [];
+    for (var i = 0; i < arguments.length; i++) {
+      objects.push(inspect(arguments[i]));
+    }
+    return objects.join(' ');
+  }
+
+  var i = 1;
+  var args = arguments;
+  var len = args.length;
+  var str = String(f).replace(formatRegExp, function(x) {
+    if (x === '%%') return '%';
+    if (i >= len) return x;
+    switch (x) {
+      case '%s': return String(args[i++]);
+      case '%d': return Number(args[i++]);
+      case '%j':
+        try {
+          return JSON.stringify(args[i++]);
+        } catch (_) {
+          return '[Circular]';
+        }
+      default:
+        return x;
+    }
+  });
+  for (var x = args[i]; i < len; x = args[++i]) {
+    if (isNull(x) || !isObject(x)) {
+      str += ' ' + x;
+    } else {
+      str += ' ' + inspect(x);
+    }
+  }
+  return str;
+};
+
+
+// Mark that a method should not be used.
+// Returns a modified function which warns once by default.
+// If --no-deprecation is set, then it is a no-op.
+exports.deprecate = function(fn, msg) {
+  // Allow for deprecating things in the process of starting up.
+  if (isUndefined(global.process)) {
+    return function() {
+      return exports.deprecate(fn, msg).apply(this, arguments);
+    };
+  }
+
+  if (process.noDeprecation === true) {
+    return fn;
+  }
+
+  var warned = false;
+  function deprecated() {
+    if (!warned) {
+      if (process.throwDeprecation) {
+        throw new Error(msg);
+      } else if (process.traceDeprecation) {
+        console.trace(msg);
+      } else {
+        console.error(msg);
+      }
+      warned = true;
+    }
+    return fn.apply(this, arguments);
+  }
+
+  return deprecated;
+};
+
+
+var debugs = {};
+var debugEnviron;
+exports.debuglog = function(set) {
+  if (isUndefined(debugEnviron))
+    debugEnviron = process.env.NODE_DEBUG || '';
+  set = set.toUpperCase();
+  if (!debugs[set]) {
+    if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) {
+      var pid = process.pid;
+      debugs[set] = function() {
+        var msg = exports.format.apply(exports, arguments);
+        console.error('%s %d: %s', set, pid, msg);
+      };
+    } else {
+      debugs[set] = function() {};
+    }
+  }
+  return debugs[set];
+};
+
+
+/**
+ * Echos the value of a value. Trys to print the value out
+ * in the best way possible given the different types.
+ *
+ * @param {Object} obj The object to print out.
+ * @param {Object} opts Optional options object that alters the output.
+ */
+/* legacy: obj, showHidden, depth, colors*/
+function inspect(obj, opts) {
+  // default options
+  var ctx = {
+    seen: [],
+    stylize: stylizeNoColor
+  };
+  // legacy...
+  if (arguments.length >= 3) ctx.depth = arguments[2];
+  if (arguments.length >= 4) ctx.colors = arguments[3];
+  if (isBoolean(opts)) {
+    // legacy...
+    ctx.showHidden = opts;
+  } else if (opts) {
+    // got an "options" object
+    exports._extend(ctx, opts);
+  }
+  // set default options
+  if (isUndefined(ctx.showHidden)) ctx.showHidden = false;
+  if (isUndefined(ctx.depth)) ctx.depth = 2;
+  if (isUndefined(ctx.colors)) ctx.colors = false;
+  if (isUndefined(ctx.customInspect)) ctx.customInspect = true;
+  if (ctx.colors) ctx.stylize = stylizeWithColor;
+  return formatValue(ctx, obj, ctx.depth);
+}
+exports.inspect = inspect;
+
+
+// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics
+inspect.colors = {
+  'bold' : [1, 22],
+  'italic' : [3, 23],
+  'underline' : [4, 24],
+  'inverse' : [7, 27],
+  'white' : [37, 39],
+  'grey' : [90, 39],
+  'black' : [30, 39],
+  'blue' : [34, 39],
+  'cyan' : [36, 39],
+  'green' : [32, 39],
+  'magenta' : [35, 39],
+  'red' : [31, 39],
+  'yellow' : [33, 39]
+};
+
+// Don't use 'blue' not visible on cmd.exe
+inspect.styles = {
+  'special': 'cyan',
+  'number': 'yellow',
+  'boolean': 'yellow',
+  'undefined': 'grey',
+  'null': 'bold',
+  'string': 'green',
+  'date': 'magenta',
+  // "name": intentionally not styling
+  'regexp': 'red'
+};
+
+
+function stylizeWithColor(str, styleType) {
+  var style = inspect.styles[styleType];
+
+  if (style) {
+    return '\u001b[' + inspect.colors[style][0] + 'm' + str +
+           '\u001b[' + inspect.colors[style][1] + 'm';
+  } else {
+    return str;
+  }
+}
+
+
+function stylizeNoColor(str, styleType) {
+  return str;
+}
+
+
+function arrayToHash(array) {
+  var hash = {};
+
+  array.forEach(function(val, idx) {
+    hash[val] = true;
+  });
+
+  return hash;
+}
+
+
+function formatValue(ctx, value, recurseTimes) {
+  // Provide a hook for user-specified inspect functions.
+  // Check that value is an object with an inspect function on it
+  if (ctx.customInspect &&
+      value &&
+      isFunction(value.inspect) &&
+      // Filter out the util module, it's inspect function is special
+      value.inspect !== exports.inspect &&
+      // Also filter out any prototype objects using the circular check.
+      !(value.constructor && value.constructor.prototype === value)) {
+    var ret = value.inspect(recurseTimes, ctx);
+    if (!isString(ret)) {
+      ret = formatValue(ctx, ret, recurseTimes);
+    }
+    return ret;
+  }
+
+  // Primitive types cannot have properties
+  var primitive = formatPrimitive(ctx, value);
+  if (primitive) {
+    return primitive;
+  }
+
+  // Look up the keys of the object.
+  var keys = Object.keys(value);
+  var visibleKeys = arrayToHash(keys);
+
+  if (ctx.showHidden) {
+    keys = Object.getOwnPropertyNames(value);
+  }
+
+  // IE doesn't make error fields non-enumerable
+  // http://msdn.microsoft.com/en-us/library/ie/dww52sbt(v=vs.94).aspx
+  if (isError(value)
+      && (keys.indexOf('message') >= 0 || keys.indexOf('description') >= 0)) {
+    return formatError(value);
+  }
+
+  // Some type of object without properties can be shortcutted.
+  if (keys.length === 0) {
+    if (isFunction(value)) {
+      var name = value.name ? ': ' + value.name : '';
+      return ctx.stylize('[Function' + name + ']', 'special');
+    }
+    if (isRegExp(value)) {
+      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+    }
+    if (isDate(value)) {
+      return ctx.stylize(Date.prototype.toString.call(value), 'date');
+    }
+    if (isError(value)) {
+      return formatError(value);
+    }
+  }
+
+  var base = '', array = false, braces = ['{', '}'];
+
+  // Make Array say that they are Array
+  if (isArray(value)) {
+    array = true;
+    braces = ['[', ']'];
+  }
+
+  // Make functions say that they are functions
+  if (isFunction(value)) {
+    var n = value.name ? ': ' + value.name : '';
+    base = ' [Function' + n + ']';
+  }
+
+  // Make RegExps say that they are RegExps
+  if (isRegExp(value)) {
+    base = ' ' + RegExp.prototype.toString.call(value);
+  }
+
+  // Make dates with properties first say the date
+  if (isDate(value)) {
+    base = ' ' + Date.prototype.toUTCString.call(value);
+  }
+
+  // Make error with message first say the error
+  if (isError(value)) {
+    base = ' ' + formatError(value);
+  }
+
+  if (keys.length === 0 && (!array || value.length == 0)) {
+    return braces[0] + base + braces[1];
+  }
+
+  if (recurseTimes < 0) {
+    if (isRegExp(value)) {
+      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+    } else {
+      return ctx.stylize('[Object]', 'special');
+    }
+  }
+
+  ctx.seen.push(value);
+
+  var output;
+  if (array) {
+    output = formatArray(ctx, value, recurseTimes, visibleKeys, keys);
+  } else {
+    output = keys.map(function(key) {
+      return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array);
+    });
+  }
+
+  ctx.seen.pop();
+
+  return reduceToSingleString(output, base, braces);
+}
+
+
+function formatPrimitive(ctx, value) {
+  if (isUndefined(value))
+    return ctx.stylize('undefined', 'undefined');
+  if (isString(value)) {
+    var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '')
+                                             .replace(/'/g, "\\'")
+                                             .replace(/\\"/g, '"') + '\'';
+    return ctx.stylize(simple, 'string');
+  }
+  if (isNumber(value))
+    return ctx.stylize('' + value, 'number');
+  if (isBoolean(value))
+    return ctx.stylize('' + value, 'boolean');
+  // For some reason typeof null is "object", so special case here.
+  if (isNull(value))
+    return ctx.stylize('null', 'null');
+}
+
+
+function formatError(value) {
+  return '[' + Error.prototype.toString.call(value) + ']';
+}
+
+
+function formatArray(ctx, value, recurseTimes, visibleKeys, keys) {
+  var output = [];
+  for (var i = 0, l = value.length; i < l; ++i) {
+    if (hasOwnProperty(value, String(i))) {
+      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+          String(i), true));
+    } else {
+      output.push('');
+    }
+  }
+  keys.forEach(function(key) {
+    if (!key.match(/^\d+$/)) {
+      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+          key, true));
+    }
+  });
+  return output;
+}
+
+
+function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) {
+  var name, str, desc;
+  desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] };
+  if (desc.get) {
+    if (desc.set) {
+      str = ctx.stylize('[Getter/Setter]', 'special');
+    } else {
+      str = ctx.stylize('[Getter]', 'special');
+    }
+  } else {
+    if (desc.set) {
+      str = ctx.stylize('[Setter]', 'special');
+    }
+  }
+  if (!hasOwnProperty(visibleKeys, key)) {
+    name = '[' + key + ']';
+  }
+  if (!str) {
+    if (ctx.seen.indexOf(desc.value) < 0) {
+      if (isNull(recurseTimes)) {
+        str = formatValue(ctx, desc.value, null);
+      } else {
+        str = formatValue(ctx, desc.value, recurseTimes - 1);
+      }
+      if (str.indexOf('\n') > -1) {
+        if (array) {
+          str = str.split('\n').map(function(line) {
+            return '  ' + line;
+          }).join('\n').substr(2);
+        } else {
+          str = '\n' + str.split('\n').map(function(line) {
+            return '   ' + line;
+          }).join('\n');
+        }
+      }
+    } else {
+      str = ctx.stylize('[Circular]', 'special');
+    }
+  }
+  if (isUndefined(name)) {
+    if (array && key.match(/^\d+$/)) {
+      return str;
+    }
+    name = JSON.stringify('' + key);
+    if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) {
+      name = name.substr(1, name.length - 2);
+      name = ctx.stylize(name, 'name');
+    } else {
+      name = name.replace(/'/g, "\\'")
+                 .replace(/\\"/g, '"')
+                 .replace(/(^"|"$)/g, "'");
+      name = ctx.stylize(name, 'string');
+    }
+  }
+
+  return name + ': ' + str;
+}
+
+
+function reduceToSingleString(output, base, braces) {
+  var numLinesEst = 0;
+  var length = output.reduce(function(prev, cur) {
+    numLinesEst++;
+    if (cur.indexOf('\n') >= 0) numLinesEst++;
+    return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1;
+  }, 0);
+
+  if (length > 60) {
+    return braces[0] +
+           (base === '' ? '' : base + '\n ') +
+           ' ' +
+           output.join(',\n  ') +
+           ' ' +
+           braces[1];
+  }
+
+  return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1];
+}
+
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+function isArray(ar) {
+  return Array.isArray(ar);
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+  return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+  return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+  return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+  return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+  return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+  return isObject(re) && objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+  return isObject(d) && objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+  return isObject(e) &&
+      (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+  return arg === null ||
+         typeof arg === 'boolean' ||
+         typeof arg === 'number' ||
+         typeof arg === 'string' ||
+         typeof arg === 'symbol' ||  // ES6 symbol
+         typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = require('./support/isBuffer');
+
+function objectToString(o) {
+  return Object.prototype.toString.call(o);
+}
+
+
+function pad(n) {
+  return n < 10 ? '0' + n.toString(10) : n.toString(10);
+}
+
+
+var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep',
+              'Oct', 'Nov', 'Dec'];
+
+// 26 Feb 16:19:34
+function timestamp() {
+  var d = new Date();
+  var time = [pad(d.getHours()),
+              pad(d.getMinutes()),
+              pad(d.getSeconds())].join(':');
+  return [d.getDate(), months[d.getMonth()], time].join(' ');
+}
+
+
+// log is just a thin wrapper to console.log that prepends a timestamp
+exports.log = function() {
+  console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments));
+};
+
+
+/**
+ * Inherit the prototype methods from one constructor into another.
+ *
+ * The Function.prototype.inherits from lang.js rewritten as a standalone
+ * function (not on Function.prototype). NOTE: If this file is to be loaded
+ * during bootstrapping this function needs to be rewritten using some native
+ * functions as prototype setup using normal JavaScript does not work as
+ * expected during bootstrapping (see mirror.js in r114903).
+ *
+ * @param {function} ctor Constructor function which needs to inherit the
+ *     prototype.
+ * @param {function} superCtor Constructor function to inherit prototype from.
+ */
+exports.inherits = require('inherits');
+
+exports._extend = function(origin, add) {
+  // Don't do anything if add isn't an object
+  if (!add || !isObject(add)) return origin;
+
+  var keys = Object.keys(add);
+  var i = keys.length;
+  while (i--) {
+    origin[keys[i]] = add[keys[i]];
+  }
+  return origin;
+};
+
+function hasOwnProperty(obj, prop) {
+  return Object.prototype.hasOwnProperty.call(obj, prop);
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./support/isBuffer":74,"_process":58,"inherits":53}]},{},[1]);
diff --git a/node_modules/mocha/node_modules/debug/.jshintrc b/node_modules/mocha/node_modules/debug/.jshintrc
new file mode 100644
index 0000000..299877f
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/.jshintrc
@@ -0,0 +1,3 @@
+{
+  "laxbreak": true
+}
diff --git a/node_modules/mocha/node_modules/debug/.npmignore b/node_modules/mocha/node_modules/debug/.npmignore
new file mode 100644
index 0000000..7e6163d
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/.npmignore
@@ -0,0 +1,6 @@
+support
+test
+examples
+example
+*.sock
+dist
diff --git a/node_modules/mocha/node_modules/debug/History.md b/node_modules/mocha/node_modules/debug/History.md
new file mode 100644
index 0000000..854c971
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/History.md
@@ -0,0 +1,195 @@
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
diff --git a/node_modules/mocha/node_modules/debug/Makefile b/node_modules/mocha/node_modules/debug/Makefile
new file mode 100644
index 0000000..5cf4a59
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/Makefile
@@ -0,0 +1,36 @@
+
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# applications
+NODE ?= $(shell which node)
+NPM ?= $(NODE) $(shell which npm)
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+all: dist/debug.js
+
+install: node_modules
+
+clean:
+	@rm -rf dist
+
+dist:
+	@mkdir -p $@
+
+dist/debug.js: node_modules browser.js debug.js dist
+	@$(BROWSERIFY) \
+		--standalone debug \
+		. > $@
+
+distclean: clean
+	@rm -rf node_modules
+
+node_modules: package.json
+	@NODE_ENV= $(NPM) install
+	@touch node_modules
+
+.PHONY: all install clean distclean
diff --git a/node_modules/mocha/node_modules/debug/Readme.md b/node_modules/mocha/node_modules/debug/Readme.md
new file mode 100644
index 0000000..b4f45e3
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/Readme.md
@@ -0,0 +1,188 @@
+# debug
+
+  tiny node.js debugging utility modelled after node core's debugging technique.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+ With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+  debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+
+  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+
+  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Browser support
+
+  Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:
+
+```js
+window.myDebug = require("debug");
+```
+
+  ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:
+
+```js
+myDebug.enable("worker:*")
+```
+
+  Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+  option. These are WebKit web inspectors, Firefox ([since version
+  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+  and the Firebug plugin for Firefox (any version).
+
+  Colored output looks something like:
+
+  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+
+### stderr vs stdout
+
+You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+### Save debug output to a file
+
+You can save all debug statements to a file by piping them.
+
+Example:
+
+```bash
+$ DEBUG_FD=3 node your-app.js 3> whatever.log
+```
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/mocha/node_modules/debug/bower.json b/node_modules/mocha/node_modules/debug/bower.json
new file mode 100644
index 0000000..6af573f
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/bower.json
@@ -0,0 +1,28 @@
+{
+  "name": "visionmedia-debug",
+  "main": "dist/debug.js",
+  "version": "2.2.0",
+  "homepage": "https://github.com/visionmedia/debug",
+  "authors": [
+    "TJ Holowaychuk "
+  ],
+  "description": "visionmedia-debug",
+  "moduleType": [
+    "amd",
+    "es6",
+    "globals",
+    "node"
+  ],
+  "keywords": [
+    "visionmedia",
+    "debug"
+  ],
+  "license": "MIT",
+  "ignore": [
+    "**/.*",
+    "node_modules",
+    "bower_components",
+    "test",
+    "tests"
+  ]
+}
diff --git a/node_modules/mocha/node_modules/debug/browser.js b/node_modules/mocha/node_modules/debug/browser.js
new file mode 100644
index 0000000..7c76452
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/browser.js
@@ -0,0 +1,168 @@
+
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+               && 'undefined' != typeof chrome.storage
+                  ? chrome.storage.local
+                  : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+  'lightseagreen',
+  'forestgreen',
+  'goldenrod',
+  'dodgerblue',
+  'darkorchid',
+  'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+  // is webkit? http://stackoverflow.com/a/16459606/376773
+  return ('WebkitAppearance' in document.documentElement.style) ||
+    // is firebug? http://stackoverflow.com/a/398120/376773
+    (window.console && (console.firebug || (console.exception && console.table))) ||
+    // is firefox >= v31?
+    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+    (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31);
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+  return JSON.stringify(v);
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+  var args = arguments;
+  var useColors = this.useColors;
+
+  args[0] = (useColors ? '%c' : '')
+    + this.namespace
+    + (useColors ? ' %c' : ' ')
+    + args[0]
+    + (useColors ? '%c ' : ' ')
+    + '+' + exports.humanize(this.diff);
+
+  if (!useColors) return args;
+
+  var c = 'color: ' + this.color;
+  args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1));
+
+  // the final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-z%]/g, function(match) {
+    if ('%%' === match) return;
+    index++;
+    if ('%c' === match) {
+      // we only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+
+  args.splice(lastC, 0, c);
+  return args;
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+  // this hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return 'object' === typeof console
+    && console.log
+    && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  try {
+    if (null == namespaces) {
+      exports.storage.removeItem('debug');
+    } else {
+      exports.storage.debug = namespaces;
+    }
+  } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  var r;
+  try {
+    r = exports.storage.debug;
+  } catch(e) {}
+  return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage(){
+  try {
+    return window.localStorage;
+  } catch (e) {}
+}
diff --git a/node_modules/mocha/node_modules/debug/component.json b/node_modules/mocha/node_modules/debug/component.json
new file mode 100644
index 0000000..ca10637
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+  "name": "debug",
+  "repo": "visionmedia/debug",
+  "description": "small debugging utility",
+  "version": "2.2.0",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "main": "browser.js",
+  "scripts": [
+    "browser.js",
+    "debug.js"
+  ],
+  "dependencies": {
+    "rauchg/ms.js": "0.7.1"
+  }
+}
diff --git a/node_modules/mocha/node_modules/debug/debug.js b/node_modules/mocha/node_modules/debug/debug.js
new file mode 100644
index 0000000..7571a86
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/debug.js
@@ -0,0 +1,197 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = debug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lowercased letter, i.e. "n".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previously assigned color.
+ */
+
+var prevColor = 0;
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ *
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor() {
+  return exports.colors[prevColor++ % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function debug(namespace) {
+
+  // define the `disabled` version
+  function disabled() {
+  }
+  disabled.enabled = false;
+
+  // define the `enabled` version
+  function enabled() {
+
+    var self = enabled;
+
+    // set `diff` timestamp
+    var curr = +new Date();
+    var ms = curr - (prevTime || curr);
+    self.diff = ms;
+    self.prev = prevTime;
+    self.curr = curr;
+    prevTime = curr;
+
+    // add the `color` if not set
+    if (null == self.useColors) self.useColors = exports.useColors();
+    if (null == self.color && self.useColors) self.color = selectColor();
+
+    var args = Array.prototype.slice.call(arguments);
+
+    args[0] = exports.coerce(args[0]);
+
+    if ('string' !== typeof args[0]) {
+      // anything else let's inspect with %o
+      args = ['%o'].concat(args);
+    }
+
+    // apply any `formatters` transformations
+    var index = 0;
+    args[0] = args[0].replace(/%([a-z%])/g, function(match, format) {
+      // if we encounter an escaped % then don't increase the array index
+      if (match === '%%') return match;
+      index++;
+      var formatter = exports.formatters[format];
+      if ('function' === typeof formatter) {
+        var val = args[index];
+        match = formatter.call(self, val);
+
+        // now we need to remove `args[index]` since it's inlined in the `format`
+        args.splice(index, 1);
+        index--;
+      }
+      return match;
+    });
+
+    if ('function' === typeof exports.formatArgs) {
+      args = exports.formatArgs.apply(self, args);
+    }
+    var logFn = enabled.log || exports.log || console.log.bind(console);
+    logFn.apply(self, args);
+  }
+  enabled.enabled = true;
+
+  var fn = exports.enabled(namespace) ? enabled : disabled;
+
+  fn.namespace = namespace;
+
+  return fn;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+  exports.save(namespaces);
+
+  var split = (namespaces || '').split(/[\s,]+/);
+  var len = split.length;
+
+  for (var i = 0; i < len; i++) {
+    if (!split[i]) continue; // ignore empty strings
+    namespaces = split[i].replace(/\*/g, '.*?');
+    if (namespaces[0] === '-') {
+      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+    } else {
+      exports.names.push(new RegExp('^' + namespaces + '$'));
+    }
+  }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+  exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+  var i, len;
+  for (i = 0, len = exports.skips.length; i < len; i++) {
+    if (exports.skips[i].test(name)) {
+      return false;
+    }
+  }
+  for (i = 0, len = exports.names.length; i < len; i++) {
+    if (exports.names[i].test(name)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+  if (val instanceof Error) return val.stack || val.message;
+  return val;
+}
diff --git a/node_modules/mocha/node_modules/debug/node.js b/node_modules/mocha/node_modules/debug/node.js
new file mode 100644
index 0000000..1d392a8
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/node.js
@@ -0,0 +1,209 @@
+
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ *   $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+var stream = 1 === fd ? process.stdout :
+             2 === fd ? process.stderr :
+             createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase();
+  if (0 === debugColors.length) {
+    return tty.isatty(fd);
+  } else {
+    return '0' !== debugColors
+        && 'no' !== debugColors
+        && 'false' !== debugColors
+        && 'disabled' !== debugColors;
+  }
+}
+
+/**
+ * Map %o to `util.inspect()`, since Node doesn't do that out of the box.
+ */
+
+var inspect = (4 === util.inspect.length ?
+  // node <= 0.8.x
+  function (v, colors) {
+    return util.inspect(v, void 0, void 0, colors);
+  } :
+  // node > 0.8.x
+  function (v, colors) {
+    return util.inspect(v, { colors: colors });
+  }
+);
+
+exports.formatters.o = function(v) {
+  return inspect(v, this.useColors)
+    .replace(/\s*\n\s*/g, ' ');
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+  var args = arguments;
+  var useColors = this.useColors;
+  var name = this.namespace;
+
+  if (useColors) {
+    var c = this.color;
+
+    args[0] = '  \u001b[3' + c + ';1m' + name + ' '
+      + '\u001b[0m'
+      + args[0] + '\u001b[3' + c + 'm'
+      + ' +' + exports.humanize(this.diff) + '\u001b[0m';
+  } else {
+    args[0] = new Date().toUTCString()
+      + ' ' + name + ' ' + args[0];
+  }
+  return args;
+}
+
+/**
+ * Invokes `console.error()` with the specified arguments.
+ */
+
+function log() {
+  return stream.write(util.format.apply(this, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  if (null == namespaces) {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  } else {
+    process.env.DEBUG = namespaces;
+  }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+  var stream;
+  var tty_wrap = process.binding('tty_wrap');
+
+  // Note stream._type is used for test-module-load-list.js
+
+  switch (tty_wrap.guessHandleType(fd)) {
+    case 'TTY':
+      stream = new tty.WriteStream(fd);
+      stream._type = 'tty';
+
+      // Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    case 'FILE':
+      var fs = require('fs');
+      stream = new fs.SyncWriteStream(fd, { autoClose: false });
+      stream._type = 'fs';
+      break;
+
+    case 'PIPE':
+    case 'TCP':
+      var net = require('net');
+      stream = new net.Socket({
+        fd: fd,
+        readable: false,
+        writable: true
+      });
+
+      // FIXME Should probably have an option in net.Socket to create a
+      // stream from an existing fd which is writable only. But for now
+      // we'll just add this hack and set the `readable` member to false.
+      // Test: ./node test/fixtures/echo.js < /etc/passwd
+      stream.readable = false;
+      stream.read = null;
+      stream._type = 'pipe';
+
+      // FIXME Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    default:
+      // Probably an error on in uv_guess_handle()
+      throw new Error('Implement me. Unknown stream file type!');
+  }
+
+  // For supporting legacy API we put the FD here.
+  stream.fd = fd;
+
+  stream._isStdio = true;
+
+  return stream;
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/node_modules/mocha/node_modules/debug/package.json b/node_modules/mocha/node_modules/debug/package.json
new file mode 100644
index 0000000..23de79b
--- /dev/null
+++ b/node_modules/mocha/node_modules/debug/package.json
@@ -0,0 +1,70 @@
+{
+  "_from": "debug@2.2.0",
+  "_id": "debug@2.2.0",
+  "_inBundle": false,
+  "_integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+  "_location": "/mocha/debug",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "debug@2.2.0",
+    "name": "debug",
+    "escapedName": "debug",
+    "rawSpec": "2.2.0",
+    "saveSpec": null,
+    "fetchSpec": "2.2.0"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+  "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da",
+  "_spec": "debug@2.2.0",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "browser": "./browser.js",
+  "bugs": {
+    "url": "https://github.com/visionmedia/debug/issues"
+  },
+  "bundleDependencies": false,
+  "component": {
+    "scripts": {
+      "debug/index.js": "browser.js",
+      "debug/debug.js": "debug.js"
+    }
+  },
+  "contributors": [
+    {
+      "name": "Nathan Rajlich",
+      "email": "nathan@tootallnate.net",
+      "url": "http://n8.io"
+    }
+  ],
+  "dependencies": {
+    "ms": "0.7.1"
+  },
+  "deprecated": false,
+  "description": "small debugging utility",
+  "devDependencies": {
+    "browserify": "9.0.3",
+    "mocha": "*"
+  },
+  "homepage": "https://github.com/visionmedia/debug#readme",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "license": "MIT",
+  "main": "./node.js",
+  "name": "debug",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "version": "2.2.0"
+}
diff --git a/node_modules/mocha/node_modules/ms/.npmignore b/node_modules/mocha/node_modules/ms/.npmignore
new file mode 100644
index 0000000..d1aa0ce
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/.npmignore
@@ -0,0 +1,5 @@
+node_modules
+test
+History.md
+Makefile
+component.json
diff --git a/node_modules/mocha/node_modules/ms/History.md b/node_modules/mocha/node_modules/ms/History.md
new file mode 100644
index 0000000..32fdfc1
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/History.md
@@ -0,0 +1,66 @@
+
+0.7.1 / 2015-04-20
+==================
+
+  * prevent extraordinary long inputs (@evilpacket)
+  * Fixed broken readme link
+
+0.7.0 / 2014-11-24
+==================
+
+ * add time abbreviations, updated tests and readme for the new units
+ * fix example in the readme.
+ * add LICENSE file
+
+0.6.2 / 2013-12-05
+==================
+
+ * Adding repository section to package.json to suppress warning from NPM.
+
+0.6.1 / 2013-05-10
+==================
+
+  * fix singularization [visionmedia]
+
+0.6.0 / 2013-03-15
+==================
+
+  * fix minutes
+
+0.5.1 / 2013-02-24
+==================
+
+  * add component namespace
+
+0.5.0 / 2012-11-09
+==================
+
+  * add short formatting as default and .long option
+  * add .license property to component.json
+  * add version to component.json
+
+0.4.0 / 2012-10-22
+==================
+
+  * add rounding to fix crazy decimals
+
+0.3.0 / 2012-09-07
+==================
+
+  * fix `ms()` [visionmedia]
+
+0.2.0 / 2012-09-03
+==================
+
+  * add component.json [visionmedia]
+  * add days support [visionmedia]
+  * add hours support [visionmedia]
+  * add minutes support [visionmedia]
+  * add seconds support [visionmedia]
+  * add ms string support [visionmedia]
+  * refactor tests to facilitate ms(number) [visionmedia]
+
+0.1.0 / 2012-03-07
+==================
+
+  * Initial release
diff --git a/node_modules/mocha/node_modules/ms/LICENSE b/node_modules/mocha/node_modules/ms/LICENSE
new file mode 100644
index 0000000..6c07561
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014 Guillermo Rauch 
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/mocha/node_modules/ms/README.md b/node_modules/mocha/node_modules/ms/README.md
new file mode 100644
index 0000000..9b4fd03
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/README.md
@@ -0,0 +1,35 @@
+# ms.js: miliseconds conversion utility
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('100')     // 100
+```
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(ms('10 hours'))    // "10h"
+```
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download).
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as
+a number (e.g: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of
+equivalent ms is returned.
+
+## License
+
+MIT
diff --git a/node_modules/mocha/node_modules/ms/index.js b/node_modules/mocha/node_modules/ms/index.js
new file mode 100644
index 0000000..4f92771
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/index.js
@@ -0,0 +1,125 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} options
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options){
+  options = options || {};
+  if ('string' == typeof val) return parse(val);
+  return options.long
+    ? long(val)
+    : short(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = '' + str;
+  if (str.length > 10000) return;
+  var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str);
+  if (!match) return;
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function short(ms) {
+  if (ms >= d) return Math.round(ms / d) + 'd';
+  if (ms >= h) return Math.round(ms / h) + 'h';
+  if (ms >= m) return Math.round(ms / m) + 'm';
+  if (ms >= s) return Math.round(ms / s) + 's';
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function long(ms) {
+  return plural(ms, d, 'day')
+    || plural(ms, h, 'hour')
+    || plural(ms, m, 'minute')
+    || plural(ms, s, 'second')
+    || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+  if (ms < n) return;
+  if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name;
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}
diff --git a/node_modules/mocha/node_modules/ms/package.json b/node_modules/mocha/node_modules/ms/package.json
new file mode 100644
index 0000000..a1b696b
--- /dev/null
+++ b/node_modules/mocha/node_modules/ms/package.json
@@ -0,0 +1,49 @@
+{
+  "_from": "ms@0.7.1",
+  "_id": "ms@0.7.1",
+  "_inBundle": false,
+  "_integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
+  "_location": "/mocha/ms",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "ms@0.7.1",
+    "name": "ms",
+    "escapedName": "ms",
+    "rawSpec": "0.7.1",
+    "saveSpec": null,
+    "fetchSpec": "0.7.1"
+  },
+  "_requiredBy": [
+    "/mocha/debug"
+  ],
+  "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+  "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098",
+  "_spec": "ms@0.7.1",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha/node_modules/debug",
+  "bugs": {
+    "url": "https://github.com/guille/ms.js/issues"
+  },
+  "bundleDependencies": false,
+  "component": {
+    "scripts": {
+      "ms/index.js": "index.js"
+    }
+  },
+  "deprecated": false,
+  "description": "Tiny ms conversion utility",
+  "devDependencies": {
+    "expect.js": "*",
+    "mocha": "*",
+    "serve": "*"
+  },
+  "homepage": "https://github.com/guille/ms.js#readme",
+  "main": "./index",
+  "name": "ms",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/guille/ms.js.git"
+  },
+  "version": "0.7.1"
+}
diff --git a/node_modules/mocha/package.json b/node_modules/mocha/package.json
new file mode 100644
index 0000000..96b8dd1
--- /dev/null
+++ b/node_modules/mocha/package.json
@@ -0,0 +1,1271 @@
+{
+  "_from": "mocha@^2.3.3",
+  "_id": "mocha@2.5.3",
+  "_inBundle": false,
+  "_integrity": "sha1-FhvlvetJZ3HrmzV0UFC2IrWu/Fg=",
+  "_location": "/mocha",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "range",
+    "registry": true,
+    "raw": "mocha@^2.3.3",
+    "name": "mocha",
+    "escapedName": "mocha",
+    "rawSpec": "^2.3.3",
+    "saveSpec": null,
+    "fetchSpec": "^2.3.3"
+  },
+  "_requiredBy": [
+    "/quick-local-ip"
+  ],
+  "_resolved": "https://registry.npmjs.org/mocha/-/mocha-2.5.3.tgz",
+  "_shasum": "161be5bdeb496771eb9b35745050b622b5aefc58",
+  "_spec": "mocha@^2.3.3",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/quick-local-ip",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "bin": {
+    "mocha": "./bin/mocha",
+    "_mocha": "./bin/_mocha"
+  },
+  "browser": {
+    "debug": "./lib/browser/debug.js",
+    "events": "./lib/browser/events.js",
+    "tty": "./lib/browser/tty.js",
+    "./index.js": "./browser-entry.js",
+    "jade": false,
+    "fs": false,
+    "glob": false,
+    "path": false,
+    "supports-color": false
+  },
+  "bugs": {
+    "url": "https://github.com/mochajs/mocha/issues"
+  },
+  "bundleDependencies": false,
+  "contributors": [
+    {
+      "name": "TJ Holowaychuk",
+      "email": "tj@vision-media.ca"
+    },
+    {
+      "name": "Travis Jeffery",
+      "email": "tj@travisjeffery.com"
+    },
+    {
+      "name": "Christopher Hiller",
+      "email": "boneskull@boneskull.com"
+    },
+    {
+      "name": "Daniel St. Jules",
+      "email": "danielst.jules@gmail.com"
+    },
+    {
+      "name": "Joshua Appelman",
+      "email": "jappelman@xebia.com"
+    },
+    {
+      "name": "David da Silva Contín",
+      "email": "dasilvacontin@gmail.com"
+    },
+    {
+      "name": "Guillermo Rauch",
+      "email": "rauchg@gmail.com"
+    },
+    {
+      "name": "Ariel Mashraki",
+      "email": "ariel@mashraki.co.il"
+    },
+    {
+      "name": "Attila Domokos",
+      "email": "adomokos@gmail.com"
+    },
+    {
+      "name": "John Firebaugh",
+      "email": "john.firebaugh@gmail.com"
+    },
+    {
+      "name": "Jo Liss",
+      "email": "joliss42@gmail.com"
+    },
+    {
+      "name": "Nathan Rajlich",
+      "email": "nathan@tootallnate.net"
+    },
+    {
+      "name": "Nathan Houle",
+      "email": "nathan@nathanhoule.com"
+    },
+    {
+      "name": "Mike Pennisi",
+      "email": "mike@mikepennisi.com"
+    },
+    {
+      "name": "James Carr",
+      "email": "james.r.carr@gmail.com"
+    },
+    {
+      "name": "Brendan Nee",
+      "email": "brendan.nee@gmail.com"
+    },
+    {
+      "name": "Glen Mailer",
+      "email": "glenjamin@gmail.com"
+    },
+    {
+      "name": "Mislav Marohnić",
+      "email": "mislav.marohnic@gmail.com"
+    },
+    {
+      "name": "Aaron Heckmann",
+      "email": "aaron.heckmann+github@gmail.com"
+    },
+    {
+      "name": "Ryunosuke SATO",
+      "email": "tricknotes.rs@gmail.com"
+    },
+    {
+      "name": "Jonathan Ong",
+      "email": "jonathanrichardong@gmail.com"
+    },
+    {
+      "name": "Joshua Krall",
+      "email": "joshuakrall@pobox.com"
+    },
+    {
+      "name": "Maximilian Antoni",
+      "email": "mail@maxantoni.de"
+    },
+    {
+      "name": "hokaccha",
+      "email": "k.hokamura@gmail.com"
+    },
+    {
+      "name": "Domenic Denicola",
+      "email": "domenic@domenicdenicola.com"
+    },
+    {
+      "name": "Forbes Lindesay",
+      "email": "forbes@lindesay.co.uk"
+    },
+    {
+      "name": "Raynos",
+      "email": "raynos2@gmail.com"
+    },
+    {
+      "name": "Xavier Antoviaque",
+      "email": "xavier@antoviaque.org"
+    },
+    {
+      "name": "Andreas Lind Petersen",
+      "email": "andreas@one.com"
+    },
+    {
+      "name": "Ben Lindsey",
+      "email": "ben.lindsey@vungle.com"
+    },
+    {
+      "name": "Mathieu Desvé",
+      "email": "mathieudesve@MacBook-Pro-de-Mathieu.local"
+    },
+    {
+      "name": "Fredrik Enestad",
+      "email": "fredrik@devloop.se"
+    },
+    {
+      "name": "Rico Sta. Cruz",
+      "email": "rstacruz@users.noreply.github.com"
+    },
+    {
+      "name": "Paul Miller",
+      "email": "paul@paulmillr.com"
+    },
+    {
+      "name": "Ben Bradley",
+      "email": "ben@bradleyit.com"
+    },
+    {
+      "name": "fool2fish",
+      "email": "fool2fish@gmail.com"
+    },
+    {
+      "name": "Cory Thomas",
+      "email": "cory.thomas@bazaarvoice.com"
+    },
+    {
+      "name": "Sune Simonsen",
+      "email": "sune@we-knowhow.dk"
+    },
+    {
+      "name": "Michael Demmer",
+      "email": "demmer@jut.io"
+    },
+    {
+      "name": "Tyson Tate",
+      "email": "tyson@tysontate.com"
+    },
+    {
+      "name": "eiji.ienaga",
+      "email": "eiji.ienaga@gmail.com"
+    },
+    {
+      "name": "Valentin Agachi",
+      "email": "github-com@agachi.name"
+    },
+    {
+      "name": "Sindre Sorhus",
+      "email": "sindresorhus@gmail.com"
+    },
+    {
+      "name": "Merrick Christensen",
+      "email": "merrick.christensen@gmail.com"
+    },
+    {
+      "name": "Wil Moore III",
+      "email": "wil.moore@wilmoore.com"
+    },
+    {
+      "name": "Nathan Bowser",
+      "email": "nathan.bowser@spiderstrategies.com"
+    },
+    {
+      "name": "Jesse Dailey",
+      "email": "jesse.dailey@gmail.com"
+    },
+    {
+      "name": "Benjie Gillam",
+      "email": "benjie@jemjie.com"
+    },
+    {
+      "name": "Vlad Magdalin",
+      "email": "vlad@webflow.com"
+    },
+    {
+      "name": "David Henderson",
+      "email": "david.henderson@triggeredmessaging.com"
+    },
+    {
+      "name": "Long Ho",
+      "email": "longho@yahoo-inc.com"
+    },
+    {
+      "name": "Adam Gruber",
+      "email": "talknmime@gmail.com"
+    },
+    {
+      "name": "Sean Lang",
+      "email": "slang800@gmail.com"
+    },
+    {
+      "name": "Shawn Krisman",
+      "email": "telaviv@github"
+    },
+    {
+      "name": "Simon Gaeremynck",
+      "email": "gaeremyncks@gmail.com"
+    },
+    {
+      "name": "John Reeves",
+      "email": "github@jonnyreeves.co.uk"
+    },
+    {
+      "name": "Soel",
+      "email": "shachar.soel@sap.com"
+    },
+    {
+      "name": "Buck Doyle",
+      "email": "b@chromatin.ca"
+    },
+    {
+      "name": "Max Goodman",
+      "email": "c@chromakode.com"
+    },
+    {
+      "name": "Jonas Westerlund",
+      "email": "jonas.westerlund@me.com"
+    },
+    {
+      "name": "Michael Riley",
+      "email": "michael.riley@autodesk.com"
+    },
+    {
+      "name": "Ian Storm Taylor",
+      "email": "ian@ianstormtaylor.com"
+    },
+    {
+      "name": "Timo Tijhof",
+      "email": "krinklemail@gmail.com"
+    },
+    {
+      "name": "Ian W. Remmel",
+      "email": "design@ianwremmel.com"
+    },
+    {
+      "name": "Tobias Bieniek",
+      "email": "tobias.bieniek@gmail.com"
+    },
+    {
+      "name": "Arian Stolwijk",
+      "email": "arian@aryweb.nl"
+    },
+    {
+      "name": "Nathan Alderson",
+      "email": "nathan.alderson@adtran.com"
+    },
+    {
+      "name": "Brian Beck",
+      "email": "exogen@gmail.com"
+    },
+    {
+      "name": "Dominique Quatravaux",
+      "email": "dominique@quatravaux.org"
+    },
+    {
+      "name": "Xavier Damman",
+      "email": "xdamman@gmail.com"
+    },
+    {
+      "name": "Benjamin Eidelman",
+      "email": "beneidel@gmail.com"
+    },
+    {
+      "name": "Outsider",
+      "email": "outsideris@gmail.com"
+    },
+    {
+      "name": "fcrisci",
+      "email": "fabio.crisci@amadeus.com"
+    },
+    {
+      "name": "FARKAS Máté",
+      "email": "mate.farkas@virtual-call-center.eu"
+    },
+    {
+      "name": "Parker Moore",
+      "email": "parkrmoore@gmail.com"
+    },
+    {
+      "name": "Paul Armstrong",
+      "email": "paul@paularmstrongdesigns.com"
+    },
+    {
+      "name": "jsdevel",
+      "email": "js.developer.undefined@gmail.com"
+    },
+    {
+      "name": "Justin DuJardin",
+      "email": "justin.dujardin@sococo.com"
+    },
+    {
+      "name": "Juzer Ali",
+      "email": "er.juzerali@gmail.com"
+    },
+    {
+      "name": "Jacob Wejendorp",
+      "email": "jacob@wejendorp.dk"
+    },
+    {
+      "name": "monowerker",
+      "email": "monowerker@gmail.com"
+    },
+    {
+      "name": "Alexander Early",
+      "email": "alexander.early@gmail.com"
+    },
+    {
+      "name": "Quang Van",
+      "email": "quangvvv@gmail.com"
+    },
+    {
+      "name": "Quanlong He",
+      "email": "kyan.ql.he@gmail.com"
+    },
+    {
+      "name": "James Nylen",
+      "email": "jnylen@gmail.com"
+    },
+    {
+      "name": "Konstantin Käfer",
+      "email": "github@kkaefer.com"
+    },
+    {
+      "name": "Jordan Sexton",
+      "email": "jordan@jordansexton.com"
+    },
+    {
+      "name": "Josh Lory",
+      "email": "josh.lory@code.org"
+    },
+    {
+      "name": "Julien Wajsberg",
+      "email": "felash@gmail.com"
+    },
+    {
+      "name": "Jussi Virtanen",
+      "email": "jussi.k.virtanen@gmail.com"
+    },
+    {
+      "name": "Jérémie Astori",
+      "email": "jeremie@astori.fr"
+    },
+    {
+      "name": "Katie Gengler",
+      "email": "katiegengler@gmail.com"
+    },
+    {
+      "name": "Keith Cirkel",
+      "email": "github@keithcirkel.co.uk"
+    },
+    {
+      "name": "Kent C. Dodds",
+      "email": "kent+github@doddsfamily.us"
+    },
+    {
+      "name": "Kevin Burke",
+      "email": "kev@inburke.com"
+    },
+    {
+      "name": "Kevin Conway",
+      "email": "kevinjacobconway@gmail.com"
+    },
+    {
+      "name": "Kevin Kirsche",
+      "email": "Kev.Kirsche+GitHub@gmail.com"
+    },
+    {
+      "name": "Kirill Korolyov",
+      "email": "kirill.korolyov@gmail.com"
+    },
+    {
+      "name": "Koen Punt",
+      "email": "koen@koenpunt.nl"
+    },
+    {
+      "name": "Kris Rasmussen",
+      "email": "kristopher.rasmussen@gmail.com"
+    },
+    {
+      "name": "Kyle Mitchell",
+      "email": "kyle@kemitchell.com"
+    },
+    {
+      "name": "Laszlo Bacsi",
+      "email": "lackac@lackac.hu"
+    },
+    {
+      "name": "Liam Newman",
+      "email": "bitwiseman@gmail.com"
+    },
+    {
+      "name": "Linus Unnebäck",
+      "email": "linus@folkdatorn.se"
+    },
+    {
+      "name": "Maciej Małecki",
+      "email": "maciej.malecki@notimplemented.org"
+    },
+    {
+      "name": "Mal Graty",
+      "email": "mal.graty@googlemail.com"
+    },
+    {
+      "name": "Marc Kuo",
+      "email": "kuomarc2@gmail.com"
+    },
+    {
+      "name": "Marcello Bastea-Forte",
+      "email": "marcello@cellosoft.com"
+    },
+    {
+      "name": "Mark Banner",
+      "email": "standard8@mozilla.com"
+    },
+    {
+      "name": "Martin Marko",
+      "email": "marcus@gratex.com"
+    },
+    {
+      "name": "Matija Marohnić",
+      "email": "matija.marohnic@gmail.com"
+    },
+    {
+      "name": "Matt Robenolt",
+      "email": "matt@ydekproductions.com"
+    },
+    {
+      "name": "Matt Smith",
+      "email": "matthewgarysmith@gmail.com"
+    },
+    {
+      "name": "Matthew Shanley",
+      "email": "matthewshanley@littlesecretsrecords.com"
+    },
+    {
+      "name": "Mattias Tidlund",
+      "email": "mattias.tidlund@learningwell.se"
+    },
+    {
+      "name": "Michael Jackson",
+      "email": "mjijackson@gmail.com"
+    },
+    {
+      "name": "Michael Olson",
+      "email": "mwolson@member.fsf.org"
+    },
+    {
+      "name": "Michael Schoonmaker",
+      "email": "michael.r.schoonmaker@gmail.com"
+    },
+    {
+      "name": "Michal Charemza",
+      "email": "michalcharemza@gmail.com"
+    },
+    {
+      "name": "Moshe Kolodny",
+      "email": "mkolodny@integralads.com"
+    },
+    {
+      "name": "Nathan Black",
+      "email": "nathan@nathanblack.org"
+    },
+    {
+      "name": "Nick Fitzgerald",
+      "email": "fitzgen@gmail.com"
+    },
+    {
+      "name": "Nicolo Taddei",
+      "email": "taddei.uk@gmail.com"
+    },
+    {
+      "name": "Noshir Patel",
+      "email": "nosh@blackpiano.com"
+    },
+    {
+      "name": "OlegTsyba",
+      "email": "oleg.tsyba.ua@gmail.com"
+    },
+    {
+      "name": "Panu Horsmalahti",
+      "email": "panu.horsmalahti@iki.fi"
+    },
+    {
+      "name": "Pavel Zubkou",
+      "email": "pavel.zubkou@gmail.com"
+    },
+    {
+      "name": "Pete Hawkins",
+      "email": "pete@petes-imac.frontinternal.net"
+    },
+    {
+      "name": "Phil Sung",
+      "email": "psung@dnanexus.com"
+    },
+    {
+      "name": "Prayag Verma",
+      "email": "prayag.verma@gmail.com"
+    },
+    {
+      "name": "R56",
+      "email": "rviskus@gmail.com"
+    },
+    {
+      "name": "Refael Ackermann",
+      "email": "refael@empeeric.com"
+    },
+    {
+      "name": "Richard Dingwall",
+      "email": "rdingwall@gmail.com"
+    },
+    {
+      "name": "Richard Knop",
+      "email": "RichardKnop@users.noreply.github.com"
+    },
+    {
+      "name": "Rob Raux",
+      "email": "rraux@peachworks.com"
+    },
+    {
+      "name": "Rob Wu",
+      "email": "rob@robwu.nl"
+    },
+    {
+      "name": "Robert Rossmann",
+      "email": "rr.rossmann@me.com"
+    },
+    {
+      "name": "Romain Prieto",
+      "email": "romain.prieto@gmail.com"
+    },
+    {
+      "name": "Roman Neuhauser",
+      "email": "rneuhauser@suse.cz"
+    },
+    {
+      "name": "Roman Shtylman",
+      "email": "shtylman@gmail.com"
+    },
+    {
+      "name": "Russ Bradberry",
+      "email": "devdazed@me.com"
+    },
+    {
+      "name": "Russell Munson",
+      "email": "rmunson@github.com"
+    },
+    {
+      "name": "Rustem Mustafin",
+      "email": "mustafin@kt-labs.com"
+    },
+    {
+      "name": "Ryan Hubbard",
+      "email": "ryanmhubbard@gmail.com"
+    },
+    {
+      "name": "Ryan Shaw",
+      "email": "ryan.shaw@min.vc"
+    },
+    {
+      "name": "Salehen Shovon Rahman",
+      "email": "salehen.rahman@gmail.com"
+    },
+    {
+      "name": "Sam Mussell",
+      "email": "smussell@gmail.com"
+    },
+    {
+      "name": "Sasha Koss",
+      "email": "koss@nocorp.me"
+    },
+    {
+      "name": "ScottFreeCode",
+      "email": "ScottFreeCode@users.noreply.github.com"
+    },
+    {
+      "name": "Seiya Konno",
+      "email": "nulltask@gmail.com"
+    },
+    {
+      "name": "Sergey Simonchik",
+      "email": "sergey.simonchik@jetbrains.com"
+    },
+    {
+      "name": "Sergio Santoro",
+      "email": "santoro.srg@gmail.com"
+    },
+    {
+      "name": "Shaine Hatch",
+      "email": "shaine@squidtree.com"
+    },
+    {
+      "name": "Simon Goumaz",
+      "email": "simon@attentif.ch"
+    },
+    {
+      "name": "Sorin Iclanzan",
+      "email": "sorin@iclanzan.com"
+    },
+    {
+      "name": "Standa Opichal",
+      "email": "opichals@gmail.com"
+    },
+    {
+      "name": "Stephen Mathieson",
+      "email": "smath23@gmail.com"
+    },
+    {
+      "name": "Steve Mason",
+      "email": "stevem@brandwatch.com"
+    },
+    {
+      "name": "Stewart Taylor",
+      "email": "stewart.taylor1@gmail.com"
+    },
+    {
+      "name": "Stone",
+      "email": "baoshi.li@adleida.com"
+    },
+    {
+      "name": "Tapiwa Kelvin",
+      "email": "tapiwa@munzwa.tk"
+    },
+    {
+      "name": "Teddy Zeenny",
+      "email": "teddyzeenny@gmail.com"
+    },
+    {
+      "name": "Thedark1337",
+      "email": "thedark1337@thedark1337.com"
+    },
+    {
+      "name": "Tim Ehat",
+      "email": "timehat@gmail.com"
+    },
+    {
+      "name": "Tingan Ho",
+      "email": "tingan87@gmail.com"
+    },
+    {
+      "name": "Todd Agulnick",
+      "email": "tagulnick@onjack.com"
+    },
+    {
+      "name": "Tom Coquereau",
+      "email": "tom@thau.me"
+    },
+    {
+      "name": "Tom Hughes",
+      "email": "tom@compton.nu"
+    },
+    {
+      "name": "Vadim Nikitin",
+      "email": "vnikiti@ncsu.edu"
+    },
+    {
+      "name": "Victor Costan",
+      "email": "costan@gmail.com"
+    },
+    {
+      "name": "Will Langstroth",
+      "email": "william.langstroth@gmail.com"
+    },
+    {
+      "name": "Yanis Wang",
+      "email": "yanis.wang@gmail.com"
+    },
+    {
+      "name": "Yuest Wang",
+      "email": "yuestwang@gmail.com"
+    },
+    {
+      "name": "Zsolt Takács",
+      "email": "zsolt@takacs.cc"
+    },
+    {
+      "name": "abrkn",
+      "email": "a@abrkn.com"
+    },
+    {
+      "name": "airportyh",
+      "email": "airportyh@gmail.com"
+    },
+    {
+      "name": "amsul",
+      "email": "reach@amsul.ca"
+    },
+    {
+      "name": "badunk",
+      "email": "baduncaduncan@gmail.com"
+    },
+    {
+      "name": "claudyus",
+      "email": "claudyus@HEX.(none)",
+      "url": "none"
+    },
+    {
+      "name": "fengmk2",
+      "email": "fengmk2@gmail.com"
+    },
+    {
+      "name": "gaye",
+      "email": "gaye@mozilla.com"
+    },
+    {
+      "name": "gigadude",
+      "email": "gigadude@users.noreply.github.com"
+    },
+    {
+      "name": "grasGendarme",
+      "email": "me@grasgendar.me"
+    },
+    {
+      "name": "klaemo",
+      "email": "klaemo@fastmail.fm"
+    },
+    {
+      "name": "lakmeer",
+      "email": "lakmeerkravid@gmail.com"
+    },
+    {
+      "name": "lodr",
+      "email": "salva@unoyunodiez.com"
+    },
+    {
+      "name": "mrShturman",
+      "email": "mrshturman@gmail.com"
+    },
+    {
+      "name": "nexdrew",
+      "email": "andrew.goode@nextraq.com"
+    },
+    {
+      "name": "nishigori",
+      "email": "Takuya_Nishigori@voyagegroup.com"
+    },
+    {
+      "name": "omardelarosa",
+      "email": "thedelarosa@gmail.com"
+    },
+    {
+      "name": "qiuzuhui",
+      "email": "qiuzuhui@users.noreply.github.com"
+    },
+    {
+      "name": "ryym",
+      "email": "ryym.64@gmail.com"
+    },
+    {
+      "name": "samuel goldszmidt",
+      "email": "samuel.goldszmidt@gmail.com"
+    },
+    {
+      "name": "sebv",
+      "email": "seb.vincent@gmail.com"
+    },
+    {
+      "name": "slyg",
+      "email": "syl.faucherand@gmail.com"
+    },
+    {
+      "name": "startswithaj",
+      "email": "jake.mc@icloud.com"
+    },
+    {
+      "name": "tgautier@yahoo.com",
+      "email": "tgautier@gmail.com"
+    },
+    {
+      "name": "tmont",
+      "email": "tommy.mont@gmail.com"
+    },
+    {
+      "name": "traleig1",
+      "email": "darkphoenix739@gmail.com"
+    },
+    {
+      "name": "vlad",
+      "email": "iamvlad@gmail.com"
+    },
+    {
+      "name": "wsw",
+      "email": "wsw0108@gmail.com"
+    },
+    {
+      "name": "yuitest",
+      "email": "yuitest@cjhat.net"
+    },
+    {
+      "name": "Aaron Hamid",
+      "email": "aaron.hamid@gmail.com"
+    },
+    {
+      "name": "zhiyelee",
+      "email": "zhiyelee@gmail.com"
+    },
+    {
+      "name": "Aaron Krause",
+      "email": "aaronjkrause@gmail.com"
+    },
+    {
+      "name": "Adam Crabtree",
+      "email": "adam.crabtree@redrobotlabs.com"
+    },
+    {
+      "name": "Adrian Ludwig",
+      "email": "me@adrianludwig.pl"
+    },
+    {
+      "name": "Ajay Kodali",
+      "email": "ajay.kodali@citrix.com"
+    },
+    {
+      "name": "Andreas Brekken",
+      "email": "andreas@opuno.com"
+    },
+    {
+      "name": "Andrew Nesbitt",
+      "email": "andrewnez@gmail.com"
+    },
+    {
+      "name": "Andrey Popp",
+      "email": "8mayday@gmail.com"
+    },
+    {
+      "name": "Andrii Shumada",
+      "email": "eagleeyes91@gmail.com"
+    },
+    {
+      "name": "Anis Safine",
+      "email": "anis.safine.ext@francetv.fr"
+    },
+    {
+      "name": "Arnaud Brousseau",
+      "email": "arnaud.brousseau@gmail.com"
+    },
+    {
+      "name": "Atsuya Takagi",
+      "email": "asoftonight@gmail.com"
+    },
+    {
+      "name": "Austin Birch",
+      "email": "mraustinbirch@gmail.com"
+    },
+    {
+      "name": "Ben Noordhuis",
+      "email": "info@bnoordhuis.nl"
+    },
+    {
+      "name": "Ben Vinegar",
+      "email": "ben@benv.ca"
+    },
+    {
+      "name": "Benoit Larroque",
+      "email": "zeta.ben@gmail.com"
+    },
+    {
+      "name": "Benoît Zugmeyer",
+      "email": "bzugmeyer@gmail.com"
+    },
+    {
+      "name": "Berker Peksag",
+      "email": "berker.peksag@gmail.com"
+    },
+    {
+      "name": "Bjørge Næss",
+      "email": "bjoerge@origo.no"
+    },
+    {
+      "name": "Brian Lalor",
+      "email": "blalor@bravo5.org"
+    },
+    {
+      "name": "Brian M. Carlson",
+      "email": "brian.m.carlson@gmail.com"
+    },
+    {
+      "name": "Brian Moore",
+      "email": "guardbionic-github@yahoo.com"
+    },
+    {
+      "name": "Bryan Donovan",
+      "email": "bdondo@gmail.com"
+    },
+    {
+      "name": "C. Scott Ananian",
+      "email": "cscott@cscott.net"
+    },
+    {
+      "name": "Casey Foster",
+      "email": "casey@caseywebdev.com"
+    },
+    {
+      "name": "Charles Lowell",
+      "email": "cowboyd@frontside.io"
+    },
+    {
+      "name": "Chris Buckley",
+      "email": "chris@cmbuckley.co.uk"
+    },
+    {
+      "name": "ChrisWren",
+      "email": "cthewren@gmail.com"
+    },
+    {
+      "name": "Connor Dunn",
+      "email": "connorhd@gmail.com"
+    },
+    {
+      "name": "Corey Butler",
+      "email": "corey@coreybutler.com"
+    },
+    {
+      "name": "Daniel Stockman",
+      "email": "daniel.stockman@gmail.com"
+    },
+    {
+      "name": "Dave McKenna",
+      "email": "davemckenna01@gmail.com"
+    },
+    {
+      "name": "Denis Bardadym",
+      "email": "bardadymchik@gmail.com"
+    },
+    {
+      "name": "Devin Weaver",
+      "email": "suki@tritarget.org"
+    },
+    {
+      "name": "Di Wu",
+      "email": "dwu@palantir.com"
+    },
+    {
+      "name": "Diogo Monteiro",
+      "email": "diogo.gmt@gmail.com"
+    },
+    {
+      "name": "Dmitry Shirokov",
+      "email": "deadrunk@gmail.com"
+    },
+    {
+      "name": "Dominic Barnes",
+      "email": "dominic@dbarnes.info"
+    },
+    {
+      "name": "Douglas Christopher Wilson",
+      "email": "doug@somethingdoug.com"
+    },
+    {
+      "name": "Duncan Beevers",
+      "email": "duncan@dweebd.com"
+    },
+    {
+      "name": "Fede Ramirez",
+      "email": "i@2fd.me"
+    },
+    {
+      "name": "Fedor Indutny",
+      "email": "fedor.indutny@gmail.com"
+    },
+    {
+      "name": "Florian Margaine",
+      "email": "florian@margaine.com"
+    },
+    {
+      "name": "Frederico Silva",
+      "email": "frederico.silva@gmail.com"
+    },
+    {
+      "name": "Fredrik Lindin",
+      "email": "fredriklindin@gmail.com"
+    },
+    {
+      "name": "Gabriel Silk",
+      "email": "gabesilk@gmail.com"
+    },
+    {
+      "name": "Gareth Murphy",
+      "email": "gareth.cpm@gmail.com"
+    },
+    {
+      "name": "Gavin Mogan",
+      "email": "GavinM@airg.com"
+    },
+    {
+      "name": "Giovanni Bassi",
+      "email": "giggio@giggio.net"
+    },
+    {
+      "name": "Glen Huang",
+      "email": "curvedmark@gmail.com"
+    },
+    {
+      "name": "Greg Perkins",
+      "email": "gregperkins@alum.mit.edu"
+    },
+    {
+      "name": "Guy Arye",
+      "email": "arye.guy@gmail.com"
+    },
+    {
+      "name": "Gyandeep Singh",
+      "email": "gyandeeps@gmail.com"
+    },
+    {
+      "name": "Harish",
+      "email": "hyeluri@gmail.com"
+    },
+    {
+      "name": "Harry Brundage",
+      "email": "harry.brundage@gmail.com"
+    },
+    {
+      "name": "Herman Junge",
+      "email": "herman@geekli.st"
+    },
+    {
+      "name": "Ian Young",
+      "email": "ian.greenleaf@gmail.com"
+    },
+    {
+      "name": "Ian Zamojc",
+      "email": "ian@thesecretlocation.net"
+    },
+    {
+      "name": "Ivan",
+      "email": "ivan@kinvey.com"
+    },
+    {
+      "name": "JP Bochi",
+      "email": "jpbochi@gmail.com"
+    },
+    {
+      "name": "Jaakko Salonen",
+      "email": "jaakko.salonen@iki.fi"
+    },
+    {
+      "name": "Jake Craige",
+      "email": "james.craige@gmail.com"
+    },
+    {
+      "name": "Jake Marsh",
+      "email": "jakemmarsh@gmail.com"
+    },
+    {
+      "name": "Jakub Nešetřil",
+      "email": "jakub@apiary.io"
+    },
+    {
+      "name": "James Bowes",
+      "email": "jbowes@repl.ca"
+    },
+    {
+      "name": "James G. Kim",
+      "email": "jgkim@jayg.org"
+    },
+    {
+      "name": "James Lal",
+      "email": "james@lightsofapollo.com"
+    },
+    {
+      "name": "Jan Kopriva",
+      "email": "jan.kopriva@gooddata.com"
+    },
+    {
+      "name": "Jason Barry",
+      "email": "jay@jcbarry.com"
+    },
+    {
+      "name": "Jason Lai",
+      "email": "jason@getpebble.com"
+    },
+    {
+      "name": "Javier Aranda",
+      "email": "javierav@javierav.com"
+    },
+    {
+      "name": "Jean Ponchon",
+      "email": "gelule@gmail.com"
+    },
+    {
+      "name": "Jeff Kunkle",
+      "email": "jeff.kunkle@nearinfinity.com"
+    },
+    {
+      "name": "Jeff Schilling",
+      "email": "jeff.schilling@q2ebanking.com"
+    },
+    {
+      "name": "Jeremy Martin",
+      "email": "jmar777@gmail.com"
+    },
+    {
+      "name": "Jimmy Cuadra",
+      "email": "jimmy@jimmycuadra.com"
+    },
+    {
+      "name": "Joao Moreno",
+      "email": "mail@joaomoreno.com"
+    },
+    {
+      "name": "Joey Cozza",
+      "email": "joey@grow.com"
+    },
+    {
+      "name": "John Doty",
+      "email": "jrhdoty@gmail.com"
+    },
+    {
+      "name": "Johnathon Sanders",
+      "email": "outdooricon@gmail.com"
+    },
+    {
+      "name": "Jonas Dohse",
+      "email": "jonas@mbr-targeting.com"
+    },
+    {
+      "name": "Jonathan Creamer",
+      "email": "matrixhasyou2k4@gmail.com"
+    },
+    {
+      "name": "Jonathan Delgado",
+      "email": "jdelgado@rewip.com"
+    },
+    {
+      "name": "Jonathan Kim",
+      "email": "jkimbo@gmail.com"
+    },
+    {
+      "name": "Jonathan Park",
+      "email": "jpark@daptiv.com"
+    }
+  ],
+  "dependencies": {
+    "commander": "2.3.0",
+    "debug": "2.2.0",
+    "diff": "1.4.0",
+    "escape-string-regexp": "1.0.2",
+    "glob": "3.2.11",
+    "growl": "1.9.2",
+    "jade": "0.26.3",
+    "mkdirp": "0.5.1",
+    "supports-color": "1.2.0",
+    "to-iso-string": "0.0.2"
+  },
+  "deprecated": false,
+  "description": "simple, flexible, fun test framework",
+  "devDependencies": {
+    "browser-stdout": "^1.2.0",
+    "browserify": "^13.0.0",
+    "coffee-script": "~1.8.0",
+    "eslint": "^1.2.1",
+    "expect.js": "^0.3.1",
+    "karma": "^0.13.22",
+    "karma-browserify": "^5.0.5",
+    "karma-expect": "^1.1.2",
+    "karma-no-mocha": "^2.0.0",
+    "karma-phantomjs-launcher": "^0.2.3",
+    "karma-sauce-launcher": "^1.0.0",
+    "karma-spec-reporter": "0.0.26",
+    "phantomjs": "1.9.8",
+    "should": "~8.0.0",
+    "through2": "~0.6.5",
+    "watchify": "^3.7.0"
+  },
+  "engines": {
+    "node": ">= 0.8.x"
+  },
+  "files": [
+    "bin",
+    "images",
+    "lib",
+    "index.js",
+    "mocha.css",
+    "mocha.js",
+    "LICENSE"
+  ],
+  "homepage": "https://github.com/mochajs/mocha#readme",
+  "keywords": [
+    "mocha",
+    "test",
+    "bdd",
+    "tdd",
+    "tap"
+  ],
+  "license": "MIT",
+  "licenses": [
+    {
+      "type": "MIT",
+      "url": "https://raw.github.com/mochajs/mocha/master/LICENSE"
+    }
+  ],
+  "name": "mocha",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/mochajs/mocha.git"
+  },
+  "scripts": {
+    "test": "make test"
+  },
+  "version": "2.5.3"
+}
diff --git a/node_modules/quick-local-ip/.npmignore b/node_modules/quick-local-ip/.npmignore
new file mode 100644
index 0000000..d4d49b0
--- /dev/null
+++ b/node_modules/quick-local-ip/.npmignore
@@ -0,0 +1,10 @@
+.DS_Store
+.nodemonignore
+.sass-cache/
+npm-debug.log
+node_modules/
+public/lib
+app/tests/coverage/
+.bower-*/
+.idea/
+.svn/
diff --git a/node_modules/quick-local-ip/LICENSE b/node_modules/quick-local-ip/LICENSE
new file mode 100644
index 0000000..e6de8ca
--- /dev/null
+++ b/node_modules/quick-local-ip/LICENSE
@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Alok Guha
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+
diff --git a/node_modules/quick-local-ip/README.md b/node_modules/quick-local-ip/README.md
new file mode 100644
index 0000000..9bdc58c
--- /dev/null
+++ b/node_modules/quick-local-ip/README.md
@@ -0,0 +1,28 @@
+# Quick-local-ip
+
+quick-local-ip is a utility module which provides straight-forward access to local network addresses. it provides 2 functions to get local ip addresses.
+
+### Installation
+
+    npm install --save quick-local-ip
+
+- If System is connected to multiple internet connections like wifi and ethernet and usb internet, following methods will return any active internet address in string format.
+- If System is connected with one internet connection, methods will return ip address in string format.
+- If system is not connected with internet default local address will be returned by all methods.
+- These method will never return null or undefined.
+
+
+
+## Quick Examples
+
+var myip = require('quick-local-ip');
+
+### getting ip4 network address of local system.
+
+    myip.getLocalIP4();
+
+
+### getting ip6 network address of local system
+
+    myip.getLocalIP6();
+
diff --git a/node_modules/quick-local-ip/index.js b/node_modules/quick-local-ip/index.js
new file mode 100644
index 0000000..c1eb210
--- /dev/null
+++ b/node_modules/quick-local-ip/index.js
@@ -0,0 +1,43 @@
+/**
+ * Created by alokguha on 25/09/15.
+ */
+'use strict'
+var ni = require('os').networkInterfaces();
+module.exports = {
+    getLocalIP4: function() {
+        var ipAddress = [];
+        for(var key in ni){
+            for(var index in ni[key]){
+                if(ni[key][index].family === 'IPv4' && !ni[key][index].internal){
+                    ipAddress.push(ni[key][index].address);
+                }
+            }
+        }
+        if(ipAddress.length > 1){
+            return ipAddress[Math.floor(Math.random() * ((ipAddress.length - 1) - 0 + 1)) + 0];
+        }else if(ipAddress.length == 1){
+            return ipAddress[0];
+        }else{
+            return '127.0.0.1';
+        }
+
+    },
+    getLocalIP6: function() {
+        var ipAddress = [];
+        for(var key in ni){
+            for(var index in ni[key]){
+                if(ni[key][index].family === 'IPv6' && !ni[key][index].internal){
+                    ipAddress.push(ni[key][index].address);
+                }
+            }
+        }
+        if(ipAddress.length > 1){
+            return ipAddress[Math.floor(Math.random() * ((ipAddress.length - 1) - 0 + 1)) + 0];
+        }else if(ipAddress.length == 1){
+            return ipAddress[0];
+        }else{
+            return 'fc00::/7';
+        }
+
+    }
+};
diff --git a/node_modules/quick-local-ip/package.json b/node_modules/quick-local-ip/package.json
new file mode 100644
index 0000000..6716b3a
--- /dev/null
+++ b/node_modules/quick-local-ip/package.json
@@ -0,0 +1,65 @@
+{
+  "_from": "quick-local-ip",
+  "_id": "quick-local-ip@1.0.7",
+  "_inBundle": false,
+  "_integrity": "sha1-S9oQKeXm2iGNtwLfcsJK3eFKpMc=",
+  "_location": "/quick-local-ip",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "tag",
+    "registry": true,
+    "raw": "quick-local-ip",
+    "name": "quick-local-ip",
+    "escapedName": "quick-local-ip",
+    "rawSpec": "",
+    "saveSpec": null,
+    "fetchSpec": "latest"
+  },
+  "_requiredBy": [
+    "#USER",
+    "/"
+  ],
+  "_resolved": "https://registry.npmjs.org/quick-local-ip/-/quick-local-ip-1.0.7.tgz",
+  "_shasum": "4bda1029e5e6da218db702df72c24adde14aa4c7",
+  "_spec": "quick-local-ip",
+  "_where": "/home/clemens/Dokumente/git/pixelnode",
+  "author": {
+    "name": "Alok Guha"
+  },
+  "bugs": {
+    "url": "https://github.com/aloksguha/myip/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {
+    "mocha": "^2.3.3"
+  },
+  "deprecated": false,
+  "description": "This is a tiny utility to get local ip address with in node applications.",
+  "homepage": "https://github.com/aloksguha/myip#readme",
+  "keywords": [
+    "nodejs",
+    "npm",
+    "local ip",
+    "network",
+    "ip4",
+    "ip6",
+    "netmask"
+  ],
+  "license": "MIT",
+  "main": "index.js",
+  "maintainers": [
+    {
+      "name": "aloksguha",
+      "email": "aloksguha@gmail.com"
+    }
+  ],
+  "name": "quick-local-ip",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/aloksguha/myip.git"
+  },
+  "scripts": {
+    "test": "mocha t7st"
+  },
+  "version": "1.0.7"
+}
diff --git a/node_modules/quick-local-ip/test.js b/node_modules/quick-local-ip/test.js
new file mode 100644
index 0000000..b577b7a
--- /dev/null
+++ b/node_modules/quick-local-ip/test.js
@@ -0,0 +1,19 @@
+/**
+ * Created by alokguha on 25/09/15.
+ */
+var network = require('./index');
+var assert = require("assert");
+describe('MyIp Tests', function() {
+    //Undefined Test
+    describe('Undefined Test', function () {
+        it('variable network should not be undefined', function () {
+            assert.notEqual(network,undefined);
+        });
+        it('variable network.getLocalIP4 should not be undefined', function () {
+            assert.notEqual(network.getLocalIP4(),undefined);
+        });
+        it('variable network.getLocalIP6 should not be undefined', function () {
+            assert.notEqual(network.getLocalIP6(),undefined);
+        });
+    });
+});
\ No newline at end of file
diff --git a/node_modules/sigmund/LICENSE b/node_modules/sigmund/LICENSE
new file mode 100644
index 0000000..19129e3
--- /dev/null
+++ b/node_modules/sigmund/LICENSE
@@ -0,0 +1,15 @@
+The ISC License
+
+Copyright (c) Isaac Z. Schlueter and Contributors
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
+IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/node_modules/sigmund/README.md b/node_modules/sigmund/README.md
new file mode 100644
index 0000000..25a38a5
--- /dev/null
+++ b/node_modules/sigmund/README.md
@@ -0,0 +1,53 @@
+# sigmund
+
+Quick and dirty signatures for Objects.
+
+This is like a much faster `deepEquals` comparison, which returns a
+string key suitable for caches and the like.
+
+## Usage
+
+```javascript
+function doSomething (someObj) {
+  var key = sigmund(someObj, maxDepth) // max depth defaults to 10
+  var cached = cache.get(key)
+  if (cached) return cached
+
+  var result = expensiveCalculation(someObj)
+  cache.set(key, result)
+  return result
+}
+```
+
+The resulting key will be as unique and reproducible as calling
+`JSON.stringify` or `util.inspect` on the object, but is much faster.
+In order to achieve this speed, some differences are glossed over.
+For example, the object `{0:'foo'}` will be treated identically to the
+array `['foo']`.
+
+Also, just as there is no way to summon the soul from the scribblings
+of a cocaine-addled psychoanalyst, there is no way to revive the object
+from the signature string that sigmund gives you.  In fact, it's
+barely even readable.
+
+As with `util.inspect` and `JSON.stringify`, larger objects will
+produce larger signature strings.
+
+Because sigmund is a bit less strict than the more thorough
+alternatives, the strings will be shorter, and also there is a
+slightly higher chance for collisions.  For example, these objects
+have the same signature:
+
+    var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]}
+    var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']}
+
+Like a good Freudian, sigmund is most effective when you already have
+some understanding of what you're looking for.  It can help you help
+yourself, but you must be willing to do some work as well.
+
+Cycles are handled, and cyclical objects are silently omitted (though
+the key is included in the signature output.)
+
+The second argument is the maximum depth, which defaults to 10,
+because that is the maximum object traversal depth covered by most
+insurance carriers.
diff --git a/node_modules/sigmund/bench.js b/node_modules/sigmund/bench.js
new file mode 100644
index 0000000..5acfd6d
--- /dev/null
+++ b/node_modules/sigmund/bench.js
@@ -0,0 +1,283 @@
+// different ways to id objects
+// use a req/res pair, since it's crazy deep and cyclical
+
+// sparseFE10 and sigmund are usually pretty close, which is to be expected,
+// since they are essentially the same algorithm, except that sigmund handles
+// regular expression objects properly.
+
+
+var http = require('http')
+var util = require('util')
+var sigmund = require('./sigmund.js')
+var sreq, sres, creq, cres, test
+
+http.createServer(function (q, s) {
+  sreq = q
+  sres = s
+  sres.end('ok')
+  this.close(function () { setTimeout(function () {
+    start()
+  }, 200) })
+}).listen(1337, function () {
+  creq = http.get({ port: 1337 })
+  creq.on('response', function (s) { cres = s })
+})
+
+function start () {
+  test = [sreq, sres, creq, cres]
+  // test = sreq
+  // sreq.sres = sres
+  // sreq.creq = creq
+  // sreq.cres = cres
+
+  for (var i in exports.compare) {
+    console.log(i)
+    var hash = exports.compare[i]()
+    console.log(hash)
+    console.log(hash.length)
+    console.log('')
+  }
+
+  require('bench').runMain()
+}
+
+function customWs (obj, md, d) {
+  d = d || 0
+  var to = typeof obj
+  if (to === 'undefined' || to === 'function' || to === null) return ''
+  if (d > md || !obj || to !== 'object') return ('' + obj).replace(/[\n ]+/g, '')
+
+  if (Array.isArray(obj)) {
+    return obj.map(function (i, _, __) {
+      return customWs(i, md, d + 1)
+    }).reduce(function (a, b) { return a + b }, '')
+  }
+
+  var keys = Object.keys(obj)
+  return keys.map(function (k, _, __) {
+    return k + ':' + customWs(obj[k], md, d + 1)
+  }).reduce(function (a, b) { return a + b }, '')
+}
+
+function custom (obj, md, d) {
+  d = d || 0
+  var to = typeof obj
+  if (to === 'undefined' || to === 'function' || to === null) return ''
+  if (d > md || !obj || to !== 'object') return '' + obj
+
+  if (Array.isArray(obj)) {
+    return obj.map(function (i, _, __) {
+      return custom(i, md, d + 1)
+    }).reduce(function (a, b) { return a + b }, '')
+  }
+
+  var keys = Object.keys(obj)
+  return keys.map(function (k, _, __) {
+    return k + ':' + custom(obj[k], md, d + 1)
+  }).reduce(function (a, b) { return a + b }, '')
+}
+
+function sparseFE2 (obj, maxDepth) {
+  var seen = []
+  var soFar = ''
+  function ch (v, depth) {
+    if (depth > maxDepth) return
+    if (typeof v === 'function' || typeof v === 'undefined') return
+    if (typeof v !== 'object' || !v) {
+      soFar += v
+      return
+    }
+    if (seen.indexOf(v) !== -1 || depth === maxDepth) return
+    seen.push(v)
+    soFar += '{'
+    Object.keys(v).forEach(function (k, _, __) {
+      // pseudo-private values.  skip those.
+      if (k.charAt(0) === '_') return
+      var to = typeof v[k]
+      if (to === 'function' || to === 'undefined') return
+      soFar += k + ':'
+      ch(v[k], depth + 1)
+    })
+    soFar += '}'
+  }
+  ch(obj, 0)
+  return soFar
+}
+
+function sparseFE (obj, maxDepth) {
+  var seen = []
+  var soFar = ''
+  function ch (v, depth) {
+    if (depth > maxDepth) return
+    if (typeof v === 'function' || typeof v === 'undefined') return
+    if (typeof v !== 'object' || !v) {
+      soFar += v
+      return
+    }
+    if (seen.indexOf(v) !== -1 || depth === maxDepth) return
+    seen.push(v)
+    soFar += '{'
+    Object.keys(v).forEach(function (k, _, __) {
+      // pseudo-private values.  skip those.
+      if (k.charAt(0) === '_') return
+      var to = typeof v[k]
+      if (to === 'function' || to === 'undefined') return
+      soFar += k
+      ch(v[k], depth + 1)
+    })
+  }
+  ch(obj, 0)
+  return soFar
+}
+
+function sparse (obj, maxDepth) {
+  var seen = []
+  var soFar = ''
+  function ch (v, depth) {
+    if (depth > maxDepth) return
+    if (typeof v === 'function' || typeof v === 'undefined') return
+    if (typeof v !== 'object' || !v) {
+      soFar += v
+      return
+    }
+    if (seen.indexOf(v) !== -1 || depth === maxDepth) return
+    seen.push(v)
+    soFar += '{'
+    for (var k in v) {
+      // pseudo-private values.  skip those.
+      if (k.charAt(0) === '_') continue
+      var to = typeof v[k]
+      if (to === 'function' || to === 'undefined') continue
+      soFar += k
+      ch(v[k], depth + 1)
+    }
+  }
+  ch(obj, 0)
+  return soFar
+}
+
+function noCommas (obj, maxDepth) {
+  var seen = []
+  var soFar = ''
+  function ch (v, depth) {
+    if (depth > maxDepth) return
+    if (typeof v === 'function' || typeof v === 'undefined') return
+    if (typeof v !== 'object' || !v) {
+      soFar += v
+      return
+    }
+    if (seen.indexOf(v) !== -1 || depth === maxDepth) return
+    seen.push(v)
+    soFar += '{'
+    for (var k in v) {
+      // pseudo-private values.  skip those.
+      if (k.charAt(0) === '_') continue
+      var to = typeof v[k]
+      if (to === 'function' || to === 'undefined') continue
+      soFar += k + ':'
+      ch(v[k], depth + 1)
+    }
+    soFar += '}'
+  }
+  ch(obj, 0)
+  return soFar
+}
+
+
+function flatten (obj, maxDepth) {
+  var seen = []
+  var soFar = ''
+  function ch (v, depth) {
+    if (depth > maxDepth) return
+    if (typeof v === 'function' || typeof v === 'undefined') return
+    if (typeof v !== 'object' || !v) {
+      soFar += v
+      return
+    }
+    if (seen.indexOf(v) !== -1 || depth === maxDepth) return
+    seen.push(v)
+    soFar += '{'
+    for (var k in v) {
+      // pseudo-private values.  skip those.
+      if (k.charAt(0) === '_') continue
+      var to = typeof v[k]
+      if (to === 'function' || to === 'undefined') continue
+      soFar += k + ':'
+      ch(v[k], depth + 1)
+      soFar += ','
+    }
+    soFar += '}'
+  }
+  ch(obj, 0)
+  return soFar
+}
+
+exports.compare =
+{
+  // 'custom 2': function () {
+  //   return custom(test, 2, 0)
+  // },
+  // 'customWs 2': function () {
+  //   return customWs(test, 2, 0)
+  // },
+  'JSON.stringify (guarded)': function () {
+    var seen = []
+    return JSON.stringify(test, function (k, v) {
+      if (typeof v !== 'object' || !v) return v
+      if (seen.indexOf(v) !== -1) return undefined
+      seen.push(v)
+      return v
+    })
+  },
+
+  'flatten 10': function () {
+    return flatten(test, 10)
+  },
+
+  // 'flattenFE 10': function () {
+  //   return flattenFE(test, 10)
+  // },
+
+  'noCommas 10': function () {
+    return noCommas(test, 10)
+  },
+
+  'sparse 10': function () {
+    return sparse(test, 10)
+  },
+
+  'sparseFE 10': function () {
+    return sparseFE(test, 10)
+  },
+
+  'sparseFE2 10': function () {
+    return sparseFE2(test, 10)
+  },
+
+  sigmund: function() {
+    return sigmund(test, 10)
+  },
+
+
+  // 'util.inspect 1': function () {
+  //   return util.inspect(test, false, 1, false)
+  // },
+  // 'util.inspect undefined': function () {
+  //   util.inspect(test)
+  // },
+  // 'util.inspect 2': function () {
+  //   util.inspect(test, false, 2, false)
+  // },
+  // 'util.inspect 3': function () {
+  //   util.inspect(test, false, 3, false)
+  // },
+  // 'util.inspect 4': function () {
+  //   util.inspect(test, false, 4, false)
+  // },
+  // 'util.inspect Infinity': function () {
+  //   util.inspect(test, false, Infinity, false)
+  // }
+}
+
+/** results
+**/
diff --git a/node_modules/sigmund/package.json b/node_modules/sigmund/package.json
new file mode 100644
index 0000000..e9e7b55
--- /dev/null
+++ b/node_modules/sigmund/package.json
@@ -0,0 +1,63 @@
+{
+  "_from": "sigmund@~1.0.0",
+  "_id": "sigmund@1.0.1",
+  "_inBundle": false,
+  "_integrity": "sha1-P/IfGYytIXX587eBhT/ZTQ0ZtZA=",
+  "_location": "/sigmund",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "range",
+    "registry": true,
+    "raw": "sigmund@~1.0.0",
+    "name": "sigmund",
+    "escapedName": "sigmund",
+    "rawSpec": "~1.0.0",
+    "saveSpec": null,
+    "fetchSpec": "~1.0.0"
+  },
+  "_requiredBy": [
+    "/minimatch"
+  ],
+  "_resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz",
+  "_shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590",
+  "_spec": "sigmund@~1.0.0",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/minimatch",
+  "author": {
+    "name": "Isaac Z. Schlueter",
+    "email": "i@izs.me",
+    "url": "http://blog.izs.me/"
+  },
+  "bugs": {
+    "url": "https://github.com/isaacs/sigmund/issues"
+  },
+  "bundleDependencies": false,
+  "dependencies": {},
+  "deprecated": false,
+  "description": "Quick and dirty signatures for Objects.",
+  "devDependencies": {
+    "tap": "~0.3.0"
+  },
+  "directories": {
+    "test": "test"
+  },
+  "homepage": "https://github.com/isaacs/sigmund#readme",
+  "keywords": [
+    "object",
+    "signature",
+    "key",
+    "data",
+    "psychoanalysis"
+  ],
+  "license": "ISC",
+  "main": "sigmund.js",
+  "name": "sigmund",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/isaacs/sigmund.git"
+  },
+  "scripts": {
+    "bench": "node bench.js",
+    "test": "tap test/*.js"
+  },
+  "version": "1.0.1"
+}
diff --git a/node_modules/sigmund/sigmund.js b/node_modules/sigmund/sigmund.js
new file mode 100644
index 0000000..82c7ab8
--- /dev/null
+++ b/node_modules/sigmund/sigmund.js
@@ -0,0 +1,39 @@
+module.exports = sigmund
+function sigmund (subject, maxSessions) {
+    maxSessions = maxSessions || 10;
+    var notes = [];
+    var analysis = '';
+    var RE = RegExp;
+
+    function psychoAnalyze (subject, session) {
+        if (session > maxSessions) return;
+
+        if (typeof subject === 'function' ||
+            typeof subject === 'undefined') {
+            return;
+        }
+
+        if (typeof subject !== 'object' || !subject ||
+            (subject instanceof RE)) {
+            analysis += subject;
+            return;
+        }
+
+        if (notes.indexOf(subject) !== -1 || session === maxSessions) return;
+
+        notes.push(subject);
+        analysis += '{';
+        Object.keys(subject).forEach(function (issue, _, __) {
+            // pseudo-private values.  skip those.
+            if (issue.charAt(0) === '_') return;
+            var to = typeof subject[issue];
+            if (to === 'function' || to === 'undefined') return;
+            analysis += issue;
+            psychoAnalyze(subject[issue], session + 1);
+        });
+    }
+    psychoAnalyze(subject, 0);
+    return analysis;
+}
+
+// vim: set softtabstop=4 shiftwidth=4:
diff --git a/node_modules/sigmund/test/basic.js b/node_modules/sigmund/test/basic.js
new file mode 100644
index 0000000..50c53a1
--- /dev/null
+++ b/node_modules/sigmund/test/basic.js
@@ -0,0 +1,24 @@
+var test = require('tap').test
+var sigmund = require('../sigmund.js')
+
+
+// occasionally there are duplicates
+// that's an acceptable edge-case.  JSON.stringify and util.inspect
+// have some collision potential as well, though less, and collision
+// detection is expensive.
+var hash = '{abc/def/g{0h1i2{jkl'
+var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]}
+var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']}
+
+var obj3 = JSON.parse(JSON.stringify(obj1))
+obj3.c = /def/
+obj3.g[2].cycle = obj3
+var cycleHash = '{abc/def/g{0h1i2{jklcycle'
+
+test('basic', function (t) {
+    t.equal(sigmund(obj1), hash)
+    t.equal(sigmund(obj2), hash)
+    t.equal(sigmund(obj3), cycleHash)
+    t.end()
+})
+
diff --git a/node_modules/supports-color/cli.js b/node_modules/supports-color/cli.js
new file mode 100755
index 0000000..e746987
--- /dev/null
+++ b/node_modules/supports-color/cli.js
@@ -0,0 +1,29 @@
+#!/usr/bin/env node
+'use strict';
+var pkg = require('./package.json');
+var supportsColor = require('./');
+var argv = process.argv.slice(2);
+
+function help() {
+	console.log([
+		'',
+		'  ' + pkg.description,
+		'',
+		'  Usage',
+		'    supports-color',
+		'',
+		'  Exits with code 0 if color is supported and 1 if not'
+	].join('\n'));
+}
+
+if (argv.indexOf('--help') !== -1) {
+	help();
+	return;
+}
+
+if (argv.indexOf('--version') !== -1) {
+	console.log(pkg.version);
+	return;
+}
+
+process.exit(supportsColor ? 0 : 1);
diff --git a/node_modules/supports-color/index.js b/node_modules/supports-color/index.js
new file mode 100644
index 0000000..a2b9784
--- /dev/null
+++ b/node_modules/supports-color/index.js
@@ -0,0 +1,39 @@
+'use strict';
+var argv = process.argv;
+
+module.exports = (function () {
+	if (argv.indexOf('--no-color') !== -1 ||
+		argv.indexOf('--no-colors') !== -1 ||
+		argv.indexOf('--color=false') !== -1) {
+		return false;
+	}
+
+	if (argv.indexOf('--color') !== -1 ||
+		argv.indexOf('--colors') !== -1 ||
+		argv.indexOf('--color=true') !== -1 ||
+		argv.indexOf('--color=always') !== -1) {
+		return true;
+	}
+
+	if (process.stdout && !process.stdout.isTTY) {
+		return false;
+	}
+
+	if (process.platform === 'win32') {
+		return true;
+	}
+
+	if ('COLORTERM' in process.env) {
+		return true;
+	}
+
+	if (process.env.TERM === 'dumb') {
+		return false;
+	}
+
+	if (/^screen|^xterm|^vt100|color|ansi|cygwin|linux/i.test(process.env.TERM)) {
+		return true;
+	}
+
+	return false;
+})();
diff --git a/node_modules/supports-color/package.json b/node_modules/supports-color/package.json
new file mode 100644
index 0000000..fc1436e
--- /dev/null
+++ b/node_modules/supports-color/package.json
@@ -0,0 +1,83 @@
+{
+  "_from": "supports-color@1.2.0",
+  "_id": "supports-color@1.2.0",
+  "_inBundle": false,
+  "_integrity": "sha1-/x7R5hFp0Gs88tWI4YixjYhH4X4=",
+  "_location": "/supports-color",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "supports-color@1.2.0",
+    "name": "supports-color",
+    "escapedName": "supports-color",
+    "rawSpec": "1.2.0",
+    "saveSpec": null,
+    "fetchSpec": "1.2.0"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/supports-color/-/supports-color-1.2.0.tgz",
+  "_shasum": "ff1ed1e61169d06b3cf2d588e188b18d8847e17e",
+  "_spec": "supports-color@1.2.0",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "author": {
+    "name": "Sindre Sorhus",
+    "email": "sindresorhus@gmail.com",
+    "url": "http://sindresorhus.com"
+  },
+  "bin": {
+    "supports-color": "cli.js"
+  },
+  "bugs": {
+    "url": "https://github.com/sindresorhus/supports-color/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "Detect whether a terminal supports color",
+  "devDependencies": {
+    "mocha": "*",
+    "require-uncached": "^1.0.2"
+  },
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "files": [
+    "index.js",
+    "cli.js"
+  ],
+  "homepage": "https://github.com/sindresorhus/supports-color#readme",
+  "keywords": [
+    "cli",
+    "bin",
+    "color",
+    "colour",
+    "colors",
+    "terminal",
+    "console",
+    "cli",
+    "ansi",
+    "styles",
+    "tty",
+    "rgb",
+    "256",
+    "shell",
+    "xterm",
+    "command-line",
+    "support",
+    "supports",
+    "capability",
+    "detect"
+  ],
+  "license": "MIT",
+  "name": "supports-color",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/sindresorhus/supports-color.git"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "version": "1.2.0"
+}
diff --git a/node_modules/supports-color/readme.md b/node_modules/supports-color/readme.md
new file mode 100644
index 0000000..32d4f46
--- /dev/null
+++ b/node_modules/supports-color/readme.md
@@ -0,0 +1,44 @@
+# supports-color [![Build Status](https://travis-ci.org/sindresorhus/supports-color.svg?branch=master)](https://travis-ci.org/sindresorhus/supports-color)
+
+> Detect whether a terminal supports color
+
+
+## Install
+
+```sh
+$ npm install --save supports-color
+```
+
+
+## Usage
+
+```js
+var supportsColor = require('supports-color');
+
+if (supportsColor) {
+	console.log('Terminal supports color');
+}
+```
+
+It obeys the `--color` and `--no-color` CLI flags.
+
+
+## CLI
+
+```sh
+$ npm install --global supports-color
+```
+
+```
+$ supports-color --help
+
+  Usage
+    supports-color
+
+  Exits with code 0 if color is supported and 1 if not
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/node_modules/to-iso-string/.npmignore b/node_modules/to-iso-string/.npmignore
new file mode 100644
index 0000000..665aa21
--- /dev/null
+++ b/node_modules/to-iso-string/.npmignore
@@ -0,0 +1,3 @@
+components
+build
+node_modules
diff --git a/node_modules/to-iso-string/History.md b/node_modules/to-iso-string/History.md
new file mode 100644
index 0000000..f23b31e
--- /dev/null
+++ b/node_modules/to-iso-string/History.md
@@ -0,0 +1,9 @@
+
+0.0.2 - May 12, 2015
+--------------------
+
+- Fix npm publish issue
+
+0.0.1 - October 16, 2013
+------------------------
+:sparkles:
diff --git a/node_modules/to-iso-string/Makefile b/node_modules/to-iso-string/Makefile
new file mode 100644
index 0000000..9600296
--- /dev/null
+++ b/node_modules/to-iso-string/Makefile
@@ -0,0 +1,17 @@
+
+build: components node_modules
+	@component build --dev
+
+clean:
+	@rm -rf components build node_modules
+
+components: component.json
+	@component install --dev
+
+node_modules: package.json
+	@npm install
+
+test: build
+	@./node_modules/.bin/mocha --reporter spec
+
+.PHONY: clean test
\ No newline at end of file
diff --git a/node_modules/to-iso-string/Readme.md b/node_modules/to-iso-string/Readme.md
new file mode 100644
index 0000000..905b8d6
--- /dev/null
+++ b/node_modules/to-iso-string/Readme.md
@@ -0,0 +1,18 @@
+
+# to-iso-string
+  
+  Cross-browser toISOString support.
+
+## Example
+
+```js
+var iso = require('to-iso-string');
+var date = new Date("05 October 2011 14:48 UTC");
+
+iso(date);
+// "2011-10-05T14:48:00.000Z"
+```
+
+## License
+
+  MIT
\ No newline at end of file
diff --git a/node_modules/to-iso-string/component.json b/node_modules/to-iso-string/component.json
new file mode 100644
index 0000000..f5270b5
--- /dev/null
+++ b/node_modules/to-iso-string/component.json
@@ -0,0 +1,9 @@
+{
+  "name": "to-iso-string",
+  "repo": "segmentio/to-iso-string",
+  "version": "0.0.2",
+  "license": "MIT",
+  "description": "Cross-browser toISOString support.",
+  "keywords": ["iso", "format", "iso8601", "date", "isostring", "toISOString"],
+  "scripts": ["index.js"]
+}
diff --git a/node_modules/to-iso-string/index.js b/node_modules/to-iso-string/index.js
new file mode 100644
index 0000000..4675691
--- /dev/null
+++ b/node_modules/to-iso-string/index.js
@@ -0,0 +1,40 @@
+
+/**
+ * Expose `toIsoString`.
+ */
+
+module.exports = toIsoString;
+
+
+/**
+ * Turn a `date` into an ISO string.
+ *
+ * https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/toISOString
+ *
+ * @param {Date} date
+ * @return {String}
+ */
+
+function toIsoString (date) {
+  return date.getUTCFullYear()
+    + '-' + pad(date.getUTCMonth() + 1)
+    + '-' + pad(date.getUTCDate())
+    + 'T' + pad(date.getUTCHours())
+    + ':' + pad(date.getUTCMinutes())
+    + ':' + pad(date.getUTCSeconds())
+    + '.' + String((date.getUTCMilliseconds()/1000).toFixed(3)).slice(2, 5)
+    + 'Z';
+}
+
+
+/**
+ * Pad a `number` with a ten's place zero.
+ *
+ * @param {Number} number
+ * @return {String}
+ */
+
+function pad (number) {
+  var n = number.toString();
+  return n.length === 1 ? '0' + n : n;
+}
\ No newline at end of file
diff --git a/node_modules/to-iso-string/package.json b/node_modules/to-iso-string/package.json
new file mode 100644
index 0000000..587aefe
--- /dev/null
+++ b/node_modules/to-iso-string/package.json
@@ -0,0 +1,50 @@
+{
+  "_from": "to-iso-string@0.0.2",
+  "_id": "to-iso-string@0.0.2",
+  "_inBundle": false,
+  "_integrity": "sha1-TcGeZk38y+Jb2NtQiwDG2hWCVdE=",
+  "_location": "/to-iso-string",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "to-iso-string@0.0.2",
+    "name": "to-iso-string",
+    "escapedName": "to-iso-string",
+    "rawSpec": "0.0.2",
+    "saveSpec": null,
+    "fetchSpec": "0.0.2"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/to-iso-string/-/to-iso-string-0.0.2.tgz",
+  "_shasum": "4dc19e664dfccbe25bd8db508b00c6da158255d1",
+  "_spec": "to-iso-string@0.0.2",
+  "_where": "/home/clemens/Dokumente/git/pixelnode/node_modules/mocha",
+  "bugs": {
+    "url": "https://github.com/segmentio/to-iso-string/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": "to-iso-string has been deprecated, use @segment/to-iso-string instead.",
+  "description": "Cross-browser toISOString support.",
+  "devDependencies": {
+    "mocha": "*"
+  },
+  "homepage": "https://github.com/segmentio/to-iso-string#readme",
+  "keywords": [
+    "iso",
+    "format",
+    "iso8601",
+    "date",
+    "isostring",
+    "toISOString"
+  ],
+  "license": "MIT",
+  "name": "to-iso-string",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/segmentio/to-iso-string.git"
+  },
+  "version": "0.0.2"
+}
diff --git a/node_modules/to-iso-string/test/index.js b/node_modules/to-iso-string/test/index.js
new file mode 100644
index 0000000..11456b3
--- /dev/null
+++ b/node_modules/to-iso-string/test/index.js
@@ -0,0 +1,10 @@
+
+var assert = require('assert');
+var iso = require('..');
+
+describe('to-iso-string', function () {
+  it('should work', function () {
+    var date = new Date("05 October 2011 14:48 UTC");
+    assert('2011-10-05T14:48:00.000Z' == iso(date));
+  });
+});
\ No newline at end of file
diff --git a/package-lock.json b/package-lock.json
index 57c6503..74beeb8 100644
--- a/package-lock.json
+++ b/package-lock.json
@@ -66,6 +66,11 @@
       "resolved": "https://registry.npmjs.org/callsite/-/callsite-1.0.0.tgz",
       "integrity": "sha1-KAOY5dZkvXQDi28JBRU+borxvCA="
     },
+    "commander": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/commander/-/commander-2.3.0.tgz",
+      "integrity": "sha1-/UMOiJgy7DU7ms0d4hfBHLPu+HM="
+    },
     "component-bind": {
       "version": "1.0.0",
       "resolved": "https://registry.npmjs.org/component-bind/-/component-bind-1.0.0.tgz",
@@ -119,6 +124,11 @@
       "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz",
       "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA="
     },
+    "diff": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/diff/-/diff-1.4.0.tgz",
+      "integrity": "sha1-fyjS657nsVqX79ic5j3P2qPMur8="
+    },
     "ee-first": {
       "version": "1.1.1",
       "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
@@ -207,6 +217,11 @@
       "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
       "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg="
     },
+    "escape-string-regexp": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.2.tgz",
+      "integrity": "sha1-Tbwv5nTnGUnK8/smlc5/LcHZqNE="
+    },
     "etag": {
       "version": "1.8.1",
       "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
@@ -286,6 +301,20 @@
       "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.0.tgz",
       "integrity": "sha1-9HTKXmqSRtb9jglTz6m5yAWvp44="
     },
+    "glob": {
+      "version": "3.2.11",
+      "resolved": "https://registry.npmjs.org/glob/-/glob-3.2.11.tgz",
+      "integrity": "sha1-Spc/Y1uRkPcV0QmH1cAP0oFevj0=",
+      "requires": {
+        "inherits": "2.0.3",
+        "minimatch": "0.3.0"
+      }
+    },
+    "growl": {
+      "version": "1.9.2",
+      "resolved": "https://registry.npmjs.org/growl/-/growl-1.9.2.tgz",
+      "integrity": "sha1-Dqd0NxXbjY3ixe3hd14bRayFwC8="
+    },
     "has-binary2": {
       "version": "1.0.2",
       "resolved": "https://registry.npmjs.org/has-binary2/-/has-binary2-1.0.2.tgz",
@@ -342,6 +371,32 @@
       "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.1.tgz",
       "integrity": "sha1-o32U7ZzaLVmGXJ92/llu4fM4dB4="
     },
+    "jade": {
+      "version": "0.26.3",
+      "resolved": "https://registry.npmjs.org/jade/-/jade-0.26.3.tgz",
+      "integrity": "sha1-jxDXl32NefL2/4YqgbBRPMslaGw=",
+      "requires": {
+        "commander": "0.6.1",
+        "mkdirp": "0.3.0"
+      },
+      "dependencies": {
+        "commander": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/commander/-/commander-0.6.1.tgz",
+          "integrity": "sha1-+mihT2qUXVTbvlDYzbMyDp47GgY="
+        },
+        "mkdirp": {
+          "version": "0.3.0",
+          "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.3.0.tgz",
+          "integrity": "sha1-G79asbqCevI1dRQ0kEJkVfSB/h4="
+        }
+      }
+    },
+    "lru-cache": {
+      "version": "2.7.3",
+      "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz",
+      "integrity": "sha1-bUUk6LlV+V1PW1iFHOId1y+06VI="
+    },
     "media-typer": {
       "version": "0.3.0",
       "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
@@ -375,6 +430,60 @@
         "mime-db": "1.33.0"
       }
     },
+    "minimatch": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-0.3.0.tgz",
+      "integrity": "sha1-J12O2qxPG7MyZHIInnlJyDlGmd0=",
+      "requires": {
+        "lru-cache": "2.7.3",
+        "sigmund": "1.0.1"
+      }
+    },
+    "minimist": {
+      "version": "0.0.8",
+      "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
+      "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0="
+    },
+    "mkdirp": {
+      "version": "0.5.1",
+      "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
+      "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
+      "requires": {
+        "minimist": "0.0.8"
+      }
+    },
+    "mocha": {
+      "version": "2.5.3",
+      "resolved": "https://registry.npmjs.org/mocha/-/mocha-2.5.3.tgz",
+      "integrity": "sha1-FhvlvetJZ3HrmzV0UFC2IrWu/Fg=",
+      "requires": {
+        "commander": "2.3.0",
+        "debug": "2.2.0",
+        "diff": "1.4.0",
+        "escape-string-regexp": "1.0.2",
+        "glob": "3.2.11",
+        "growl": "1.9.2",
+        "jade": "0.26.3",
+        "mkdirp": "0.5.1",
+        "supports-color": "1.2.0",
+        "to-iso-string": "0.0.2"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "2.2.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+          "integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+          "requires": {
+            "ms": "0.7.1"
+          }
+        },
+        "ms": {
+          "version": "0.7.1",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+          "integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg="
+        }
+      }
+    },
     "ms": {
       "version": "0.7.2",
       "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
@@ -443,6 +552,14 @@
       "resolved": "https://registry.npmjs.org/qs/-/qs-6.4.0.tgz",
       "integrity": "sha1-E+JtKK1rD/qpExLNO/cI7TUecjM="
     },
+    "quick-local-ip": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/quick-local-ip/-/quick-local-ip-1.0.7.tgz",
+      "integrity": "sha1-S9oQKeXm2iGNtwLfcsJK3eFKpMc=",
+      "requires": {
+        "mocha": "2.5.3"
+      }
+    },
     "range-parser": {
       "version": "1.2.0",
       "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz",
@@ -489,6 +606,11 @@
       "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz",
       "integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ="
     },
+    "sigmund": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz",
+      "integrity": "sha1-P/IfGYytIXX587eBhT/ZTQ0ZtZA="
+    },
     "socket.io": {
       "version": "2.1.0",
       "resolved": "https://registry.npmjs.org/socket.io/-/socket.io-2.1.0.tgz",
@@ -588,11 +710,21 @@
       "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz",
       "integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4="
     },
+    "supports-color": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-1.2.0.tgz",
+      "integrity": "sha1-/x7R5hFp0Gs88tWI4YixjYhH4X4="
+    },
     "to-array": {
       "version": "0.1.4",
       "resolved": "https://registry.npmjs.org/to-array/-/to-array-0.1.4.tgz",
       "integrity": "sha1-F+bBH3PdTz10zaek/zI46a2b+JA="
     },
+    "to-iso-string": {
+      "version": "0.0.2",
+      "resolved": "https://registry.npmjs.org/to-iso-string/-/to-iso-string-0.0.2.tgz",
+      "integrity": "sha1-TcGeZk38y+Jb2NtQiwDG2hWCVdE="
+    },
     "type-is": {
       "version": "1.6.16",
       "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.16.tgz",
diff --git a/package.json b/package.json
index 4d1d43f..12e52b1 100644
--- a/package.json
+++ b/package.json
@@ -5,6 +5,7 @@
   "dependencies": {
     "express": "^4.15.2",
     "net": "^1.0.2",
+    "quick-local-ip": "^1.0.7",
     "socket.io": "^2.1.0"
   }
 }
diff --git a/public/index.html b/public/index.html
index 045b0ca..0630467 100644
--- a/public/index.html
+++ b/public/index.html
@@ -9,6 +9,7 @@
 
   
   
      
+  
      
 
   
   
diff --git a/public/main.js b/public/main.js
index aff4831..5f06b5a 100644
--- a/public/main.js
+++ b/public/main.js
@@ -3,6 +3,7 @@
 (function() {
 
   var stats = document.getElementsByClassName('stats')[0];
+  var play = document.getElementsByClassName('play')[0];
 
   var socket = io();
 
@@ -22,6 +23,20 @@
   function onSetting(data) {
     canvas_size_x = data.canvas.size.x;
     canvas_size_y = data.canvas.size.y;
+
+    var out = 'Play PixelFlut @ ';
+
+    if (data.network.ip4 != '') {
+      out += 'IP4 ' + data.network.ip4 + ' ';
+    }
+    if (data.network.ip4 != '' && data.network.ip6 != '') {
+      out += '|| ';
+    }
+    if (data.network.ip6 != '') {
+      out += 'IP6 ' + data.network.ip6 + ' ';
+    }
+    out += 'port ' + data.network.port;
+    play.innerHTML = out;
   }
 
 
diff --git a/public/style.css b/public/style.css
index 000fdba..74c9f6a 100644
--- a/public/style.css
+++ b/public/style.css
@@ -26,3 +26,14 @@ html, body {
   left: 10px;
   bottom: 10px;
 }
+
+.play {
+  z-index: 100;
+  position: absolute;
+  background-color: #00000022;
+  padding: 3px;
+  left: 10px;
+  right: 10px;
+  top: 10px;
+  text-align: center;
+}